\n \n {\n comments.length > 0 ?\n \n {comments.length ? (comments.slice(-5).map((comment) => (\n \n \n {comment.user} \n \n \n \n \n \n \n ))): ''}\n \n }>\n :\n \n \n }\n \n
\n );\n}\n\n","var toPropertyKey = require(\"./toPropertyKey.js\");\nfunction _defineProperties(target, props) {\n for (var i = 0; i < props.length; i++) {\n var descriptor = props[i];\n descriptor.enumerable = descriptor.enumerable || false;\n descriptor.configurable = true;\n if (\"value\" in descriptor) descriptor.writable = true;\n Object.defineProperty(target, toPropertyKey(descriptor.key), descriptor);\n }\n}\nfunction _createClass(Constructor, protoProps, staticProps) {\n if (protoProps) _defineProperties(Constructor.prototype, protoProps);\n if (staticProps) _defineProperties(Constructor, staticProps);\n Object.defineProperty(Constructor, \"prototype\", {\n writable: false\n });\n return Constructor;\n}\nmodule.exports = _createClass, module.exports.__esModule = true, module.exports[\"default\"] = module.exports;","import { h as hasOwnProperty, E as Emotion, c as createEmotionProps, w as withEmotionCache, T as ThemeContext, i as isBrowser$1 } from './emotion-element-c39617d8.browser.esm.js';\nexport { C as CacheProvider, T as ThemeContext, a as ThemeProvider, _ as __unsafe_useEmotionCache, u as useTheme, w as withEmotionCache, b as withTheme } from './emotion-element-c39617d8.browser.esm.js';\nimport * as React from 'react';\nimport { insertStyles, registerStyles, getRegisteredStyles } from '@emotion/utils';\nimport { useInsertionEffectWithLayoutFallback, useInsertionEffectAlwaysWithSyncFallback } from '@emotion/use-insertion-effect-with-fallbacks';\nimport { serializeStyles } from '@emotion/serialize';\nimport '@emotion/cache';\nimport '@babel/runtime/helpers/extends';\nimport '@emotion/weak-memoize';\nimport '../_isolated-hnrs/dist/emotion-react-_isolated-hnrs.browser.esm.js';\nimport 'hoist-non-react-statics';\nvar pkg = {\n name: \"@emotion/react\",\n version: \"11.11.1\",\n main: \"dist/emotion-react.cjs.js\",\n module: \"dist/emotion-react.esm.js\",\n browser: {\n \"./dist/emotion-react.esm.js\": \"./dist/emotion-react.browser.esm.js\"\n },\n exports: {\n \".\": {\n module: {\n worker: \"./dist/emotion-react.worker.esm.js\",\n browser: \"./dist/emotion-react.browser.esm.js\",\n \"default\": \"./dist/emotion-react.esm.js\"\n },\n \"import\": \"./dist/emotion-react.cjs.mjs\",\n \"default\": \"./dist/emotion-react.cjs.js\"\n },\n \"./jsx-runtime\": {\n module: {\n worker: \"./jsx-runtime/dist/emotion-react-jsx-runtime.worker.esm.js\",\n browser: \"./jsx-runtime/dist/emotion-react-jsx-runtime.browser.esm.js\",\n \"default\": \"./jsx-runtime/dist/emotion-react-jsx-runtime.esm.js\"\n },\n \"import\": \"./jsx-runtime/dist/emotion-react-jsx-runtime.cjs.mjs\",\n \"default\": \"./jsx-runtime/dist/emotion-react-jsx-runtime.cjs.js\"\n },\n \"./_isolated-hnrs\": {\n module: {\n worker: \"./_isolated-hnrs/dist/emotion-react-_isolated-hnrs.worker.esm.js\",\n browser: \"./_isolated-hnrs/dist/emotion-react-_isolated-hnrs.browser.esm.js\",\n \"default\": \"./_isolated-hnrs/dist/emotion-react-_isolated-hnrs.esm.js\"\n },\n \"import\": \"./_isolated-hnrs/dist/emotion-react-_isolated-hnrs.cjs.mjs\",\n \"default\": \"./_isolated-hnrs/dist/emotion-react-_isolated-hnrs.cjs.js\"\n },\n \"./jsx-dev-runtime\": {\n module: {\n worker: \"./jsx-dev-runtime/dist/emotion-react-jsx-dev-runtime.worker.esm.js\",\n browser: \"./jsx-dev-runtime/dist/emotion-react-jsx-dev-runtime.browser.esm.js\",\n \"default\": \"./jsx-dev-runtime/dist/emotion-react-jsx-dev-runtime.esm.js\"\n },\n \"import\": \"./jsx-dev-runtime/dist/emotion-react-jsx-dev-runtime.cjs.mjs\",\n \"default\": \"./jsx-dev-runtime/dist/emotion-react-jsx-dev-runtime.cjs.js\"\n },\n \"./package.json\": \"./package.json\",\n \"./types/css-prop\": \"./types/css-prop.d.ts\",\n \"./macro\": {\n types: {\n \"import\": \"./macro.d.mts\",\n \"default\": \"./macro.d.ts\"\n },\n \"default\": \"./macro.js\"\n }\n },\n types: \"types/index.d.ts\",\n files: [\"src\", \"dist\", \"jsx-runtime\", \"jsx-dev-runtime\", \"_isolated-hnrs\", \"types/*.d.ts\", \"macro.*\"],\n sideEffects: false,\n author: \"Emotion Contributors\",\n license: \"MIT\",\n scripts: {\n \"test:typescript\": \"dtslint types\"\n },\n dependencies: {\n \"@babel/runtime\": \"^7.18.3\",\n \"@emotion/babel-plugin\": \"^11.11.0\",\n \"@emotion/cache\": \"^11.11.0\",\n \"@emotion/serialize\": \"^1.1.2\",\n \"@emotion/use-insertion-effect-with-fallbacks\": \"^1.0.1\",\n \"@emotion/utils\": \"^1.2.1\",\n \"@emotion/weak-memoize\": \"^0.3.1\",\n \"hoist-non-react-statics\": \"^3.3.1\"\n },\n peerDependencies: {\n react: \">=16.8.0\"\n },\n peerDependenciesMeta: {\n \"@types/react\": {\n optional: true\n }\n },\n devDependencies: {\n \"@definitelytyped/dtslint\": \"0.0.112\",\n \"@emotion/css\": \"11.11.0\",\n \"@emotion/css-prettifier\": \"1.1.3\",\n \"@emotion/server\": \"11.11.0\",\n \"@emotion/styled\": \"11.11.0\",\n \"html-tag-names\": \"^1.1.2\",\n react: \"16.14.0\",\n \"svg-tag-names\": \"^1.1.1\",\n typescript: \"^4.5.5\"\n },\n repository: \"https://github.com/emotion-js/emotion/tree/main/packages/react\",\n publishConfig: {\n access: \"public\"\n },\n \"umd:main\": \"dist/emotion-react.umd.min.js\",\n preconstruct: {\n entrypoints: [\"./index.js\", \"./jsx-runtime.js\", \"./jsx-dev-runtime.js\", \"./_isolated-hnrs.js\"],\n umdName: \"emotionReact\",\n exports: {\n envConditions: [\"browser\", \"worker\"],\n extra: {\n \"./types/css-prop\": \"./types/css-prop.d.ts\",\n \"./macro\": {\n types: {\n \"import\": \"./macro.d.mts\",\n \"default\": \"./macro.d.ts\"\n },\n \"default\": \"./macro.js\"\n }\n }\n }\n }\n};\nvar jsx = function jsx(type, props) {\n var args = arguments;\n if (props == null || !hasOwnProperty.call(props, 'css')) {\n // $FlowFixMe\n return React.createElement.apply(undefined, args);\n }\n var argsLength = args.length;\n var createElementArgArray = new Array(argsLength);\n createElementArgArray[0] = Emotion;\n createElementArgArray[1] = createEmotionProps(type, props);\n for (var i = 2; i < argsLength; i++) {\n createElementArgArray[i] = args[i];\n } // $FlowFixMe\n\n return React.createElement.apply(null, createElementArgArray);\n};\nvar warnedAboutCssPropForGlobal = false; // maintain place over rerenders.\n// initial render from browser, insertBefore context.sheet.tags[0] or if a style hasn't been inserted there yet, appendChild\n// initial client-side render from SSR, use place of hydrating tag\n\nvar Global = /* #__PURE__ */withEmotionCache(function (props, cache) {\n if (process.env.NODE_ENV !== 'production' && !warnedAboutCssPropForGlobal && (\n // check for className as well since the user is\n // probably using the custom createElement which\n // means it will be turned into a className prop\n // $FlowFixMe I don't really want to add it to the type since it shouldn't be used\n props.className || props.css)) {\n console.error(\"It looks like you're using the css prop on Global, did you mean to use the styles prop instead?\");\n warnedAboutCssPropForGlobal = true;\n }\n var styles = props.styles;\n var serialized = serializeStyles([styles], undefined, React.useContext(ThemeContext));\n if (!isBrowser$1) {\n var _ref;\n var serializedNames = serialized.name;\n var serializedStyles = serialized.styles;\n var next = serialized.next;\n while (next !== undefined) {\n serializedNames += ' ' + next.name;\n serializedStyles += next.styles;\n next = next.next;\n }\n var shouldCache = cache.compat === true;\n var rules = cache.insert(\"\", {\n name: serializedNames,\n styles: serializedStyles\n }, cache.sheet, shouldCache);\n if (shouldCache) {\n return null;\n }\n return /*#__PURE__*/React.createElement(\"style\", (_ref = {}, _ref[\"data-emotion\"] = cache.key + \"-global \" + serializedNames, _ref.dangerouslySetInnerHTML = {\n __html: rules\n }, _ref.nonce = cache.sheet.nonce, _ref));\n } // yes, i know these hooks are used conditionally\n // but it is based on a constant that will never change at runtime\n // it's effectively like having two implementations and switching them out\n // so it's not actually breaking anything\n\n var sheetRef = React.useRef();\n useInsertionEffectWithLayoutFallback(function () {\n var key = cache.key + \"-global\"; // use case of https://github.com/emotion-js/emotion/issues/2675\n\n var sheet = new cache.sheet.constructor({\n key: key,\n nonce: cache.sheet.nonce,\n container: cache.sheet.container,\n speedy: cache.sheet.isSpeedy\n });\n var rehydrating = false; // $FlowFixMe\n\n var node = document.querySelector(\"style[data-emotion=\\\"\" + key + \" \" + serialized.name + \"\\\"]\");\n if (cache.sheet.tags.length) {\n sheet.before = cache.sheet.tags[0];\n }\n if (node !== null) {\n rehydrating = true; // clear the hash so this node won't be recognizable as rehydratable by other {comment.description}
\n\n \n \n { !editingComment ?\n \n :\n
\n \n \n Comentários \n
\n \n handleClose()}>\n \n
\n \n {comments.length ? (comments.map((comment) => (\n \n \n \n \n {`${comment.user} - ${formattedDate(comment.create)}`} \n {comment.description} \n \n \n ))\n ): ''}\n
\n \n \n \n
\n \n\t\t user.name}\n\t\t getOptionValue={(user) => user.id}\n\t\t menuIsOpen={true}\n\t styles={{\n\t\t control: (provided) => ({ ...provided, backgroundColor: 'transparent', border: 'none' }),\n\t\t placeholder: (provided) => ({ ...provided, display: 'none' }),\n\t\t singleValue: (provided) => ({ ...provided, display: 'none' }),\n\t\t indicatorSeparator: (provided) => ({ ...provided, display: 'none' }),\n\t\t }}\n\t\t/>\n\t
\n )}\n \n \n \n
\n }\n \n {props.dataKey === 'result' ? (\n
\n );\n }\n\t \n // return \n
\n {shouldRender &&
\n ) : ['params', 'param-lines', 'param-head'].includes(props.dataKey) && props.isFlowChart ? (\n \n {shouldRender &&
\n
\n
\n ) : \n \n
\n
\n {shouldRender &&
\n }\n \n {shouldRender &&
{JSON.stringify(options)}
\n } catch (e) {\n return <>\n }\n }\n\n function renderTableTR(year, isBudget=false){\n let kind = isBudget ? \"budget\" : \"analisado\"\n let label = isBudget ? `${formatYear(year)}-Orçamento` : formatYear(year)\n const meses = [\"janeiro\", \"fevereiro\", \"março\", \"abril\", \"maio\", \"junho\", \"julho\", \"agosto\", \"setembro\", \"outubro\", \"novembro\", \"dezembro\"];\n let ultimoMesIndex = -1;\n for (let i = meses.length - 1; i >= 0; i--) {\n if (visibleMonths?.[meses[i]]) {\n ultimoMesIndex = i;\n break;\n }\n }\n return \n\n {props.isWidget && (\n \n )}\n\n {!props.isWidget && (\n \n\n \n \n \n\n :\n chartVisible ? renderHighChart() : }\n \n \n \n \n }\n
\n );\n }\n}\n\n\n\nconst range = (min, max) => [...Array(max - min + 1).keys()].map(i => i + min);\nconst monthDict = {\n \"janeiro\": 1,\n \"fevereiro\": 2,\n \"março\": 3,\n \"abril\": 4,\n \"maio\": 5,\n \"junho\": 6,\n \"julho\": 7,\n \"agosto\": 8,\n \"setembro\": 9,\n \"outubro\": 10,\n \"novembro\": 11,\n \"dezembro\": 12,\n \"total\": 13\n}\n","/*\n Highcharts JS v8.2.2 (2020-10-22)\n\n (c) 2009-2018 Torstein Honsi\n\n License: www.highcharts.com/license\n*/\n(function (X, N) {\n \"object\" === typeof module && module.exports ? (N[\"default\"] = N, module.exports = X.document ? N(X) : N) : \"function\" === typeof define && define.amd ? define(\"highcharts/highcharts\", function () {\n return N(X);\n }) : (X.Highcharts && X.Highcharts.error(16, !0), X.Highcharts = N(X));\n})(\"undefined\" !== typeof window ? window : this, function (X) {\n function N(f, h, m, z) {\n f.hasOwnProperty(h) || (f[h] = z.apply(null, m));\n }\n var m = {};\n N(m, \"Core/Globals.js\", [], function () {\n var f = \"undefined\" !== typeof X ? X : \"undefined\" !== typeof window ? window : {},\n h = f.document,\n m = f.navigator && f.navigator.userAgent || \"\",\n z = h && h.createElementNS && !!h.createElementNS(\"http://www.w3.org/2000/svg\", \"svg\").createSVGRect,\n F = /(edge|msie|trident)/i.test(m) && !f.opera,\n L = -1 !== m.indexOf(\"Firefox\"),\n K = -1 !== m.indexOf(\"Chrome\"),\n C = L && 4 > parseInt(m.split(\"Firefox/\")[1], 10);\n return {\n product: \"Highcharts\",\n version: \"8.2.2\",\n deg2rad: 2 * Math.PI / 360,\n doc: h,\n hasBidiBug: C,\n hasTouch: !!f.TouchEvent,\n isMS: F,\n isWebKit: -1 !== m.indexOf(\"AppleWebKit\"),\n isFirefox: L,\n isChrome: K,\n isSafari: !K && -1 !== m.indexOf(\"Safari\"),\n isTouchDevice: /(Mobile|Android|Windows Phone)/.test(m),\n SVG_NS: \"http://www.w3.org/2000/svg\",\n chartCount: 0,\n seriesTypes: {},\n symbolSizes: {},\n svg: z,\n win: f,\n marginNames: [\"plotTop\", \"marginRight\", \"marginBottom\", \"plotLeft\"],\n noop: function () {},\n charts: [],\n dateFormats: {}\n };\n });\n N(m, \"Core/Utilities.js\", [m[\"Core/Globals.js\"]], function (f) {\n function h(b, k, t, a) {\n var u = k ? \"Highcharts error\" : \"Highcharts warning\";\n 32 === b && (b = u + \": Deprecated member\");\n var c = l(b),\n H = c ? u + \" #\" + b + \": www.highcharts.com/errors/\" + b + \"/\" : b.toString();\n u = function () {\n if (k) throw Error(H);\n e.console && -1 === h.messages.indexOf(H) && console.log(H);\n };\n if (\"undefined\" !== typeof a) {\n var d = \"\";\n c && (H += \"?\");\n S(a, function (b, k) {\n d += \"\\n - \" + k + \": \" + b;\n c && (H += encodeURI(k) + \"=\" + encodeURI(b));\n });\n H += d;\n }\n t ? ca(t, \"displayError\", {\n code: b,\n message: H,\n params: a\n }, u) : u();\n h.messages.push(H);\n }\n function m() {\n var b,\n k = arguments,\n t = {},\n a = function (b, k) {\n \"object\" !== typeof b && (b = {});\n S(k, function (t, u) {\n !z(t, !0) || n(t) || D(t) ? b[u] = k[u] : b[u] = a(b[u] || {}, t);\n });\n return b;\n };\n !0 === k[0] && (t = k[1], k = Array.prototype.slice.call(k, 2));\n var u = k.length;\n for (b = 0; b < u; b++) t = a(t, k[b]);\n return t;\n }\n function z(b, k) {\n return !!b && \"object\" === typeof b && (!k || !x(b));\n }\n function F(b, k, t) {\n var a;\n v(k) ? w(t) ? b.setAttribute(k, t) : b && b.getAttribute && ((a = b.getAttribute(k)) || \"class\" !== k || (a = b.getAttribute(k + \"Name\"))) : S(k, function (k, t) {\n b.setAttribute(t, k);\n });\n return a;\n }\n function L() {\n for (var b = arguments, k = b.length, t = 0; t < k; t++) {\n var a = b[t];\n if (\"undefined\" !== typeof a && null !== a) return a;\n }\n }\n function K(b, k) {\n if (!b) return k;\n var t = b.split(\".\").reverse();\n if (1 === t.length) return k[b];\n for (b = t.pop(); \"undefined\" !== typeof b && \"undefined\" !== typeof k && null !== k;) k = k[b], b = t.pop();\n return k;\n }\n f.timers = [];\n var C = f.charts,\n y = f.doc,\n e = f.win;\n (h || (h = {})).messages = [];\n f.error = h;\n f.merge = m;\n var I = f.pInt = function (b, k) {\n return parseInt(b, k || 10);\n },\n v = f.isString = function (b) {\n return \"string\" === typeof b;\n },\n x = f.isArray = function (b) {\n b = Object.prototype.toString.call(b);\n return \"[object Array]\" === b || \"[object Array Iterator]\" === b;\n };\n f.isObject = z;\n var D = f.isDOMElement = function (b) {\n return z(b) && \"number\" === typeof b.nodeType;\n },\n n = f.isClass = function (b) {\n var k = b && b.constructor;\n return !(!z(b, !0) || D(b) || !k || !k.name || \"Object\" === k.name);\n },\n l = f.isNumber = function (b) {\n return \"number\" === typeof b && !isNaN(b) && Infinity > b && -Infinity < b;\n },\n J = f.erase = function (b, k) {\n for (var t = b.length; t--;) if (b[t] === k) {\n b.splice(t, 1);\n break;\n }\n },\n w = f.defined = function (b) {\n return \"undefined\" !== typeof b && null !== b;\n };\n f.attr = F;\n var r = f.splat = function (b) {\n return x(b) ? b : [b];\n },\n d = f.syncTimeout = function (b, k, t) {\n if (0 < k) return setTimeout(b, k, t);\n b.call(0, t);\n return -1;\n },\n g = f.clearTimeout = function (b) {\n w(b) && clearTimeout(b);\n },\n c = f.extend = function (b, k) {\n var t;\n b || (b = {});\n for (t in k) b[t] = k[t];\n return b;\n };\n f.pick = L;\n var a = f.css = function (b, k) {\n f.isMS && !f.svg && k && \"undefined\" !== typeof k.opacity && (k.filter = \"alpha(opacity=\" + 100 * k.opacity + \")\");\n c(b.style, k);\n },\n q = f.createElement = function (b, k, t, u, H) {\n b = y.createElement(b);\n k && c(b, k);\n H && a(b, {\n padding: \"0\",\n border: \"none\",\n margin: \"0\"\n });\n t && a(b, t);\n u && u.appendChild(b);\n return b;\n },\n p = f.extendClass = function (b, k) {\n var t = function () {};\n t.prototype = new b();\n c(t.prototype, k);\n return t;\n },\n B = f.pad = function (b, k, t) {\n return Array((k || 2) + 1 - String(b).replace(\"-\", \"\").length).join(t || \"0\") + b;\n },\n A = f.relativeLength = function (b, k, t) {\n return /%$/.test(b) ? k * parseFloat(b) / 100 + (t || 0) : parseFloat(b);\n },\n G = f.wrap = function (b, k, t) {\n var a = b[k];\n b[k] = function () {\n var b = Array.prototype.slice.call(arguments),\n k = arguments,\n u = this;\n u.proceed = function () {\n a.apply(u, arguments.length ? arguments : k);\n };\n b.unshift(a);\n b = t.apply(this, b);\n u.proceed = null;\n return b;\n };\n },\n M = f.format = function (b, k, t) {\n var a = \"{\",\n u = !1,\n H = [],\n c = /f$/,\n d = /\\.([0-9])/,\n g = f.defaultOptions.lang,\n p = t && t.time || f.time;\n for (t = t && t.numberFormatter || R; b;) {\n var q = b.indexOf(a);\n if (-1 === q) break;\n var U = b.slice(0, q);\n if (u) {\n U = U.split(\":\");\n a = K(U.shift() || \"\", k);\n if (U.length && \"number\" === typeof a) if (U = U.join(\":\"), c.test(U)) {\n var r = parseInt((U.match(d) || [\"\", \"-1\"])[1], 10);\n null !== a && (a = t(a, r, g.decimalPoint, -1 < U.indexOf(\",\") ? g.thousandsSep : \"\"));\n } else a = p.dateFormat(U, a);\n H.push(a);\n } else H.push(U);\n b = b.slice(q + 1);\n a = (u = !u) ? \"}\" : \"{\";\n }\n H.push(b);\n return H.join(\"\");\n },\n T = f.getMagnitude = function (b) {\n return Math.pow(10, Math.floor(Math.log(b) / Math.LN10));\n },\n Q = f.normalizeTickInterval = function (b, k, a, u, H) {\n var c = b;\n a = L(a, 1);\n var d = b / a;\n k || (k = H ? [1, 1.2, 1.5, 2, 2.5, 3, 4, 5, 6, 8, 10] : [1, 2, 2.5, 5, 10], !1 === u && (1 === a ? k = k.filter(function (b) {\n return 0 === b % 1;\n }) : .1 >= a && (k = [1 / a])));\n for (u = 0; u < k.length && !(c = k[u], H && c * a >= b || !H && d <= (k[u] + (k[u + 1] || k[u])) / 2); u++);\n return c = t(c * a, -Math.round(Math.log(.001) / Math.LN10));\n },\n O = f.stableSort = function (b, k) {\n var t = b.length,\n a,\n u;\n for (u = 0; u < t; u++) b[u].safeI = u;\n b.sort(function (b, t) {\n a = k(b, t);\n return 0 === a ? b.safeI - t.safeI : a;\n });\n for (u = 0; u < t; u++) delete b[u].safeI;\n },\n E = f.arrayMin = function (b) {\n for (var k = b.length, t = b[0]; k--;) b[k] < t && (t = b[k]);\n return t;\n },\n u = f.arrayMax = function (b) {\n for (var k = b.length, t = b[0]; k--;) b[k] > t && (t = b[k]);\n return t;\n },\n b = f.destroyObjectProperties = function (b, k) {\n S(b, function (t, a) {\n t && t !== k && t.destroy && t.destroy();\n delete b[a];\n });\n },\n k = f.discardElement = function (b) {\n var k = f.garbageBin;\n k || (k = q(\"div\"));\n b && k.appendChild(b);\n k.innerHTML = \"\";\n },\n t = f.correctFloat = function (b, k) {\n return parseFloat(b.toPrecision(k || 14));\n },\n H = f.timeUnits = {\n millisecond: 1,\n second: 1E3,\n minute: 6E4,\n hour: 36E5,\n day: 864E5,\n week: 6048E5,\n month: 24192E5,\n year: 314496E5\n },\n R = f.numberFormat = function (b, k, t, a) {\n b = +b || 0;\n k = +k;\n var u = f.defaultOptions.lang,\n H = (b.toString().split(\".\")[1] || \"\").split(\"e\")[0].length,\n c = b.toString().split(\"e\");\n if (-1 === k) k = Math.min(H, 20);else if (!l(k)) k = 2;else if (k && c[1] && 0 > c[1]) {\n var d = k + +c[1];\n 0 <= d ? (c[0] = (+c[0]).toExponential(d).split(\"e\")[0], k = d) : (c[0] = c[0].split(\".\")[0] || 0, b = 20 > k ? (c[0] * Math.pow(10, c[1])).toFixed(k) : 0, c[1] = 0);\n }\n var g = (Math.abs(c[1] ? c[0] : b) + Math.pow(10, -Math.max(k, H) - 1)).toFixed(k);\n H = String(I(g));\n d = 3 < H.length ? H.length % 3 : 0;\n t = L(t, u.decimalPoint);\n a = L(a, u.thousandsSep);\n b = (0 > b ? \"-\" : \"\") + (d ? H.substr(0, d) + a : \"\");\n b += H.substr(d).replace(/(\\d{3})(?=\\d)/g, \"$1\" + a);\n k && (b += t + g.slice(-k));\n c[1] && 0 !== +b && (b += \"e\" + c[1]);\n return b;\n };\n Math.easeInOutSine = function (b) {\n return -.5 * (Math.cos(Math.PI * b) - 1);\n };\n var U = f.getStyle = function (b, k, t) {\n if (\"width\" === k) return k = Math.min(b.offsetWidth, b.scrollWidth), t = b.getBoundingClientRect && b.getBoundingClientRect().width, t < k && t >= k - 1 && (k = Math.floor(t)), Math.max(0, k - f.getStyle(b, \"padding-left\") - f.getStyle(b, \"padding-right\"));\n if (\"height\" === k) return Math.max(0, Math.min(b.offsetHeight, b.scrollHeight) - f.getStyle(b, \"padding-top\") - f.getStyle(b, \"padding-bottom\"));\n e.getComputedStyle || h(27, !0);\n if (b = e.getComputedStyle(b, void 0)) b = b.getPropertyValue(k), L(t, \"opacity\" !== k) && (b = I(b));\n return b;\n },\n Z = f.inArray = function (b, k, t) {\n h(32, !1, void 0, {\n \"Highcharts.inArray\": \"use Array.indexOf\"\n });\n return k.indexOf(b, t);\n },\n aa = f.find = Array.prototype.find ? function (b, k) {\n return b.find(k);\n } : function (b, k) {\n var t,\n a = b.length;\n for (t = 0; t < a; t++) if (k(b[t], t)) return b[t];\n };\n f.keys = function (b) {\n h(32, !1, void 0, {\n \"Highcharts.keys\": \"use Object.keys\"\n });\n return Object.keys(b);\n };\n var ba = f.offset = function (b) {\n var k = y.documentElement;\n b = b.parentElement || b.parentNode ? b.getBoundingClientRect() : {\n top: 0,\n left: 0\n };\n return {\n top: b.top + (e.pageYOffset || k.scrollTop) - (k.clientTop || 0),\n left: b.left + (e.pageXOffset || k.scrollLeft) - (k.clientLeft || 0)\n };\n },\n S = f.objectEach = function (b, k, t) {\n for (var a in b) Object.hasOwnProperty.call(b, a) && k.call(t || b[a], b[a], a, b);\n };\n S({\n map: \"map\",\n each: \"forEach\",\n grep: \"filter\",\n reduce: \"reduce\",\n some: \"some\"\n }, function (b, k) {\n f[k] = function (t) {\n var a;\n h(32, !1, void 0, (a = {}, a[\"Highcharts.\" + k] = \"use Array.\" + b, a));\n return Array.prototype[b].apply(t, [].slice.call(arguments, 1));\n };\n });\n var Y = f.addEvent = function (b, k, t, a) {\n void 0 === a && (a = {});\n var u = b.addEventListener || f.addEventListenerPolyfill;\n var c = \"function\" === typeof b && b.prototype ? b.prototype.protoEvents = b.prototype.protoEvents || {} : b.hcEvents = b.hcEvents || {};\n f.Point && b instanceof f.Point && b.series && b.series.chart && (b.series.chart.runTrackerClick = !0);\n u && u.call(b, k, t, !1);\n c[k] || (c[k] = []);\n c[k].push({\n fn: t,\n order: \"number\" === typeof a.order ? a.order : Infinity\n });\n c[k].sort(function (b, k) {\n return b.order - k.order;\n });\n return function () {\n W(b, k, t);\n };\n },\n W = f.removeEvent = function (b, k, t) {\n function a(k, t) {\n var a = b.removeEventListener || f.removeEventListenerPolyfill;\n a && a.call(b, k, t, !1);\n }\n function u(t) {\n var u;\n if (b.nodeName) {\n if (k) {\n var c = {};\n c[k] = !0;\n } else c = t;\n S(c, function (b, k) {\n if (t[k]) for (u = t[k].length; u--;) a(k, t[k][u].fn);\n });\n }\n }\n var c;\n [\"protoEvents\", \"hcEvents\"].forEach(function (H, d) {\n var g = (d = d ? b : b.prototype) && d[H];\n g && (k ? (c = g[k] || [], t ? (g[k] = c.filter(function (b) {\n return t !== b.fn;\n }), a(k, t)) : (u(g), g[k] = [])) : (u(g), d[H] = {}));\n });\n },\n ca = f.fireEvent = function (b, k, t, a) {\n var u;\n t = t || {};\n if (y.createEvent && (b.dispatchEvent || b.fireEvent)) {\n var H = y.createEvent(\"Events\");\n H.initEvent(k, !0, !0);\n c(H, t);\n b.dispatchEvent ? b.dispatchEvent(H) : b.fireEvent(k, H);\n } else t.target || c(t, {\n preventDefault: function () {\n t.defaultPrevented = !0;\n },\n target: b,\n type: k\n }), function (k, a) {\n void 0 === k && (k = []);\n void 0 === a && (a = []);\n var c = 0,\n H = 0,\n d = k.length + a.length;\n for (u = 0; u < d; u++) !1 === (k[c] ? a[H] ? k[c].order <= a[H].order ? k[c++] : a[H++] : k[c++] : a[H++]).fn.call(b, t) && t.preventDefault();\n }(b.protoEvents && b.protoEvents[k], b.hcEvents && b.hcEvents[k]);\n a && !t.defaultPrevented && a.call(b, t);\n },\n V,\n da = f.uniqueKey = function () {\n var b = Math.random().toString(36).substring(2, 9) + \"-\",\n k = 0;\n return function () {\n return \"highcharts-\" + (V ? \"\" : b) + k++;\n };\n }(),\n ea = f.useSerialIds = function (b) {\n return V = L(b, V);\n },\n fa = f.isFunction = function (b) {\n return \"function\" === typeof b;\n },\n ha = f.getOptions = function () {\n return f.defaultOptions;\n },\n ia = f.setOptions = function (b) {\n f.defaultOptions = m(!0, f.defaultOptions, b);\n (b.time || b.global) && f.time.update(m(f.defaultOptions.global, f.defaultOptions.time, b.global, b.time));\n return f.defaultOptions;\n };\n e.jQuery && (e.jQuery.fn.highcharts = function () {\n var b = [].slice.call(arguments);\n if (this[0]) return b[0] ? (new f[v(b[0]) ? b.shift() : \"Chart\"](this[0], b[0], b[1]), this) : C[F(this[0], \"data-highcharts-chart\")];\n });\n return {\n addEvent: Y,\n arrayMax: u,\n arrayMin: E,\n attr: F,\n clamp: function (b, k, t) {\n return b > k ? b < t ? b : t : k;\n },\n clearTimeout: g,\n correctFloat: t,\n createElement: q,\n css: a,\n defined: w,\n destroyObjectProperties: b,\n discardElement: k,\n erase: J,\n error: h,\n extend: c,\n extendClass: p,\n find: aa,\n fireEvent: ca,\n format: M,\n getMagnitude: T,\n getNestedProperty: K,\n getOptions: ha,\n getStyle: U,\n inArray: Z,\n isArray: x,\n isClass: n,\n isDOMElement: D,\n isFunction: fa,\n isNumber: l,\n isObject: z,\n isString: v,\n merge: m,\n normalizeTickInterval: Q,\n numberFormat: R,\n objectEach: S,\n offset: ba,\n pad: B,\n pick: L,\n pInt: I,\n relativeLength: A,\n removeEvent: W,\n setOptions: ia,\n splat: r,\n stableSort: O,\n syncTimeout: d,\n timeUnits: H,\n uniqueKey: da,\n useSerialIds: ea,\n wrap: G\n };\n });\n N(m, \"Core/Color/Color.js\", [m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = h.isNumber,\n z = h.merge,\n F = h.pInt;\n \"\";\n h = function () {\n function h(K) {\n this.parsers = [{\n regex: /rgba\\(\\s*([0-9]{1,3})\\s*,\\s*([0-9]{1,3})\\s*,\\s*([0-9]{1,3})\\s*,\\s*([0-9]?(?:\\.[0-9]+)?)\\s*\\)/,\n parse: function (h) {\n return [F(h[1]), F(h[2]), F(h[3]), parseFloat(h[4], 10)];\n }\n }, {\n regex: /rgb\\(\\s*([0-9]{1,3})\\s*,\\s*([0-9]{1,3})\\s*,\\s*([0-9]{1,3})\\s*\\)/,\n parse: function (h) {\n return [F(h[1]), F(h[2]), F(h[3]), 1];\n }\n }];\n this.rgba = [];\n if (f.Color !== h) return new f.Color(K);\n if (!(this instanceof h)) return new h(K);\n this.init(K);\n }\n h.parse = function (f) {\n return new h(f);\n };\n h.prototype.init = function (f) {\n var C, y;\n if ((this.input = f = h.names[f && f.toLowerCase ? f.toLowerCase() : \"\"] || f) && f.stops) this.stops = f.stops.map(function (v) {\n return new h(v[1]);\n });else {\n if (f && f.charAt && \"#\" === f.charAt()) {\n var e = f.length;\n f = parseInt(f.substr(1), 16);\n 7 === e ? C = [(f & 16711680) >> 16, (f & 65280) >> 8, f & 255, 1] : 4 === e && (C = [(f & 3840) >> 4 | (f & 3840) >> 8, (f & 240) >> 4 | f & 240, (f & 15) << 4 | f & 15, 1]);\n }\n if (!C) for (y = this.parsers.length; y-- && !C;) {\n var I = this.parsers[y];\n (e = I.regex.exec(f)) && (C = I.parse(e));\n }\n }\n this.rgba = C || [];\n };\n h.prototype.get = function (f) {\n var h = this.input,\n y = this.rgba;\n if (\"undefined\" !== typeof this.stops) {\n var e = z(h);\n e.stops = [].concat(e.stops);\n this.stops.forEach(function (I, v) {\n e.stops[v] = [e.stops[v][0], I.get(f)];\n });\n } else e = y && m(y[0]) ? \"rgb\" === f || !f && 1 === y[3] ? \"rgb(\" + y[0] + \",\" + y[1] + \",\" + y[2] + \")\" : \"a\" === f ? y[3] : \"rgba(\" + y.join(\",\") + \")\" : h;\n return e;\n };\n h.prototype.brighten = function (f) {\n var h,\n y = this.rgba;\n if (this.stops) this.stops.forEach(function (e) {\n e.brighten(f);\n });else if (m(f) && 0 !== f) for (h = 0; 3 > h; h++) y[h] += F(255 * f), 0 > y[h] && (y[h] = 0), 255 < y[h] && (y[h] = 255);\n return this;\n };\n h.prototype.setOpacity = function (f) {\n this.rgba[3] = f;\n return this;\n };\n h.prototype.tweenTo = function (f, h) {\n var y = this.rgba,\n e = f.rgba;\n e.length && y && y.length ? (f = 1 !== e[3] || 1 !== y[3], h = (f ? \"rgba(\" : \"rgb(\") + Math.round(e[0] + (y[0] - e[0]) * (1 - h)) + \",\" + Math.round(e[1] + (y[1] - e[1]) * (1 - h)) + \",\" + Math.round(e[2] + (y[2] - e[2]) * (1 - h)) + (f ? \",\" + (e[3] + (y[3] - e[3]) * (1 - h)) : \"\") + \")\") : h = f.input || \"none\";\n return h;\n };\n h.names = {\n white: \"#ffffff\",\n black: \"#000000\"\n };\n return h;\n }();\n f.Color = h;\n f.color = h.parse;\n return h;\n });\n N(m, \"Core/Animation/Fx.js\", [m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = f.win,\n z = h.isNumber,\n F = h.objectEach;\n h = function () {\n function h(f, h, y) {\n this.pos = NaN;\n this.options = h;\n this.elem = f;\n this.prop = y;\n }\n h.prototype.dSetter = function () {\n var f = this.paths,\n h = f && f[0];\n f = f && f[1];\n var y = [],\n e = this.now || 0;\n if (1 !== e && h && f) {\n if (h.length === f.length && 1 > e) for (var I = 0; I < f.length; I++) {\n for (var v = h[I], x = f[I], D = [], n = 0; n < x.length; n++) {\n var l = v[n],\n J = x[n];\n D[n] = \"number\" === typeof l && \"number\" === typeof J && (\"A\" !== x[0] || 4 !== n && 5 !== n) ? l + e * (J - l) : J;\n }\n y.push(D);\n } else y = f;\n } else y = this.toD || [];\n this.elem.attr(\"d\", y, void 0, !0);\n };\n h.prototype.update = function () {\n var f = this.elem,\n h = this.prop,\n y = this.now,\n e = this.options.step;\n if (this[h + \"Setter\"]) this[h + \"Setter\"]();else f.attr ? f.element && f.attr(h, y, null, !0) : f.style[h] = y + this.unit;\n e && e.call(f, y, this);\n };\n h.prototype.run = function (h, C, y) {\n var e = this,\n I = e.options,\n v = function (n) {\n return v.stopped ? !1 : e.step(n);\n },\n x = m.requestAnimationFrame || function (n) {\n setTimeout(n, 13);\n },\n D = function () {\n for (var n = 0; n < f.timers.length; n++) f.timers[n]() || f.timers.splice(n--, 1);\n f.timers.length && x(D);\n };\n h !== C || this.elem[\"forceAnimate:\" + this.prop] ? (this.startTime = +new Date(), this.start = h, this.end = C, this.unit = y, this.now = this.start, this.pos = 0, v.elem = this.elem, v.prop = this.prop, v() && 1 === f.timers.push(v) && x(D)) : (delete I.curAnim[this.prop], I.complete && 0 === Object.keys(I.curAnim).length && I.complete.call(this.elem));\n };\n h.prototype.step = function (f) {\n var h = +new Date(),\n y = this.options,\n e = this.elem,\n I = y.complete,\n v = y.duration,\n x = y.curAnim;\n if (e.attr && !e.element) f = !1;else if (f || h >= v + this.startTime) {\n this.now = this.end;\n this.pos = 1;\n this.update();\n var D = x[this.prop] = !0;\n F(x, function (n) {\n !0 !== n && (D = !1);\n });\n D && I && I.call(e);\n f = !1;\n } else this.pos = y.easing((h - this.startTime) / v), this.now = this.start + (this.end - this.start) * this.pos, this.update(), f = !0;\n return f;\n };\n h.prototype.initPath = function (f, h, y) {\n function e(r, d) {\n for (; r.length < w;) {\n var g = r[0],\n c = d[w - r.length];\n c && \"M\" === g[0] && (r[0] = \"C\" === c[0] ? [\"C\", g[1], g[2], g[1], g[2], g[1], g[2]] : [\"L\", g[1], g[2]]);\n r.unshift(g);\n D && r.push(r[r.length - 1]);\n }\n }\n function I(r, d) {\n for (; r.length < w;) if (d = r[r.length / n - 1].slice(), \"C\" === d[0] && (d[1] = d[5], d[2] = d[6]), D) {\n var g = r[r.length / n].slice();\n r.splice(r.length / 2, 0, d, g);\n } else r.push(d);\n }\n var v = f.startX,\n x = f.endX;\n h = h && h.slice();\n y = y.slice();\n var D = f.isArea,\n n = D ? 2 : 1;\n if (!h) return [y, y];\n if (v && x) {\n for (f = 0; f < v.length; f++) if (v[f] === x[0]) {\n var l = f;\n break;\n } else if (v[0] === x[x.length - v.length + f]) {\n l = f;\n var J = !0;\n break;\n } else if (v[v.length - 1] === x[x.length - v.length + f]) {\n l = v.length - f;\n break;\n }\n \"undefined\" === typeof l && (h = []);\n }\n if (h.length && z(l)) {\n var w = y.length + l * n;\n J ? (e(h, y), I(y, h)) : (e(y, h), I(h, y));\n }\n return [h, y];\n };\n h.prototype.fillSetter = function () {\n h.prototype.strokeSetter.apply(this, arguments);\n };\n h.prototype.strokeSetter = function () {\n this.elem.attr(this.prop, f.color(this.start).tweenTo(f.color(this.end), this.pos), null, !0);\n };\n return h;\n }();\n return f.Fx = h;\n });\n N(m, \"Core/Animation/AnimationUtilities.js\", [m[\"Core/Animation/Fx.js\"], m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h, m) {\n var z = m.defined,\n P = m.getStyle,\n L = m.isArray,\n K = m.isNumber,\n C = m.isObject,\n y = m.merge,\n e = m.objectEach,\n I = m.pick;\n m = h.setAnimation = function (l, n) {\n n.renderer.globalAnimation = I(l, n.options.chart.animation, !0);\n };\n var v = h.animObject = function (l) {\n return C(l) ? h.merge({\n duration: 500,\n defer: 0\n }, l) : {\n duration: l ? 500 : 0,\n defer: 0\n };\n },\n x = h.getDeferredAnimation = function (l, n, w) {\n var r = v(n),\n d = 0,\n g = 0;\n (w ? [w] : l.series).forEach(function (c) {\n c = v(c.options.animation);\n d = n && z(n.defer) ? r.defer : Math.max(d, c.duration + c.defer);\n g = Math.min(r.duration, c.duration);\n });\n l.renderer.forExport && (d = 0);\n return {\n defer: Math.max(0, d - g),\n duration: Math.min(d, g)\n };\n },\n D = h.animate = function (l, v, w) {\n var r,\n d = \"\",\n g,\n c;\n if (!C(w)) {\n var a = arguments;\n w = {\n duration: a[2],\n easing: a[3],\n complete: a[4]\n };\n }\n K(w.duration) || (w.duration = 400);\n w.easing = \"function\" === typeof w.easing ? w.easing : Math[w.easing] || Math.easeInOutSine;\n w.curAnim = y(v);\n e(v, function (a, p) {\n n(l, p);\n c = new f(l, w, p);\n g = null;\n \"d\" === p && L(v.d) ? (c.paths = c.initPath(l, l.pathArray, v.d), c.toD = v.d, r = 0, g = 1) : l.attr ? r = l.attr(p) : (r = parseFloat(P(l, p)) || 0, \"opacity\" !== p && (d = \"px\"));\n g || (g = a);\n g && g.match && g.match(\"px\") && (g = g.replace(/px/g, \"\"));\n c.run(r, g, d);\n });\n },\n n = h.stop = function (l, n) {\n for (var w = h.timers.length; w--;) h.timers[w].elem !== l || n && n !== h.timers[w].prop || (h.timers[w].stopped = !0);\n };\n return {\n animate: D,\n animObject: v,\n getDeferredAnimation: x,\n setAnimation: m,\n stop: n\n };\n });\n N(m, \"Core/Renderer/SVG/SVGElement.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Color/Color.js\"], m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z) {\n var F = f.animate,\n P = f.animObject,\n K = f.stop,\n C = m.deg2rad,\n y = m.doc,\n e = m.hasTouch,\n I = m.isFirefox,\n v = m.noop,\n x = m.svg,\n D = m.SVG_NS,\n n = m.win,\n l = z.attr,\n J = z.createElement,\n w = z.css,\n r = z.defined,\n d = z.erase,\n g = z.extend,\n c = z.fireEvent,\n a = z.isArray,\n q = z.isFunction,\n p = z.isNumber,\n B = z.isString,\n A = z.merge,\n G = z.objectEach,\n M = z.pick,\n T = z.pInt,\n Q = z.syncTimeout,\n O = z.uniqueKey;\n \"\";\n f = function () {\n function E() {\n this.height = this.element = void 0;\n this.opacity = 1;\n this.renderer = void 0;\n this.SVG_NS = D;\n this.symbolCustomAttribs = \"x y width height r start end innerR anchorX anchorY rounded\".split(\" \");\n this.width = void 0;\n }\n E.prototype._defaultGetter = function (a) {\n a = M(this[a + \"Value\"], this[a], this.element ? this.element.getAttribute(a) : null, 0);\n /^[\\-0-9\\.]+$/.test(a) && (a = parseFloat(a));\n return a;\n };\n E.prototype._defaultSetter = function (a, b, k) {\n k.setAttribute(b, a);\n };\n E.prototype.add = function (a) {\n var b = this.renderer,\n k = this.element;\n a && (this.parentGroup = a);\n this.parentInverted = a && a.inverted;\n \"undefined\" !== typeof this.textStr && \"text\" === this.element.nodeName && b.buildText(this);\n this.added = !0;\n if (!a || a.handleZ || this.zIndex) var t = this.zIndexSetter();\n t || (a ? a.element : b.box).appendChild(k);\n if (this.onAdd) this.onAdd();\n return this;\n };\n E.prototype.addClass = function (a, b) {\n var k = b ? \"\" : this.attr(\"class\") || \"\";\n a = (a || \"\").split(/ /g).reduce(function (b, a) {\n -1 === k.indexOf(a) && b.push(a);\n return b;\n }, k ? [k] : []).join(\" \");\n a !== k && this.attr(\"class\", a);\n return this;\n };\n E.prototype.afterSetters = function () {\n this.doTransform && (this.updateTransform(), this.doTransform = !1);\n };\n E.prototype.align = function (a, b, k) {\n var t,\n c = {};\n var u = this.renderer;\n var g = u.alignedObjects;\n var p, q;\n if (a) {\n if (this.alignOptions = a, this.alignByTranslate = b, !k || B(k)) this.alignTo = t = k || \"renderer\", d(g, this), g.push(this), k = void 0;\n } else a = this.alignOptions, b = this.alignByTranslate, t = this.alignTo;\n k = M(k, u[t], u);\n t = a.align;\n u = a.verticalAlign;\n g = (k.x || 0) + (a.x || 0);\n var r = (k.y || 0) + (a.y || 0);\n \"right\" === t ? p = 1 : \"center\" === t && (p = 2);\n p && (g += (k.width - (a.width || 0)) / p);\n c[b ? \"translateX\" : \"x\"] = Math.round(g);\n \"bottom\" === u ? q = 1 : \"middle\" === u && (q = 2);\n q && (r += (k.height - (a.height || 0)) / q);\n c[b ? \"translateY\" : \"y\"] = Math.round(r);\n this[this.placed ? \"animate\" : \"attr\"](c);\n this.placed = !0;\n this.alignAttr = c;\n return this;\n };\n E.prototype.alignSetter = function (a) {\n var b = {\n left: \"start\",\n center: \"middle\",\n right: \"end\"\n };\n b[a] && (this.alignValue = a, this.element.setAttribute(\"text-anchor\", b[a]));\n };\n E.prototype.animate = function (a, b, k) {\n var t = this,\n c = P(M(b, this.renderer.globalAnimation, !0));\n b = c.defer;\n M(y.hidden, y.msHidden, y.webkitHidden, !1) && (c.duration = 0);\n 0 !== c.duration ? (k && (c.complete = k), Q(function () {\n t.element && F(t, a, c);\n }, b)) : (this.attr(a, void 0, k), G(a, function (b, k) {\n c.step && c.step.call(this, b, {\n prop: k,\n pos: 1\n });\n }, this));\n return this;\n };\n E.prototype.applyTextOutline = function (a) {\n var b = this.element,\n k;\n -1 !== a.indexOf(\"contrast\") && (a = a.replace(/contrast/g, this.renderer.getContrast(b.style.fill)));\n a = a.split(\" \");\n var t = a[a.length - 1];\n if ((k = a[0]) && \"none\" !== k && m.svg) {\n this.fakeTS = !0;\n a = [].slice.call(b.getElementsByTagName(\"tspan\"));\n this.ySetter = this.xSetter;\n k = k.replace(/(^[\\d\\.]+)(.*?)$/g, function (b, k, t) {\n return 2 * k + t;\n });\n this.removeTextOutline(a);\n var c = b.textContent ? /^[\\u0591-\\u065F\\u066A-\\u07FF\\uFB1D-\\uFDFD\\uFE70-\\uFEFC]/.test(b.textContent) : !1;\n var u = b.firstChild;\n a.forEach(function (a, H) {\n 0 === H && (a.setAttribute(\"x\", b.getAttribute(\"x\")), H = b.getAttribute(\"y\"), a.setAttribute(\"y\", H || 0), null === H && b.setAttribute(\"y\", 0));\n H = a.cloneNode(!0);\n l(c && !I ? a : H, {\n \"class\": \"highcharts-text-outline\",\n fill: t,\n stroke: t,\n \"stroke-width\": k,\n \"stroke-linejoin\": \"round\"\n });\n b.insertBefore(H, u);\n });\n c && I && a[0] && (a = a[0].cloneNode(!0), a.textContent = \" \", b.insertBefore(a, u));\n }\n };\n E.prototype.attr = function (a, b, k, t) {\n var c = this.element,\n u,\n d = this,\n g,\n p,\n q = this.symbolCustomAttribs;\n if (\"string\" === typeof a && \"undefined\" !== typeof b) {\n var r = a;\n a = {};\n a[r] = b;\n }\n \"string\" === typeof a ? d = (this[a + \"Getter\"] || this._defaultGetter).call(this, a, c) : (G(a, function (b, k) {\n g = !1;\n t || K(this, k);\n this.symbolName && -1 !== q.indexOf(k) && (u || (this.symbolAttr(a), u = !0), g = !0);\n !this.rotation || \"x\" !== k && \"y\" !== k || (this.doTransform = !0);\n g || (p = this[k + \"Setter\"] || this._defaultSetter, p.call(this, b, k, c), !this.styledMode && this.shadows && /^(width|height|visibility|x|y|d|transform|cx|cy|r)$/.test(k) && this.updateShadows(k, b, p));\n }, this), this.afterSetters());\n k && k.call(this);\n return d;\n };\n E.prototype.clip = function (a) {\n return this.attr(\"clip-path\", a ? \"url(\" + this.renderer.url + \"#\" + a.id + \")\" : \"none\");\n };\n E.prototype.crisp = function (a, b) {\n b = b || a.strokeWidth || 0;\n var k = Math.round(b) % 2 / 2;\n a.x = Math.floor(a.x || this.x || 0) + k;\n a.y = Math.floor(a.y || this.y || 0) + k;\n a.width = Math.floor((a.width || this.width || 0) - 2 * k);\n a.height = Math.floor((a.height || this.height || 0) - 2 * k);\n r(a.strokeWidth) && (a.strokeWidth = b);\n return a;\n };\n E.prototype.complexColor = function (u, b, k) {\n var t = this.renderer,\n H,\n d,\n g,\n p,\n q,\n B,\n l,\n n,\n w,\n E,\n V = [],\n v;\n c(this.renderer, \"complexColor\", {\n args: arguments\n }, function () {\n u.radialGradient ? d = \"radialGradient\" : u.linearGradient && (d = \"linearGradient\");\n if (d) {\n g = u[d];\n q = t.gradients;\n B = u.stops;\n w = k.radialReference;\n a(g) && (u[d] = g = {\n x1: g[0],\n y1: g[1],\n x2: g[2],\n y2: g[3],\n gradientUnits: \"userSpaceOnUse\"\n });\n \"radialGradient\" === d && w && !r(g.gradientUnits) && (p = g, g = A(g, t.getRadialAttr(w, p), {\n gradientUnits: \"userSpaceOnUse\"\n }));\n G(g, function (b, k) {\n \"id\" !== k && V.push(k, b);\n });\n G(B, function (b) {\n V.push(b);\n });\n V = V.join(\",\");\n if (q[V]) E = q[V].attr(\"id\");else {\n g.id = E = O();\n var c = q[V] = t.createElement(d).attr(g).add(t.defs);\n c.radAttr = p;\n c.stops = [];\n B.forEach(function (b) {\n 0 === b[1].indexOf(\"rgba\") ? (H = h.parse(b[1]), l = H.get(\"rgb\"), n = H.get(\"a\")) : (l = b[1], n = 1);\n b = t.createElement(\"stop\").attr({\n offset: b[0],\n \"stop-color\": l,\n \"stop-opacity\": n\n }).add(c);\n c.stops.push(b);\n });\n }\n v = \"url(\" + t.url + \"#\" + E + \")\";\n k.setAttribute(b, v);\n k.gradient = V;\n u.toString = function () {\n return v;\n };\n }\n });\n };\n E.prototype.css = function (a) {\n var b = this.styles,\n k = {},\n t = this.element,\n c = \"\",\n d = !b,\n u = [\"textOutline\", \"textOverflow\", \"width\"];\n a && a.color && (a.fill = a.color);\n b && G(a, function (a, t) {\n b && b[t] !== a && (k[t] = a, d = !0);\n });\n if (d) {\n b && (a = g(b, k));\n if (a) if (null === a.width || \"auto\" === a.width) delete this.textWidth;else if (\"text\" === t.nodeName.toLowerCase() && a.width) var p = this.textWidth = T(a.width);\n this.styles = a;\n p && !x && this.renderer.forExport && delete a.width;\n if (t.namespaceURI === this.SVG_NS) {\n var q = function (b, k) {\n return \"-\" + k.toLowerCase();\n };\n G(a, function (b, k) {\n -1 === u.indexOf(k) && (c += k.replace(/([A-Z])/g, q) + \":\" + b + \";\");\n });\n c && l(t, \"style\", c);\n } else w(t, a);\n this.added && (\"text\" === this.element.nodeName && this.renderer.buildText(this), a && a.textOutline && this.applyTextOutline(a.textOutline));\n }\n return this;\n };\n E.prototype.dashstyleSetter = function (a) {\n var b = this[\"stroke-width\"];\n \"inherit\" === b && (b = 1);\n if (a = a && a.toLowerCase()) {\n var k = a.replace(\"shortdashdotdot\", \"3,1,1,1,1,1,\").replace(\"shortdashdot\", \"3,1,1,1\").replace(\"shortdot\", \"1,1,\").replace(\"shortdash\", \"3,1,\").replace(\"longdash\", \"8,3,\").replace(/dot/g, \"1,3,\").replace(\"dash\", \"4,3,\").replace(/,$/, \"\").split(\",\");\n for (a = k.length; a--;) k[a] = \"\" + T(k[a]) * M(b, NaN);\n a = k.join(\",\").replace(/NaN/g, \"none\");\n this.element.setAttribute(\"stroke-dasharray\", a);\n }\n };\n E.prototype.destroy = function () {\n var a = this,\n b = a.element || {},\n k = a.renderer,\n t = k.isSVG && \"SPAN\" === b.nodeName && a.parentGroup || void 0,\n c = b.ownerSVGElement;\n b.onclick = b.onmouseout = b.onmouseover = b.onmousemove = b.point = null;\n K(a);\n if (a.clipPath && c) {\n var g = a.clipPath;\n [].forEach.call(c.querySelectorAll(\"[clip-path],[CLIP-PATH]\"), function (b) {\n -1 < b.getAttribute(\"clip-path\").indexOf(g.element.id) && b.removeAttribute(\"clip-path\");\n });\n a.clipPath = g.destroy();\n }\n if (a.stops) {\n for (c = 0; c < a.stops.length; c++) a.stops[c].destroy();\n a.stops.length = 0;\n a.stops = void 0;\n }\n a.safeRemoveChild(b);\n for (k.styledMode || a.destroyShadows(); t && t.div && 0 === t.div.childNodes.length;) b = t.parentGroup, a.safeRemoveChild(t.div), delete t.div, t = b;\n a.alignTo && d(k.alignedObjects, a);\n G(a, function (b, k) {\n a[k] && a[k].parentGroup === a && a[k].destroy && a[k].destroy();\n delete a[k];\n });\n };\n E.prototype.destroyShadows = function () {\n (this.shadows || []).forEach(function (a) {\n this.safeRemoveChild(a);\n }, this);\n this.shadows = void 0;\n };\n E.prototype.destroyTextPath = function (a, b) {\n var k = a.getElementsByTagName(\"text\")[0];\n if (k) {\n if (k.removeAttribute(\"dx\"), k.removeAttribute(\"dy\"), b.element.setAttribute(\"id\", \"\"), this.textPathWrapper && k.getElementsByTagName(\"textPath\").length) {\n for (a = this.textPathWrapper.element.childNodes; a.length;) k.appendChild(a[0]);\n k.removeChild(this.textPathWrapper.element);\n }\n } else if (a.getAttribute(\"dx\") || a.getAttribute(\"dy\")) a.removeAttribute(\"dx\"), a.removeAttribute(\"dy\");\n this.textPathWrapper && (this.textPathWrapper = this.textPathWrapper.destroy());\n };\n E.prototype.dSetter = function (c, b, k) {\n a(c) && (\"string\" === typeof c[0] && (c = this.renderer.pathToSegments(c)), this.pathArray = c, c = c.reduce(function (b, k, a) {\n return k && k.join ? (a ? b + \" \" : \"\") + k.join(\" \") : (k || \"\").toString();\n }, \"\"));\n /(NaN| {2}|^$)/.test(c) && (c = \"M 0 0\");\n this[b] !== c && (k.setAttribute(b, c), this[b] = c);\n };\n E.prototype.fadeOut = function (a) {\n var b = this;\n b.animate({\n opacity: 0\n }, {\n duration: M(a, 150),\n complete: function () {\n b.attr({\n y: -9999\n }).hide();\n }\n });\n };\n E.prototype.fillSetter = function (a, b, k) {\n \"string\" === typeof a ? k.setAttribute(b, a) : a && this.complexColor(a, b, k);\n };\n E.prototype.getBBox = function (a, b) {\n var k,\n t = this.renderer,\n c = this.element,\n d = this.styles,\n p = this.textStr,\n u = t.cache,\n B = t.cacheKeys,\n A = c.namespaceURI === this.SVG_NS;\n b = M(b, this.rotation, 0);\n var l = t.styledMode ? c && E.prototype.getStyle.call(c, \"font-size\") : d && d.fontSize;\n if (r(p)) {\n var n = p.toString();\n -1 === n.indexOf(\"<\") && (n = n.replace(/[0-9]/g, \"0\"));\n n += [\"\", b, l, this.textWidth, d && d.textOverflow, d && d.fontWeight].join();\n }\n n && !a && (k = u[n]);\n if (!k) {\n if (A || t.forExport) {\n try {\n var w = this.fakeTS && function (b) {\n [].forEach.call(c.querySelectorAll(\".highcharts-text-outline\"), function (k) {\n k.style.display = b;\n });\n };\n q(w) && w(\"none\");\n k = c.getBBox ? g({}, c.getBBox()) : {\n width: c.offsetWidth,\n height: c.offsetHeight\n };\n q(w) && w(\"\");\n } catch (ca) {\n \"\";\n }\n if (!k || 0 > k.width) k = {\n width: 0,\n height: 0\n };\n } else k = this.htmlGetBBox();\n t.isSVG && (a = k.width, t = k.height, A && (k.height = t = {\n \"11px,17\": 14,\n \"13px,20\": 16\n }[d && d.fontSize + \",\" + Math.round(t)] || t), b && (d = b * C, k.width = Math.abs(t * Math.sin(d)) + Math.abs(a * Math.cos(d)), k.height = Math.abs(t * Math.cos(d)) + Math.abs(a * Math.sin(d))));\n if (n && 0 < k.height) {\n for (; 250 < B.length;) delete u[B.shift()];\n u[n] || B.push(n);\n u[n] = k;\n }\n }\n return k;\n };\n E.prototype.getStyle = function (a) {\n return n.getComputedStyle(this.element || this, \"\").getPropertyValue(a);\n };\n E.prototype.hasClass = function (a) {\n return -1 !== (\"\" + this.attr(\"class\")).split(\" \").indexOf(a);\n };\n E.prototype.hide = function (a) {\n a ? this.attr({\n y: -9999\n }) : this.attr({\n visibility: \"hidden\"\n });\n return this;\n };\n E.prototype.htmlGetBBox = function () {\n return {\n height: 0,\n width: 0,\n x: 0,\n y: 0\n };\n };\n E.prototype.init = function (a, b) {\n this.element = \"span\" === b ? J(b) : y.createElementNS(this.SVG_NS, b);\n this.renderer = a;\n c(this, \"afterInit\");\n };\n E.prototype.invert = function (a) {\n this.inverted = a;\n this.updateTransform();\n return this;\n };\n E.prototype.on = function (a, b) {\n var k,\n t,\n c = this.element,\n d;\n e && \"click\" === a ? (c.ontouchstart = function (b) {\n k = b.touches[0].clientX;\n t = b.touches[0].clientY;\n }, c.ontouchend = function (a) {\n k && 4 <= Math.sqrt(Math.pow(k - a.changedTouches[0].clientX, 2) + Math.pow(t - a.changedTouches[0].clientY, 2)) || b.call(c, a);\n d = !0;\n !1 !== a.cancelable && a.preventDefault();\n }, c.onclick = function (k) {\n d || b.call(c, k);\n }) : c[\"on\" + a] = b;\n return this;\n };\n E.prototype.opacitySetter = function (a, b, k) {\n this.opacity = a = Number(Number(a).toFixed(3));\n k.setAttribute(b, a);\n };\n E.prototype.removeClass = function (a) {\n return this.attr(\"class\", (\"\" + this.attr(\"class\")).replace(B(a) ? new RegExp(\"(^| )\" + a + \"( |$)\") : a, \" \").replace(/ +/g, \" \").trim());\n };\n E.prototype.removeTextOutline = function (a) {\n for (var b = a.length, k; b--;) k = a[b], \"highcharts-text-outline\" === k.getAttribute(\"class\") && d(a, this.element.removeChild(k));\n };\n E.prototype.safeRemoveChild = function (a) {\n var b = a.parentNode;\n b && b.removeChild(a);\n };\n E.prototype.setRadialReference = function (a) {\n var b = this.element.gradient && this.renderer.gradients[this.element.gradient];\n this.element.radialReference = a;\n b && b.radAttr && b.animate(this.renderer.getRadialAttr(a, b.radAttr));\n return this;\n };\n E.prototype.setTextPath = function (a, b) {\n var k = this.element,\n t = {\n textAnchor: \"text-anchor\"\n },\n c = !1,\n d = this.textPathWrapper,\n g = !d;\n b = A(!0, {\n enabled: !0,\n attributes: {\n dy: -5,\n startOffset: \"50%\",\n textAnchor: \"middle\"\n }\n }, b);\n var q = b.attributes;\n if (a && b && b.enabled) {\n d && null === d.element.parentNode ? (g = !0, d = d.destroy()) : d && this.removeTextOutline.call(d.parentGroup, [].slice.call(k.getElementsByTagName(\"tspan\")));\n this.options && this.options.padding && (q.dx = -this.options.padding);\n d || (this.textPathWrapper = d = this.renderer.createElement(\"textPath\"), c = !0);\n var u = d.element;\n (b = a.element.getAttribute(\"id\")) || a.element.setAttribute(\"id\", b = O());\n if (g) for (a = k.getElementsByTagName(\"tspan\"); a.length;) a[0].setAttribute(\"y\", 0), p(q.dx) && a[0].setAttribute(\"x\", -q.dx), u.appendChild(a[0]);\n c && d && d.add({\n element: this.text ? this.text.element : k\n });\n u.setAttributeNS(\"http://www.w3.org/1999/xlink\", \"href\", this.renderer.url + \"#\" + b);\n r(q.dy) && (u.parentNode.setAttribute(\"dy\", q.dy), delete q.dy);\n r(q.dx) && (u.parentNode.setAttribute(\"dx\", q.dx), delete q.dx);\n G(q, function (b, k) {\n u.setAttribute(t[k] || k, b);\n });\n k.removeAttribute(\"transform\");\n this.removeTextOutline.call(d, [].slice.call(k.getElementsByTagName(\"tspan\")));\n this.text && !this.renderer.styledMode && this.attr({\n fill: \"none\",\n \"stroke-width\": 0\n });\n this.applyTextOutline = this.updateTransform = v;\n } else d && (delete this.updateTransform, delete this.applyTextOutline, this.destroyTextPath(k, a), this.updateTransform(), this.options && this.options.rotation && this.applyTextOutline(this.options.style.textOutline));\n return this;\n };\n E.prototype.shadow = function (a, b, k) {\n var t = [],\n c = this.element,\n d = !1,\n p = this.oldShadowOptions;\n var q = {\n color: \"#000000\",\n offsetX: 1,\n offsetY: 1,\n opacity: .15,\n width: 3\n };\n var u;\n !0 === a ? u = q : \"object\" === typeof a && (u = g(q, a));\n u && (u && p && G(u, function (b, k) {\n b !== p[k] && (d = !0);\n }), d && this.destroyShadows(), this.oldShadowOptions = u);\n if (!u) this.destroyShadows();else if (!this.shadows) {\n var r = u.opacity / u.width;\n var B = this.parentInverted ? \"translate(-1,-1)\" : \"translate(\" + u.offsetX + \", \" + u.offsetY + \")\";\n for (q = 1; q <= u.width; q++) {\n var A = c.cloneNode(!1);\n var n = 2 * u.width + 1 - 2 * q;\n l(A, {\n stroke: a.color || \"#000000\",\n \"stroke-opacity\": r * q,\n \"stroke-width\": n,\n transform: B,\n fill: \"none\"\n });\n A.setAttribute(\"class\", (A.getAttribute(\"class\") || \"\") + \" highcharts-shadow\");\n k && (l(A, \"height\", Math.max(l(A, \"height\") - n, 0)), A.cutHeight = n);\n b ? b.element.appendChild(A) : c.parentNode && c.parentNode.insertBefore(A, c);\n t.push(A);\n }\n this.shadows = t;\n }\n return this;\n };\n E.prototype.show = function (a) {\n return this.attr({\n visibility: a ? \"inherit\" : \"visible\"\n });\n };\n E.prototype.strokeSetter = function (a, b, k) {\n this[b] = a;\n this.stroke && this[\"stroke-width\"] ? (E.prototype.fillSetter.call(this, this.stroke, \"stroke\", k), k.setAttribute(\"stroke-width\", this[\"stroke-width\"]), this.hasStroke = !0) : \"stroke-width\" === b && 0 === a && this.hasStroke ? (k.removeAttribute(\"stroke\"), this.hasStroke = !1) : this.renderer.styledMode && this[\"stroke-width\"] && (k.setAttribute(\"stroke-width\", this[\"stroke-width\"]), this.hasStroke = !0);\n };\n E.prototype.strokeWidth = function () {\n if (!this.renderer.styledMode) return this[\"stroke-width\"] || 0;\n var a = this.getStyle(\"stroke-width\"),\n b = 0;\n if (a.indexOf(\"px\") === a.length - 2) b = T(a);else if (\"\" !== a) {\n var k = y.createElementNS(D, \"rect\");\n l(k, {\n width: a,\n \"stroke-width\": 0\n });\n this.element.parentNode.appendChild(k);\n b = k.getBBox().width;\n k.parentNode.removeChild(k);\n }\n return b;\n };\n E.prototype.symbolAttr = function (a) {\n var b = this;\n \"x y r start end width height innerR anchorX anchorY clockwise\".split(\" \").forEach(function (k) {\n b[k] = M(a[k], b[k]);\n });\n b.attr({\n d: b.renderer.symbols[b.symbolName](b.x, b.y, b.width, b.height, b)\n });\n };\n E.prototype.textSetter = function (a) {\n a !== this.textStr && (delete this.textPxLength, this.textStr = a, this.added && this.renderer.buildText(this));\n };\n E.prototype.titleSetter = function (a) {\n var b = this.element.getElementsByTagName(\"title\")[0];\n b || (b = y.createElementNS(this.SVG_NS, \"title\"), this.element.appendChild(b));\n b.firstChild && b.removeChild(b.firstChild);\n b.appendChild(y.createTextNode(String(M(a, \"\")).replace(/<[^>]*>/g, \"\").replace(/</g, \"<\").replace(/>/g, \">\")));\n };\n E.prototype.toFront = function () {\n var a = this.element;\n a.parentNode.appendChild(a);\n return this;\n };\n E.prototype.translate = function (a, b) {\n return this.attr({\n translateX: a,\n translateY: b\n });\n };\n E.prototype.updateShadows = function (a, b, k) {\n var t = this.shadows;\n if (t) for (var c = t.length; c--;) k.call(t[c], \"height\" === a ? Math.max(b - (t[c].cutHeight || 0), 0) : \"d\" === a ? this.d : b, a, t[c]);\n };\n E.prototype.updateTransform = function () {\n var a = this.translateX || 0,\n b = this.translateY || 0,\n k = this.scaleX,\n t = this.scaleY,\n c = this.inverted,\n d = this.rotation,\n g = this.matrix,\n p = this.element;\n c && (a += this.width, b += this.height);\n a = [\"translate(\" + a + \",\" + b + \")\"];\n r(g) && a.push(\"matrix(\" + g.join(\",\") + \")\");\n c ? a.push(\"rotate(90) scale(-1,1)\") : d && a.push(\"rotate(\" + d + \" \" + M(this.rotationOriginX, p.getAttribute(\"x\"), 0) + \" \" + M(this.rotationOriginY, p.getAttribute(\"y\") || 0) + \")\");\n (r(k) || r(t)) && a.push(\"scale(\" + M(k, 1) + \" \" + M(t, 1) + \")\");\n a.length && p.setAttribute(\"transform\", a.join(\" \"));\n };\n E.prototype.visibilitySetter = function (a, b, k) {\n \"inherit\" === a ? k.removeAttribute(b) : this[b] !== a && k.setAttribute(b, a);\n this[b] = a;\n };\n E.prototype.xGetter = function (a) {\n \"circle\" === this.element.nodeName && (\"x\" === a ? a = \"cx\" : \"y\" === a && (a = \"cy\"));\n return this._defaultGetter(a);\n };\n E.prototype.zIndexSetter = function (a, b) {\n var k = this.renderer,\n t = this.parentGroup,\n c = (t || k).element || k.box,\n d = this.element,\n g = !1;\n k = c === k.box;\n var p = this.added;\n var q;\n r(a) ? (d.setAttribute(\"data-z-index\", a), a = +a, this[b] === a && (p = !1)) : r(this[b]) && d.removeAttribute(\"data-z-index\");\n this[b] = a;\n if (p) {\n (a = this.zIndex) && t && (t.handleZ = !0);\n b = c.childNodes;\n for (q = b.length - 1; 0 <= q && !g; q--) {\n t = b[q];\n p = t.getAttribute(\"data-z-index\");\n var u = !r(p);\n if (t !== d) if (0 > a && u && !k && !q) c.insertBefore(d, b[q]), g = !0;else if (T(p) <= a || u && (!r(a) || 0 <= a)) c.insertBefore(d, b[q + 1] || null), g = !0;\n }\n g || (c.insertBefore(d, b[k ? 3 : 0] || null), g = !0);\n }\n return g;\n };\n return E;\n }();\n f.prototype[\"stroke-widthSetter\"] = f.prototype.strokeSetter;\n f.prototype.yGetter = f.prototype.xGetter;\n f.prototype.matrixSetter = f.prototype.rotationOriginXSetter = f.prototype.rotationOriginYSetter = f.prototype.rotationSetter = f.prototype.scaleXSetter = f.prototype.scaleYSetter = f.prototype.translateXSetter = f.prototype.translateYSetter = f.prototype.verticalAlignSetter = function (a, c) {\n this[c] = a;\n this.doTransform = !0;\n };\n m.SVGElement = f;\n return m.SVGElement;\n });\n N(m, \"Core/Renderer/SVG/SVGLabel.js\", [m[\"Core/Renderer/SVG/SVGElement.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = this && this.__extends || function () {\n var f = function (e, I) {\n f = Object.setPrototypeOf || {\n __proto__: []\n } instanceof Array && function (v, e) {\n v.__proto__ = e;\n } || function (v, e) {\n for (var f in e) e.hasOwnProperty(f) && (v[f] = e[f]);\n };\n return f(e, I);\n };\n return function (e, I) {\n function v() {\n this.constructor = e;\n }\n f(e, I);\n e.prototype = null === I ? Object.create(I) : (v.prototype = I.prototype, new v());\n };\n }(),\n z = h.defined,\n F = h.extend,\n L = h.isNumber,\n K = h.merge,\n C = h.removeEvent;\n return function (h) {\n function e(f, v, x, D, n, l, J, w, r, d) {\n var g = h.call(this) || this;\n g.init(f, \"g\");\n g.textStr = v;\n g.x = x;\n g.y = D;\n g.anchorX = l;\n g.anchorY = J;\n g.baseline = r;\n g.className = d;\n \"button\" !== d && g.addClass(\"highcharts-label\");\n d && g.addClass(\"highcharts-\" + d);\n g.text = f.text(\"\", 0, 0, w).attr({\n zIndex: 1\n });\n if (\"string\" === typeof n) {\n var c = /^url\\((.*?)\\)$/.test(n);\n if (g.renderer.symbols[n] || c) g.symbolKey = n;\n }\n g.bBox = e.emptyBBox;\n g.padding = 3;\n g.paddingLeft = 0;\n g.baselineOffset = 0;\n g.needsBox = f.styledMode || c;\n g.deferredAttr = {};\n g.alignFactor = 0;\n return g;\n }\n m(e, h);\n e.prototype.alignSetter = function (e) {\n e = {\n left: 0,\n center: .5,\n right: 1\n }[e];\n e !== this.alignFactor && (this.alignFactor = e, this.bBox && L(this.xSetting) && this.attr({\n x: this.xSetting\n }));\n };\n e.prototype.anchorXSetter = function (e, v) {\n this.anchorX = e;\n this.boxAttr(v, Math.round(e) - this.getCrispAdjust() - this.xSetting);\n };\n e.prototype.anchorYSetter = function (e, v) {\n this.anchorY = e;\n this.boxAttr(v, e - this.ySetting);\n };\n e.prototype.boxAttr = function (e, v) {\n this.box ? this.box.attr(e, v) : this.deferredAttr[e] = v;\n };\n e.prototype.css = function (h) {\n if (h) {\n var v = {};\n h = K(h);\n e.textProps.forEach(function (e) {\n \"undefined\" !== typeof h[e] && (v[e] = h[e], delete h[e]);\n });\n this.text.css(v);\n var I = \"fontSize\" in v || \"fontWeight\" in v;\n if (\"width\" in v || I) this.updateBoxSize(), I && this.updateTextPadding();\n }\n return f.prototype.css.call(this, h);\n };\n e.prototype.destroy = function () {\n C(this.element, \"mouseenter\");\n C(this.element, \"mouseleave\");\n this.text && this.text.destroy();\n this.box && (this.box = this.box.destroy());\n f.prototype.destroy.call(this);\n };\n e.prototype.fillSetter = function (e, v) {\n e && (this.needsBox = !0);\n this.fill = e;\n this.boxAttr(v, e);\n };\n e.prototype.getBBox = function () {\n var e = this.bBox,\n v = this.padding;\n return {\n width: e.width + 2 * v,\n height: e.height + 2 * v,\n x: e.x - v,\n y: e.y - v\n };\n };\n e.prototype.getCrispAdjust = function () {\n return this.renderer.styledMode && this.box ? this.box.strokeWidth() % 2 / 2 : (this[\"stroke-width\"] ? parseInt(this[\"stroke-width\"], 10) : 0) % 2 / 2;\n };\n e.prototype.heightSetter = function (e) {\n this.heightSetting = e;\n };\n e.prototype.on = function (e, v) {\n var h = this,\n D = h.text,\n n = D && \"SPAN\" === D.element.tagName ? D : void 0;\n if (n) {\n var l = function (l) {\n (\"mouseenter\" === e || \"mouseleave\" === e) && l.relatedTarget instanceof Element && (h.element.contains(l.relatedTarget) || n.element.contains(l.relatedTarget)) || v.call(h.element, l);\n };\n n.on(e, l);\n }\n f.prototype.on.call(h, e, l || v);\n return h;\n };\n e.prototype.onAdd = function () {\n var e = this.textStr;\n this.text.add(this);\n this.attr({\n text: z(e) ? e : \"\",\n x: this.x,\n y: this.y\n });\n this.box && z(this.anchorX) && this.attr({\n anchorX: this.anchorX,\n anchorY: this.anchorY\n });\n };\n e.prototype.paddingSetter = function (e) {\n z(e) && e !== this.padding && (this.padding = e, this.updateTextPadding());\n };\n e.prototype.paddingLeftSetter = function (e) {\n z(e) && e !== this.paddingLeft && (this.paddingLeft = e, this.updateTextPadding());\n };\n e.prototype.rSetter = function (e, v) {\n this.boxAttr(v, e);\n };\n e.prototype.shadow = function (e) {\n e && !this.renderer.styledMode && (this.updateBoxSize(), this.box && this.box.shadow(e));\n return this;\n };\n e.prototype.strokeSetter = function (e, v) {\n this.stroke = e;\n this.boxAttr(v, e);\n };\n e.prototype[\"stroke-widthSetter\"] = function (e, v) {\n e && (this.needsBox = !0);\n this[\"stroke-width\"] = e;\n this.boxAttr(v, e);\n };\n e.prototype[\"text-alignSetter\"] = function (e) {\n this.textAlign = e;\n };\n e.prototype.textSetter = function (e) {\n \"undefined\" !== typeof e && this.text.attr({\n text: e\n });\n this.updateBoxSize();\n this.updateTextPadding();\n };\n e.prototype.updateBoxSize = function () {\n var f = this.text.element.style,\n v = {},\n h = this.padding,\n D = this.paddingLeft,\n n = L(this.widthSetting) && L(this.heightSetting) && !this.textAlign || !z(this.text.textStr) ? e.emptyBBox : this.text.getBBox();\n this.width = (this.widthSetting || n.width || 0) + 2 * h + D;\n this.height = (this.heightSetting || n.height || 0) + 2 * h;\n this.baselineOffset = h + Math.min(this.renderer.fontMetrics(f && f.fontSize, this.text).b, n.height || Infinity);\n this.needsBox && (this.box || (f = this.box = this.symbolKey ? this.renderer.symbol(this.symbolKey) : this.renderer.rect(), f.addClass((\"button\" === this.className ? \"\" : \"highcharts-label-box\") + (this.className ? \" highcharts-\" + this.className + \"-box\" : \"\")), f.add(this), f = this.getCrispAdjust(), v.x = f, v.y = (this.baseline ? -this.baselineOffset : 0) + f), v.width = Math.round(this.width), v.height = Math.round(this.height), this.box.attr(F(v, this.deferredAttr)), this.deferredAttr = {});\n this.bBox = n;\n };\n e.prototype.updateTextPadding = function () {\n var e = this.text,\n f = this.baseline ? 0 : this.baselineOffset,\n h = this.paddingLeft + this.padding;\n z(this.widthSetting) && this.bBox && (\"center\" === this.textAlign || \"right\" === this.textAlign) && (h += {\n center: .5,\n right: 1\n }[this.textAlign] * (this.widthSetting - this.bBox.width));\n if (h !== e.x || f !== e.y) e.attr(\"x\", h), e.hasBoxWidthChanged && (this.bBox = e.getBBox(!0), this.updateBoxSize()), \"undefined\" !== typeof f && e.attr(\"y\", f);\n e.x = h;\n e.y = f;\n };\n e.prototype.widthSetter = function (e) {\n this.widthSetting = L(e) ? e : void 0;\n };\n e.prototype.xSetter = function (e) {\n this.x = e;\n this.alignFactor && (e -= this.alignFactor * ((this.widthSetting || this.bBox.width) + 2 * this.padding), this[\"forceAnimate:x\"] = !0);\n this.xSetting = Math.round(e);\n this.attr(\"translateX\", this.xSetting);\n };\n e.prototype.ySetter = function (e) {\n this.ySetting = this.y = Math.round(e);\n this.attr(\"translateY\", this.ySetting);\n };\n e.emptyBBox = {\n width: 0,\n height: 0,\n x: 0,\n y: 0\n };\n e.textProps = \"color cursor direction fontFamily fontSize fontStyle fontWeight lineHeight textAlign textDecoration textOutline textOverflow width\".split(\" \");\n return e;\n }(f);\n });\n N(m, \"Core/Renderer/SVG/SVGRenderer.js\", [m[\"Core/Color/Color.js\"], m[\"Core/Globals.js\"], m[\"Core/Renderer/SVG/SVGElement.js\"], m[\"Core/Renderer/SVG/SVGLabel.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z, F) {\n var P = F.addEvent,\n K = F.attr,\n C = F.createElement,\n y = F.css,\n e = F.defined,\n I = F.destroyObjectProperties,\n v = F.extend,\n x = F.isArray,\n D = F.isNumber,\n n = F.isObject,\n l = F.isString,\n J = F.merge,\n w = F.objectEach,\n r = F.pick,\n d = F.pInt,\n g = F.splat,\n c = F.uniqueKey,\n a = h.charts,\n q = h.deg2rad,\n p = h.doc,\n B = h.isFirefox,\n A = h.isMS,\n G = h.isWebKit;\n F = h.noop;\n var M = h.svg,\n T = h.SVG_NS,\n Q = h.symbolSizes,\n O = h.win,\n E = function () {\n function u(b, k, a, c, d, g, p) {\n this.width = this.url = this.style = this.isSVG = this.imgCount = this.height = this.gradients = this.globalAnimation = this.defs = this.chartIndex = this.cacheKeys = this.cache = this.boxWrapper = this.box = this.alignedObjects = void 0;\n this.init(b, k, a, c, d, g, p);\n }\n u.prototype.init = function (b, k, a, c, d, g, q) {\n var t = this.createElement(\"svg\").attr({\n version: \"1.1\",\n \"class\": \"highcharts-root\"\n });\n q || t.css(this.getStyle(c));\n c = t.element;\n b.appendChild(c);\n K(b, \"dir\", \"ltr\");\n -1 === b.innerHTML.indexOf(\"xmlns\") && K(c, \"xmlns\", this.SVG_NS);\n this.isSVG = !0;\n this.box = c;\n this.boxWrapper = t;\n this.alignedObjects = [];\n this.url = (B || G) && p.getElementsByTagName(\"base\").length ? O.location.href.split(\"#\")[0].replace(/<[^>]*>/g, \"\").replace(/([\\('\\)])/g, \"\\\\$1\").replace(/ /g, \"%20\") : \"\";\n this.createElement(\"desc\").add().element.appendChild(p.createTextNode(\"Created with Highcharts 8.2.2\"));\n this.defs = this.createElement(\"defs\").add();\n this.allowHTML = g;\n this.forExport = d;\n this.styledMode = q;\n this.gradients = {};\n this.cache = {};\n this.cacheKeys = [];\n this.imgCount = 0;\n this.setSize(k, a, !1);\n var H;\n B && b.getBoundingClientRect && (k = function () {\n y(b, {\n left: 0,\n top: 0\n });\n H = b.getBoundingClientRect();\n y(b, {\n left: Math.ceil(H.left) - H.left + \"px\",\n top: Math.ceil(H.top) - H.top + \"px\"\n });\n }, k(), this.unSubPixelFix = P(O, \"resize\", k));\n };\n u.prototype.definition = function (b) {\n function k(b, t) {\n var c;\n g(b).forEach(function (b) {\n var d = a.createElement(b.tagName),\n g = {};\n w(b, function (b, k) {\n \"tagName\" !== k && \"children\" !== k && \"textContent\" !== k && (g[k] = b);\n });\n d.attr(g);\n d.add(t || a.defs);\n b.textContent && d.element.appendChild(p.createTextNode(b.textContent));\n k(b.children || [], d);\n c = d;\n });\n return c;\n }\n var a = this;\n return k(b);\n };\n u.prototype.getStyle = function (b) {\n return this.style = v({\n fontFamily: '\"Lucida Grande\", \"Lucida Sans Unicode\", Arial, Helvetica, sans-serif',\n fontSize: \"12px\"\n }, b);\n };\n u.prototype.setStyle = function (b) {\n this.boxWrapper.css(this.getStyle(b));\n };\n u.prototype.isHidden = function () {\n return !this.boxWrapper.getBBox().width;\n };\n u.prototype.destroy = function () {\n var b = this.defs;\n this.box = null;\n this.boxWrapper = this.boxWrapper.destroy();\n I(this.gradients || {});\n this.gradients = null;\n b && (this.defs = b.destroy());\n this.unSubPixelFix && this.unSubPixelFix();\n return this.alignedObjects = null;\n };\n u.prototype.createElement = function (b) {\n var k = new this.Element();\n k.init(this, b);\n return k;\n };\n u.prototype.getRadialAttr = function (b, k) {\n return {\n cx: b[0] - b[2] / 2 + k.cx * b[2],\n cy: b[1] - b[2] / 2 + k.cy * b[2],\n r: k.r * b[2]\n };\n };\n u.prototype.truncate = function (b, k, a, c, d, g, q) {\n var t = this,\n H = b.rotation,\n R,\n u = c ? 1 : 0,\n A = (a || c).length,\n r = A,\n B = [],\n n = function (b) {\n k.firstChild && k.removeChild(k.firstChild);\n b && k.appendChild(p.createTextNode(b));\n },\n l = function (g, p) {\n p = p || g;\n if (\"undefined\" === typeof B[p]) if (k.getSubStringLength) try {\n B[p] = d + k.getSubStringLength(0, c ? p + 1 : p);\n } catch (ja) {\n \"\";\n } else t.getSpanWidth && (n(q(a || c, g)), B[p] = d + t.getSpanWidth(b, k));\n return B[p];\n },\n e;\n b.rotation = 0;\n var w = l(k.textContent.length);\n if (e = d + w > g) {\n for (; u <= A;) r = Math.ceil((u + A) / 2), c && (R = q(c, r)), w = l(r, R && R.length - 1), u === A ? u = A + 1 : w > g ? A = r - 1 : u = r;\n 0 === A ? n(\"\") : a && A === a.length - 1 || n(R || q(a || c, r));\n }\n c && c.splice(0, r);\n b.actualWidth = w;\n b.rotation = H;\n return e;\n };\n u.prototype.buildText = function (b) {\n var k = b.element,\n a = this,\n c = a.forExport,\n g = r(b.textStr, \"\").toString(),\n q = -1 !== g.indexOf(\"<\"),\n u = k.childNodes,\n A,\n B = K(k, \"x\"),\n n = b.styles,\n e = b.textWidth,\n G = n && n.lineHeight,\n f = n && n.textOutline,\n V = n && \"ellipsis\" === n.textOverflow,\n E = n && \"nowrap\" === n.whiteSpace,\n h = n && n.fontSize,\n v,\n D = u.length;\n n = e && !b.added && this.box;\n var O = function (b) {\n var t;\n a.styledMode || (t = /(px|em)$/.test(b && b.style.fontSize) ? b.style.fontSize : h || a.style.fontSize || 12);\n return G ? d(G) : a.fontMetrics(t, b.getAttribute(\"style\") ? b : k).h;\n },\n J = function (b, k) {\n w(a.escapes, function (a, t) {\n k && -1 !== k.indexOf(a) || (b = b.toString().replace(new RegExp(a, \"g\"), t));\n });\n return b;\n },\n x = function (b, k) {\n var a = b.indexOf(\"<\");\n b = b.substring(a, b.indexOf(\">\") - a);\n a = b.indexOf(k + \"=\");\n if (-1 !== a && (a = a + k.length + 1, k = b.charAt(a), '\"' === k || \"'\" === k)) return b = b.substring(a + 1), b.substring(0, b.indexOf(k));\n },\n I = /\n {/**/}\n 
\n
\n )}\n\n {open && \n \n \n setChartStyle(\"column\")}>\n \n setChartStyle(\"line\")}>\n \n {!props.attachment ? (\n setChartStyle(\"table\")}>\n \n ) : null}\n \n \n\n {!props.onlyLineData && \n \n {props.dataKey != \"result_dashboard\" && props?.years?.map((year) => (\n {\n loadYear(year)\n setLoadedYears({...loadedYears, [year]: true})\n }}>{year} \n ))}\n \n {/* {\n props.loadAllYears\n && props.dataKey != \"result_dashboard\"\n && loadAllYears()}>Todos os anos \n } */}\n }\n
\n {open &&\n chartStyle == \"table\" ?\n {props.title}
\n\n \n
\n
\n | \n {(monthsArray).map((month) => {\n return | {month} | \n })}\n {(!props.dataKey.includes(\"balance\") && (props.formulasTotalByYearYTD || ytdOn())) &&YTD | }\n {!props.dataKey.includes(\"balance\") &&Total | }\n
',\n pointFormat: '\\u25cf {series.name}: {point.y}
',\n backgroundColor: h(\"#f7f7f7\").setOpacity(.85).get(),\n borderWidth: 1,\n shadow: !0,\n style: {\n color: \"#333333\",\n cursor: \"default\",\n fontSize: \"12px\",\n whiteSpace: \"nowrap\"\n }\n },\n credits: {\n enabled: !0,\n href: \"https://www.highcharts.com?credits\",\n position: {\n align: \"right\",\n x: -10,\n verticalAlign: \"bottom\",\n y: -5\n },\n style: {\n cursor: \"pointer\",\n color: \"#999999\",\n fontSize: \"9px\"\n },\n text: \"Highcharts.com\"\n }\n };\n \"\";\n f.time = new m(z(f.defaultOptions.global, f.defaultOptions.time));\n f.dateFormat = function (h, m, y) {\n return f.time.dateFormat(h, m, y);\n };\n return {\n dateFormat: f.dateFormat,\n defaultOptions: f.defaultOptions,\n time: f.time\n };\n });\n N(m, \"Core/Axis/Axis.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Color/Color.js\"], m[\"Core/Globals.js\"], m[\"Core/Axis/Tick.js\"], m[\"Core/Utilities.js\"], m[\"Core/Options.js\"]], function (f, h, m, z, F, L) {\n var K = f.animObject,\n C = F.addEvent,\n y = F.arrayMax,\n e = F.arrayMin,\n I = F.clamp,\n v = F.correctFloat,\n x = F.defined,\n D = F.destroyObjectProperties,\n n = F.error,\n l = F.extend,\n J = F.fireEvent,\n w = F.format,\n r = F.getMagnitude,\n d = F.isArray,\n g = F.isFunction,\n c = F.isNumber,\n a = F.isString,\n q = F.merge,\n p = F.normalizeTickInterval,\n B = F.objectEach,\n A = F.pick,\n G = F.relativeLength,\n M = F.removeEvent,\n T = F.splat,\n Q = F.syncTimeout,\n O = L.defaultOptions,\n E = m.deg2rad;\n f = function () {\n function u(b, k) {\n this.zoomEnabled = this.width = this.visible = this.userOptions = this.translationSlope = this.transB = this.transA = this.top = this.ticks = this.tickRotCorr = this.tickPositions = this.tickmarkOffset = this.tickInterval = this.tickAmount = this.side = this.series = this.right = this.positiveValuesOnly = this.pos = this.pointRangePadding = this.pointRange = this.plotLinesAndBandsGroups = this.plotLinesAndBands = this.paddedTicks = this.overlap = this.options = this.oldMin = this.oldMax = this.offset = this.names = this.minPixelPadding = this.minorTicks = this.minorTickInterval = this.min = this.maxLabelLength = this.max = this.len = this.left = this.labelFormatter = this.labelEdge = this.isLinked = this.height = this.hasVisibleSeries = this.hasNames = this.coll = this.closestPointRange = this.chart = this.categories = this.bottom = this.alternateBands = void 0;\n this.init(b, k);\n }\n u.prototype.init = function (b, k) {\n var a = k.isX,\n c = this;\n c.chart = b;\n c.horiz = b.inverted && !c.isZAxis ? !a : a;\n c.isXAxis = a;\n c.coll = c.coll || (a ? \"xAxis\" : \"yAxis\");\n J(this, \"init\", {\n userOptions: k\n });\n c.opposite = k.opposite;\n c.side = k.side || (c.horiz ? c.opposite ? 0 : 2 : c.opposite ? 1 : 3);\n c.setOptions(k);\n var d = this.options,\n p = d.type;\n c.labelFormatter = d.labels.formatter || c.defaultLabelFormatter;\n c.userOptions = k;\n c.minPixelPadding = 0;\n c.reversed = d.reversed;\n c.visible = !1 !== d.visible;\n c.zoomEnabled = !1 !== d.zoomEnabled;\n c.hasNames = \"category\" === p || !0 === d.categories;\n c.categories = d.categories || c.hasNames;\n c.names || (c.names = [], c.names.keys = {});\n c.plotLinesAndBandsGroups = {};\n c.positiveValuesOnly = !!c.logarithmic;\n c.isLinked = x(d.linkedTo);\n c.ticks = {};\n c.labelEdge = [];\n c.minorTicks = {};\n c.plotLinesAndBands = [];\n c.alternateBands = {};\n c.len = 0;\n c.minRange = c.userMinRange = d.minRange || d.maxZoom;\n c.range = d.range;\n c.offset = d.offset || 0;\n c.max = null;\n c.min = null;\n c.crosshair = A(d.crosshair, T(b.options.tooltip.crosshairs)[a ? 0 : 1], !1);\n k = c.options.events;\n -1 === b.axes.indexOf(c) && (a ? b.axes.splice(b.xAxis.length, 0, c) : b.axes.push(c), b[c.coll].push(c));\n c.series = c.series || [];\n b.inverted && !c.isZAxis && a && \"undefined\" === typeof c.reversed && (c.reversed = !0);\n c.labelRotation = c.options.labels.rotation;\n B(k, function (b, k) {\n g(b) && C(c, k, b);\n });\n J(this, \"afterInit\");\n };\n u.prototype.setOptions = function (b) {\n this.options = q(u.defaultOptions, \"yAxis\" === this.coll && u.defaultYAxisOptions, [u.defaultTopAxisOptions, u.defaultRightAxisOptions, u.defaultBottomAxisOptions, u.defaultLeftAxisOptions][this.side], q(O[this.coll], b));\n J(this, \"afterSetOptions\", {\n userOptions: b\n });\n };\n u.prototype.defaultLabelFormatter = function () {\n var b = this.axis,\n k = c(this.value) ? this.value : NaN,\n a = b.chart.time,\n d = b.categories,\n g = this.dateTimeLabelFormat,\n p = O.lang,\n q = p.numericSymbols;\n p = p.numericSymbolMagnitude || 1E3;\n var e = q && q.length,\n u = b.options.labels.format;\n b = b.logarithmic ? Math.abs(k) : b.tickInterval;\n var B = this.chart,\n l = B.numberFormatter;\n if (u) var A = w(u, this, B);else if (d) A = \"\" + this.value;else if (g) A = a.dateFormat(g, k);else if (e && 1E3 <= b) for (; e-- && \"undefined\" === typeof A;) a = Math.pow(p, e + 1), b >= a && 0 === 10 * k % a && null !== q[e] && 0 !== k && (A = l(k / a, -1) + q[e]);\n \"undefined\" === typeof A && (A = 1E4 <= Math.abs(k) ? l(k, -1) : l(k, -1, void 0, \"\"));\n return A;\n };\n u.prototype.getSeriesExtremes = function () {\n var b = this,\n k = b.chart,\n a;\n J(this, \"getSeriesExtremes\", null, function () {\n b.hasVisibleSeries = !1;\n b.dataMin = b.dataMax = b.threshold = null;\n b.softThreshold = !b.isXAxis;\n b.stacking && b.stacking.buildStacks();\n b.series.forEach(function (t) {\n if (t.visible || !k.options.chart.ignoreHiddenSeries) {\n var d = t.options,\n g = d.threshold;\n b.hasVisibleSeries = !0;\n b.positiveValuesOnly && 0 >= g && (g = null);\n if (b.isXAxis) {\n if (d = t.xData, d.length) {\n d = b.logarithmic ? d.filter(b.validatePositiveValue) : d;\n a = t.getXExtremes(d);\n var p = a.min;\n var q = a.max;\n c(p) || p instanceof Date || (d = d.filter(c), a = t.getXExtremes(d), p = a.min, q = a.max);\n d.length && (b.dataMin = Math.min(A(b.dataMin, p), p), b.dataMax = Math.max(A(b.dataMax, q), q));\n }\n } else if (t = t.applyExtremes(), c(t.dataMin) && (p = t.dataMin, b.dataMin = Math.min(A(b.dataMin, p), p)), c(t.dataMax) && (q = t.dataMax, b.dataMax = Math.max(A(b.dataMax, q), q)), x(g) && (b.threshold = g), !d.softThreshold || b.positiveValuesOnly) b.softThreshold = !1;\n }\n });\n });\n J(this, \"afterGetSeriesExtremes\");\n };\n u.prototype.translate = function (b, a, t, d, g, p) {\n var k = this.linkedParent || this,\n q = 1,\n e = 0,\n H = d ? k.oldTransA : k.transA;\n d = d ? k.oldMin : k.min;\n var u = k.minPixelPadding;\n g = (k.isOrdinal || k.brokenAxis && k.brokenAxis.hasBreaks || k.logarithmic && g) && k.lin2val;\n H || (H = k.transA);\n t && (q *= -1, e = k.len);\n k.reversed && (q *= -1, e -= q * (k.sector || k.len));\n a ? (b = (b * q + e - u) / H + d, g && (b = k.lin2val(b))) : (g && (b = k.val2lin(b)), b = c(d) ? q * (b - d) * H + e + q * u + (c(p) ? H * p : 0) : void 0);\n return b;\n };\n u.prototype.toPixels = function (b, k) {\n return this.translate(b, !1, !this.horiz, null, !0) + (k ? 0 : this.pos);\n };\n u.prototype.toValue = function (b, k) {\n return this.translate(b - (k ? 0 : this.pos), !0, !this.horiz, null, !0);\n };\n u.prototype.getPlotLinePath = function (b) {\n function k(b, a, k) {\n if (\"pass\" !== l && b < a || b > k) l ? b = I(b, a, k) : E = !0;\n return b;\n }\n var a = this,\n d = a.chart,\n g = a.left,\n p = a.top,\n q = b.old,\n e = b.value,\n u = b.translatedValue,\n B = b.lineWidth,\n l = b.force,\n r,\n n,\n f,\n h,\n w = q && d.oldChartHeight || d.chartHeight,\n G = q && d.oldChartWidth || d.chartWidth,\n E,\n v = a.transB;\n b = {\n value: e,\n lineWidth: B,\n old: q,\n force: l,\n acrossPanes: b.acrossPanes,\n translatedValue: u\n };\n J(this, \"getPlotLinePath\", b, function (b) {\n u = A(u, a.translate(e, null, null, q));\n u = I(u, -1E5, 1E5);\n r = f = Math.round(u + v);\n n = h = Math.round(w - u - v);\n c(u) ? a.horiz ? (n = p, h = w - a.bottom, r = f = k(r, g, g + a.width)) : (r = g, f = G - a.right, n = h = k(n, p, p + a.height)) : (E = !0, l = !1);\n b.path = E && !l ? null : d.renderer.crispLine([[\"M\", r, n], [\"L\", f, h]], B || 1);\n });\n return b.path;\n };\n u.prototype.getLinearTickPositions = function (b, a, c) {\n var k = v(Math.floor(a / b) * b);\n c = v(Math.ceil(c / b) * b);\n var t = [],\n d;\n v(k + b) === k && (d = 20);\n if (this.single) return [a];\n for (a = k; a <= c;) {\n t.push(a);\n a = v(a + b, d);\n if (a === g) break;\n var g = a;\n }\n return t;\n };\n u.prototype.getMinorTickInterval = function () {\n var b = this.options;\n return !0 === b.minorTicks ? A(b.minorTickInterval, \"auto\") : !1 === b.minorTicks ? null : b.minorTickInterval;\n };\n u.prototype.getMinorTickPositions = function () {\n var b = this.options,\n a = this.tickPositions,\n c = this.minorTickInterval,\n d = [],\n g = this.pointRangePadding || 0,\n p = this.min - g;\n g = this.max + g;\n var q = g - p;\n if (q && q / c < this.len / 3) {\n var e = this.logarithmic;\n if (e) this.paddedTicks.forEach(function (b, a, k) {\n a && d.push.apply(d, e.getLogTickPositions(c, k[a - 1], k[a], !0));\n });else if (this.dateTime && \"auto\" === this.getMinorTickInterval()) d = d.concat(this.getTimeTicks(this.dateTime.normalizeTimeTickInterval(c), p, g, b.startOfWeek));else for (b = p + (a[0] - p) % c; b <= g && b !== d[0]; b += c) d.push(b);\n }\n 0 !== d.length && this.trimTicks(d);\n return d;\n };\n u.prototype.adjustForMinRange = function () {\n var b = this.options,\n a = this.min,\n c = this.max,\n d = this.logarithmic,\n g,\n p,\n q,\n u,\n B;\n this.isXAxis && \"undefined\" === typeof this.minRange && !d && (x(b.min) || x(b.max) ? this.minRange = null : (this.series.forEach(function (b) {\n u = b.xData;\n for (p = B = b.xIncrement ? 1 : u.length - 1; 0 < p; p--) if (q = u[p] - u[p - 1], \"undefined\" === typeof g || q < g) g = q;\n }), this.minRange = Math.min(5 * g, this.dataMax - this.dataMin)));\n if (c - a < this.minRange) {\n var l = this.dataMax - this.dataMin >= this.minRange;\n var r = this.minRange;\n var n = (r - c + a) / 2;\n n = [a - n, A(b.min, a - n)];\n l && (n[2] = this.logarithmic ? this.logarithmic.log2lin(this.dataMin) : this.dataMin);\n a = y(n);\n c = [a + r, A(b.max, a + r)];\n l && (c[2] = d ? d.log2lin(this.dataMax) : this.dataMax);\n c = e(c);\n c - a < r && (n[0] = c - r, n[1] = A(b.min, c - r), a = y(n));\n }\n this.min = a;\n this.max = c;\n };\n u.prototype.getClosest = function () {\n var b;\n this.categories ? b = 1 : this.series.forEach(function (a) {\n var k = a.closestPointRange,\n c = a.visible || !a.chart.options.chart.ignoreHiddenSeries;\n !a.noSharedTooltip && x(k) && c && (b = x(b) ? Math.min(b, k) : k);\n });\n return b;\n };\n u.prototype.nameToX = function (b) {\n var a = d(this.categories),\n c = a ? this.categories : this.names,\n g = b.options.x;\n b.series.requireSorting = !1;\n x(g) || (g = !1 === this.options.uniqueNames ? b.series.autoIncrement() : a ? c.indexOf(b.name) : A(c.keys[b.name], -1));\n if (-1 === g) {\n if (!a) var p = c.length;\n } else p = g;\n \"undefined\" !== typeof p && (this.names[p] = b.name, this.names.keys[b.name] = p);\n return p;\n };\n u.prototype.updateNames = function () {\n var b = this,\n a = this.names;\n 0 < a.length && (Object.keys(a.keys).forEach(function (b) {\n delete a.keys[b];\n }), a.length = 0, this.minRange = this.userMinRange, (this.series || []).forEach(function (a) {\n a.xIncrement = null;\n if (!a.points || a.isDirtyData) b.max = Math.max(b.max, a.xData.length - 1), a.processData(), a.generatePoints();\n a.data.forEach(function (k, c) {\n if (k && k.options && \"undefined\" !== typeof k.name) {\n var d = b.nameToX(k);\n \"undefined\" !== typeof d && d !== k.x && (k.x = d, a.xData[c] = d);\n }\n });\n }));\n };\n u.prototype.setAxisTranslation = function (b) {\n var k = this,\n c = k.max - k.min,\n d = k.axisPointRange || 0,\n g = 0,\n p = 0,\n q = k.linkedParent,\n e = !!k.categories,\n u = k.transA,\n B = k.isXAxis;\n if (B || e || d) {\n var l = k.getClosest();\n q ? (g = q.minPointOffset, p = q.pointRangePadding) : k.series.forEach(function (b) {\n var c = e ? 1 : B ? A(b.options.pointRange, l, 0) : k.axisPointRange || 0,\n t = b.options.pointPlacement;\n d = Math.max(d, c);\n if (!k.single || e) b = b.is(\"xrange\") ? !B : B, g = Math.max(g, b && a(t) ? 0 : c / 2), p = Math.max(p, b && \"on\" === t ? 0 : c);\n });\n q = k.ordinal && k.ordinal.slope && l ? k.ordinal.slope / l : 1;\n k.minPointOffset = g *= q;\n k.pointRangePadding = p *= q;\n k.pointRange = Math.min(d, k.single && e ? 1 : c);\n B && (k.closestPointRange = l);\n }\n b && (k.oldTransA = u);\n k.translationSlope = k.transA = u = k.staticScale || k.len / (c + p || 1);\n k.transB = k.horiz ? k.left : k.bottom;\n k.minPixelPadding = u * g;\n J(this, \"afterSetAxisTranslation\");\n };\n u.prototype.minFromRange = function () {\n return this.max - this.range;\n };\n u.prototype.setTickInterval = function (b) {\n var a = this,\n d = a.chart,\n g = a.logarithmic,\n q = a.options,\n e = a.isXAxis,\n u = a.isLinked,\n B = q.maxPadding,\n l = q.minPadding,\n f = q.tickInterval,\n h = q.tickPixelInterval,\n w = a.categories,\n G = c(a.threshold) ? a.threshold : null,\n E = a.softThreshold;\n a.dateTime || w || u || this.getTickAmount();\n var O = A(a.userMin, q.min);\n var D = A(a.userMax, q.max);\n if (u) {\n a.linkedParent = d[a.coll][q.linkedTo];\n var M = a.linkedParent.getExtremes();\n a.min = A(M.min, M.dataMin);\n a.max = A(M.max, M.dataMax);\n q.type !== a.linkedParent.options.type && n(11, 1, d);\n } else {\n if (E && x(G)) if (a.dataMin >= G) M = G, l = 0;else if (a.dataMax <= G) {\n var m = G;\n B = 0;\n }\n a.min = A(O, M, a.dataMin);\n a.max = A(D, m, a.dataMax);\n }\n g && (a.positiveValuesOnly && !b && 0 >= Math.min(a.min, A(a.dataMin, a.min)) && n(10, 1, d), a.min = v(g.log2lin(a.min), 16), a.max = v(g.log2lin(a.max), 16));\n a.range && x(a.max) && (a.userMin = a.min = O = Math.max(a.dataMin, a.minFromRange()), a.userMax = D = a.max, a.range = null);\n J(a, \"foundExtremes\");\n a.beforePadding && a.beforePadding();\n a.adjustForMinRange();\n !(w || a.axisPointRange || a.stacking && a.stacking.usePercentage || u) && x(a.min) && x(a.max) && (d = a.max - a.min) && (!x(O) && l && (a.min -= d * l), !x(D) && B && (a.max += d * B));\n c(a.userMin) || (c(q.softMin) && q.softMin < a.min && (a.min = O = q.softMin), c(q.floor) && (a.min = Math.max(a.min, q.floor)));\n c(a.userMax) || (c(q.softMax) && q.softMax > a.max && (a.max = D = q.softMax), c(q.ceiling) && (a.max = Math.min(a.max, q.ceiling)));\n E && x(a.dataMin) && (G = G || 0, !x(O) && a.min < G && a.dataMin >= G ? a.min = a.options.minRange ? Math.min(G, a.max - a.minRange) : G : !x(D) && a.max > G && a.dataMax <= G && (a.max = a.options.minRange ? Math.max(G, a.min + a.minRange) : G));\n a.tickInterval = a.min === a.max || \"undefined\" === typeof a.min || \"undefined\" === typeof a.max ? 1 : u && !f && h === a.linkedParent.options.tickPixelInterval ? f = a.linkedParent.tickInterval : A(f, this.tickAmount ? (a.max - a.min) / Math.max(this.tickAmount - 1, 1) : void 0, w ? 1 : (a.max - a.min) * h / Math.max(a.len, h));\n e && !b && a.series.forEach(function (b) {\n b.processData(a.min !== a.oldMin || a.max !== a.oldMax);\n });\n a.setAxisTranslation(!0);\n J(this, \"initialAxisTranslation\");\n a.pointRange && !f && (a.tickInterval = Math.max(a.pointRange, a.tickInterval));\n b = A(q.minTickInterval, a.dateTime && !a.series.some(function (b) {\n return b.noSharedTooltip;\n }) ? a.closestPointRange : 0);\n !f && a.tickInterval < b && (a.tickInterval = b);\n a.dateTime || a.logarithmic || f || (a.tickInterval = p(a.tickInterval, void 0, r(a.tickInterval), A(q.allowDecimals, .5 > a.tickInterval || void 0 !== this.tickAmount), !!this.tickAmount));\n this.tickAmount || (a.tickInterval = a.unsquish());\n this.setTickPositions();\n };\n u.prototype.setTickPositions = function () {\n var b = this.options,\n a = b.tickPositions;\n var c = this.getMinorTickInterval();\n var d = b.tickPositioner,\n g = this.hasVerticalPanning(),\n p = \"colorAxis\" === this.coll,\n q = (p || !g) && b.startOnTick;\n g = (p || !g) && b.endOnTick;\n this.tickmarkOffset = this.categories && \"between\" === b.tickmarkPlacement && 1 === this.tickInterval ? .5 : 0;\n this.minorTickInterval = \"auto\" === c && this.tickInterval ? this.tickInterval / 5 : c;\n this.single = this.min === this.max && x(this.min) && !this.tickAmount && (parseInt(this.min, 10) === this.min || !1 !== b.allowDecimals);\n this.tickPositions = c = a && a.slice();\n !c && (this.ordinal && this.ordinal.positions || !((this.max - this.min) / this.tickInterval > Math.max(2 * this.len, 200)) ? c = this.dateTime ? this.getTimeTicks(this.dateTime.normalizeTimeTickInterval(this.tickInterval, b.units), this.min, this.max, b.startOfWeek, this.ordinal && this.ordinal.positions, this.closestPointRange, !0) : this.logarithmic ? this.logarithmic.getLogTickPositions(this.tickInterval, this.min, this.max) : this.getLinearTickPositions(this.tickInterval, this.min, this.max) : (c = [this.min, this.max], n(19, !1, this.chart)), c.length > this.len && (c = [c[0], c.pop()], c[0] === c[1] && (c.length = 1)), this.tickPositions = c, d && (d = d.apply(this, [this.min, this.max]))) && (this.tickPositions = c = d);\n this.paddedTicks = c.slice(0);\n this.trimTicks(c, q, g);\n this.isLinked || (this.single && 2 > c.length && !this.categories && !this.series.some(function (b) {\n return b.is(\"heatmap\") && \"between\" === b.options.pointPlacement;\n }) && (this.min -= .5, this.max += .5), a || d || this.adjustTickAmount());\n J(this, \"afterSetTickPositions\");\n };\n u.prototype.trimTicks = function (b, a, c) {\n var k = b[0],\n d = b[b.length - 1],\n t = !this.isOrdinal && this.minPointOffset || 0;\n J(this, \"trimTicks\");\n if (!this.isLinked) {\n if (a && -Infinity !== k) this.min = k;else for (; this.min - t > b[0];) b.shift();\n if (c) this.max = d;else for (; this.max + t < b[b.length - 1];) b.pop();\n 0 === b.length && x(k) && !this.options.tickPositions && b.push((d + k) / 2);\n }\n };\n u.prototype.alignToOthers = function () {\n var b = {},\n a,\n c = this.options;\n !1 === this.chart.options.chart.alignTicks || !1 === c.alignTicks || !1 === c.startOnTick || !1 === c.endOnTick || this.logarithmic || this.chart[this.coll].forEach(function (k) {\n var c = k.options;\n c = [k.horiz ? c.left : c.top, c.width, c.height, c.pane].join();\n k.series.length && (b[c] ? a = !0 : b[c] = 1);\n });\n return a;\n };\n u.prototype.getTickAmount = function () {\n var b = this.options,\n a = b.tickAmount,\n c = b.tickPixelInterval;\n !x(b.tickInterval) && !a && this.len < c && !this.isRadial && !this.logarithmic && b.startOnTick && b.endOnTick && (a = 2);\n !a && this.alignToOthers() && (a = Math.ceil(this.len / c) + 1);\n 4 > a && (this.finalTickAmt = a, a = 5);\n this.tickAmount = a;\n };\n u.prototype.adjustTickAmount = function () {\n var b = this.options,\n a = this.tickInterval,\n c = this.tickPositions,\n d = this.tickAmount,\n g = this.finalTickAmt,\n p = c && c.length,\n q = A(this.threshold, this.softThreshold ? 0 : null),\n e;\n if (this.hasData()) {\n if (p < d) {\n for (e = this.min; c.length < d;) c.length % 2 || e === q ? c.push(v(c[c.length - 1] + a)) : c.unshift(v(c[0] - a));\n this.transA *= (p - 1) / (d - 1);\n this.min = b.startOnTick ? c[0] : Math.min(this.min, c[0]);\n this.max = b.endOnTick ? c[c.length - 1] : Math.max(this.max, c[c.length - 1]);\n } else p > d && (this.tickInterval *= 2, this.setTickPositions());\n if (x(g)) {\n for (a = b = c.length; a--;) (3 === g && 1 === a % 2 || 2 >= g && 0 < a && a < b - 1) && c.splice(a, 1);\n this.finalTickAmt = void 0;\n }\n }\n };\n u.prototype.setScale = function () {\n var b,\n a = !1,\n c = !1;\n this.series.forEach(function (b) {\n var k;\n a = a || b.isDirtyData || b.isDirty;\n c = c || (null === (k = b.xAxis) || void 0 === k ? void 0 : k.isDirty) || !1;\n });\n this.oldMin = this.min;\n this.oldMax = this.max;\n this.oldAxisLength = this.len;\n this.setAxisSize();\n (b = this.len !== this.oldAxisLength) || a || c || this.isLinked || this.forceRedraw || this.userMin !== this.oldUserMin || this.userMax !== this.oldUserMax || this.alignToOthers() ? (this.stacking && this.stacking.resetStacks(), this.forceRedraw = !1, this.getSeriesExtremes(), this.setTickInterval(), this.oldUserMin = this.userMin, this.oldUserMax = this.userMax, this.isDirty || (this.isDirty = b || this.min !== this.oldMin || this.max !== this.oldMax)) : this.stacking && this.stacking.cleanStacks();\n a && this.panningState && (this.panningState.isDirty = !0);\n J(this, \"afterSetScale\");\n };\n u.prototype.setExtremes = function (b, a, c, d, g) {\n var k = this,\n t = k.chart;\n c = A(c, !0);\n k.series.forEach(function (b) {\n delete b.kdTree;\n });\n g = l(g, {\n min: b,\n max: a\n });\n J(k, \"setExtremes\", g, function () {\n k.userMin = b;\n k.userMax = a;\n k.eventArgs = g;\n c && t.redraw(d);\n });\n };\n u.prototype.zoom = function (b, a) {\n var k = this,\n c = this.dataMin,\n d = this.dataMax,\n g = this.options,\n p = Math.min(c, A(g.min, c)),\n q = Math.max(d, A(g.max, d));\n b = {\n newMin: b,\n newMax: a\n };\n J(this, \"zoom\", b, function (b) {\n var a = b.newMin,\n g = b.newMax;\n if (a !== k.min || g !== k.max) k.allowZoomOutside || (x(c) && (a < p && (a = p), a > q && (a = q)), x(d) && (g < p && (g = p), g > q && (g = q))), k.displayBtn = \"undefined\" !== typeof a || \"undefined\" !== typeof g, k.setExtremes(a, g, !1, void 0, {\n trigger: \"zoom\"\n });\n b.zoomed = !0;\n });\n return b.zoomed;\n };\n u.prototype.setAxisSize = function () {\n var b = this.chart,\n a = this.options,\n c = a.offsets || [0, 0, 0, 0],\n d = this.horiz,\n g = this.width = Math.round(G(A(a.width, b.plotWidth - c[3] + c[1]), b.plotWidth)),\n p = this.height = Math.round(G(A(a.height, b.plotHeight - c[0] + c[2]), b.plotHeight)),\n q = this.top = Math.round(G(A(a.top, b.plotTop + c[0]), b.plotHeight, b.plotTop));\n a = this.left = Math.round(G(A(a.left, b.plotLeft + c[3]), b.plotWidth, b.plotLeft));\n this.bottom = b.chartHeight - p - q;\n this.right = b.chartWidth - g - a;\n this.len = Math.max(d ? g : p, 0);\n this.pos = d ? a : q;\n };\n u.prototype.getExtremes = function () {\n var b = this.logarithmic;\n return {\n min: b ? v(b.lin2log(this.min)) : this.min,\n max: b ? v(b.lin2log(this.max)) : this.max,\n dataMin: this.dataMin,\n dataMax: this.dataMax,\n userMin: this.userMin,\n userMax: this.userMax\n };\n };\n u.prototype.getThreshold = function (b) {\n var a = this.logarithmic,\n c = a ? a.lin2log(this.min) : this.min;\n a = a ? a.lin2log(this.max) : this.max;\n null === b || -Infinity === b ? b = c : Infinity === b ? b = a : c > b ? b = c : a < b && (b = a);\n return this.translate(b, 0, 1, 0, 1);\n };\n u.prototype.autoLabelAlign = function (b) {\n var a = (A(b, 0) - 90 * this.side + 720) % 360;\n b = {\n align: \"center\"\n };\n J(this, \"autoLabelAlign\", b, function (b) {\n 15 < a && 165 > a ? b.align = \"right\" : 195 < a && 345 > a && (b.align = \"left\");\n });\n return b.align;\n };\n u.prototype.tickSize = function (b) {\n var a = this.options,\n c = a[\"tick\" === b ? \"tickLength\" : \"minorTickLength\"],\n d = A(a[\"tick\" === b ? \"tickWidth\" : \"minorTickWidth\"], \"tick\" === b && this.isXAxis && !this.categories ? 1 : 0);\n if (d && c) {\n \"inside\" === a[b + \"Position\"] && (c = -c);\n var g = [c, d];\n }\n b = {\n tickSize: g\n };\n J(this, \"afterTickSize\", b);\n return b.tickSize;\n };\n u.prototype.labelMetrics = function () {\n var b = this.tickPositions && this.tickPositions[0] || 0;\n return this.chart.renderer.fontMetrics(this.options.labels.style && this.options.labels.style.fontSize, this.ticks[b] && this.ticks[b].label);\n };\n u.prototype.unsquish = function () {\n var b = this.options.labels,\n a = this.horiz,\n c = this.tickInterval,\n d = c,\n g = this.len / (((this.categories ? 1 : 0) + this.max - this.min) / c),\n p,\n q = b.rotation,\n e = this.labelMetrics(),\n u,\n B = Number.MAX_VALUE,\n l,\n r = this.max - this.min,\n n = function (b) {\n var a = b / (g || 1);\n a = 1 < a ? Math.ceil(a) : 1;\n a * c > r && Infinity !== b && Infinity !== g && r && (a = Math.ceil(r / c));\n return v(a * c);\n };\n a ? (l = !b.staggerLines && !b.step && (x(q) ? [q] : g < A(b.autoRotationLimit, 80) && b.autoRotation)) && l.forEach(function (b) {\n if (b === q || b && -90 <= b && 90 >= b) {\n u = n(Math.abs(e.h / Math.sin(E * b)));\n var a = u + Math.abs(b / 360);\n a < B && (B = a, p = b, d = u);\n }\n }) : b.step || (d = n(e.h));\n this.autoRotation = l;\n this.labelRotation = A(p, q);\n return d;\n };\n u.prototype.getSlotWidth = function (b) {\n var a,\n d = this.chart,\n g = this.horiz,\n p = this.options.labels,\n q = Math.max(this.tickPositions.length - (this.categories ? 0 : 1), 1),\n e = d.margin[3];\n if (b && c(b.slotWidth)) return b.slotWidth;\n if (g && p && 2 > (p.step || 0)) return p.rotation ? 0 : (this.staggerLines || 1) * this.len / q;\n if (!g) {\n b = null === (a = null === p || void 0 === p ? void 0 : p.style) || void 0 === a ? void 0 : a.width;\n if (void 0 !== b) return parseInt(b, 10);\n if (e) return e - d.spacing[3];\n }\n return .33 * d.chartWidth;\n };\n u.prototype.renderUnsquish = function () {\n var b = this.chart,\n k = b.renderer,\n c = this.tickPositions,\n d = this.ticks,\n g = this.options.labels,\n p = g && g.style || {},\n q = this.horiz,\n e = this.getSlotWidth(),\n u = Math.max(1, Math.round(e - 2 * (g.padding || 5))),\n B = {},\n l = this.labelMetrics(),\n r = g.style && g.style.textOverflow,\n n = 0;\n a(g.rotation) || (B.rotation = g.rotation || 0);\n c.forEach(function (b) {\n b = d[b];\n b.movedLabel && b.replaceMovedLabel();\n b && b.label && b.label.textPxLength > n && (n = b.label.textPxLength);\n });\n this.maxLabelLength = n;\n if (this.autoRotation) n > u && n > l.h ? B.rotation = this.labelRotation : this.labelRotation = 0;else if (e) {\n var A = u;\n if (!r) {\n var f = \"clip\";\n for (u = c.length; !q && u--;) {\n var h = c[u];\n if (h = d[h].label) h.styles && \"ellipsis\" === h.styles.textOverflow ? h.css({\n textOverflow: \"clip\"\n }) : h.textPxLength > e && h.css({\n width: e + \"px\"\n }), h.getBBox().height > this.len / c.length - (l.h - l.f) && (h.specificTextOverflow = \"ellipsis\");\n }\n }\n }\n B.rotation && (A = n > .5 * b.chartHeight ? .33 * b.chartHeight : n, r || (f = \"ellipsis\"));\n if (this.labelAlign = g.align || this.autoLabelAlign(this.labelRotation)) B.align = this.labelAlign;\n c.forEach(function (b) {\n var a = (b = d[b]) && b.label,\n k = p.width,\n c = {};\n a && (a.attr(B), b.shortenLabel ? b.shortenLabel() : A && !k && \"nowrap\" !== p.whiteSpace && (A < a.textPxLength || \"SPAN\" === a.element.tagName) ? (c.width = A + \"px\", r || (c.textOverflow = a.specificTextOverflow || f), a.css(c)) : a.styles && a.styles.width && !c.width && !k && a.css({\n width: null\n }), delete a.specificTextOverflow, b.rotation = B.rotation);\n }, this);\n this.tickRotCorr = k.rotCorr(l.b, this.labelRotation || 0, 0 !== this.side);\n };\n u.prototype.hasData = function () {\n return this.series.some(function (b) {\n return b.hasData();\n }) || this.options.showEmpty && x(this.min) && x(this.max);\n };\n u.prototype.addTitle = function (b) {\n var a = this.chart.renderer,\n c = this.horiz,\n d = this.opposite,\n g = this.options.title,\n p,\n e = this.chart.styledMode;\n this.axisTitle || ((p = g.textAlign) || (p = (c ? {\n low: \"left\",\n middle: \"center\",\n high: \"right\"\n } : {\n low: d ? \"right\" : \"left\",\n middle: \"center\",\n high: d ? \"left\" : \"right\"\n })[g.align]), this.axisTitle = a.text(g.text, 0, 0, g.useHTML).attr({\n zIndex: 7,\n rotation: g.rotation || 0,\n align: p\n }).addClass(\"highcharts-axis-title\"), e || this.axisTitle.css(q(g.style)), this.axisTitle.add(this.axisGroup), this.axisTitle.isNew = !0);\n e || g.style.width || this.isRadial || this.axisTitle.css({\n width: this.len + \"px\"\n });\n this.axisTitle[b ? \"show\" : \"hide\"](b);\n };\n u.prototype.generateTick = function (b) {\n var a = this.ticks;\n a[b] ? a[b].addLabel() : a[b] = new z(this, b);\n };\n u.prototype.getOffset = function () {\n var b = this,\n a = b.chart,\n c = a.renderer,\n d = b.options,\n g = b.tickPositions,\n p = b.ticks,\n q = b.horiz,\n e = b.side,\n u = a.inverted && !b.isZAxis ? [1, 0, 3, 2][e] : e,\n l,\n n = 0,\n r = 0,\n f = d.title,\n h = d.labels,\n G = 0,\n w = a.axisOffset;\n a = a.clipOffset;\n var E = [-1, 1, 1, -1][e],\n v = d.className,\n O = b.axisParent;\n var D = b.hasData();\n b.showAxis = l = D || A(d.showEmpty, !0);\n b.staggerLines = b.horiz && h.staggerLines;\n b.axisGroup || (b.gridGroup = c.g(\"grid\").attr({\n zIndex: d.gridZIndex || 1\n }).addClass(\"highcharts-\" + this.coll.toLowerCase() + \"-grid \" + (v || \"\")).add(O), b.axisGroup = c.g(\"axis\").attr({\n zIndex: d.zIndex || 2\n }).addClass(\"highcharts-\" + this.coll.toLowerCase() + \" \" + (v || \"\")).add(O), b.labelGroup = c.g(\"axis-labels\").attr({\n zIndex: h.zIndex || 7\n }).addClass(\"highcharts-\" + b.coll.toLowerCase() + \"-labels \" + (v || \"\")).add(O));\n D || b.isLinked ? (g.forEach(function (a, c) {\n b.generateTick(a, c);\n }), b.renderUnsquish(), b.reserveSpaceDefault = 0 === e || 2 === e || {\n 1: \"left\",\n 3: \"right\"\n }[e] === b.labelAlign, A(h.reserveSpace, \"center\" === b.labelAlign ? !0 : null, b.reserveSpaceDefault) && g.forEach(function (b) {\n G = Math.max(p[b].getLabelSize(), G);\n }), b.staggerLines && (G *= b.staggerLines), b.labelOffset = G * (b.opposite ? -1 : 1)) : B(p, function (b, a) {\n b.destroy();\n delete p[a];\n });\n if (f && f.text && !1 !== f.enabled && (b.addTitle(l), l && !1 !== f.reserveSpace)) {\n b.titleOffset = n = b.axisTitle.getBBox()[q ? \"height\" : \"width\"];\n var M = f.offset;\n r = x(M) ? 0 : A(f.margin, q ? 5 : 10);\n }\n b.renderLine();\n b.offset = E * A(d.offset, w[e] ? w[e] + (d.margin || 0) : 0);\n b.tickRotCorr = b.tickRotCorr || {\n x: 0,\n y: 0\n };\n c = 0 === e ? -b.labelMetrics().h : 2 === e ? b.tickRotCorr.y : 0;\n r = Math.abs(G) + r;\n G && (r = r - c + E * (q ? A(h.y, b.tickRotCorr.y + 8 * E) : h.x));\n b.axisTitleMargin = A(M, r);\n b.getMaxLabelDimensions && (b.maxLabelDimensions = b.getMaxLabelDimensions(p, g));\n q = this.tickSize(\"tick\");\n w[e] = Math.max(w[e], b.axisTitleMargin + n + E * b.offset, r, g && g.length && q ? q[0] + E * b.offset : 0);\n d = d.offset ? 0 : 2 * Math.floor(b.axisLine.strokeWidth() / 2);\n a[u] = Math.max(a[u], d);\n J(this, \"afterGetOffset\");\n };\n u.prototype.getLinePath = function (b) {\n var a = this.chart,\n c = this.opposite,\n d = this.offset,\n g = this.horiz,\n p = this.left + (c ? this.width : 0) + d;\n d = a.chartHeight - this.bottom - (c ? this.height : 0) + d;\n c && (b *= -1);\n return a.renderer.crispLine([[\"M\", g ? this.left : p, g ? d : this.top], [\"L\", g ? a.chartWidth - this.right : p, g ? d : a.chartHeight - this.bottom]], b);\n };\n u.prototype.renderLine = function () {\n this.axisLine || (this.axisLine = this.chart.renderer.path().addClass(\"highcharts-axis-line\").add(this.axisGroup), this.chart.styledMode || this.axisLine.attr({\n stroke: this.options.lineColor,\n \"stroke-width\": this.options.lineWidth,\n zIndex: 7\n }));\n };\n u.prototype.getTitlePosition = function () {\n var b = this.horiz,\n a = this.left,\n c = this.top,\n d = this.len,\n g = this.options.title,\n p = b ? a : c,\n q = this.opposite,\n e = this.offset,\n u = g.x || 0,\n B = g.y || 0,\n l = this.axisTitle,\n r = this.chart.renderer.fontMetrics(g.style && g.style.fontSize, l);\n l = Math.max(l.getBBox(null, 0).height - r.h - 1, 0);\n d = {\n low: p + (b ? 0 : d),\n middle: p + d / 2,\n high: p + (b ? d : 0)\n }[g.align];\n a = (b ? c + this.height : a) + (b ? 1 : -1) * (q ? -1 : 1) * this.axisTitleMargin + [-l, l, r.f, -l][this.side];\n b = {\n x: b ? d + u : a + (q ? this.width : 0) + e + u,\n y: b ? a + B - (q ? this.height : 0) + e : d + B\n };\n J(this, \"afterGetTitlePosition\", {\n titlePosition: b\n });\n return b;\n };\n u.prototype.renderMinorTick = function (b) {\n var a = this.chart.hasRendered && c(this.oldMin),\n d = this.minorTicks;\n d[b] || (d[b] = new z(this, b, \"minor\"));\n a && d[b].isNew && d[b].render(null, !0);\n d[b].render(null, !1, 1);\n };\n u.prototype.renderTick = function (b, a) {\n var k,\n d = this.isLinked,\n g = this.ticks,\n p = this.chart.hasRendered && c(this.oldMin);\n if (!d || b >= this.min && b <= this.max || (null === (k = this.grid) || void 0 === k ? 0 : k.isColumn)) g[b] || (g[b] = new z(this, b)), p && g[b].isNew && g[b].render(a, !0, -1), g[b].render(a);\n };\n u.prototype.render = function () {\n var b = this,\n a = b.chart,\n d = b.logarithmic,\n g = b.options,\n p = b.isLinked,\n q = b.tickPositions,\n e = b.axisTitle,\n u = b.ticks,\n l = b.minorTicks,\n r = b.alternateBands,\n n = g.stackLabels,\n f = g.alternateGridColor,\n A = b.tickmarkOffset,\n h = b.axisLine,\n G = b.showAxis,\n w = K(a.renderer.globalAnimation),\n E,\n v;\n b.labelEdge.length = 0;\n b.overlap = !1;\n [u, l, r].forEach(function (b) {\n B(b, function (b) {\n b.isActive = !1;\n });\n });\n if (b.hasData() || p) b.minorTickInterval && !b.categories && b.getMinorTickPositions().forEach(function (a) {\n b.renderMinorTick(a);\n }), q.length && (q.forEach(function (a, c) {\n b.renderTick(a, c);\n }), A && (0 === b.min || b.single) && (u[-1] || (u[-1] = new z(b, -1, null, !0)), u[-1].render(-1))), f && q.forEach(function (c, k) {\n v = \"undefined\" !== typeof q[k + 1] ? q[k + 1] + A : b.max - A;\n 0 === k % 2 && c < b.max && v <= b.max + (a.polar ? -A : A) && (r[c] || (r[c] = new m.PlotLineOrBand(b)), E = c + A, r[c].options = {\n from: d ? d.lin2log(E) : E,\n to: d ? d.lin2log(v) : v,\n color: f,\n className: \"highcharts-alternate-grid\"\n }, r[c].render(), r[c].isActive = !0);\n }), b._addedPlotLB || ((g.plotLines || []).concat(g.plotBands || []).forEach(function (a) {\n b.addPlotBandOrLine(a);\n }), b._addedPlotLB = !0);\n [u, l, r].forEach(function (b) {\n var c,\n k = [],\n d = w.duration;\n B(b, function (b, a) {\n b.isActive || (b.render(a, !1, 0), b.isActive = !1, k.push(a));\n });\n Q(function () {\n for (c = k.length; c--;) b[k[c]] && !b[k[c]].isActive && (b[k[c]].destroy(), delete b[k[c]]);\n }, b !== r && a.hasRendered && d ? d : 0);\n });\n h && (h[h.isPlaced ? \"animate\" : \"attr\"]({\n d: this.getLinePath(h.strokeWidth())\n }), h.isPlaced = !0, h[G ? \"show\" : \"hide\"](G));\n e && G && (g = b.getTitlePosition(), c(g.y) ? (e[e.isNew ? \"attr\" : \"animate\"](g), e.isNew = !1) : (e.attr(\"y\", -9999), e.isNew = !0));\n n && n.enabled && b.stacking && b.stacking.renderStackTotals();\n b.isDirty = !1;\n J(this, \"afterRender\");\n };\n u.prototype.redraw = function () {\n this.visible && (this.render(), this.plotLinesAndBands.forEach(function (b) {\n b.render();\n }));\n this.series.forEach(function (b) {\n b.isDirty = !0;\n });\n };\n u.prototype.getKeepProps = function () {\n return this.keepProps || u.keepProps;\n };\n u.prototype.destroy = function (b) {\n var a = this,\n c = a.plotLinesAndBands,\n d;\n J(this, \"destroy\", {\n keepEvents: b\n });\n b || M(a);\n [a.ticks, a.minorTicks, a.alternateBands].forEach(function (b) {\n D(b);\n });\n if (c) for (b = c.length; b--;) c[b].destroy();\n \"axisLine axisTitle axisGroup gridGroup labelGroup cross scrollbar\".split(\" \").forEach(function (b) {\n a[b] && (a[b] = a[b].destroy());\n });\n for (d in a.plotLinesAndBandsGroups) a.plotLinesAndBandsGroups[d] = a.plotLinesAndBandsGroups[d].destroy();\n B(a, function (b, c) {\n -1 === a.getKeepProps().indexOf(c) && delete a[c];\n });\n };\n u.prototype.drawCrosshair = function (b, a) {\n var c = this.crosshair,\n k = A(c.snap, !0),\n d,\n g = this.cross,\n p = this.chart;\n J(this, \"drawCrosshair\", {\n e: b,\n point: a\n });\n b || (b = this.cross && this.cross.e);\n if (this.crosshair && !1 !== (x(a) || !k)) {\n k ? x(a) && (d = A(\"colorAxis\" !== this.coll ? a.crosshairPos : null, this.isXAxis ? a.plotX : this.len - a.plotY)) : d = b && (this.horiz ? b.chartX - this.pos : this.len - b.chartY + this.pos);\n if (x(d)) {\n var q = {\n value: a && (this.isXAxis ? a.x : A(a.stackY, a.y)),\n translatedValue: d\n };\n p.polar && l(q, {\n isCrosshair: !0,\n chartX: b && b.chartX,\n chartY: b && b.chartY,\n point: a\n });\n q = this.getPlotLinePath(q) || null;\n }\n if (!x(q)) {\n this.hideCrosshair();\n return;\n }\n k = this.categories && !this.isRadial;\n g || (this.cross = g = p.renderer.path().addClass(\"highcharts-crosshair highcharts-crosshair-\" + (k ? \"category \" : \"thin \") + c.className).attr({\n zIndex: A(c.zIndex, 2)\n }).add(), p.styledMode || (g.attr({\n stroke: c.color || (k ? h.parse(\"#ccd6eb\").setOpacity(.25).get() : \"#cccccc\"),\n \"stroke-width\": A(c.width, 1)\n }).css({\n \"pointer-events\": \"none\"\n }), c.dashStyle && g.attr({\n dashstyle: c.dashStyle\n })));\n g.show().attr({\n d: q\n });\n k && !c.width && g.attr({\n \"stroke-width\": this.transA\n });\n this.cross.e = b;\n } else this.hideCrosshair();\n J(this, \"afterDrawCrosshair\", {\n e: b,\n point: a\n });\n };\n u.prototype.hideCrosshair = function () {\n this.cross && this.cross.hide();\n J(this, \"afterHideCrosshair\");\n };\n u.prototype.hasVerticalPanning = function () {\n var b, a;\n return /y/.test((null === (a = null === (b = this.chart.options.chart) || void 0 === b ? void 0 : b.panning) || void 0 === a ? void 0 : a.type) || \"\");\n };\n u.prototype.validatePositiveValue = function (b) {\n return c(b) && 0 < b;\n };\n u.defaultOptions = {\n dateTimeLabelFormats: {\n millisecond: {\n main: \"%H:%M:%S.%L\",\n range: !1\n },\n second: {\n main: \"%H:%M:%S\",\n range: !1\n },\n minute: {\n main: \"%H:%M\",\n range: !1\n },\n hour: {\n main: \"%H:%M\",\n range: !1\n },\n day: {\n main: \"%e. %b\"\n },\n week: {\n main: \"%e. %b\"\n },\n month: {\n main: \"%b '%y\"\n },\n year: {\n main: \"%Y\"\n }\n },\n endOnTick: !1,\n labels: {\n enabled: !0,\n indentation: 10,\n x: 0,\n style: {\n color: \"#666666\",\n cursor: \"default\",\n fontSize: \"11px\"\n }\n },\n maxPadding: .01,\n minorTickLength: 2,\n minorTickPosition: \"outside\",\n minPadding: .01,\n showEmpty: !0,\n startOfWeek: 1,\n startOnTick: !1,\n tickLength: 10,\n tickPixelInterval: 100,\n tickmarkPlacement: \"between\",\n tickPosition: \"outside\",\n title: {\n align: \"middle\",\n style: {\n color: \"#666666\"\n }\n },\n type: \"linear\",\n minorGridLineColor: \"#f2f2f2\",\n minorGridLineWidth: 1,\n minorTickColor: \"#999999\",\n lineColor: \"#ccd6eb\",\n lineWidth: 1,\n gridLineColor: \"#e6e6e6\",\n tickColor: \"#ccd6eb\"\n };\n u.defaultYAxisOptions = {\n endOnTick: !0,\n maxPadding: .05,\n minPadding: .05,\n tickPixelInterval: 72,\n showLastLabel: !0,\n labels: {\n x: -8\n },\n startOnTick: !0,\n title: {\n rotation: 270,\n text: \"Values\"\n },\n stackLabels: {\n animation: {},\n allowOverlap: !1,\n enabled: !1,\n crop: !0,\n overflow: \"justify\",\n formatter: function () {\n var b = this.axis.chart.numberFormatter;\n return b(this.total, -1);\n },\n style: {\n color: \"#000000\",\n fontSize: \"11px\",\n fontWeight: \"bold\",\n textOutline: \"1px contrast\"\n }\n },\n gridLineWidth: 1,\n lineWidth: 0\n };\n u.defaultLeftAxisOptions = {\n labels: {\n x: -15\n },\n title: {\n rotation: 270\n }\n };\n u.defaultRightAxisOptions = {\n labels: {\n x: 15\n },\n title: {\n rotation: 90\n }\n };\n u.defaultBottomAxisOptions = {\n labels: {\n autoRotation: [-45],\n x: 0\n },\n margin: 15,\n title: {\n rotation: 0\n }\n };\n u.defaultTopAxisOptions = {\n labels: {\n autoRotation: [-45],\n x: 0\n },\n margin: 15,\n title: {\n rotation: 0\n }\n };\n u.keepProps = \"extKey hcEvents names series userMax userMin\".split(\" \");\n return u;\n }();\n m.Axis = f;\n return m.Axis;\n });\n N(m, \"Core/Axis/DateTimeAxis.js\", [m[\"Core/Axis/Axis.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = h.addEvent,\n z = h.getMagnitude,\n F = h.normalizeTickInterval,\n L = h.timeUnits,\n K = function () {\n function f(f) {\n this.axis = f;\n }\n f.prototype.normalizeTimeTickInterval = function (f, e) {\n var h = e || [[\"millisecond\", [1, 2, 5, 10, 20, 25, 50, 100, 200, 500]], [\"second\", [1, 2, 5, 10, 15, 30]], [\"minute\", [1, 2, 5, 10, 15, 30]], [\"hour\", [1, 2, 3, 4, 6, 8, 12]], [\"day\", [1, 2]], [\"week\", [1, 2]], [\"month\", [1, 2, 3, 4, 6]], [\"year\", null]];\n e = h[h.length - 1];\n var v = L[e[0]],\n x = e[1],\n D;\n for (D = 0; D < h.length && !(e = h[D], v = L[e[0]], x = e[1], h[D + 1] && f <= (v * x[x.length - 1] + L[h[D + 1][0]]) / 2); D++);\n v === L.year && f < 5 * v && (x = [1, 2, 5]);\n f = F(f / v, x, \"year\" === e[0] ? Math.max(z(f / v), 1) : 1);\n return {\n unitRange: v,\n count: f,\n unitName: e[0]\n };\n };\n return f;\n }();\n h = function () {\n function f() {}\n f.compose = function (f) {\n f.keepProps.push(\"dateTime\");\n f.prototype.getTimeTicks = function () {\n return this.chart.time.getTimeTicks.apply(this.chart.time, arguments);\n };\n m(f, \"init\", function (e) {\n \"datetime\" !== e.userOptions.type ? this.dateTime = void 0 : this.dateTime || (this.dateTime = new K(this));\n });\n };\n f.AdditionsClass = K;\n return f;\n }();\n h.compose(f);\n return h;\n });\n N(m, \"Core/Axis/LogarithmicAxis.js\", [m[\"Core/Axis/Axis.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = h.addEvent,\n z = h.getMagnitude,\n F = h.normalizeTickInterval,\n L = h.pick,\n K = function () {\n function f(f) {\n this.axis = f;\n }\n f.prototype.getLogTickPositions = function (f, e, h, v) {\n var x = this.axis,\n D = x.len,\n n = x.options,\n l = [];\n v || (this.minorAutoInterval = void 0);\n if (.5 <= f) f = Math.round(f), l = x.getLinearTickPositions(f, e, h);else if (.08 <= f) {\n n = Math.floor(e);\n var m, w;\n for (D = .3 < f ? [1, 2, 4] : .15 < f ? [1, 2, 4, 6, 8] : [1, 2, 3, 4, 5, 6, 7, 8, 9]; n < h + 1 && !w; n++) {\n var r = D.length;\n for (m = 0; m < r && !w; m++) {\n var d = this.log2lin(this.lin2log(n) * D[m]);\n d > e && (!v || g <= h) && \"undefined\" !== typeof g && l.push(g);\n g > h && (w = !0);\n var g = d;\n }\n }\n } else e = this.lin2log(e), h = this.lin2log(h), f = v ? x.getMinorTickInterval() : n.tickInterval, f = L(\"auto\" === f ? null : f, this.minorAutoInterval, n.tickPixelInterval / (v ? 5 : 1) * (h - e) / ((v ? D / x.tickPositions.length : D) || 1)), f = F(f, void 0, z(f)), l = x.getLinearTickPositions(f, e, h).map(this.log2lin), v || (this.minorAutoInterval = f / 5);\n v || (x.tickInterval = f);\n return l;\n };\n f.prototype.lin2log = function (f) {\n return Math.pow(10, f);\n };\n f.prototype.log2lin = function (f) {\n return Math.log(f) / Math.LN10;\n };\n return f;\n }();\n h = function () {\n function f() {}\n f.compose = function (f) {\n f.keepProps.push(\"logarithmic\");\n var e = f.prototype,\n h = K.prototype;\n e.log2lin = h.log2lin;\n e.lin2log = h.lin2log;\n m(f, \"init\", function (e) {\n var f = this.logarithmic;\n \"logarithmic\" !== e.userOptions.type ? this.logarithmic = void 0 : (f || (f = this.logarithmic = new K(this)), this.log2lin !== f.log2lin && (f.log2lin = this.log2lin.bind(this)), this.lin2log !== f.lin2log && (f.lin2log = this.lin2log.bind(this)));\n });\n m(f, \"afterInit\", function () {\n var e = this.logarithmic;\n e && (this.lin2val = function (f) {\n return e.lin2log(f);\n }, this.val2lin = function (f) {\n return e.log2lin(f);\n });\n });\n };\n return f;\n }();\n h.compose(f);\n return h;\n });\n N(m, \"Core/Axis/PlotLineOrBand.js\", [m[\"Core/Axis/Axis.js\"], m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h, m) {\n var z = m.arrayMax,\n F = m.arrayMin,\n P = m.defined,\n K = m.destroyObjectProperties,\n C = m.erase,\n y = m.extend,\n e = m.merge,\n I = m.objectEach,\n v = m.pick;\n m = function () {\n function f(e, f) {\n this.axis = e;\n f && (this.options = f, this.id = f.id);\n }\n f.prototype.render = function () {\n h.fireEvent(this, \"render\");\n var f = this,\n n = f.axis,\n l = n.horiz,\n m = n.logarithmic,\n w = f.options,\n r = w.label,\n d = f.label,\n g = w.to,\n c = w.from,\n a = w.value,\n q = P(c) && P(g),\n p = P(a),\n B = f.svgElem,\n A = !B,\n G = [],\n M = w.color,\n x = v(w.zIndex, 0),\n Q = w.events;\n G = {\n \"class\": \"highcharts-plot-\" + (q ? \"band \" : \"line \") + (w.className || \"\")\n };\n var O = {},\n E = n.chart.renderer,\n u = q ? \"bands\" : \"lines\";\n m && (c = m.log2lin(c), g = m.log2lin(g), a = m.log2lin(a));\n n.chart.styledMode || (p ? (G.stroke = M || \"#999999\", G[\"stroke-width\"] = v(w.width, 1), w.dashStyle && (G.dashstyle = w.dashStyle)) : q && (G.fill = M || \"#e6ebf5\", w.borderWidth && (G.stroke = w.borderColor, G[\"stroke-width\"] = w.borderWidth)));\n O.zIndex = x;\n u += \"-\" + x;\n (m = n.plotLinesAndBandsGroups[u]) || (n.plotLinesAndBandsGroups[u] = m = E.g(\"plot-\" + u).attr(O).add());\n A && (f.svgElem = B = E.path().attr(G).add(m));\n if (p) G = n.getPlotLinePath({\n value: a,\n lineWidth: B.strokeWidth(),\n acrossPanes: w.acrossPanes\n });else if (q) G = n.getPlotBandPath(c, g, w);else return;\n !f.eventsAdded && Q && (I(Q, function (b, a) {\n B.on(a, function (b) {\n Q[a].apply(f, [b]);\n });\n }), f.eventsAdded = !0);\n (A || !B.d) && G && G.length ? B.attr({\n d: G\n }) : B && (G ? (B.show(!0), B.animate({\n d: G\n })) : B.d && (B.hide(), d && (f.label = d = d.destroy())));\n r && (P(r.text) || P(r.formatter)) && G && G.length && 0 < n.width && 0 < n.height && !G.isFlat ? (r = e({\n align: l && q && \"center\",\n x: l ? !q && 4 : 10,\n verticalAlign: !l && q && \"middle\",\n y: l ? q ? 16 : 10 : q ? 6 : -4,\n rotation: l && !q && 90\n }, r), this.renderLabel(r, G, q, x)) : d && d.hide();\n return f;\n };\n f.prototype.renderLabel = function (e, f, l, h) {\n var n = this.label,\n r = this.axis.chart.renderer;\n n || (n = {\n align: e.textAlign || e.align,\n rotation: e.rotation,\n \"class\": \"highcharts-plot-\" + (l ? \"band\" : \"line\") + \"-label \" + (e.className || \"\")\n }, n.zIndex = h, h = this.getLabelText(e), this.label = n = r.text(h, 0, 0, e.useHTML).attr(n).add(), this.axis.chart.styledMode || n.css(e.style));\n r = f.xBounds || [f[0][1], f[1][1], l ? f[2][1] : f[0][1]];\n f = f.yBounds || [f[0][2], f[1][2], l ? f[2][2] : f[0][2]];\n l = F(r);\n h = F(f);\n n.align(e, !1, {\n x: l,\n y: h,\n width: z(r) - l,\n height: z(f) - h\n });\n n.show(!0);\n };\n f.prototype.getLabelText = function (e) {\n return P(e.formatter) ? e.formatter.call(this) : e.text;\n };\n f.prototype.destroy = function () {\n C(this.axis.plotLinesAndBands, this);\n delete this.axis;\n K(this);\n };\n return f;\n }();\n y(f.prototype, {\n getPlotBandPath: function (e, f, n) {\n void 0 === n && (n = this.options);\n var l = this.getPlotLinePath({\n value: f,\n force: !0,\n acrossPanes: n.acrossPanes\n });\n n = this.getPlotLinePath({\n value: e,\n force: !0,\n acrossPanes: n.acrossPanes\n });\n var h = [],\n w = this.horiz,\n r = 1;\n e = e < this.min && f < this.min || e > this.max && f > this.max;\n if (n && l) {\n if (e) {\n var d = n.toString() === l.toString();\n r = 0;\n }\n for (e = 0; e < n.length; e += 2) {\n f = n[e];\n var g = n[e + 1],\n c = l[e],\n a = l[e + 1];\n \"M\" !== f[0] && \"L\" !== f[0] || \"M\" !== g[0] && \"L\" !== g[0] || \"M\" !== c[0] && \"L\" !== c[0] || \"M\" !== a[0] && \"L\" !== a[0] || (w && c[1] === f[1] ? (c[1] += r, a[1] += r) : w || c[2] !== f[2] || (c[2] += r, a[2] += r), h.push([\"M\", f[1], f[2]], [\"L\", g[1], g[2]], [\"L\", a[1], a[2]], [\"L\", c[1], c[2]], [\"Z\"]));\n h.isFlat = d;\n }\n }\n return h;\n },\n addPlotBand: function (e) {\n return this.addPlotBandOrLine(e, \"plotBands\");\n },\n addPlotLine: function (e) {\n return this.addPlotBandOrLine(e, \"plotLines\");\n },\n addPlotBandOrLine: function (e, f) {\n var n = new h.PlotLineOrBand(this, e),\n l = this.userOptions;\n this.visible && (n = n.render());\n if (n) {\n if (f) {\n var v = l[f] || [];\n v.push(e);\n l[f] = v;\n }\n this.plotLinesAndBands.push(n);\n this._addedPlotLB = !0;\n }\n return n;\n },\n removePlotBandOrLine: function (e) {\n for (var f = this.plotLinesAndBands, n = this.options, l = this.userOptions, h = f.length; h--;) f[h].id === e && f[h].destroy();\n [n.plotLines || [], l.plotLines || [], n.plotBands || [], l.plotBands || []].forEach(function (f) {\n for (h = f.length; h--;) (f[h] || {}).id === e && C(f, f[h]);\n });\n },\n removePlotBand: function (e) {\n this.removePlotBandOrLine(e);\n },\n removePlotLine: function (e) {\n this.removePlotBandOrLine(e);\n }\n });\n h.PlotLineOrBand = m;\n return h.PlotLineOrBand;\n });\n N(m, \"Core/Tooltip.js\", [m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = f.doc,\n z = h.clamp,\n F = h.css,\n L = h.defined,\n K = h.discardElement,\n C = h.extend,\n y = h.fireEvent,\n e = h.format,\n I = h.isNumber,\n v = h.isString,\n x = h.merge,\n D = h.pick,\n n = h.splat,\n l = h.syncTimeout,\n J = h.timeUnits;\n \"\";\n var w = function () {\n function r(d, g) {\n this.container = void 0;\n this.crosshairs = [];\n this.distance = 0;\n this.isHidden = !0;\n this.isSticky = !1;\n this.now = {};\n this.options = {};\n this.outside = !1;\n this.chart = d;\n this.init(d, g);\n }\n r.prototype.applyFilter = function () {\n var d = this.chart;\n d.renderer.definition({\n tagName: \"filter\",\n id: \"drop-shadow-\" + d.index,\n opacity: .5,\n children: [{\n tagName: \"feGaussianBlur\",\n \"in\": \"SourceAlpha\",\n stdDeviation: 1\n }, {\n tagName: \"feOffset\",\n dx: 1,\n dy: 1\n }, {\n tagName: \"feComponentTransfer\",\n children: [{\n tagName: \"feFuncA\",\n type: \"linear\",\n slope: .3\n }]\n }, {\n tagName: \"feMerge\",\n children: [{\n tagName: \"feMergeNode\"\n }, {\n tagName: \"feMergeNode\",\n \"in\": \"SourceGraphic\"\n }]\n }]\n });\n d.renderer.definition({\n tagName: \"style\",\n textContent: \".highcharts-tooltip-\" + d.index + \"{filter:url(#drop-shadow-\" + d.index + \")}\"\n });\n };\n r.prototype.bodyFormatter = function (d) {\n return d.map(function (d) {\n var c = d.series.tooltipOptions;\n return (c[(d.point.formatPrefix || \"point\") + \"Formatter\"] || d.point.tooltipFormatter).call(d.point, c[(d.point.formatPrefix || \"point\") + \"Format\"] || \"\");\n });\n };\n r.prototype.cleanSplit = function (d) {\n this.chart.series.forEach(function (g) {\n var c = g && g.tt;\n c && (!c.isActive || d ? g.tt = c.destroy() : c.isActive = !1);\n });\n };\n r.prototype.defaultFormatter = function (d) {\n var g = this.points || n(this);\n var c = [d.tooltipFooterHeaderFormatter(g[0])];\n c = c.concat(d.bodyFormatter(g));\n c.push(d.tooltipFooterHeaderFormatter(g[0], !0));\n return c;\n };\n r.prototype.destroy = function () {\n this.label && (this.label = this.label.destroy());\n this.split && this.tt && (this.cleanSplit(this.chart, !0), this.tt = this.tt.destroy());\n this.renderer && (this.renderer = this.renderer.destroy(), K(this.container));\n h.clearTimeout(this.hideTimer);\n h.clearTimeout(this.tooltipTimeout);\n };\n r.prototype.getAnchor = function (d, g) {\n var c = this.chart,\n a = c.pointer,\n q = c.inverted,\n p = c.plotTop,\n e = c.plotLeft,\n f = 0,\n l = 0,\n r,\n h;\n d = n(d);\n this.followPointer && g ? (\"undefined\" === typeof g.chartX && (g = a.normalize(g)), d = [g.chartX - e, g.chartY - p]) : d[0].tooltipPos ? d = d[0].tooltipPos : (d.forEach(function (a) {\n r = a.series.yAxis;\n h = a.series.xAxis;\n f += a.plotX + (!q && h ? h.left - e : 0);\n l += (a.plotLow ? (a.plotLow + a.plotHigh) / 2 : a.plotY) + (!q && r ? r.top - p : 0);\n }), f /= d.length, l /= d.length, d = [q ? c.plotWidth - l : f, this.shared && !q && 1 < d.length && g ? g.chartY - p : q ? c.plotHeight - f : l]);\n return d.map(Math.round);\n };\n r.prototype.getDateFormat = function (d, g, c, a) {\n var q = this.chart.time,\n p = q.dateFormat(\"%m-%d %H:%M:%S.%L\", g),\n e = {\n millisecond: 15,\n second: 12,\n minute: 9,\n hour: 6,\n day: 3\n },\n f = \"millisecond\";\n for (l in J) {\n if (d === J.week && +q.dateFormat(\"%w\", g) === c && \"00:00:00.000\" === p.substr(6)) {\n var l = \"week\";\n break;\n }\n if (J[l] > d) {\n l = f;\n break;\n }\n if (e[l] && p.substr(e[l]) !== \"01-01 00:00:00.000\".substr(e[l])) break;\n \"week\" !== l && (f = l);\n }\n if (l) var r = q.resolveDTLFormat(a[l]).main;\n return r;\n };\n r.prototype.getLabel = function () {\n var d,\n g,\n c = this,\n a = this.chart.renderer,\n q = this.chart.styledMode,\n p = this.options,\n e = \"tooltip\" + (L(p.className) ? \" \" + p.className : \"\"),\n l = (null === (d = p.style) || void 0 === d ? void 0 : d.pointerEvents) || (!this.followPointer && p.stickOnContact ? \"auto\" : \"none\"),\n r;\n d = function () {\n c.inContact = !0;\n };\n var n = function () {\n var a = c.chart.hoverSeries;\n c.inContact = !1;\n if (a && a.onMouseOut) a.onMouseOut();\n };\n if (!this.label) {\n this.outside && (this.container = r = f.doc.createElement(\"div\"), r.className = \"highcharts-tooltip-container\", F(r, {\n position: \"absolute\",\n top: \"1px\",\n pointerEvents: l,\n zIndex: 3\n }), f.doc.body.appendChild(r), this.renderer = a = new f.Renderer(r, 0, 0, null === (g = this.chart.options.chart) || void 0 === g ? void 0 : g.style, void 0, void 0, a.styledMode));\n this.split ? this.label = a.g(e) : (this.label = a.label(\"\", 0, 0, p.shape || \"callout\", null, null, p.useHTML, null, e).attr({\n padding: p.padding,\n r: p.borderRadius\n }), q || this.label.attr({\n fill: p.backgroundColor,\n \"stroke-width\": p.borderWidth\n }).css(p.style).css({\n pointerEvents: l\n }).shadow(p.shadow));\n q && (this.applyFilter(), this.label.addClass(\"highcharts-tooltip-\" + this.chart.index));\n if (c.outside && !c.split) {\n var h = this.label,\n w = h.xSetter,\n v = h.ySetter;\n h.xSetter = function (a) {\n w.call(h, c.distance);\n r.style.left = a + \"px\";\n };\n h.ySetter = function (a) {\n v.call(h, c.distance);\n r.style.top = a + \"px\";\n };\n }\n this.label.on(\"mouseenter\", d).on(\"mouseleave\", n).attr({\n zIndex: 8\n }).add();\n }\n return this.label;\n };\n r.prototype.getPosition = function (d, g, c) {\n var a = this.chart,\n q = this.distance,\n p = {},\n e = a.inverted && c.h || 0,\n f,\n l = this.outside,\n r = l ? m.documentElement.clientWidth - 2 * q : a.chartWidth,\n n = l ? Math.max(m.body.scrollHeight, m.documentElement.scrollHeight, m.body.offsetHeight, m.documentElement.offsetHeight, m.documentElement.clientHeight) : a.chartHeight,\n h = a.pointer.getChartPosition(),\n w = a.containerScaling,\n E = function (b) {\n return w ? b * w.scaleX : b;\n },\n u = function (b) {\n return w ? b * w.scaleY : b;\n },\n b = function (b) {\n var k = \"x\" === b;\n return [b, k ? r : n, k ? d : g].concat(l ? [k ? E(d) : u(g), k ? h.left - q + E(c.plotX + a.plotLeft) : h.top - q + u(c.plotY + a.plotTop), 0, k ? r : n] : [k ? d : g, k ? c.plotX + a.plotLeft : c.plotY + a.plotTop, k ? a.plotLeft : a.plotTop, k ? a.plotLeft + a.plotWidth : a.plotTop + a.plotHeight]);\n },\n k = b(\"y\"),\n t = b(\"x\"),\n H = !this.followPointer && D(c.ttBelow, !a.inverted === !!c.negative),\n v = function (b, a, c, k, d, g, t) {\n var f = \"y\" === b ? u(q) : E(q),\n l = (c - k) / 2,\n r = k < d - q,\n B = d + q + k < a,\n n = d - f - c + l;\n d = d + f - l;\n if (H && B) p[b] = d;else if (!H && r) p[b] = n;else if (r) p[b] = Math.min(t - k, 0 > n - e ? n : n - e);else if (B) p[b] = Math.max(g, d + e + c > a ? d : d + e);else return !1;\n },\n U = function (b, a, c, k, d) {\n var g;\n d < q || d > a - q ? g = !1 : p[b] = d < c / 2 ? 1 : d > a - k / 2 ? a - k - 2 : d - c / 2;\n return g;\n },\n x = function (b) {\n var a = k;\n k = t;\n t = a;\n f = b;\n },\n I = function () {\n !1 !== v.apply(0, k) ? !1 !== U.apply(0, t) || f || (x(!0), I()) : f ? p.x = p.y = 0 : (x(!0), I());\n };\n (a.inverted || 1 < this.len) && x();\n I();\n return p;\n };\n r.prototype.getXDateFormat = function (d, g, c) {\n g = g.dateTimeLabelFormats;\n var a = c && c.closestPointRange;\n return (a ? this.getDateFormat(a, d.x, c.options.startOfWeek, g) : g.day) || g.year;\n };\n r.prototype.hide = function (d) {\n var g = this;\n h.clearTimeout(this.hideTimer);\n d = D(d, this.options.hideDelay, 500);\n this.isHidden || (this.hideTimer = l(function () {\n g.getLabel().fadeOut(d ? void 0 : d);\n g.isHidden = !0;\n }, d));\n };\n r.prototype.init = function (d, g) {\n this.chart = d;\n this.options = g;\n this.crosshairs = [];\n this.now = {\n x: 0,\n y: 0\n };\n this.isHidden = !0;\n this.split = g.split && !d.inverted && !d.polar;\n this.shared = g.shared || this.split;\n this.outside = D(g.outside, !(!d.scrollablePixelsX && !d.scrollablePixelsY));\n };\n r.prototype.isStickyOnContact = function () {\n return !(this.followPointer || !this.options.stickOnContact || !this.inContact);\n };\n r.prototype.move = function (d, g, c, a) {\n var q = this,\n p = q.now,\n e = !1 !== q.options.animation && !q.isHidden && (1 < Math.abs(d - p.x) || 1 < Math.abs(g - p.y)),\n f = q.followPointer || 1 < q.len;\n C(p, {\n x: e ? (2 * p.x + d) / 3 : d,\n y: e ? (p.y + g) / 2 : g,\n anchorX: f ? void 0 : e ? (2 * p.anchorX + c) / 3 : c,\n anchorY: f ? void 0 : e ? (p.anchorY + a) / 2 : a\n });\n q.getLabel().attr(p);\n q.drawTracker();\n e && (h.clearTimeout(this.tooltipTimeout), this.tooltipTimeout = setTimeout(function () {\n q && q.move(d, g, c, a);\n }, 32));\n };\n r.prototype.refresh = function (d, g) {\n var c = this.chart,\n a = this.options,\n q = d,\n p = {},\n e = [],\n f = a.formatter || this.defaultFormatter;\n p = this.shared;\n var l = c.styledMode;\n if (a.enabled) {\n h.clearTimeout(this.hideTimer);\n this.followPointer = n(q)[0].series.tooltipOptions.followPointer;\n var r = this.getAnchor(q, g);\n g = r[0];\n var w = r[1];\n !p || q.series && q.series.noSharedTooltip ? p = q.getLabelConfig() : (c.pointer.applyInactiveState(q), q.forEach(function (a) {\n a.setState(\"hover\");\n e.push(a.getLabelConfig());\n }), p = {\n x: q[0].category,\n y: q[0].y\n }, p.points = e, q = q[0]);\n this.len = e.length;\n c = f.call(p, this);\n f = q.series;\n this.distance = D(f.tooltipOptions.distance, 16);\n !1 === c ? this.hide() : (this.split ? this.renderSplit(c, n(d)) : (d = this.getLabel(), a.style.width && !l || d.css({\n width: this.chart.spacingBox.width + \"px\"\n }), d.attr({\n text: c && c.join ? c.join(\"\") : c\n }), d.removeClass(/highcharts-color-[\\d]+/g).addClass(\"highcharts-color-\" + D(q.colorIndex, f.colorIndex)), l || d.attr({\n stroke: a.borderColor || q.color || f.color || \"#666666\"\n }), this.updatePosition({\n plotX: g,\n plotY: w,\n negative: q.negative,\n ttBelow: q.ttBelow,\n h: r[2] || 0\n })), this.isHidden && this.label && this.label.attr({\n opacity: 1\n }).show(), this.isHidden = !1);\n y(this, \"refresh\");\n }\n };\n r.prototype.renderSplit = function (d, g) {\n function c(b, a, c, d, g) {\n void 0 === g && (g = !0);\n c ? (a = I ? 0 : F, b = z(b - d / 2, m.left, m.right - d)) : (a -= y, b = g ? b - d - k : b + k, b = z(b, g ? b : m.left, m.right));\n return {\n x: b,\n y: a\n };\n }\n var a = this,\n q = a.chart,\n p = a.chart,\n e = p.plotHeight,\n l = p.plotLeft,\n r = p.plotTop,\n n = p.pointer,\n h = p.renderer,\n w = p.scrollablePixelsY,\n O = void 0 === w ? 0 : w;\n w = p.scrollingContainer;\n w = void 0 === w ? {\n scrollLeft: 0,\n scrollTop: 0\n } : w;\n var E = w.scrollLeft,\n u = w.scrollTop,\n b = p.styledMode,\n k = a.distance,\n t = a.options,\n H = a.options.positioner,\n m = {\n left: E,\n right: E + p.chartWidth,\n top: u,\n bottom: u + p.chartHeight\n },\n x = a.getLabel(),\n I = !(!q.xAxis[0] || !q.xAxis[0].opposite),\n y = r + u,\n J = 0,\n F = e - O;\n v(d) && (d = [!1, d]);\n d = d.slice(0, g.length + 1).reduce(function (d, p, q) {\n if (!1 !== p && \"\" !== p) {\n q = g[q - 1] || {\n isHeader: !0,\n plotX: g[0].plotX,\n plotY: e,\n series: {}\n };\n var f = q.isHeader,\n n = f ? a : q.series,\n B = n.tt,\n A = q.isHeader;\n var w = q.series;\n var E = \"highcharts-color-\" + D(q.colorIndex, w.colorIndex, \"none\");\n B || (B = {\n padding: t.padding,\n r: t.borderRadius\n }, b || (B.fill = t.backgroundColor, B[\"stroke-width\"] = t.borderWidth), B = h.label(\"\", 0, 0, t[A ? \"headerShape\" : \"shape\"] || \"callout\", void 0, void 0, t.useHTML).addClass((A ? \"highcharts-tooltip-header \" : \"\") + \"highcharts-tooltip-box \" + E).attr(B).add(x));\n B.isActive = !0;\n B.attr({\n text: p\n });\n b || B.css(t.style).shadow(t.shadow).attr({\n stroke: t.borderColor || q.color || w.color || \"#333333\"\n });\n p = n.tt = B;\n A = p.getBBox();\n n = A.width + p.strokeWidth();\n f && (J = A.height, F += J, I && (y -= J));\n w = q.plotX;\n w = void 0 === w ? 0 : w;\n E = q.plotY;\n E = void 0 === E ? 0 : E;\n var v = q.series;\n if (q.isHeader) {\n w = l + w;\n var G = r + e / 2;\n } else B = v.xAxis, v = v.yAxis, w = B.pos + z(w, -k, B.len + k), v.pos + E >= u + r && v.pos + E <= u + r + e - O && (G = v.pos + E);\n w = z(w, m.left - k, m.right + k);\n \"number\" === typeof G ? (A = A.height + 1, E = H ? H.call(a, n, A, q) : c(w, G, f, n), d.push({\n align: H ? 0 : void 0,\n anchorX: w,\n anchorY: G,\n boxWidth: n,\n point: q,\n rank: D(E.rank, f ? 1 : 0),\n size: A,\n target: E.y,\n tt: p,\n x: E.x\n })) : p.isActive = !1;\n }\n return d;\n }, []);\n !H && d.some(function (b) {\n return b.x < m.left;\n }) && (d = d.map(function (b) {\n var a = c(b.anchorX, b.anchorY, b.point.isHeader, b.boxWidth, !1);\n return C(b, {\n target: a.y,\n x: a.x\n });\n }));\n a.cleanSplit();\n f.distribute(d, F);\n d.forEach(function (b) {\n var a = b.pos;\n b.tt.attr({\n visibility: \"undefined\" === typeof a ? \"hidden\" : \"inherit\",\n x: b.x,\n y: a + y,\n anchorX: b.anchorX,\n anchorY: b.anchorY\n });\n });\n d = a.container;\n q = a.renderer;\n a.outside && d && q && (p = x.getBBox(), q.setSize(p.width + p.x, p.height + p.y, !1), n = n.getChartPosition(), d.style.left = n.left + \"px\", d.style.top = n.top + \"px\");\n };\n r.prototype.drawTracker = function () {\n if (this.followPointer || !this.options.stickOnContact) this.tracker && this.tracker.destroy();else {\n var d = this.chart,\n g = this.label,\n c = d.hoverPoint;\n if (g && c) {\n var a = {\n x: 0,\n y: 0,\n width: 0,\n height: 0\n };\n c = this.getAnchor(c);\n var q = g.getBBox();\n c[0] += d.plotLeft - g.translateX;\n c[1] += d.plotTop - g.translateY;\n a.x = Math.min(0, c[0]);\n a.y = Math.min(0, c[1]);\n a.width = 0 > c[0] ? Math.max(Math.abs(c[0]), q.width - c[0]) : Math.max(Math.abs(c[0]), q.width);\n a.height = 0 > c[1] ? Math.max(Math.abs(c[1]), q.height - Math.abs(c[1])) : Math.max(Math.abs(c[1]), q.height);\n this.tracker ? this.tracker.attr(a) : (this.tracker = g.renderer.rect(a).addClass(\"highcharts-tracker\").add(g), d.styledMode || this.tracker.attr({\n fill: \"rgba(0,0,0,0)\"\n }));\n }\n }\n };\n r.prototype.styledModeFormat = function (d) {\n return d.replace('style=\"font-size: 10px\"', 'class=\"highcharts-header\"').replace(/style=\"color:{(point|series)\\.color}\"/g, 'class=\"highcharts-color-{$1.colorIndex}\"');\n };\n r.prototype.tooltipFooterHeaderFormatter = function (d, g) {\n var c = g ? \"footer\" : \"header\",\n a = d.series,\n q = a.tooltipOptions,\n p = q.xDateFormat,\n f = a.xAxis,\n l = f && \"datetime\" === f.options.type && I(d.key),\n r = q[c + \"Format\"];\n g = {\n isFooter: g,\n labelConfig: d\n };\n y(this, \"headerFormatter\", g, function (c) {\n l && !p && (p = this.getXDateFormat(d, q, f));\n l && p && (d.point && d.point.tooltipDateKeys || [\"key\"]).forEach(function (a) {\n r = r.replace(\"{point.\" + a + \"}\", \"{point.\" + a + \":\" + p + \"}\");\n });\n a.chart.styledMode && (r = this.styledModeFormat(r));\n c.text = e(r, {\n point: d,\n series: a\n }, this.chart);\n });\n return g.text;\n };\n r.prototype.update = function (d) {\n this.destroy();\n x(!0, this.chart.options.tooltip.userOptions, d);\n this.init(this.chart, x(!0, this.options, d));\n };\n r.prototype.updatePosition = function (d) {\n var g = this.chart,\n c = g.pointer,\n a = this.getLabel(),\n q = d.plotX + g.plotLeft,\n p = d.plotY + g.plotTop;\n c = c.getChartPosition();\n d = (this.options.positioner || this.getPosition).call(this, a.width, a.height, d);\n if (this.outside) {\n var e = (this.options.borderWidth || 0) + 2 * this.distance;\n this.renderer.setSize(a.width + e, a.height + e, !1);\n if (g = g.containerScaling) F(this.container, {\n transform: \"scale(\" + g.scaleX + \", \" + g.scaleY + \")\"\n }), q *= g.scaleX, p *= g.scaleY;\n q += c.left - d.x;\n p += c.top - d.y;\n }\n this.move(Math.round(d.x), Math.round(d.y || 0), q, p);\n };\n return r;\n }();\n f.Tooltip = w;\n return f.Tooltip;\n });\n N(m, \"Core/Pointer.js\", [m[\"Core/Color/Color.js\"], m[\"Core/Globals.js\"], m[\"Core/Tooltip.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z) {\n var F = f.parse,\n P = h.charts,\n K = h.noop,\n C = z.addEvent,\n y = z.attr,\n e = z.css,\n I = z.defined,\n v = z.extend,\n x = z.find,\n D = z.fireEvent,\n n = z.isNumber,\n l = z.isObject,\n J = z.objectEach,\n w = z.offset,\n r = z.pick,\n d = z.splat;\n \"\";\n f = function () {\n function g(c, a) {\n this.lastValidTouch = {};\n this.pinchDown = [];\n this.runChartClick = !1;\n this.chart = c;\n this.hasDragged = !1;\n this.options = a;\n this.unbindContainerMouseLeave = function () {};\n this.unbindContainerMouseEnter = function () {};\n this.init(c, a);\n }\n g.prototype.applyInactiveState = function (c) {\n var a = [],\n d;\n (c || []).forEach(function (c) {\n d = c.series;\n a.push(d);\n d.linkedParent && a.push(d.linkedParent);\n d.linkedSeries && (a = a.concat(d.linkedSeries));\n d.navigatorSeries && a.push(d.navigatorSeries);\n });\n this.chart.series.forEach(function (c) {\n -1 === a.indexOf(c) ? c.setState(\"inactive\", !0) : c.options.inactiveOtherPoints && c.setAllPointsToState(\"inactive\");\n });\n };\n g.prototype.destroy = function () {\n var c = this;\n \"undefined\" !== typeof c.unDocMouseMove && c.unDocMouseMove();\n this.unbindContainerMouseLeave();\n h.chartCount || (h.unbindDocumentMouseUp && (h.unbindDocumentMouseUp = h.unbindDocumentMouseUp()), h.unbindDocumentTouchEnd && (h.unbindDocumentTouchEnd = h.unbindDocumentTouchEnd()));\n clearInterval(c.tooltipTimeout);\n J(c, function (a, d) {\n c[d] = void 0;\n });\n };\n g.prototype.drag = function (c) {\n var a = this.chart,\n d = a.options.chart,\n g = c.chartX,\n e = c.chartY,\n f = this.zoomHor,\n r = this.zoomVert,\n n = a.plotLeft,\n h = a.plotTop,\n w = a.plotWidth,\n v = a.plotHeight,\n E = this.selectionMarker,\n u = this.mouseDownX || 0,\n b = this.mouseDownY || 0,\n k = l(d.panning) ? d.panning && d.panning.enabled : d.panning,\n t = d.panKey && c[d.panKey + \"Key\"];\n if (!E || !E.touch) if (g < n ? g = n : g > n + w && (g = n + w), e < h ? e = h : e > h + v && (e = h + v), this.hasDragged = Math.sqrt(Math.pow(u - g, 2) + Math.pow(b - e, 2)), 10 < this.hasDragged) {\n var H = a.isInsidePlot(u - n, b - h);\n a.hasCartesianSeries && (this.zoomX || this.zoomY) && H && !t && !E && (this.selectionMarker = E = a.renderer.rect(n, h, f ? 1 : w, r ? 1 : v, 0).attr({\n \"class\": \"highcharts-selection-marker\",\n zIndex: 7\n }).add(), a.styledMode || E.attr({\n fill: d.selectionMarkerFill || F(\"#335cad\").setOpacity(.25).get()\n }));\n E && f && (g -= u, E.attr({\n width: Math.abs(g),\n x: (0 < g ? 0 : g) + u\n }));\n E && r && (g = e - b, E.attr({\n height: Math.abs(g),\n y: (0 < g ? 0 : g) + b\n }));\n H && !E && k && a.pan(c, d.panning);\n }\n };\n g.prototype.dragStart = function (c) {\n var a = this.chart;\n a.mouseIsDown = c.type;\n a.cancelClick = !1;\n a.mouseDownX = this.mouseDownX = c.chartX;\n a.mouseDownY = this.mouseDownY = c.chartY;\n };\n g.prototype.drop = function (c) {\n var a = this,\n d = this.chart,\n g = this.hasPinched;\n if (this.selectionMarker) {\n var f = {\n originalEvent: c,\n xAxis: [],\n yAxis: []\n },\n l = this.selectionMarker,\n r = l.attr ? l.attr(\"x\") : l.x,\n h = l.attr ? l.attr(\"y\") : l.y,\n w = l.attr ? l.attr(\"width\") : l.width,\n m = l.attr ? l.attr(\"height\") : l.height,\n O;\n if (this.hasDragged || g) d.axes.forEach(function (d) {\n if (d.zoomEnabled && I(d.min) && (g || a[{\n xAxis: \"zoomX\",\n yAxis: \"zoomY\"\n }[d.coll]]) && n(r) && n(h)) {\n var p = d.horiz,\n b = \"touchend\" === c.type ? d.minPixelPadding : 0,\n k = d.toValue((p ? r : h) + b);\n p = d.toValue((p ? r + w : h + m) - b);\n f[d.coll].push({\n axis: d,\n min: Math.min(k, p),\n max: Math.max(k, p)\n });\n O = !0;\n }\n }), O && D(d, \"selection\", f, function (a) {\n d.zoom(v(a, g ? {\n animation: !1\n } : null));\n });\n n(d.index) && (this.selectionMarker = this.selectionMarker.destroy());\n g && this.scaleGroups();\n }\n d && n(d.index) && (e(d.container, {\n cursor: d._cursor\n }), d.cancelClick = 10 < this.hasDragged, d.mouseIsDown = this.hasDragged = this.hasPinched = !1, this.pinchDown = []);\n };\n g.prototype.findNearestKDPoint = function (c, a, d) {\n var g = this.chart,\n q = g.hoverPoint;\n g = g.tooltip;\n if (q && g && g.isStickyOnContact()) return q;\n var e;\n c.forEach(function (c) {\n var g = !(c.noSharedTooltip && a) && 0 > c.options.findNearestPointBy.indexOf(\"y\");\n c = c.searchPoint(d, g);\n if ((g = l(c, !0)) && !(g = !l(e, !0))) {\n g = e.distX - c.distX;\n var p = e.dist - c.dist,\n q = (c.series.group && c.series.group.zIndex) - (e.series.group && e.series.group.zIndex);\n g = 0 < (0 !== g && a ? g : 0 !== p ? p : 0 !== q ? q : e.series.index > c.series.index ? -1 : 1);\n }\n g && (e = c);\n });\n return e;\n };\n g.prototype.getChartCoordinatesFromPoint = function (c, a) {\n var d = c.series,\n g = d.xAxis;\n d = d.yAxis;\n var e = r(c.clientX, c.plotX),\n f = c.shapeArgs;\n if (g && d) return a ? {\n chartX: g.len + g.pos - e,\n chartY: d.len + d.pos - c.plotY\n } : {\n chartX: e + g.pos,\n chartY: c.plotY + d.pos\n };\n if (f && f.x && f.y) return {\n chartX: f.x,\n chartY: f.y\n };\n };\n g.prototype.getChartPosition = function () {\n return this.chartPosition || (this.chartPosition = w(this.chart.container));\n };\n g.prototype.getCoordinates = function (c) {\n var a = {\n xAxis: [],\n yAxis: []\n };\n this.chart.axes.forEach(function (d) {\n a[d.isXAxis ? \"xAxis\" : \"yAxis\"].push({\n axis: d,\n value: d.toValue(c[d.horiz ? \"chartX\" : \"chartY\"])\n });\n });\n return a;\n };\n g.prototype.getHoverData = function (c, a, d, g, e, f) {\n var p,\n q = [];\n g = !(!g || !c);\n var n = a && !a.stickyTracking,\n h = {\n chartX: f ? f.chartX : void 0,\n chartY: f ? f.chartY : void 0,\n shared: e\n };\n D(this, \"beforeGetHoverData\", h);\n n = n ? [a] : d.filter(function (a) {\n return h.filter ? h.filter(a) : a.visible && !(!e && a.directTouch) && r(a.options.enableMouseTracking, !0) && a.stickyTracking;\n });\n a = (p = g || !f ? c : this.findNearestKDPoint(n, e, f)) && p.series;\n p && (e && !a.noSharedTooltip ? (n = d.filter(function (a) {\n return h.filter ? h.filter(a) : a.visible && !(!e && a.directTouch) && r(a.options.enableMouseTracking, !0) && !a.noSharedTooltip;\n }), n.forEach(function (a) {\n var c = x(a.points, function (a) {\n return a.x === p.x && !a.isNull;\n });\n l(c) && (a.chart.isBoosting && (c = a.getPoint(c)), q.push(c));\n })) : q.push(p));\n h = {\n hoverPoint: p\n };\n D(this, \"afterGetHoverData\", h);\n return {\n hoverPoint: h.hoverPoint,\n hoverSeries: a,\n hoverPoints: q\n };\n };\n g.prototype.getPointFromEvent = function (c) {\n c = c.target;\n for (var a; c && !a;) a = c.point, c = c.parentNode;\n return a;\n };\n g.prototype.onTrackerMouseOut = function (c) {\n c = c.relatedTarget || c.toElement;\n var a = this.chart.hoverSeries;\n this.isDirectTouch = !1;\n if (!(!a || !c || a.stickyTracking || this.inClass(c, \"highcharts-tooltip\") || this.inClass(c, \"highcharts-series-\" + a.index) && this.inClass(c, \"highcharts-tracker\"))) a.onMouseOut();\n };\n g.prototype.inClass = function (c, a) {\n for (var d; c;) {\n if (d = y(c, \"class\")) {\n if (-1 !== d.indexOf(a)) return !0;\n if (-1 !== d.indexOf(\"highcharts-container\")) return !1;\n }\n c = c.parentNode;\n }\n };\n g.prototype.init = function (c, a) {\n this.options = a;\n this.chart = c;\n this.runChartClick = a.chart.events && !!a.chart.events.click;\n this.pinchDown = [];\n this.lastValidTouch = {};\n m && (c.tooltip = new m(c, a.tooltip), this.followTouchMove = r(a.tooltip.followTouchMove, !0));\n this.setDOMEvents();\n };\n g.prototype.normalize = function (c, a) {\n var d = c.touches,\n g = d ? d.length ? d.item(0) : r(d.changedTouches, c.changedTouches)[0] : c;\n a || (a = this.getChartPosition());\n d = g.pageX - a.left;\n a = g.pageY - a.top;\n if (g = this.chart.containerScaling) d /= g.scaleX, a /= g.scaleY;\n return v(c, {\n chartX: Math.round(d),\n chartY: Math.round(a)\n });\n };\n g.prototype.onContainerClick = function (c) {\n var a = this.chart,\n d = a.hoverPoint;\n c = this.normalize(c);\n var g = a.plotLeft,\n e = a.plotTop;\n a.cancelClick || (d && this.inClass(c.target, \"highcharts-tracker\") ? (D(d.series, \"click\", v(c, {\n point: d\n })), a.hoverPoint && d.firePointEvent(\"click\", c)) : (v(c, this.getCoordinates(c)), a.isInsidePlot(c.chartX - g, c.chartY - e) && D(a, \"click\", c)));\n };\n g.prototype.onContainerMouseDown = function (c) {\n var a = 1 === ((c.buttons || c.button) & 1);\n c = this.normalize(c);\n if (h.isFirefox && 0 !== c.button) this.onContainerMouseMove(c);\n if (\"undefined\" === typeof c.button || a) this.zoomOption(c), a && c.preventDefault && c.preventDefault(), this.dragStart(c);\n };\n g.prototype.onContainerMouseLeave = function (c) {\n var a = P[r(h.hoverChartIndex, -1)],\n d = this.chart.tooltip;\n c = this.normalize(c);\n a && (c.relatedTarget || c.toElement) && (a.pointer.reset(), a.pointer.chartPosition = void 0);\n d && !d.isHidden && this.reset();\n };\n g.prototype.onContainerMouseEnter = function (c) {\n delete this.chartPosition;\n };\n g.prototype.onContainerMouseMove = function (c) {\n var a = this.chart;\n c = this.normalize(c);\n this.setHoverChartIndex();\n c.preventDefault || (c.returnValue = !1);\n \"mousedown\" === a.mouseIsDown && this.drag(c);\n a.openMenu || !this.inClass(c.target, \"highcharts-tracker\") && !a.isInsidePlot(c.chartX - a.plotLeft, c.chartY - a.plotTop) || this.runPointActions(c);\n };\n g.prototype.onDocumentTouchEnd = function (c) {\n P[h.hoverChartIndex] && P[h.hoverChartIndex].pointer.drop(c);\n };\n g.prototype.onContainerTouchMove = function (c) {\n this.touch(c);\n };\n g.prototype.onContainerTouchStart = function (c) {\n this.zoomOption(c);\n this.touch(c, !0);\n };\n g.prototype.onDocumentMouseMove = function (c) {\n var a = this.chart,\n d = this.chartPosition;\n c = this.normalize(c, d);\n var g = a.tooltip;\n !d || g && g.isStickyOnContact() || a.isInsidePlot(c.chartX - a.plotLeft, c.chartY - a.plotTop) || this.inClass(c.target, \"highcharts-tracker\") || this.reset();\n };\n g.prototype.onDocumentMouseUp = function (c) {\n var a = P[r(h.hoverChartIndex, -1)];\n a && a.pointer.drop(c);\n };\n g.prototype.pinch = function (c) {\n var a = this,\n d = a.chart,\n g = a.pinchDown,\n e = c.touches || [],\n f = e.length,\n l = a.lastValidTouch,\n n = a.hasZoom,\n h = a.selectionMarker,\n w = {},\n m = 1 === f && (a.inClass(c.target, \"highcharts-tracker\") && d.runTrackerClick || a.runChartClick),\n E = {};\n 1 < f && (a.initiated = !0);\n n && a.initiated && !m && !1 !== c.cancelable && c.preventDefault();\n [].map.call(e, function (c) {\n return a.normalize(c);\n });\n \"touchstart\" === c.type ? ([].forEach.call(e, function (a, b) {\n g[b] = {\n chartX: a.chartX,\n chartY: a.chartY\n };\n }), l.x = [g[0].chartX, g[1] && g[1].chartX], l.y = [g[0].chartY, g[1] && g[1].chartY], d.axes.forEach(function (a) {\n if (a.zoomEnabled) {\n var b = d.bounds[a.horiz ? \"h\" : \"v\"],\n c = a.minPixelPadding,\n g = a.toPixels(Math.min(r(a.options.min, a.dataMin), a.dataMin)),\n p = a.toPixels(Math.max(r(a.options.max, a.dataMax), a.dataMax)),\n q = Math.max(g, p);\n b.min = Math.min(a.pos, Math.min(g, p) - c);\n b.max = Math.max(a.pos + a.len, q + c);\n }\n }), a.res = !0) : a.followTouchMove && 1 === f ? this.runPointActions(a.normalize(c)) : g.length && (h || (a.selectionMarker = h = v({\n destroy: K,\n touch: !0\n }, d.plotBox)), a.pinchTranslate(g, e, w, h, E, l), a.hasPinched = n, a.scaleGroups(w, E), a.res && (a.res = !1, this.reset(!1, 0)));\n };\n g.prototype.pinchTranslate = function (c, a, d, g, e, f) {\n this.zoomHor && this.pinchTranslateDirection(!0, c, a, d, g, e, f);\n this.zoomVert && this.pinchTranslateDirection(!1, c, a, d, g, e, f);\n };\n g.prototype.pinchTranslateDirection = function (c, a, d, g, e, f, l, r) {\n var p = this.chart,\n q = c ? \"x\" : \"y\",\n n = c ? \"X\" : \"Y\",\n h = \"chart\" + n,\n u = c ? \"width\" : \"height\",\n b = p[\"plot\" + (c ? \"Left\" : \"Top\")],\n k,\n t,\n B = r || 1,\n w = p.inverted,\n A = p.bounds[c ? \"h\" : \"v\"],\n v = 1 === a.length,\n G = a[0][h],\n m = d[0][h],\n D = !v && a[1][h],\n M = !v && d[1][h];\n d = function () {\n \"number\" === typeof M && 20 < Math.abs(G - D) && (B = r || Math.abs(m - M) / Math.abs(G - D));\n t = (b - m) / B + G;\n k = p[\"plot\" + (c ? \"Width\" : \"Height\")] / B;\n };\n d();\n a = t;\n if (a < A.min) {\n a = A.min;\n var x = !0;\n } else a + k > A.max && (a = A.max - k, x = !0);\n x ? (m -= .8 * (m - l[q][0]), \"number\" === typeof M && (M -= .8 * (M - l[q][1])), d()) : l[q] = [m, M];\n w || (f[q] = t - b, f[u] = k);\n f = w ? 1 / B : B;\n e[u] = k;\n e[q] = a;\n g[w ? c ? \"scaleY\" : \"scaleX\" : \"scale\" + n] = B;\n g[\"translate\" + n] = f * b + (m - f * G);\n };\n g.prototype.reset = function (c, a) {\n var g = this.chart,\n p = g.hoverSeries,\n e = g.hoverPoint,\n f = g.hoverPoints,\n l = g.tooltip,\n r = l && l.shared ? f : e;\n c && r && d(r).forEach(function (a) {\n a.series.isCartesian && \"undefined\" === typeof a.plotX && (c = !1);\n });\n if (c) l && r && d(r).length && (l.refresh(r), l.shared && f ? f.forEach(function (a) {\n a.setState(a.state, !0);\n a.series.isCartesian && (a.series.xAxis.crosshair && a.series.xAxis.drawCrosshair(null, a), a.series.yAxis.crosshair && a.series.yAxis.drawCrosshair(null, a));\n }) : e && (e.setState(e.state, !0), g.axes.forEach(function (a) {\n a.crosshair && e.series[a.coll] === a && a.drawCrosshair(null, e);\n })));else {\n if (e) e.onMouseOut();\n f && f.forEach(function (a) {\n a.setState();\n });\n if (p) p.onMouseOut();\n l && l.hide(a);\n this.unDocMouseMove && (this.unDocMouseMove = this.unDocMouseMove());\n g.axes.forEach(function (a) {\n a.hideCrosshair();\n });\n this.hoverX = g.hoverPoints = g.hoverPoint = null;\n }\n };\n g.prototype.runPointActions = function (c, a) {\n var d = this.chart,\n g = d.tooltip && d.tooltip.options.enabled ? d.tooltip : void 0,\n e = g ? g.shared : !1,\n f = a || d.hoverPoint,\n l = f && f.series || d.hoverSeries;\n l = this.getHoverData(f, l, d.series, (!c || \"touchmove\" !== c.type) && (!!a || l && l.directTouch && this.isDirectTouch), e, c);\n f = l.hoverPoint;\n var n = l.hoverPoints;\n a = (l = l.hoverSeries) && l.tooltipOptions.followPointer;\n e = e && l && !l.noSharedTooltip;\n if (f && (f !== d.hoverPoint || g && g.isHidden)) {\n (d.hoverPoints || []).forEach(function (a) {\n -1 === n.indexOf(a) && a.setState();\n });\n if (d.hoverSeries !== l) l.onMouseOver();\n this.applyInactiveState(n);\n (n || []).forEach(function (a) {\n a.setState(\"hover\");\n });\n d.hoverPoint && d.hoverPoint.firePointEvent(\"mouseOut\");\n if (!f.series) return;\n d.hoverPoints = n;\n d.hoverPoint = f;\n f.firePointEvent(\"mouseOver\");\n g && g.refresh(e ? n : f, c);\n } else a && g && !g.isHidden && (f = g.getAnchor([{}], c), g.updatePosition({\n plotX: f[0],\n plotY: f[1]\n }));\n this.unDocMouseMove || (this.unDocMouseMove = C(d.container.ownerDocument, \"mousemove\", function (a) {\n var c = P[h.hoverChartIndex];\n if (c) c.pointer.onDocumentMouseMove(a);\n }));\n d.axes.forEach(function (a) {\n var g = r((a.crosshair || {}).snap, !0),\n p;\n g && ((p = d.hoverPoint) && p.series[a.coll] === a || (p = x(n, function (c) {\n return c.series[a.coll] === a;\n })));\n p || !g ? a.drawCrosshair(c, p) : a.hideCrosshair();\n });\n };\n g.prototype.scaleGroups = function (c, a) {\n var d = this.chart,\n g;\n d.series.forEach(function (p) {\n g = c || p.getPlotBox();\n p.xAxis && p.xAxis.zoomEnabled && p.group && (p.group.attr(g), p.markerGroup && (p.markerGroup.attr(g), p.markerGroup.clip(a ? d.clipRect : null)), p.dataLabelsGroup && p.dataLabelsGroup.attr(g));\n });\n d.clipRect.attr(a || d.clipBox);\n };\n g.prototype.setDOMEvents = function () {\n var c = this.chart.container,\n a = c.ownerDocument;\n c.onmousedown = this.onContainerMouseDown.bind(this);\n c.onmousemove = this.onContainerMouseMove.bind(this);\n c.onclick = this.onContainerClick.bind(this);\n this.unbindContainerMouseEnter = C(c, \"mouseenter\", this.onContainerMouseEnter.bind(this));\n this.unbindContainerMouseLeave = C(c, \"mouseleave\", this.onContainerMouseLeave.bind(this));\n h.unbindDocumentMouseUp || (h.unbindDocumentMouseUp = C(a, \"mouseup\", this.onDocumentMouseUp.bind(this)));\n h.hasTouch && (C(c, \"touchstart\", this.onContainerTouchStart.bind(this)), C(c, \"touchmove\", this.onContainerTouchMove.bind(this)), h.unbindDocumentTouchEnd || (h.unbindDocumentTouchEnd = C(a, \"touchend\", this.onDocumentTouchEnd.bind(this))));\n };\n g.prototype.setHoverChartIndex = function () {\n var c = this.chart,\n a = h.charts[r(h.hoverChartIndex, -1)];\n if (a && a !== c) a.pointer.onContainerMouseLeave({\n relatedTarget: !0\n });\n a && a.mouseIsDown || (h.hoverChartIndex = c.index);\n };\n g.prototype.touch = function (c, a) {\n var d = this.chart,\n g;\n this.setHoverChartIndex();\n if (1 === c.touches.length) {\n if (c = this.normalize(c), (g = d.isInsidePlot(c.chartX - d.plotLeft, c.chartY - d.plotTop)) && !d.openMenu) {\n a && this.runPointActions(c);\n if (\"touchmove\" === c.type) {\n a = this.pinchDown;\n var e = a[0] ? 4 <= Math.sqrt(Math.pow(a[0].chartX - c.chartX, 2) + Math.pow(a[0].chartY - c.chartY, 2)) : !1;\n }\n r(e, !0) && this.pinch(c);\n } else a && this.reset();\n } else 2 === c.touches.length && this.pinch(c);\n };\n g.prototype.zoomOption = function (c) {\n var a = this.chart,\n d = a.options.chart,\n g = d.zoomType || \"\";\n a = a.inverted;\n /touch/.test(c.type) && (g = r(d.pinchType, g));\n this.zoomX = c = /x/.test(g);\n this.zoomY = g = /y/.test(g);\n this.zoomHor = c && !a || g && a;\n this.zoomVert = g && !a || c && a;\n this.hasZoom = c || g;\n };\n return g;\n }();\n return h.Pointer = f;\n });\n N(m, \"Core/MSPointer.js\", [m[\"Core/Globals.js\"], m[\"Core/Pointer.js\"], m[\"Core/Utilities.js\"]], function (f, h, m) {\n function z() {\n var e = [];\n e.item = function (e) {\n return this[e];\n };\n v(D, function (f) {\n e.push({\n pageX: f.pageX,\n pageY: f.pageY,\n target: f.target\n });\n });\n return e;\n }\n function F(e, n, h, r) {\n \"touch\" !== e.pointerType && e.pointerType !== e.MSPOINTER_TYPE_TOUCH || !K[f.hoverChartIndex] || (r(e), r = K[f.hoverChartIndex].pointer, r[n]({\n type: h,\n target: e.currentTarget,\n preventDefault: y,\n touches: z()\n }));\n }\n var P = this && this.__extends || function () {\n var e = function (f, l) {\n e = Object.setPrototypeOf || {\n __proto__: []\n } instanceof Array && function (e, d) {\n e.__proto__ = d;\n } || function (e, d) {\n for (var g in d) d.hasOwnProperty(g) && (e[g] = d[g]);\n };\n return e(f, l);\n };\n return function (f, l) {\n function r() {\n this.constructor = f;\n }\n e(f, l);\n f.prototype = null === l ? Object.create(l) : (r.prototype = l.prototype, new r());\n };\n }(),\n K = f.charts,\n C = f.doc,\n y = f.noop,\n e = m.addEvent,\n I = m.css,\n v = m.objectEach,\n x = m.removeEvent,\n D = {},\n n = !!f.win.PointerEvent;\n return function (f) {\n function l() {\n return null !== f && f.apply(this, arguments) || this;\n }\n P(l, f);\n l.prototype.batchMSEvents = function (e) {\n e(this.chart.container, n ? \"pointerdown\" : \"MSPointerDown\", this.onContainerPointerDown);\n e(this.chart.container, n ? \"pointermove\" : \"MSPointerMove\", this.onContainerPointerMove);\n e(C, n ? \"pointerup\" : \"MSPointerUp\", this.onDocumentPointerUp);\n };\n l.prototype.destroy = function () {\n this.batchMSEvents(x);\n f.prototype.destroy.call(this);\n };\n l.prototype.init = function (e, l) {\n f.prototype.init.call(this, e, l);\n this.hasZoom && I(e.container, {\n \"-ms-touch-action\": \"none\",\n \"touch-action\": \"none\"\n });\n };\n l.prototype.onContainerPointerDown = function (e) {\n F(e, \"onContainerTouchStart\", \"touchstart\", function (e) {\n D[e.pointerId] = {\n pageX: e.pageX,\n pageY: e.pageY,\n target: e.currentTarget\n };\n });\n };\n l.prototype.onContainerPointerMove = function (e) {\n F(e, \"onContainerTouchMove\", \"touchmove\", function (e) {\n D[e.pointerId] = {\n pageX: e.pageX,\n pageY: e.pageY\n };\n D[e.pointerId].target || (D[e.pointerId].target = e.currentTarget);\n });\n };\n l.prototype.onDocumentPointerUp = function (e) {\n F(e, \"onDocumentTouchEnd\", \"touchend\", function (e) {\n delete D[e.pointerId];\n });\n };\n l.prototype.setDOMEvents = function () {\n f.prototype.setDOMEvents.call(this);\n (this.hasZoom || this.followTouchMove) && this.batchMSEvents(e);\n };\n return l;\n }(h);\n });\n N(m, \"Core/Legend.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h, m) {\n var z = f.animObject,\n F = f.setAnimation,\n L = m.addEvent,\n K = m.css,\n C = m.defined,\n y = m.discardElement,\n e = m.find,\n I = m.fireEvent,\n v = m.format,\n x = m.isNumber,\n D = m.merge,\n n = m.pick,\n l = m.relativeLength,\n J = m.stableSort,\n w = m.syncTimeout;\n f = m.wrap;\n m = h.isFirefox;\n var r = h.marginNames,\n d = h.win,\n g = function () {\n function c(a, c) {\n this.allItems = [];\n this.contentGroup = this.box = void 0;\n this.display = !1;\n this.group = void 0;\n this.offsetWidth = this.maxLegendWidth = this.maxItemWidth = this.legendWidth = this.legendHeight = this.lastLineHeight = this.lastItemY = this.itemY = this.itemX = this.itemMarginTop = this.itemMarginBottom = this.itemHeight = this.initialItemY = 0;\n this.options = {};\n this.padding = 0;\n this.pages = [];\n this.proximate = !1;\n this.scrollGroup = void 0;\n this.widthOption = this.totalItemWidth = this.titleHeight = this.symbolWidth = this.symbolHeight = 0;\n this.chart = a;\n this.init(a, c);\n }\n c.prototype.init = function (a, c) {\n this.chart = a;\n this.setOptions(c);\n c.enabled && (this.render(), L(this.chart, \"endResize\", function () {\n this.legend.positionCheckboxes();\n }), this.proximate ? this.unchartrender = L(this.chart, \"render\", function () {\n this.legend.proximatePositions();\n this.legend.positionItems();\n }) : this.unchartrender && this.unchartrender());\n };\n c.prototype.setOptions = function (a) {\n var c = n(a.padding, 8);\n this.options = a;\n this.chart.styledMode || (this.itemStyle = a.itemStyle, this.itemHiddenStyle = D(this.itemStyle, a.itemHiddenStyle));\n this.itemMarginTop = a.itemMarginTop || 0;\n this.itemMarginBottom = a.itemMarginBottom || 0;\n this.padding = c;\n this.initialItemY = c - 5;\n this.symbolWidth = n(a.symbolWidth, 16);\n this.pages = [];\n this.proximate = \"proximate\" === a.layout && !this.chart.inverted;\n this.baseline = void 0;\n };\n c.prototype.update = function (a, c) {\n var d = this.chart;\n this.setOptions(D(!0, this.options, a));\n this.destroy();\n d.isDirtyLegend = d.isDirtyBox = !0;\n n(c, !0) && d.redraw();\n I(this, \"afterUpdate\");\n };\n c.prototype.colorizeItem = function (a, c) {\n a.legendGroup[c ? \"removeClass\" : \"addClass\"](\"highcharts-legend-item-hidden\");\n if (!this.chart.styledMode) {\n var d = this.options,\n g = a.legendItem,\n e = a.legendLine,\n f = a.legendSymbol,\n q = this.itemHiddenStyle.color;\n d = c ? d.itemStyle.color : q;\n var l = c ? a.color || q : q,\n r = a.options && a.options.marker,\n n = {\n fill: l\n };\n g && g.css({\n fill: d,\n color: d\n });\n e && e.attr({\n stroke: l\n });\n f && (r && f.isMarker && (n = a.pointAttribs(), c || (n.stroke = n.fill = q)), f.attr(n));\n }\n I(this, \"afterColorizeItem\", {\n item: a,\n visible: c\n });\n };\n c.prototype.positionItems = function () {\n this.allItems.forEach(this.positionItem, this);\n this.chart.isResizing || this.positionCheckboxes();\n };\n c.prototype.positionItem = function (a) {\n var c = this,\n d = this.options,\n g = d.symbolPadding,\n e = !d.rtl,\n f = a._legendItemPos;\n d = f[0];\n f = f[1];\n var l = a.checkbox,\n n = a.legendGroup;\n n && n.element && (g = {\n translateX: e ? d : this.legendWidth - d - 2 * g - 4,\n translateY: f\n }, e = function () {\n I(c, \"afterPositionItem\", {\n item: a\n });\n }, C(n.translateY) ? n.animate(g, void 0, e) : (n.attr(g), e()));\n l && (l.x = d, l.y = f);\n };\n c.prototype.destroyItem = function (a) {\n var c = a.checkbox;\n [\"legendItem\", \"legendLine\", \"legendSymbol\", \"legendGroup\"].forEach(function (c) {\n a[c] && (a[c] = a[c].destroy());\n });\n c && y(a.checkbox);\n };\n c.prototype.destroy = function () {\n function a(a) {\n this[a] && (this[a] = this[a].destroy());\n }\n this.getAllItems().forEach(function (c) {\n [\"legendItem\", \"legendGroup\"].forEach(a, c);\n });\n \"clipRect up down pager nav box title group\".split(\" \").forEach(a, this);\n this.display = null;\n };\n c.prototype.positionCheckboxes = function () {\n var a = this.group && this.group.alignAttr,\n c = this.clipHeight || this.legendHeight,\n d = this.titleHeight;\n if (a) {\n var g = a.translateY;\n this.allItems.forEach(function (e) {\n var p = e.checkbox;\n if (p) {\n var f = g + d + p.y + (this.scrollOffset || 0) + 3;\n K(p, {\n left: a.translateX + e.checkboxOffset + p.x - 20 + \"px\",\n top: f + \"px\",\n display: this.proximate || f > g - 6 && f < g + c - 6 ? \"\" : \"none\"\n });\n }\n }, this);\n }\n };\n c.prototype.renderTitle = function () {\n var a = this.options,\n c = this.padding,\n d = a.title,\n g = 0;\n d.text && (this.title || (this.title = this.chart.renderer.label(d.text, c - 3, c - 4, null, null, null, a.useHTML, null, \"legend-title\").attr({\n zIndex: 1\n }), this.chart.styledMode || this.title.css(d.style), this.title.add(this.group)), d.width || this.title.css({\n width: this.maxLegendWidth + \"px\"\n }), a = this.title.getBBox(), g = a.height, this.offsetWidth = a.width, this.contentGroup.attr({\n translateY: g\n }));\n this.titleHeight = g;\n };\n c.prototype.setText = function (a) {\n var c = this.options;\n a.legendItem.attr({\n text: c.labelFormat ? v(c.labelFormat, a, this.chart) : c.labelFormatter.call(a)\n });\n };\n c.prototype.renderItem = function (a) {\n var c = this.chart,\n d = c.renderer,\n g = this.options,\n e = this.symbolWidth,\n f = g.symbolPadding,\n l = this.itemStyle,\n r = this.itemHiddenStyle,\n h = \"horizontal\" === g.layout ? n(g.itemDistance, 20) : 0,\n w = !g.rtl,\n v = a.legendItem,\n u = !a.series,\n b = !u && a.series.drawLegendSymbol ? a.series : a,\n k = b.options;\n k = this.createCheckboxForItem && k && k.showCheckbox;\n h = e + f + h + (k ? 20 : 0);\n var t = g.useHTML,\n H = a.options.className;\n v || (a.legendGroup = d.g(\"legend-item\").addClass(\"highcharts-\" + b.type + \"-series highcharts-color-\" + a.colorIndex + (H ? \" \" + H : \"\") + (u ? \" highcharts-series-\" + a.index : \"\")).attr({\n zIndex: 1\n }).add(this.scrollGroup), a.legendItem = v = d.text(\"\", w ? e + f : -f, this.baseline || 0, t), c.styledMode || v.css(D(a.visible ? l : r)), v.attr({\n align: w ? \"left\" : \"right\",\n zIndex: 2\n }).add(a.legendGroup), this.baseline || (this.fontMetrics = d.fontMetrics(c.styledMode ? 12 : l.fontSize, v), this.baseline = this.fontMetrics.f + 3 + this.itemMarginTop, v.attr(\"y\", this.baseline)), this.symbolHeight = g.symbolHeight || this.fontMetrics.f, b.drawLegendSymbol(this, a), this.setItemEvents && this.setItemEvents(a, v, t));\n k && !a.checkbox && this.createCheckboxForItem && this.createCheckboxForItem(a);\n this.colorizeItem(a, a.visible);\n !c.styledMode && l.width || v.css({\n width: (g.itemWidth || this.widthOption || c.spacingBox.width) - h + \"px\"\n });\n this.setText(a);\n c = v.getBBox();\n a.itemWidth = a.checkboxOffset = g.itemWidth || a.legendItemWidth || c.width + h;\n this.maxItemWidth = Math.max(this.maxItemWidth, a.itemWidth);\n this.totalItemWidth += a.itemWidth;\n this.itemHeight = a.itemHeight = Math.round(a.legendItemHeight || c.height || this.symbolHeight);\n };\n c.prototype.layoutItem = function (a) {\n var c = this.options,\n d = this.padding,\n g = \"horizontal\" === c.layout,\n e = a.itemHeight,\n f = this.itemMarginBottom,\n l = this.itemMarginTop,\n r = g ? n(c.itemDistance, 20) : 0,\n h = this.maxLegendWidth;\n c = c.alignColumns && this.totalItemWidth > h ? this.maxItemWidth : a.itemWidth;\n g && this.itemX - d + c > h && (this.itemX = d, this.lastLineHeight && (this.itemY += l + this.lastLineHeight + f), this.lastLineHeight = 0);\n this.lastItemY = l + this.itemY + f;\n this.lastLineHeight = Math.max(e, this.lastLineHeight);\n a._legendItemPos = [this.itemX, this.itemY];\n g ? this.itemX += c : (this.itemY += l + e + f, this.lastLineHeight = e);\n this.offsetWidth = this.widthOption || Math.max((g ? this.itemX - d - (a.checkbox ? 0 : r) : c) + d, this.offsetWidth);\n };\n c.prototype.getAllItems = function () {\n var a = [];\n this.chart.series.forEach(function (c) {\n var d = c && c.options;\n c && n(d.showInLegend, C(d.linkedTo) ? !1 : void 0, !0) && (a = a.concat(c.legendItems || (\"point\" === d.legendType ? c.data : c)));\n });\n I(this, \"afterGetAllItems\", {\n allItems: a\n });\n return a;\n };\n c.prototype.getAlignment = function () {\n var a = this.options;\n return this.proximate ? a.align.charAt(0) + \"tv\" : a.floating ? \"\" : a.align.charAt(0) + a.verticalAlign.charAt(0) + a.layout.charAt(0);\n };\n c.prototype.adjustMargins = function (a, c) {\n var d = this.chart,\n g = this.options,\n e = this.getAlignment();\n e && [/(lth|ct|rth)/, /(rtv|rm|rbv)/, /(rbh|cb|lbh)/, /(lbv|lm|ltv)/].forEach(function (f, p) {\n f.test(e) && !C(a[p]) && (d[r[p]] = Math.max(d[r[p]], d.legend[(p + 1) % 2 ? \"legendHeight\" : \"legendWidth\"] + [1, -1, -1, 1][p] * g[p % 2 ? \"x\" : \"y\"] + n(g.margin, 12) + c[p] + (d.titleOffset[p] || 0)));\n });\n };\n c.prototype.proximatePositions = function () {\n var a = this.chart,\n c = [],\n d = \"left\" === this.options.align;\n this.allItems.forEach(function (g) {\n var f;\n var p = d;\n if (g.yAxis) {\n g.xAxis.options.reversed && (p = !p);\n g.points && (f = e(p ? g.points : g.points.slice(0).reverse(), function (a) {\n return x(a.plotY);\n }));\n p = this.itemMarginTop + g.legendItem.getBBox().height + this.itemMarginBottom;\n var q = g.yAxis.top - a.plotTop;\n g.visible ? (f = f ? f.plotY : g.yAxis.height, f += q - .3 * p) : f = q + g.yAxis.height;\n c.push({\n target: f,\n size: p,\n item: g\n });\n }\n }, this);\n h.distribute(c, a.plotHeight);\n c.forEach(function (c) {\n c.item._legendItemPos[1] = a.plotTop - a.spacing[0] + c.pos;\n });\n };\n c.prototype.render = function () {\n var a = this.chart,\n c = a.renderer,\n d = this.group,\n g = this.box,\n e = this.options,\n f = this.padding;\n this.itemX = f;\n this.itemY = this.initialItemY;\n this.lastItemY = this.offsetWidth = 0;\n this.widthOption = l(e.width, a.spacingBox.width - f);\n var n = a.spacingBox.width - 2 * f - e.x;\n -1 < [\"rm\", \"lm\"].indexOf(this.getAlignment().substring(0, 2)) && (n /= 2);\n this.maxLegendWidth = this.widthOption || n;\n d || (this.group = d = c.g(\"legend\").attr({\n zIndex: 7\n }).add(), this.contentGroup = c.g().attr({\n zIndex: 1\n }).add(d), this.scrollGroup = c.g().add(this.contentGroup));\n this.renderTitle();\n var r = this.getAllItems();\n J(r, function (a, c) {\n return (a.options && a.options.legendIndex || 0) - (c.options && c.options.legendIndex || 0);\n });\n e.reversed && r.reverse();\n this.allItems = r;\n this.display = n = !!r.length;\n this.itemHeight = this.totalItemWidth = this.maxItemWidth = this.lastLineHeight = 0;\n r.forEach(this.renderItem, this);\n r.forEach(this.layoutItem, this);\n r = (this.widthOption || this.offsetWidth) + f;\n var h = this.lastItemY + this.lastLineHeight + this.titleHeight;\n h = this.handleOverflow(h);\n h += f;\n g || (this.box = g = c.rect().addClass(\"highcharts-legend-box\").attr({\n r: e.borderRadius\n }).add(d), g.isNew = !0);\n a.styledMode || g.attr({\n stroke: e.borderColor,\n \"stroke-width\": e.borderWidth || 0,\n fill: e.backgroundColor || \"none\"\n }).shadow(e.shadow);\n 0 < r && 0 < h && (g[g.isNew ? \"attr\" : \"animate\"](g.crisp.call({}, {\n x: 0,\n y: 0,\n width: r,\n height: h\n }, g.strokeWidth())), g.isNew = !1);\n g[n ? \"show\" : \"hide\"]();\n a.styledMode && \"none\" === d.getStyle(\"display\") && (r = h = 0);\n this.legendWidth = r;\n this.legendHeight = h;\n n && this.align();\n this.proximate || this.positionItems();\n I(this, \"afterRender\");\n };\n c.prototype.align = function (a) {\n void 0 === a && (a = this.chart.spacingBox);\n var c = this.chart,\n d = this.options,\n g = a.y;\n /(lth|ct|rth)/.test(this.getAlignment()) && 0 < c.titleOffset[0] ? g += c.titleOffset[0] : /(lbh|cb|rbh)/.test(this.getAlignment()) && 0 < c.titleOffset[2] && (g -= c.titleOffset[2]);\n g !== a.y && (a = D(a, {\n y: g\n }));\n this.group.align(D(d, {\n width: this.legendWidth,\n height: this.legendHeight,\n verticalAlign: this.proximate ? \"top\" : d.verticalAlign\n }), !0, a);\n };\n c.prototype.handleOverflow = function (a) {\n var c = this,\n d = this.chart,\n g = d.renderer,\n e = this.options,\n f = e.y,\n l = this.padding;\n f = d.spacingBox.height + (\"top\" === e.verticalAlign ? -f : f) - l;\n var r = e.maxHeight,\n h,\n w = this.clipRect,\n v = e.navigation,\n u = n(v.animation, !0),\n b = v.arrowSize || 12,\n k = this.nav,\n t = this.pages,\n H,\n m = this.allItems,\n D = function (a) {\n \"number\" === typeof a ? w.attr({\n height: a\n }) : w && (c.clipRect = w.destroy(), c.contentGroup.clip());\n c.contentGroup.div && (c.contentGroup.div.style.clip = a ? \"rect(\" + l + \"px,9999px,\" + (l + a) + \"px,0)\" : \"auto\");\n },\n x = function (a) {\n c[a] = g.circle(0, 0, 1.3 * b).translate(b / 2, b / 2).add(k);\n d.styledMode || c[a].attr(\"fill\", \"rgba(0,0,0,0.0001)\");\n return c[a];\n };\n \"horizontal\" !== e.layout || \"middle\" === e.verticalAlign || e.floating || (f /= 2);\n r && (f = Math.min(f, r));\n t.length = 0;\n a > f && !1 !== v.enabled ? (this.clipHeight = h = Math.max(f - 20 - this.titleHeight - l, 0), this.currentPage = n(this.currentPage, 1), this.fullHeight = a, m.forEach(function (a, b) {\n var c = a._legendItemPos[1],\n d = Math.round(a.legendItem.getBBox().height),\n g = t.length;\n if (!g || c - t[g - 1] > h && (H || c) !== t[g - 1]) t.push(H || c), g++;\n a.pageIx = g - 1;\n H && (m[b - 1].pageIx = g - 1);\n b === m.length - 1 && c + d - t[g - 1] > h && c !== H && (t.push(c), a.pageIx = g);\n c !== H && (H = c);\n }), w || (w = c.clipRect = g.clipRect(0, l, 9999, 0), c.contentGroup.clip(w)), D(h), k || (this.nav = k = g.g().attr({\n zIndex: 1\n }).add(this.group), this.up = g.symbol(\"triangle\", 0, 0, b, b).add(k), x(\"upTracker\").on(\"click\", function () {\n c.scroll(-1, u);\n }), this.pager = g.text(\"\", 15, 10).addClass(\"highcharts-legend-navigation\"), d.styledMode || this.pager.css(v.style), this.pager.add(k), this.down = g.symbol(\"triangle-down\", 0, 0, b, b).add(k), x(\"downTracker\").on(\"click\", function () {\n c.scroll(1, u);\n })), c.scroll(0), a = f) : k && (D(), this.nav = k.destroy(), this.scrollGroup.attr({\n translateY: 1\n }), this.clipHeight = 0);\n return a;\n };\n c.prototype.scroll = function (a, c) {\n var d = this,\n g = this.chart,\n e = this.pages,\n f = e.length,\n l = this.currentPage + a;\n a = this.clipHeight;\n var q = this.options.navigation,\n r = this.pager,\n h = this.padding;\n l > f && (l = f);\n 0 < l && (\"undefined\" !== typeof c && F(c, g), this.nav.attr({\n translateX: h,\n translateY: a + this.padding + 7 + this.titleHeight,\n visibility: \"visible\"\n }), [this.up, this.upTracker].forEach(function (a) {\n a.attr({\n \"class\": 1 === l ? \"highcharts-legend-nav-inactive\" : \"highcharts-legend-nav-active\"\n });\n }), r.attr({\n text: l + \"/\" + f\n }), [this.down, this.downTracker].forEach(function (a) {\n a.attr({\n x: 18 + this.pager.getBBox().width,\n \"class\": l === f ? \"highcharts-legend-nav-inactive\" : \"highcharts-legend-nav-active\"\n });\n }, this), g.styledMode || (this.up.attr({\n fill: 1 === l ? q.inactiveColor : q.activeColor\n }), this.upTracker.css({\n cursor: 1 === l ? \"default\" : \"pointer\"\n }), this.down.attr({\n fill: l === f ? q.inactiveColor : q.activeColor\n }), this.downTracker.css({\n cursor: l === f ? \"default\" : \"pointer\"\n })), this.scrollOffset = -e[l - 1] + this.initialItemY, this.scrollGroup.animate({\n translateY: this.scrollOffset\n }), this.currentPage = l, this.positionCheckboxes(), c = z(n(c, g.renderer.globalAnimation, !0)), w(function () {\n I(d, \"afterScroll\", {\n currentPage: l\n });\n }, c.duration));\n };\n return c;\n }();\n (/Trident\\/7\\.0/.test(d.navigator && d.navigator.userAgent) || m) && f(g.prototype, \"positionItem\", function (c, a) {\n var d = this,\n g = function () {\n a._legendItemPos && c.call(d, a);\n };\n g();\n d.bubbleLegend || setTimeout(g);\n });\n h.Legend = g;\n return h.Legend;\n });\n N(m, \"Core/Series/Point.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h, m) {\n var z = f.animObject,\n F = m.defined,\n L = m.erase,\n K = m.extend,\n C = m.fireEvent,\n y = m.format,\n e = m.getNestedProperty,\n I = m.isArray,\n v = m.isNumber,\n x = m.isObject,\n D = m.syncTimeout,\n n = m.pick,\n l = m.removeEvent,\n J = m.uniqueKey;\n \"\";\n f = function () {\n function f() {\n this.colorIndex = this.category = void 0;\n this.formatPrefix = \"point\";\n this.id = void 0;\n this.isNull = !1;\n this.percentage = this.options = this.name = void 0;\n this.selected = !1;\n this.total = this.series = void 0;\n this.visible = !0;\n this.x = void 0;\n }\n f.prototype.animateBeforeDestroy = function () {\n var e = this,\n d = {\n x: e.startXPos,\n opacity: 0\n },\n g,\n c = e.getGraphicalProps();\n c.singular.forEach(function (a) {\n g = \"dataLabel\" === a;\n e[a] = e[a].animate(g ? {\n x: e[a].startXPos,\n y: e[a].startYPos,\n opacity: 0\n } : d);\n });\n c.plural.forEach(function (a) {\n e[a].forEach(function (a) {\n a.element && a.animate(K({\n x: e.startXPos\n }, a.startYPos ? {\n x: a.startXPos,\n y: a.startYPos\n } : {}));\n });\n });\n };\n f.prototype.applyOptions = function (e, d) {\n var g = this.series,\n c = g.options.pointValKey || g.pointValKey;\n e = f.prototype.optionsToObject.call(this, e);\n K(this, e);\n this.options = this.options ? K(this.options, e) : e;\n e.group && delete this.group;\n e.dataLabels && delete this.dataLabels;\n c && (this.y = f.prototype.getNestedProperty.call(this, c));\n this.formatPrefix = (this.isNull = n(this.isValid && !this.isValid(), null === this.x || !v(this.y))) ? \"null\" : \"point\";\n this.selected && (this.state = \"select\");\n \"name\" in this && \"undefined\" === typeof d && g.xAxis && g.xAxis.hasNames && (this.x = g.xAxis.nameToX(this));\n \"undefined\" === typeof this.x && g && (this.x = \"undefined\" === typeof d ? g.autoIncrement(this) : d);\n return this;\n };\n f.prototype.destroy = function () {\n function e() {\n if (d.graphic || d.dataLabel || d.dataLabels) l(d), d.destroyElements();\n for (p in d) d[p] = null;\n }\n var d = this,\n g = d.series,\n c = g.chart;\n g = g.options.dataSorting;\n var a = c.hoverPoints,\n f = z(d.series.chart.renderer.globalAnimation),\n p;\n d.legendItem && c.legend.destroyItem(d);\n a && (d.setState(), L(a, d), a.length || (c.hoverPoints = null));\n if (d === c.hoverPoint) d.onMouseOut();\n g && g.enabled ? (this.animateBeforeDestroy(), D(e, f.duration)) : e();\n c.pointCount--;\n };\n f.prototype.destroyElements = function (e) {\n var d = this;\n e = d.getGraphicalProps(e);\n e.singular.forEach(function (g) {\n d[g] = d[g].destroy();\n });\n e.plural.forEach(function (g) {\n d[g].forEach(function (c) {\n c.element && c.destroy();\n });\n delete d[g];\n });\n };\n f.prototype.firePointEvent = function (e, d, g) {\n var c = this,\n a = this.series.options;\n (a.point.events[e] || c.options && c.options.events && c.options.events[e]) && c.importEvents();\n \"click\" === e && a.allowPointSelect && (g = function (a) {\n c.select && c.select(null, a.ctrlKey || a.metaKey || a.shiftKey);\n });\n C(c, e, d, g);\n };\n f.prototype.getClassName = function () {\n return \"highcharts-point\" + (this.selected ? \" highcharts-point-select\" : \"\") + (this.negative ? \" highcharts-negative\" : \"\") + (this.isNull ? \" highcharts-null-point\" : \"\") + (\"undefined\" !== typeof this.colorIndex ? \" highcharts-color-\" + this.colorIndex : \"\") + (this.options.className ? \" \" + this.options.className : \"\") + (this.zone && this.zone.className ? \" \" + this.zone.className.replace(\"highcharts-negative\", \"\") : \"\");\n };\n f.prototype.getGraphicalProps = function (e) {\n var d = this,\n g = [],\n c,\n a = {\n singular: [],\n plural: []\n };\n e = e || {\n graphic: 1,\n dataLabel: 1\n };\n e.graphic && g.push(\"graphic\", \"shadowGroup\");\n e.dataLabel && g.push(\"dataLabel\", \"dataLabelUpper\", \"connector\");\n for (c = g.length; c--;) {\n var f = g[c];\n d[f] && a.singular.push(f);\n }\n [\"dataLabel\", \"connector\"].forEach(function (c) {\n var g = c + \"s\";\n e[c] && d[g] && a.plural.push(g);\n });\n return a;\n };\n f.prototype.getLabelConfig = function () {\n return {\n x: this.category,\n y: this.y,\n color: this.color,\n colorIndex: this.colorIndex,\n key: this.name || this.category,\n series: this.series,\n point: this,\n percentage: this.percentage,\n total: this.total || this.stackTotal\n };\n };\n f.prototype.getNestedProperty = function (f) {\n if (f) return 0 === f.indexOf(\"custom.\") ? e(f, this.options) : this[f];\n };\n f.prototype.getZone = function () {\n var e = this.series,\n d = e.zones;\n e = e.zoneAxis || \"y\";\n var g = 0,\n c;\n for (c = d[g]; this[e] >= c.value;) c = d[++g];\n this.nonZonedColor || (this.nonZonedColor = this.color);\n this.color = c && c.color && !this.options.color ? c.color : this.nonZonedColor;\n return c;\n };\n f.prototype.hasNewShapeType = function () {\n return (this.graphic && (this.graphic.symbolName || this.graphic.element.nodeName)) !== this.shapeType;\n };\n f.prototype.init = function (e, d, g) {\n this.series = e;\n this.applyOptions(d, g);\n this.id = F(this.id) ? this.id : J();\n this.resolveColor();\n e.chart.pointCount++;\n C(this, \"afterInit\");\n return this;\n };\n f.prototype.optionsToObject = function (e) {\n var d = {},\n g = this.series,\n c = g.options.keys,\n a = c || g.pointArrayMap || [\"y\"],\n l = a.length,\n p = 0,\n n = 0;\n if (v(e) || null === e) d[a[0]] = e;else if (I(e)) for (!c && e.length > l && (g = typeof e[0], \"string\" === g ? d.name = e[0] : \"number\" === g && (d.x = e[0]), p++); n < l;) c && \"undefined\" === typeof e[p] || (0 < a[n].indexOf(\".\") ? f.prototype.setNestedProperty(d, e[p], a[n]) : d[a[n]] = e[p]), p++, n++;else \"object\" === typeof e && (d = e, e.dataLabels && (g._hasPointLabels = !0), e.marker && (g._hasPointMarkers = !0));\n return d;\n };\n f.prototype.resolveColor = function () {\n var e = this.series;\n var d = e.chart.options.chart.colorCount;\n var g = e.chart.styledMode;\n delete this.nonZonedColor;\n g || this.options.color || (this.color = e.color);\n e.options.colorByPoint ? (g || (d = e.options.colors || e.chart.options.colors, this.color = this.color || d[e.colorCounter], d = d.length), g = e.colorCounter, e.colorCounter++, e.colorCounter === d && (e.colorCounter = 0)) : g = e.colorIndex;\n this.colorIndex = n(this.colorIndex, g);\n };\n f.prototype.setNestedProperty = function (e, d, g) {\n g.split(\".\").reduce(function (c, a, g, e) {\n c[a] = e.length - 1 === g ? d : x(c[a], !0) ? c[a] : {};\n return c[a];\n }, e);\n return e;\n };\n f.prototype.tooltipFormatter = function (e) {\n var d = this.series,\n g = d.tooltipOptions,\n c = n(g.valueDecimals, \"\"),\n a = g.valuePrefix || \"\",\n f = g.valueSuffix || \"\";\n d.chart.styledMode && (e = d.chart.tooltip.styledModeFormat(e));\n (d.pointArrayMap || [\"y\"]).forEach(function (d) {\n d = \"{point.\" + d;\n if (a || f) e = e.replace(RegExp(d + \"}\", \"g\"), a + d + \"}\" + f);\n e = e.replace(RegExp(d + \"}\", \"g\"), d + \":,.\" + c + \"f}\");\n });\n return y(e, {\n point: this,\n series: this.series\n }, d.chart);\n };\n return f;\n }();\n return h.Point = f;\n });\n N(m, \"Core/Series/Series.js\", [m[\"Core/Globals.js\"], m[\"Core/Series/Point.js\"], m[\"Core/Utilities.js\"]], function (f, h, m) {\n var z = m.error,\n F = m.extendClass,\n L = m.fireEvent,\n K = m.getOptions,\n C = m.isObject,\n y = m.merge,\n e = m.objectEach;\n m = function () {\n function f(e, h) {\n var v = y(f.defaultOptions, h);\n this.chart = e;\n this._i = e.series.length;\n e.series.push(this);\n this.options = v;\n this.userOptions = y(h);\n }\n f.addSeries = function (e, h) {\n f.seriesTypes[e] = h;\n };\n f.cleanRecursively = function (h, m) {\n var v = {};\n e(h, function (e, l) {\n if (C(h[l], !0) && !h.nodeType && m[l]) e = f.cleanRecursively(h[l], m[l]), Object.keys(e).length && (v[l] = e);else if (C(h[l]) || h[l] !== m[l]) v[l] = h[l];\n });\n return v;\n };\n f.getSeries = function (e, h) {\n void 0 === h && (h = {});\n var v = e.options.chart;\n v = h.type || v.type || v.defaultSeriesType || \"\";\n var n = f.seriesTypes[v];\n n || z(17, !0, e, {\n missingModuleFor: v\n });\n return new n(e, h);\n };\n f.seriesType = function (e, m, D, n, l) {\n var v = K().plotOptions || {},\n w = f.seriesTypes;\n m = m || \"\";\n v[e] = y(v[m], D);\n f.addSeries(e, F(w[m] || function () {}, n));\n w[e].prototype.type = e;\n l && (w[e].prototype.pointClass = F(h, l));\n return w[e];\n };\n f.prototype.update = function (e, h) {\n void 0 === h && (h = !0);\n var m = this;\n e = f.cleanRecursively(e, this.userOptions);\n var n = e.type;\n \"undefined\" !== typeof n && n !== m.type && (m = f.getSeries(m.chart, e));\n L(m, \"update\", {\n newOptions: e\n });\n m.userOptions = y(e);\n L(m, \"afterUpdate\", {\n newOptions: e\n });\n h && m.chart.redraw();\n return m;\n };\n f.defaultOptions = {\n type: \"base\"\n };\n f.seriesTypes = {};\n return f;\n }();\n m.prototype.pointClass = h;\n f.seriesType = m.seriesType;\n f.seriesTypes = m.seriesTypes;\n return m;\n });\n N(m, \"Core/Chart/Chart.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Axis/Axis.js\"], m[\"Core/Series/Series.js\"], m[\"Core/Globals.js\"], m[\"Core/Legend.js\"], m[\"Core/MSPointer.js\"], m[\"Core/Options.js\"], m[\"Core/Pointer.js\"], m[\"Core/Time.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z, F, L, K, C, y, e) {\n var I = f.animate,\n v = f.animObject,\n x = f.setAnimation,\n D = z.charts,\n n = z.doc,\n l = z.win,\n J = K.defaultOptions,\n w = e.addEvent,\n r = e.attr,\n d = e.createElement,\n g = e.css,\n c = e.defined,\n a = e.discardElement,\n q = e.erase,\n p = e.error,\n B = e.extend,\n A = e.find,\n G = e.fireEvent,\n M = e.getStyle,\n T = e.isArray,\n Q = e.isFunction,\n O = e.isNumber,\n E = e.isObject,\n u = e.isString,\n b = e.merge,\n k = e.numberFormat,\n t = e.objectEach,\n H = e.pick,\n R = e.pInt,\n U = e.relativeLength,\n Z = e.removeEvent,\n aa = e.splat,\n ba = e.syncTimeout,\n S = e.uniqueKey,\n Y = z.marginNames,\n W = function () {\n function f(a, b, c) {\n this.yAxis = this.xAxis = this.userOptions = this.titleOffset = this.time = this.symbolCounter = this.spacingBox = this.spacing = this.series = this.renderTo = this.renderer = this.pointer = this.pointCount = this.plotWidth = this.plotTop = this.plotLeft = this.plotHeight = this.plotBox = this.options = this.numberFormatter = this.margin = this.legend = this.labelCollectors = this.isResizing = this.index = this.container = this.colorCounter = this.clipBox = this.chartWidth = this.chartHeight = this.bounds = this.axisOffset = this.axes = void 0;\n this.getArgs(a, b, c);\n }\n f.prototype.getArgs = function (a, b, c) {\n u(a) || a.nodeName ? (this.renderTo = a, this.init(b, c)) : this.init(a, b);\n };\n f.prototype.init = function (a, c) {\n var d,\n g = a.series,\n e = a.plotOptions || {};\n G(this, \"init\", {\n args: arguments\n }, function () {\n a.series = null;\n d = b(J, a);\n var f = d.chart || {};\n t(d.plotOptions, function (a, c) {\n E(a) && (a.tooltip = e[c] && b(e[c].tooltip) || void 0);\n });\n d.tooltip.userOptions = a.chart && a.chart.forExport && a.tooltip.userOptions || a.tooltip;\n d.series = a.series = g;\n this.userOptions = a;\n var p = f.events;\n this.margin = [];\n this.spacing = [];\n this.bounds = {\n h: {},\n v: {}\n };\n this.labelCollectors = [];\n this.callback = c;\n this.isResizing = 0;\n this.options = d;\n this.axes = [];\n this.series = [];\n this.time = a.time && Object.keys(a.time).length ? new y(a.time) : z.time;\n this.numberFormatter = f.numberFormatter || k;\n this.styledMode = f.styledMode;\n this.hasCartesianSeries = f.showAxes;\n var l = this;\n l.index = D.length;\n D.push(l);\n z.chartCount++;\n p && t(p, function (a, b) {\n Q(a) && w(l, b, a);\n });\n l.xAxis = [];\n l.yAxis = [];\n l.pointCount = l.colorCounter = l.symbolCounter = 0;\n G(l, \"afterInit\");\n l.firstRender();\n });\n };\n f.prototype.initSeries = function (a) {\n var b = this.options.chart;\n b = a.type || b.type || b.defaultSeriesType;\n var c = m.seriesTypes[b];\n c || p(17, !0, this, {\n missingModuleFor: b\n });\n b = new c(this, a);\n \"function\" === typeof b.init && b.init(this, a);\n return b;\n };\n f.prototype.setSeriesData = function () {\n this.getSeriesOrderByLinks().forEach(function (a) {\n a.points || a.data || !a.enabledDataSorting || a.setData(a.options.data, !1);\n });\n };\n f.prototype.getSeriesOrderByLinks = function () {\n return this.series.concat().sort(function (a, b) {\n return a.linkedSeries.length || b.linkedSeries.length ? b.linkedSeries.length - a.linkedSeries.length : 0;\n });\n };\n f.prototype.orderSeries = function (a) {\n var b = this.series;\n for (a = a || 0; a < b.length; a++) b[a] && (b[a].index = a, b[a].name = b[a].getName());\n };\n f.prototype.isInsidePlot = function (a, b, c) {\n var d = c ? b : a;\n a = c ? a : b;\n d = {\n x: d,\n y: a,\n isInsidePlot: 0 <= d && d <= this.plotWidth && 0 <= a && a <= this.plotHeight\n };\n G(this, \"afterIsInsidePlot\", d);\n return d.isInsidePlot;\n };\n f.prototype.redraw = function (a) {\n G(this, \"beforeRedraw\");\n var b = this,\n c = b.axes,\n d = b.series,\n g = b.pointer,\n k = b.legend,\n e = b.userOptions.legend,\n f = b.isDirtyLegend,\n t = b.hasCartesianSeries,\n p = b.isDirtyBox,\n l = b.renderer,\n q = l.isHidden(),\n h = [];\n b.setResponsive && b.setResponsive(!1);\n x(b.hasRendered ? a : !1, b);\n q && b.temporaryDisplay();\n b.layOutTitles();\n for (a = d.length; a--;) {\n var n = d[a];\n if (n.options.stacking) {\n var u = !0;\n if (n.isDirty) {\n var r = !0;\n break;\n }\n }\n }\n if (r) for (a = d.length; a--;) n = d[a], n.options.stacking && (n.isDirty = !0);\n d.forEach(function (a) {\n a.isDirty && (\"point\" === a.options.legendType ? (\"function\" === typeof a.updateTotals && a.updateTotals(), f = !0) : e && (e.labelFormatter || e.labelFormat) && (f = !0));\n a.isDirtyData && G(a, \"updatedData\");\n });\n f && k && k.options.enabled && (k.render(), b.isDirtyLegend = !1);\n u && b.getStacks();\n t && c.forEach(function (a) {\n b.isResizing && O(a.min) || (a.updateNames(), a.setScale());\n });\n b.getMargins();\n t && (c.forEach(function (a) {\n a.isDirty && (p = !0);\n }), c.forEach(function (a) {\n var b = a.min + \",\" + a.max;\n a.extKey !== b && (a.extKey = b, h.push(function () {\n G(a, \"afterSetExtremes\", B(a.eventArgs, a.getExtremes()));\n delete a.eventArgs;\n }));\n (p || u) && a.redraw();\n }));\n p && b.drawChartBox();\n G(b, \"predraw\");\n d.forEach(function (a) {\n (p || a.isDirty) && a.visible && a.redraw();\n a.isDirtyData = !1;\n });\n g && g.reset(!0);\n l.draw();\n G(b, \"redraw\");\n G(b, \"render\");\n q && b.temporaryDisplay(!0);\n h.forEach(function (a) {\n a.call();\n });\n };\n f.prototype.get = function (a) {\n function b(b) {\n return b.id === a || b.options && b.options.id === a;\n }\n var c = this.series,\n d;\n var g = A(this.axes, b) || A(this.series, b);\n for (d = 0; !g && d < c.length; d++) g = A(c[d].points || [], b);\n return g;\n };\n f.prototype.getAxes = function () {\n var a = this,\n b = this.options,\n c = b.xAxis = aa(b.xAxis || {});\n b = b.yAxis = aa(b.yAxis || {});\n G(this, \"getAxes\");\n c.forEach(function (a, b) {\n a.index = b;\n a.isX = !0;\n });\n b.forEach(function (a, b) {\n a.index = b;\n });\n c.concat(b).forEach(function (b) {\n new h(a, b);\n });\n G(this, \"afterGetAxes\");\n };\n f.prototype.getSelectedPoints = function () {\n var a = [];\n this.series.forEach(function (b) {\n a = a.concat(b.getPointsCollection().filter(function (a) {\n return H(a.selectedStaging, a.selected);\n }));\n });\n return a;\n };\n f.prototype.getSelectedSeries = function () {\n return this.series.filter(function (a) {\n return a.selected;\n });\n };\n f.prototype.setTitle = function (a, b, c) {\n this.applyDescription(\"title\", a);\n this.applyDescription(\"subtitle\", b);\n this.applyDescription(\"caption\", void 0);\n this.layOutTitles(c);\n };\n f.prototype.applyDescription = function (a, c) {\n var d = this,\n g = \"title\" === a ? {\n color: \"#333333\",\n fontSize: this.options.isStock ? \"16px\" : \"18px\"\n } : {\n color: \"#666666\"\n };\n g = this.options[a] = b(!this.styledMode && {\n style: g\n }, this.options[a], c);\n var k = this[a];\n k && c && (this[a] = k = k.destroy());\n g && !k && (k = this.renderer.text(g.text, 0, 0, g.useHTML).attr({\n align: g.align,\n \"class\": \"highcharts-\" + a,\n zIndex: g.zIndex || 4\n }).add(), k.update = function (b) {\n d[{\n title: \"setTitle\",\n subtitle: \"setSubtitle\",\n caption: \"setCaption\"\n }[a]](b);\n }, this.styledMode || k.css(g.style), this[a] = k);\n };\n f.prototype.layOutTitles = function (a) {\n var b = [0, 0, 0],\n c = this.renderer,\n d = this.spacingBox;\n [\"title\", \"subtitle\", \"caption\"].forEach(function (a) {\n var g = this[a],\n k = this.options[a],\n e = k.verticalAlign || \"top\";\n a = \"title\" === a ? -3 : \"top\" === e ? b[0] + 2 : 0;\n if (g) {\n if (!this.styledMode) var f = k.style.fontSize;\n f = c.fontMetrics(f, g).b;\n g.css({\n width: (k.width || d.width + (k.widthAdjust || 0)) + \"px\"\n });\n var t = Math.round(g.getBBox(k.useHTML).height);\n g.align(B({\n y: \"bottom\" === e ? f : a + f,\n height: t\n }, k), !1, \"spacingBox\");\n k.floating || (\"top\" === e ? b[0] = Math.ceil(b[0] + t) : \"bottom\" === e && (b[2] = Math.ceil(b[2] + t)));\n }\n }, this);\n b[0] && \"top\" === (this.options.title.verticalAlign || \"top\") && (b[0] += this.options.title.margin);\n b[2] && \"bottom\" === this.options.caption.verticalAlign && (b[2] += this.options.caption.margin);\n var g = !this.titleOffset || this.titleOffset.join(\",\") !== b.join(\",\");\n this.titleOffset = b;\n G(this, \"afterLayOutTitles\");\n !this.isDirtyBox && g && (this.isDirtyBox = this.isDirtyLegend = g, this.hasRendered && H(a, !0) && this.isDirtyBox && this.redraw());\n };\n f.prototype.getChartSize = function () {\n var a = this.options.chart,\n b = a.width;\n a = a.height;\n var d = this.renderTo;\n c(b) || (this.containerWidth = M(d, \"width\"));\n c(a) || (this.containerHeight = M(d, \"height\"));\n this.chartWidth = Math.max(0, b || this.containerWidth || 600);\n this.chartHeight = Math.max(0, U(a, this.chartWidth) || (1 < this.containerHeight ? this.containerHeight : 400));\n };\n f.prototype.temporaryDisplay = function (a) {\n var b = this.renderTo;\n if (a) for (; b && b.style;) b.hcOrigStyle && (g(b, b.hcOrigStyle), delete b.hcOrigStyle), b.hcOrigDetached && (n.body.removeChild(b), b.hcOrigDetached = !1), b = b.parentNode;else for (; b && b.style;) {\n n.body.contains(b) || b.parentNode || (b.hcOrigDetached = !0, n.body.appendChild(b));\n if (\"none\" === M(b, \"display\", !1) || b.hcOricDetached) b.hcOrigStyle = {\n display: b.style.display,\n height: b.style.height,\n overflow: b.style.overflow\n }, a = {\n display: \"block\",\n overflow: \"hidden\"\n }, b !== this.renderTo && (a.height = 0), g(b, a), b.offsetWidth || b.style.setProperty(\"display\", \"block\", \"important\");\n b = b.parentNode;\n if (b === n.body) break;\n }\n };\n f.prototype.setClassName = function (a) {\n this.container.className = \"highcharts-container \" + (a || \"\");\n };\n f.prototype.getContainer = function () {\n var a = this.options,\n b = a.chart;\n var c = this.renderTo;\n var k = S(),\n e,\n f;\n c || (this.renderTo = c = b.renderTo);\n u(c) && (this.renderTo = c = n.getElementById(c));\n c || p(13, !0, this);\n var t = R(r(c, \"data-highcharts-chart\"));\n O(t) && D[t] && D[t].hasRendered && D[t].destroy();\n r(c, \"data-highcharts-chart\", this.index);\n c.innerHTML = \"\";\n b.skipClone || c.offsetWidth || this.temporaryDisplay();\n this.getChartSize();\n t = this.chartWidth;\n var l = this.chartHeight;\n g(c, {\n overflow: \"hidden\"\n });\n this.styledMode || (e = B({\n position: \"relative\",\n overflow: \"hidden\",\n width: t + \"px\",\n height: l + \"px\",\n textAlign: \"left\",\n lineHeight: \"normal\",\n zIndex: 0,\n \"-webkit-tap-highlight-color\": \"rgba(0,0,0,0)\",\n userSelect: \"none\"\n }, b.style));\n this.container = c = d(\"div\", {\n id: k\n }, e, c);\n this._cursor = c.style.cursor;\n this.renderer = new (z[b.renderer] || z.Renderer)(c, t, l, null, b.forExport, a.exporting && a.exporting.allowHTML, this.styledMode);\n x(void 0, this);\n this.setClassName(b.className);\n if (this.styledMode) for (f in a.defs) this.renderer.definition(a.defs[f]);else this.renderer.setStyle(b.style);\n this.renderer.chartIndex = this.index;\n G(this, \"afterGetContainer\");\n };\n f.prototype.getMargins = function (a) {\n var b = this.spacing,\n d = this.margin,\n g = this.titleOffset;\n this.resetMargins();\n g[0] && !c(d[0]) && (this.plotTop = Math.max(this.plotTop, g[0] + b[0]));\n g[2] && !c(d[2]) && (this.marginBottom = Math.max(this.marginBottom, g[2] + b[2]));\n this.legend && this.legend.display && this.legend.adjustMargins(d, b);\n G(this, \"getMargins\");\n a || this.getAxisMargins();\n };\n f.prototype.getAxisMargins = function () {\n var a = this,\n b = a.axisOffset = [0, 0, 0, 0],\n d = a.colorAxis,\n g = a.margin,\n k = function (a) {\n a.forEach(function (a) {\n a.visible && a.getOffset();\n });\n };\n a.hasCartesianSeries ? k(a.axes) : d && d.length && k(d);\n Y.forEach(function (d, k) {\n c(g[k]) || (a[d] += b[k]);\n });\n a.setChartSize();\n };\n f.prototype.reflow = function (a) {\n var b = this,\n d = b.options.chart,\n g = b.renderTo,\n k = c(d.width) && c(d.height),\n f = d.width || M(g, \"width\");\n d = d.height || M(g, \"height\");\n g = a ? a.target : l;\n if (!k && !b.isPrinting && f && d && (g === l || g === n)) {\n if (f !== b.containerWidth || d !== b.containerHeight) e.clearTimeout(b.reflowTimeout), b.reflowTimeout = ba(function () {\n b.container && b.setSize(void 0, void 0, !1);\n }, a ? 100 : 0);\n b.containerWidth = f;\n b.containerHeight = d;\n }\n };\n f.prototype.setReflow = function (a) {\n var b = this;\n !1 === a || this.unbindReflow ? !1 === a && this.unbindReflow && (this.unbindReflow = this.unbindReflow()) : (this.unbindReflow = w(l, \"resize\", function (a) {\n b.options && b.reflow(a);\n }), w(this, \"destroy\", this.unbindReflow));\n };\n f.prototype.setSize = function (a, b, c) {\n var d = this,\n k = d.renderer;\n d.isResizing += 1;\n x(c, d);\n c = k.globalAnimation;\n d.oldChartHeight = d.chartHeight;\n d.oldChartWidth = d.chartWidth;\n \"undefined\" !== typeof a && (d.options.chart.width = a);\n \"undefined\" !== typeof b && (d.options.chart.height = b);\n d.getChartSize();\n d.styledMode || (c ? I : g)(d.container, {\n width: d.chartWidth + \"px\",\n height: d.chartHeight + \"px\"\n }, c);\n d.setChartSize(!0);\n k.setSize(d.chartWidth, d.chartHeight, c);\n d.axes.forEach(function (a) {\n a.isDirty = !0;\n a.setScale();\n });\n d.isDirtyLegend = !0;\n d.isDirtyBox = !0;\n d.layOutTitles();\n d.getMargins();\n d.redraw(c);\n d.oldChartHeight = null;\n G(d, \"resize\");\n ba(function () {\n d && G(d, \"endResize\", null, function () {\n --d.isResizing;\n });\n }, v(c).duration);\n };\n f.prototype.setChartSize = function (a) {\n var b = this.inverted,\n c = this.renderer,\n d = this.chartWidth,\n g = this.chartHeight,\n k = this.options.chart,\n e = this.spacing,\n f = this.clipOffset,\n t,\n p,\n l,\n q;\n this.plotLeft = t = Math.round(this.plotLeft);\n this.plotTop = p = Math.round(this.plotTop);\n this.plotWidth = l = Math.max(0, Math.round(d - t - this.marginRight));\n this.plotHeight = q = Math.max(0, Math.round(g - p - this.marginBottom));\n this.plotSizeX = b ? q : l;\n this.plotSizeY = b ? l : q;\n this.plotBorderWidth = k.plotBorderWidth || 0;\n this.spacingBox = c.spacingBox = {\n x: e[3],\n y: e[0],\n width: d - e[3] - e[1],\n height: g - e[0] - e[2]\n };\n this.plotBox = c.plotBox = {\n x: t,\n y: p,\n width: l,\n height: q\n };\n d = 2 * Math.floor(this.plotBorderWidth / 2);\n b = Math.ceil(Math.max(d, f[3]) / 2);\n c = Math.ceil(Math.max(d, f[0]) / 2);\n this.clipBox = {\n x: b,\n y: c,\n width: Math.floor(this.plotSizeX - Math.max(d, f[1]) / 2 - b),\n height: Math.max(0, Math.floor(this.plotSizeY - Math.max(d, f[2]) / 2 - c))\n };\n a || this.axes.forEach(function (a) {\n a.setAxisSize();\n a.setAxisTranslation();\n });\n G(this, \"afterSetChartSize\", {\n skipAxes: a\n });\n };\n f.prototype.resetMargins = function () {\n G(this, \"resetMargins\");\n var a = this,\n b = a.options.chart;\n [\"margin\", \"spacing\"].forEach(function (c) {\n var d = b[c],\n g = E(d) ? d : [d, d, d, d];\n [\"Top\", \"Right\", \"Bottom\", \"Left\"].forEach(function (d, k) {\n a[c][k] = H(b[c + d], g[k]);\n });\n });\n Y.forEach(function (b, c) {\n a[b] = H(a.margin[c], a.spacing[c]);\n });\n a.axisOffset = [0, 0, 0, 0];\n a.clipOffset = [0, 0, 0, 0];\n };\n f.prototype.drawChartBox = function () {\n var a = this.options.chart,\n b = this.renderer,\n c = this.chartWidth,\n d = this.chartHeight,\n g = this.chartBackground,\n k = this.plotBackground,\n e = this.plotBorder,\n f = this.styledMode,\n t = this.plotBGImage,\n p = a.backgroundColor,\n l = a.plotBackgroundColor,\n q = a.plotBackgroundImage,\n h,\n n = this.plotLeft,\n u = this.plotTop,\n r = this.plotWidth,\n m = this.plotHeight,\n w = this.plotBox,\n v = this.clipRect,\n H = this.clipBox,\n B = \"animate\";\n g || (this.chartBackground = g = b.rect().addClass(\"highcharts-background\").add(), B = \"attr\");\n if (f) var A = h = g.strokeWidth();else {\n A = a.borderWidth || 0;\n h = A + (a.shadow ? 8 : 0);\n p = {\n fill: p || \"none\"\n };\n if (A || g[\"stroke-width\"]) p.stroke = a.borderColor, p[\"stroke-width\"] = A;\n g.attr(p).shadow(a.shadow);\n }\n g[B]({\n x: h / 2,\n y: h / 2,\n width: c - h - A % 2,\n height: d - h - A % 2,\n r: a.borderRadius\n });\n B = \"animate\";\n k || (B = \"attr\", this.plotBackground = k = b.rect().addClass(\"highcharts-plot-background\").add());\n k[B](w);\n f || (k.attr({\n fill: l || \"none\"\n }).shadow(a.plotShadow), q && (t ? (q !== t.attr(\"href\") && t.attr(\"href\", q), t.animate(w)) : this.plotBGImage = b.image(q, n, u, r, m).add()));\n v ? v.animate({\n width: H.width,\n height: H.height\n }) : this.clipRect = b.clipRect(H);\n B = \"animate\";\n e || (B = \"attr\", this.plotBorder = e = b.rect().addClass(\"highcharts-plot-border\").attr({\n zIndex: 1\n }).add());\n f || e.attr({\n stroke: a.plotBorderColor,\n \"stroke-width\": a.plotBorderWidth || 0,\n fill: \"none\"\n });\n e[B](e.crisp({\n x: n,\n y: u,\n width: r,\n height: m\n }, -e.strokeWidth()));\n this.isDirtyBox = !1;\n G(this, \"afterDrawChartBox\");\n };\n f.prototype.propFromSeries = function () {\n var a = this,\n b = a.options.chart,\n c,\n d = a.options.series,\n g,\n k;\n [\"inverted\", \"angular\", \"polar\"].forEach(function (e) {\n c = m.seriesTypes[b.type || b.defaultSeriesType];\n k = b[e] || c && c.prototype[e];\n for (g = d && d.length; !k && g--;) (c = m.seriesTypes[d[g].type]) && c.prototype[e] && (k = !0);\n a[e] = k;\n });\n };\n f.prototype.linkSeries = function () {\n var a = this,\n b = a.series;\n b.forEach(function (a) {\n a.linkedSeries.length = 0;\n });\n b.forEach(function (b) {\n var c = b.options.linkedTo;\n u(c) && (c = \":previous\" === c ? a.series[b.index - 1] : a.get(c)) && c.linkedParent !== b && (c.linkedSeries.push(b), b.linkedParent = c, c.enabledDataSorting && b.setDataSortingOptions(), b.visible = H(b.options.visible, c.options.visible, b.visible));\n });\n G(this, \"afterLinkSeries\");\n };\n f.prototype.renderSeries = function () {\n this.series.forEach(function (a) {\n a.translate();\n a.render();\n });\n };\n f.prototype.renderLabels = function () {\n var a = this,\n b = a.options.labels;\n b.items && b.items.forEach(function (c) {\n var d = B(b.style, c.style),\n g = R(d.left) + a.plotLeft,\n k = R(d.top) + a.plotTop + 12;\n delete d.left;\n delete d.top;\n a.renderer.text(c.html, g, k).attr({\n zIndex: 2\n }).css(d).add();\n });\n };\n f.prototype.render = function () {\n var a = this.axes,\n b = this.colorAxis,\n c = this.renderer,\n d = this.options,\n g = 0,\n k = function (a) {\n a.forEach(function (a) {\n a.visible && a.render();\n });\n };\n this.setTitle();\n this.legend = new F(this, d.legend);\n this.getStacks && this.getStacks();\n this.getMargins(!0);\n this.setChartSize();\n d = this.plotWidth;\n a.some(function (a) {\n if (a.horiz && a.visible && a.options.labels.enabled && a.series.length) return g = 21, !0;\n });\n var e = this.plotHeight = Math.max(this.plotHeight - g, 0);\n a.forEach(function (a) {\n a.setScale();\n });\n this.getAxisMargins();\n var f = 1.1 < d / this.plotWidth;\n var t = 1.05 < e / this.plotHeight;\n if (f || t) a.forEach(function (a) {\n (a.horiz && f || !a.horiz && t) && a.setTickInterval(!0);\n }), this.getMargins();\n this.drawChartBox();\n this.hasCartesianSeries ? k(a) : b && b.length && k(b);\n this.seriesGroup || (this.seriesGroup = c.g(\"series-group\").attr({\n zIndex: 3\n }).add());\n this.renderSeries();\n this.renderLabels();\n this.addCredits();\n this.setResponsive && this.setResponsive();\n this.updateContainerScaling();\n this.hasRendered = !0;\n };\n f.prototype.addCredits = function (a) {\n var c = this,\n d = b(!0, this.options.credits, a);\n d.enabled && !this.credits && (this.credits = this.renderer.text(d.text + (this.mapCredits || \"\"), 0, 0).addClass(\"highcharts-credits\").on(\"click\", function () {\n d.href && (l.location.href = d.href);\n }).attr({\n align: d.position.align,\n zIndex: 8\n }), c.styledMode || this.credits.css(d.style), this.credits.add().align(d.position), this.credits.update = function (a) {\n c.credits = c.credits.destroy();\n c.addCredits(a);\n });\n };\n f.prototype.updateContainerScaling = function () {\n var a = this.container;\n if (2 < a.offsetWidth && 2 < a.offsetHeight && a.getBoundingClientRect) {\n var b = a.getBoundingClientRect(),\n c = b.width / a.offsetWidth;\n a = b.height / a.offsetHeight;\n 1 !== c || 1 !== a ? this.containerScaling = {\n scaleX: c,\n scaleY: a\n } : delete this.containerScaling;\n }\n };\n f.prototype.destroy = function () {\n var b = this,\n c = b.axes,\n d = b.series,\n g = b.container,\n k,\n e = g && g.parentNode;\n G(b, \"destroy\");\n b.renderer.forExport ? q(D, b) : D[b.index] = void 0;\n z.chartCount--;\n b.renderTo.removeAttribute(\"data-highcharts-chart\");\n Z(b);\n for (k = c.length; k--;) c[k] = c[k].destroy();\n this.scroller && this.scroller.destroy && this.scroller.destroy();\n for (k = d.length; k--;) d[k] = d[k].destroy();\n \"title subtitle chartBackground plotBackground plotBGImage plotBorder seriesGroup clipRect credits pointer rangeSelector legend resetZoomButton tooltip renderer\".split(\" \").forEach(function (a) {\n var c = b[a];\n c && c.destroy && (b[a] = c.destroy());\n });\n g && (g.innerHTML = \"\", Z(g), e && a(g));\n t(b, function (a, c) {\n delete b[c];\n });\n };\n f.prototype.firstRender = function () {\n var a = this,\n b = a.options;\n if (!a.isReadyToRender || a.isReadyToRender()) {\n a.getContainer();\n a.resetMargins();\n a.setChartSize();\n a.propFromSeries();\n a.getAxes();\n (T(b.series) ? b.series : []).forEach(function (b) {\n a.initSeries(b);\n });\n a.linkSeries();\n a.setSeriesData();\n G(a, \"beforeRender\");\n C && (a.pointer = z.hasTouch || !l.PointerEvent && !l.MSPointerEvent ? new C(a, b) : new L(a, b));\n a.render();\n if (!a.renderer.imgCount && !a.hasLoaded) a.onload();\n a.temporaryDisplay(!0);\n }\n };\n f.prototype.onload = function () {\n this.callbacks.concat([this.callback]).forEach(function (a) {\n a && \"undefined\" !== typeof this.index && a.apply(this, [this]);\n }, this);\n G(this, \"load\");\n G(this, \"render\");\n c(this.index) && this.setReflow(this.options.chart.reflow);\n this.hasLoaded = !0;\n };\n return f;\n }();\n W.prototype.callbacks = [];\n z.chart = function (a, b, c) {\n return new W(a, b, c);\n };\n return z.Chart = W;\n });\n N(m, \"Extensions/ScrollablePlotArea.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Chart/Chart.js\"], m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z) {\n var F = f.stop,\n L = z.addEvent,\n K = z.createElement,\n C = z.pick;\n \"\";\n L(h, \"afterSetChartSize\", function (f) {\n var e = this.options.chart.scrollablePlotArea,\n h = e && e.minWidth;\n e = e && e.minHeight;\n if (!this.renderer.forExport) {\n if (h) {\n if (this.scrollablePixelsX = h = Math.max(0, h - this.chartWidth)) {\n this.plotWidth += h;\n this.inverted ? (this.clipBox.height += h, this.plotBox.height += h) : (this.clipBox.width += h, this.plotBox.width += h);\n var v = {\n 1: {\n name: \"right\",\n value: h\n }\n };\n }\n } else e && (this.scrollablePixelsY = h = Math.max(0, e - this.chartHeight)) && (this.plotHeight += h, this.inverted ? (this.clipBox.width += h, this.plotBox.width += h) : (this.clipBox.height += h, this.plotBox.height += h), v = {\n 2: {\n name: \"bottom\",\n value: h\n }\n });\n v && !f.skipAxes && this.axes.forEach(function (e) {\n v[e.side] ? e.getPlotLinePath = function () {\n var f = v[e.side].name,\n h = this[f];\n this[f] = h - v[e.side].value;\n var l = m.Axis.prototype.getPlotLinePath.apply(this, arguments);\n this[f] = h;\n return l;\n } : (e.setAxisSize(), e.setAxisTranslation());\n });\n }\n });\n L(h, \"render\", function () {\n this.scrollablePixelsX || this.scrollablePixelsY ? (this.setUpScrolling && this.setUpScrolling(), this.applyFixed()) : this.fixedDiv && this.applyFixed();\n });\n h.prototype.setUpScrolling = function () {\n var f = this,\n e = {\n WebkitOverflowScrolling: \"touch\",\n overflowX: \"hidden\",\n overflowY: \"hidden\"\n };\n this.scrollablePixelsX && (e.overflowX = \"auto\");\n this.scrollablePixelsY && (e.overflowY = \"auto\");\n this.scrollingParent = K(\"div\", {\n className: \"highcharts-scrolling-parent\"\n }, {\n position: \"relative\"\n }, this.renderTo);\n this.scrollingContainer = K(\"div\", {\n className: \"highcharts-scrolling\"\n }, e, this.scrollingParent);\n L(this.scrollingContainer, \"scroll\", function () {\n f.pointer && delete f.pointer.chartPosition;\n });\n this.innerContainer = K(\"div\", {\n className: \"highcharts-inner-container\"\n }, null, this.scrollingContainer);\n this.innerContainer.appendChild(this.container);\n this.setUpScrolling = null;\n };\n h.prototype.moveFixedElements = function () {\n var f = this.container,\n e = this.fixedRenderer,\n h = \".highcharts-contextbutton .highcharts-credits .highcharts-legend .highcharts-legend-checkbox .highcharts-navigator-series .highcharts-navigator-xaxis .highcharts-navigator-yaxis .highcharts-navigator .highcharts-reset-zoom .highcharts-scrollbar .highcharts-subtitle .highcharts-title\".split(\" \"),\n m;\n this.scrollablePixelsX && !this.inverted ? m = \".highcharts-yaxis\" : this.scrollablePixelsX && this.inverted ? m = \".highcharts-xaxis\" : this.scrollablePixelsY && !this.inverted ? m = \".highcharts-xaxis\" : this.scrollablePixelsY && this.inverted && (m = \".highcharts-yaxis\");\n h.push(m, m + \"-labels\");\n h.forEach(function (h) {\n [].forEach.call(f.querySelectorAll(h), function (f) {\n (f.namespaceURI === e.SVG_NS ? e.box : e.box.parentNode).appendChild(f);\n f.style.pointerEvents = \"auto\";\n });\n });\n };\n h.prototype.applyFixed = function () {\n var f,\n e,\n h = !this.fixedDiv,\n v = this.options.chart.scrollablePlotArea;\n h ? (this.fixedDiv = K(\"div\", {\n className: \"highcharts-fixed\"\n }, {\n position: \"absolute\",\n overflow: \"hidden\",\n pointerEvents: \"none\",\n zIndex: 2,\n top: 0\n }, null, !0), null === (f = this.scrollingContainer) || void 0 === f ? void 0 : f.parentNode.insertBefore(this.fixedDiv, this.scrollingContainer), this.renderTo.style.overflow = \"visible\", this.fixedRenderer = f = new m.Renderer(this.fixedDiv, this.chartWidth, this.chartHeight, null === (e = this.options.chart) || void 0 === e ? void 0 : e.style), this.scrollableMask = f.path().attr({\n fill: this.options.chart.backgroundColor || \"#fff\",\n \"fill-opacity\": C(v.opacity, .85),\n zIndex: -1\n }).addClass(\"highcharts-scrollable-mask\").add(), this.moveFixedElements(), L(this, \"afterShowResetZoom\", this.moveFixedElements), L(this, \"afterLayOutTitles\", this.moveFixedElements)) : this.fixedRenderer.setSize(this.chartWidth, this.chartHeight);\n e = this.chartWidth + (this.scrollablePixelsX || 0);\n f = this.chartHeight + (this.scrollablePixelsY || 0);\n F(this.container);\n this.container.style.width = e + \"px\";\n this.container.style.height = f + \"px\";\n this.renderer.boxWrapper.attr({\n width: e,\n height: f,\n viewBox: [0, 0, e, f].join(\" \")\n });\n this.chartBackground.attr({\n width: e,\n height: f\n });\n this.scrollingContainer.style.height = this.chartHeight + \"px\";\n h && (v.scrollPositionX && (this.scrollingContainer.scrollLeft = this.scrollablePixelsX * v.scrollPositionX), v.scrollPositionY && (this.scrollingContainer.scrollTop = this.scrollablePixelsY * v.scrollPositionY));\n f = this.axisOffset;\n h = this.plotTop - f[0] - 1;\n v = this.plotLeft - f[3] - 1;\n e = this.plotTop + this.plotHeight + f[2] + 1;\n f = this.plotLeft + this.plotWidth + f[1] + 1;\n var x = this.plotLeft + this.plotWidth - (this.scrollablePixelsX || 0),\n D = this.plotTop + this.plotHeight - (this.scrollablePixelsY || 0);\n h = this.scrollablePixelsX ? [[\"M\", 0, h], [\"L\", this.plotLeft - 1, h], [\"L\", this.plotLeft - 1, e], [\"L\", 0, e], [\"Z\"], [\"M\", x, h], [\"L\", this.chartWidth, h], [\"L\", this.chartWidth, e], [\"L\", x, e], [\"Z\"]] : this.scrollablePixelsY ? [[\"M\", v, 0], [\"L\", v, this.plotTop - 1], [\"L\", f, this.plotTop - 1], [\"L\", f, 0], [\"Z\"], [\"M\", v, D], [\"L\", v, this.chartHeight], [\"L\", f, this.chartHeight], [\"L\", f, D], [\"Z\"]] : [[\"M\", 0, 0]];\n \"adjustHeight\" !== this.redrawTrigger && this.scrollableMask.attr({\n d: h\n });\n };\n });\n N(m, \"Core/Axis/StackingAxis.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = f.getDeferredAnimation,\n z = h.addEvent,\n F = h.destroyObjectProperties,\n L = h.fireEvent,\n K = h.objectEach,\n C = h.pick,\n y = function () {\n function e(e) {\n this.oldStacks = {};\n this.stacks = {};\n this.stacksTouched = 0;\n this.axis = e;\n }\n e.prototype.buildStacks = function () {\n var e = this.axis,\n f = e.series,\n h = C(e.options.reversedStacks, !0),\n m = f.length,\n n;\n if (!e.isXAxis) {\n this.usePercentage = !1;\n for (n = m; n--;) {\n var l = f[h ? n : m - n - 1];\n l.setStackedPoints();\n l.setGroupedPoints();\n }\n for (n = 0; n < m; n++) f[n].modifyStacks();\n L(e, \"afterBuildStacks\");\n }\n };\n e.prototype.cleanStacks = function () {\n if (!this.axis.isXAxis) {\n if (this.oldStacks) var e = this.stacks = this.oldStacks;\n K(e, function (e) {\n K(e, function (e) {\n e.cumulative = e.total;\n });\n });\n }\n };\n e.prototype.resetStacks = function () {\n var e = this,\n f = e.stacks;\n e.axis.isXAxis || K(f, function (f) {\n K(f, function (h, n) {\n h.touched < e.stacksTouched ? (h.destroy(), delete f[n]) : (h.total = null, h.cumulative = null);\n });\n });\n };\n e.prototype.renderStackTotals = function () {\n var e = this.axis,\n f = e.chart,\n h = f.renderer,\n D = this.stacks;\n e = m(f, e.options.stackLabels.animation);\n var n = this.stackTotalGroup = this.stackTotalGroup || h.g(\"stack-labels\").attr({\n visibility: \"visible\",\n zIndex: 6,\n opacity: 0\n }).add();\n n.translate(f.plotLeft, f.plotTop);\n K(D, function (e) {\n K(e, function (e) {\n e.render(n);\n });\n });\n n.animate({\n opacity: 1\n }, e);\n };\n return e;\n }();\n return function () {\n function e() {}\n e.compose = function (f) {\n z(f, \"init\", e.onInit);\n z(f, \"destroy\", e.onDestroy);\n };\n e.onDestroy = function () {\n var e = this.stacking;\n if (e) {\n var f = e.stacks;\n K(f, function (e, h) {\n F(e);\n f[h] = null;\n });\n e && e.stackTotalGroup && e.stackTotalGroup.destroy();\n }\n };\n e.onInit = function () {\n this.stacking || (this.stacking = new y(this));\n };\n return e;\n }();\n });\n N(m, \"Mixins/LegendSymbol.js\", [m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = h.merge,\n z = h.pick;\n return f.LegendSymbolMixin = {\n drawRectangle: function (f, h) {\n var m = f.symbolHeight,\n C = f.options.squareSymbol;\n h.legendSymbol = this.chart.renderer.rect(C ? (f.symbolWidth - m) / 2 : 0, f.baseline - m + 1, C ? m : f.symbolWidth, m, z(f.options.symbolRadius, m / 2)).addClass(\"highcharts-point\").attr({\n zIndex: 3\n }).add(h.legendGroup);\n },\n drawLineMarker: function (f) {\n var h = this.options,\n F = h.marker,\n C = f.symbolWidth,\n y = f.symbolHeight,\n e = y / 2,\n I = this.chart.renderer,\n v = this.legendGroup;\n f = f.baseline - Math.round(.3 * f.fontMetrics.b);\n var x = {};\n this.chart.styledMode || (x = {\n \"stroke-width\": h.lineWidth || 0\n }, h.dashStyle && (x.dashstyle = h.dashStyle));\n this.legendLine = I.path([[\"M\", 0, f], [\"L\", C, f]]).addClass(\"highcharts-graph\").attr(x).add(v);\n F && !1 !== F.enabled && C && (h = Math.min(z(F.radius, e), e), 0 === this.symbol.indexOf(\"url\") && (F = m(F, {\n width: y,\n height: y\n }), h = 0), this.legendSymbol = F = I.symbol(this.symbol, C / 2 - h, f - h, 2 * h, 2 * h, F).addClass(\"highcharts-point\").add(v), F.isMarker = !0);\n }\n };\n });\n N(m, \"Core/Series/CartesianSeries.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Series/Series.js\"], m[\"Core/Globals.js\"], m[\"Mixins/LegendSymbol.js\"], m[\"Core/Options.js\"], m[\"Core/Series/Point.js\"], m[\"Core/Renderer/SVG/SVGElement.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z, F, L, K, C) {\n var y = f.animObject,\n e = F.defaultOptions,\n I = C.addEvent,\n v = C.arrayMax,\n x = C.arrayMin,\n D = C.clamp,\n n = C.correctFloat,\n l = C.defined,\n J = C.erase,\n w = C.error,\n r = C.extend,\n d = C.find,\n g = C.fireEvent,\n c = C.getNestedProperty,\n a = C.isArray,\n q = C.isFunction,\n p = C.isNumber,\n B = C.isString,\n A = C.merge,\n G = C.objectEach,\n M = C.pick,\n T = C.removeEvent,\n Q = C.splat,\n O = C.syncTimeout;\n \"\";\n var E = h.seriesTypes,\n u = m.win;\n f = h.seriesType(\"line\", void 0, {\n lineWidth: 2,\n allowPointSelect: !1,\n crisp: !0,\n showCheckbox: !1,\n animation: {\n duration: 1E3\n },\n events: {},\n marker: {\n enabledThreshold: 2,\n lineColor: \"#ffffff\",\n lineWidth: 0,\n radius: 4,\n states: {\n normal: {\n animation: !0\n },\n hover: {\n animation: {\n duration: 50\n },\n enabled: !0,\n radiusPlus: 2,\n lineWidthPlus: 1\n },\n select: {\n fillColor: \"#cccccc\",\n lineColor: \"#000000\",\n lineWidth: 2\n }\n }\n },\n point: {\n events: {}\n },\n dataLabels: {\n animation: {},\n align: \"center\",\n defer: !0,\n formatter: function () {\n var a = this.series.chart.numberFormatter;\n return \"number\" !== typeof this.y ? \"\" : a(this.y, -1);\n },\n padding: 5,\n style: {\n fontSize: \"11px\",\n fontWeight: \"bold\",\n color: \"contrast\",\n textOutline: \"1px contrast\"\n },\n verticalAlign: \"bottom\",\n x: 0,\n y: 0\n },\n cropThreshold: 300,\n opacity: 1,\n pointRange: 0,\n softThreshold: !0,\n states: {\n normal: {\n animation: !0\n },\n hover: {\n animation: {\n duration: 50\n },\n lineWidthPlus: 1,\n marker: {},\n halo: {\n size: 10,\n opacity: .25\n }\n },\n select: {\n animation: {\n duration: 0\n }\n },\n inactive: {\n animation: {\n duration: 50\n },\n opacity: .2\n }\n },\n stickyTracking: !0,\n turboThreshold: 1E3,\n findNearestPointBy: \"x\"\n }, {\n axisTypes: [\"xAxis\", \"yAxis\"],\n coll: \"series\",\n colorCounter: 0,\n cropShoulder: 1,\n directTouch: !1,\n isCartesian: !0,\n parallelArrays: [\"x\", \"y\"],\n pointClass: L,\n requireSorting: !0,\n sorted: !0,\n init: function (a, c) {\n g(this, \"init\", {\n options: c\n });\n var b = this,\n d = a.series,\n k;\n this.eventOptions = this.eventOptions || {};\n this.eventsToUnbind = [];\n b.chart = a;\n b.options = c = b.setOptions(c);\n b.linkedSeries = [];\n b.bindAxes();\n r(b, {\n name: c.name,\n state: \"\",\n visible: !1 !== c.visible,\n selected: !0 === c.selected\n });\n var e = c.events;\n G(e, function (a, c) {\n q(a) && b.eventOptions[c] !== a && (q(b.eventOptions[c]) && T(b, c, b.eventOptions[c]), b.eventOptions[c] = a, I(b, c, a));\n });\n if (e && e.click || c.point && c.point.events && c.point.events.click || c.allowPointSelect) a.runTrackerClick = !0;\n b.getColor();\n b.getSymbol();\n b.parallelArrays.forEach(function (a) {\n b[a + \"Data\"] || (b[a + \"Data\"] = []);\n });\n b.isCartesian && (a.hasCartesianSeries = !0);\n d.length && (k = d[d.length - 1]);\n b._i = M(k && k._i, -1) + 1;\n b.opacity = b.options.opacity;\n a.orderSeries(this.insert(d));\n c.dataSorting && c.dataSorting.enabled ? b.setDataSortingOptions() : b.points || b.data || b.setData(c.data, !1);\n g(this, \"afterInit\");\n },\n is: function (a) {\n return E[a] && this instanceof E[a];\n },\n insert: function (a) {\n var b = this.options.index,\n c;\n if (p(b)) {\n for (c = a.length; c--;) if (b >= M(a[c].options.index, a[c]._i)) {\n a.splice(c + 1, 0, this);\n break;\n }\n -1 === c && a.unshift(this);\n c += 1;\n } else a.push(this);\n return M(c, a.length - 1);\n },\n bindAxes: function () {\n var a = this,\n c = a.options,\n d = a.chart,\n e;\n g(this, \"bindAxes\", null, function () {\n (a.axisTypes || []).forEach(function (b) {\n d[b].forEach(function (d) {\n e = d.options;\n if (c[b] === e.index || \"undefined\" !== typeof c[b] && c[b] === e.id || \"undefined\" === typeof c[b] && 0 === e.index) a.insert(d.series), a[b] = d, d.isDirty = !0;\n });\n a[b] || a.optionalAxis === b || w(18, !0, d);\n });\n });\n g(this, \"afterBindAxes\");\n },\n updateParallelArrays: function (a, c) {\n var b = a.series,\n d = arguments,\n g = p(c) ? function (d) {\n var g = \"y\" === d && b.toYData ? b.toYData(a) : a[d];\n b[d + \"Data\"][c] = g;\n } : function (a) {\n Array.prototype[c].apply(b[a + \"Data\"], Array.prototype.slice.call(d, 2));\n };\n b.parallelArrays.forEach(g);\n },\n hasData: function () {\n return this.visible && \"undefined\" !== typeof this.dataMax && \"undefined\" !== typeof this.dataMin || this.visible && this.yData && 0 < this.yData.length;\n },\n autoIncrement: function () {\n var a = this.options,\n c = this.xIncrement,\n d,\n g = a.pointIntervalUnit,\n e = this.chart.time;\n c = M(c, a.pointStart, 0);\n this.pointInterval = d = M(this.pointInterval, a.pointInterval, 1);\n g && (a = new e.Date(c), \"day\" === g ? e.set(\"Date\", a, e.get(\"Date\", a) + d) : \"month\" === g ? e.set(\"Month\", a, e.get(\"Month\", a) + d) : \"year\" === g && e.set(\"FullYear\", a, e.get(\"FullYear\", a) + d), d = a.getTime() - c);\n this.xIncrement = c + d;\n return c;\n },\n setDataSortingOptions: function () {\n var a = this.options;\n r(this, {\n requireSorting: !1,\n sorted: !1,\n enabledDataSorting: !0,\n allowDG: !1\n });\n l(a.pointRange) || (a.pointRange = 1);\n },\n setOptions: function (a) {\n var b = this.chart,\n c = b.options,\n d = c.plotOptions,\n f = b.userOptions || {};\n a = A(a);\n b = b.styledMode;\n var p = {\n plotOptions: d,\n userOptions: a\n };\n g(this, \"setOptions\", p);\n var h = p.plotOptions[this.type],\n q = f.plotOptions || {};\n this.userOptions = p.userOptions;\n f = A(h, d.series, f.plotOptions && f.plotOptions[this.type], a);\n this.tooltipOptions = A(e.tooltip, e.plotOptions.series && e.plotOptions.series.tooltip, e.plotOptions[this.type].tooltip, c.tooltip.userOptions, d.series && d.series.tooltip, d[this.type].tooltip, a.tooltip);\n this.stickyTracking = M(a.stickyTracking, q[this.type] && q[this.type].stickyTracking, q.series && q.series.stickyTracking, this.tooltipOptions.shared && !this.noSharedTooltip ? !0 : f.stickyTracking);\n null === h.marker && delete f.marker;\n this.zoneAxis = f.zoneAxis;\n c = this.zones = (f.zones || []).slice();\n !f.negativeColor && !f.negativeFillColor || f.zones || (d = {\n value: f[this.zoneAxis + \"Threshold\"] || f.threshold || 0,\n className: \"highcharts-negative\"\n }, b || (d.color = f.negativeColor, d.fillColor = f.negativeFillColor), c.push(d));\n c.length && l(c[c.length - 1].value) && c.push(b ? {} : {\n color: this.color,\n fillColor: this.fillColor\n });\n g(this, \"afterSetOptions\", {\n options: f\n });\n return f;\n },\n getName: function () {\n return M(this.options.name, \"Series \" + (this.index + 1));\n },\n getCyclic: function (a, c, d) {\n var b = this.chart,\n g = this.userOptions,\n k = a + \"Index\",\n e = a + \"Counter\",\n f = d ? d.length : M(b.options.chart[a + \"Count\"], b[a + \"Count\"]);\n if (!c) {\n var p = M(g[k], g[\"_\" + k]);\n l(p) || (b.series.length || (b[e] = 0), g[\"_\" + k] = p = b[e] % f, b[e] += 1);\n d && (c = d[p]);\n }\n \"undefined\" !== typeof p && (this[k] = p);\n this[a] = c;\n },\n getColor: function () {\n this.chart.styledMode ? this.getCyclic(\"color\") : this.options.colorByPoint ? this.options.color = null : this.getCyclic(\"color\", this.options.color || e.plotOptions[this.type].color, this.chart.options.colors);\n },\n getPointsCollection: function () {\n return (this.hasGroupedData ? this.points : this.data) || [];\n },\n getSymbol: function () {\n this.getCyclic(\"symbol\", this.options.marker.symbol, this.chart.options.symbols);\n },\n findPointIndex: function (a, c) {\n var b = a.id,\n g = a.x,\n k = this.points,\n e,\n f = this.options.dataSorting;\n if (b) var l = this.chart.get(b);else if (this.linkedParent || this.enabledDataSorting) {\n var h = f && f.matchByName ? \"name\" : \"index\";\n l = d(k, function (b) {\n return !b.touched && b[h] === a[h];\n });\n if (!l) return;\n }\n if (l) {\n var q = l && l.index;\n \"undefined\" !== typeof q && (e = !0);\n }\n \"undefined\" === typeof q && p(g) && (q = this.xData.indexOf(g, c));\n -1 !== q && \"undefined\" !== typeof q && this.cropped && (q = q >= this.cropStart ? q - this.cropStart : q);\n !e && k[q] && k[q].touched && (q = void 0);\n return q;\n },\n drawLegendSymbol: z.drawLineMarker,\n updateData: function (a, c) {\n var b = this.options,\n d = b.dataSorting,\n g = this.points,\n k = [],\n e,\n f,\n h,\n q = this.requireSorting,\n n = a.length === g.length,\n u = !0;\n this.xIncrement = null;\n a.forEach(function (a, c) {\n var f = l(a) && this.pointClass.prototype.optionsToObject.call({\n series: this\n }, a) || {};\n var t = f.x;\n if (f.id || p(t)) {\n if (t = this.findPointIndex(f, h), -1 === t || \"undefined\" === typeof t ? k.push(a) : g[t] && a !== b.data[t] ? (g[t].update(a, !1, null, !1), g[t].touched = !0, q && (h = t + 1)) : g[t] && (g[t].touched = !0), !n || c !== t || d && d.enabled || this.hasDerivedData) e = !0;\n } else k.push(a);\n }, this);\n if (e) for (a = g.length; a--;) (f = g[a]) && !f.touched && f.remove && f.remove(!1, c);else !n || d && d.enabled ? u = !1 : (a.forEach(function (a, b) {\n g[b].update && a !== g[b].y && g[b].update(a, !1, null, !1);\n }), k.length = 0);\n g.forEach(function (a) {\n a && (a.touched = !1);\n });\n if (!u) return !1;\n k.forEach(function (a) {\n this.addPoint(a, !1, null, null, !1);\n }, this);\n null === this.xIncrement && this.xData && this.xData.length && (this.xIncrement = v(this.xData), this.autoIncrement());\n return !0;\n },\n setData: function (b, c, d, g) {\n var k = this,\n e = k.points,\n f = e && e.length || 0,\n t,\n l = k.options,\n h = k.chart,\n q = l.dataSorting,\n n = null,\n u = k.xAxis;\n n = l.turboThreshold;\n var r = this.xData,\n m = this.yData,\n A = (t = k.pointArrayMap) && t.length,\n v = l.keys,\n E = 0,\n H = 1,\n O;\n b = b || [];\n t = b.length;\n c = M(c, !0);\n q && q.enabled && (b = this.sortData(b));\n !1 !== g && t && f && !k.cropped && !k.hasGroupedData && k.visible && !k.isSeriesBoosting && (O = this.updateData(b, d));\n if (!O) {\n k.xIncrement = null;\n k.colorCounter = 0;\n this.parallelArrays.forEach(function (a) {\n k[a + \"Data\"].length = 0;\n });\n if (n && t > n) {\n if (n = k.getFirstValidPoint(b), p(n)) for (d = 0; d < t; d++) r[d] = this.autoIncrement(), m[d] = b[d];else if (a(n)) {\n if (A) for (d = 0; d < t; d++) g = b[d], r[d] = g[0], m[d] = g.slice(1, A + 1);else for (v && (E = v.indexOf(\"x\"), H = v.indexOf(\"y\"), E = 0 <= E ? E : 0, H = 0 <= H ? H : 1), d = 0; d < t; d++) g = b[d], r[d] = g[E], m[d] = g[H];\n } else w(12, !1, h);\n } else for (d = 0; d < t; d++) \"undefined\" !== typeof b[d] && (g = {\n series: k\n }, k.pointClass.prototype.applyOptions.apply(g, [b[d]]), k.updateParallelArrays(g, d));\n m && B(m[0]) && w(14, !0, h);\n k.data = [];\n k.options.data = k.userOptions.data = b;\n for (d = f; d--;) e[d] && e[d].destroy && e[d].destroy();\n u && (u.minRange = u.userMinRange);\n k.isDirty = h.isDirtyBox = !0;\n k.isDirtyData = !!e;\n d = !1;\n }\n \"point\" === l.legendType && (this.processData(), this.generatePoints());\n c && h.redraw(d);\n },\n sortData: function (a) {\n var b = this,\n d = b.options.dataSorting.sortKey || \"y\",\n g = function (a, b) {\n return l(b) && a.pointClass.prototype.optionsToObject.call({\n series: a\n }, b) || {};\n };\n a.forEach(function (c, d) {\n a[d] = g(b, c);\n a[d].index = d;\n }, this);\n a.concat().sort(function (a, b) {\n a = c(d, a);\n b = c(d, b);\n return b < a ? -1 : b > a ? 1 : 0;\n }).forEach(function (a, b) {\n a.x = b;\n }, this);\n b.linkedSeries && b.linkedSeries.forEach(function (b) {\n var c = b.options,\n d = c.data;\n c.dataSorting && c.dataSorting.enabled || !d || (d.forEach(function (c, k) {\n d[k] = g(b, c);\n a[k] && (d[k].x = a[k].x, d[k].index = k);\n }), b.setData(d, !1));\n });\n return a;\n },\n getProcessedData: function (a) {\n var b = this.xData,\n c = this.yData,\n d = b.length;\n var g = 0;\n var e = this.xAxis,\n f = this.options;\n var p = f.cropThreshold;\n var l = a || this.getExtremesFromAll || f.getExtremesFromAll,\n h = this.isCartesian;\n a = e && e.val2lin;\n f = !(!e || !e.logarithmic);\n var q = this.requireSorting;\n if (e) {\n e = e.getExtremes();\n var n = e.min;\n var u = e.max;\n }\n if (h && this.sorted && !l && (!p || d > p || this.forceCrop)) if (b[d - 1] < n || b[0] > u) b = [], c = [];else if (this.yData && (b[0] < n || b[d - 1] > u)) {\n g = this.cropData(this.xData, this.yData, n, u);\n b = g.xData;\n c = g.yData;\n g = g.start;\n var r = !0;\n }\n for (p = b.length || 1; --p;) if (d = f ? a(b[p]) - a(b[p - 1]) : b[p] - b[p - 1], 0 < d && (\"undefined\" === typeof m || d < m)) var m = d;else 0 > d && q && (w(15, !1, this.chart), q = !1);\n return {\n xData: b,\n yData: c,\n cropped: r,\n cropStart: g,\n closestPointRange: m\n };\n },\n processData: function (a) {\n var b = this.xAxis;\n if (this.isCartesian && !this.isDirty && !b.isDirty && !this.yAxis.isDirty && !a) return !1;\n a = this.getProcessedData();\n this.cropped = a.cropped;\n this.cropStart = a.cropStart;\n this.processedXData = a.xData;\n this.processedYData = a.yData;\n this.closestPointRange = this.basePointRange = a.closestPointRange;\n },\n cropData: function (a, c, d, g, e) {\n var b = a.length,\n k = 0,\n f = b,\n p;\n e = M(e, this.cropShoulder);\n for (p = 0; p < b; p++) if (a[p] >= d) {\n k = Math.max(0, p - e);\n break;\n }\n for (d = p; d < b; d++) if (a[d] > g) {\n f = d + e;\n break;\n }\n return {\n xData: a.slice(k, f),\n yData: c.slice(k, f),\n start: k,\n end: f\n };\n },\n generatePoints: function () {\n var a = this.options,\n c = a.data,\n d = this.data,\n e,\n f = this.processedXData,\n p = this.processedYData,\n l = this.pointClass,\n h = f.length,\n q = this.cropStart || 0,\n n = this.hasGroupedData;\n a = a.keys;\n var u = [],\n m;\n d || n || (d = [], d.length = c.length, d = this.data = d);\n a && n && (this.options.keys = !1);\n for (m = 0; m < h; m++) {\n var w = q + m;\n if (n) {\n var v = new l().init(this, [f[m]].concat(Q(p[m])));\n v.dataGroup = this.groupMap[m];\n v.dataGroup.options && (v.options = v.dataGroup.options, r(v, v.dataGroup.options), delete v.dataLabels);\n } else (v = d[w]) || \"undefined\" === typeof c[w] || (d[w] = v = new l().init(this, c[w], f[m]));\n v && (v.index = w, u[m] = v);\n }\n this.options.keys = a;\n if (d && (h !== (e = d.length) || n)) for (m = 0; m < e; m++) m !== q || n || (m += h), d[m] && (d[m].destroyElements(), d[m].plotX = void 0);\n this.data = d;\n this.points = u;\n g(this, \"afterGeneratePoints\");\n },\n getXExtremes: function (a) {\n return {\n min: x(a),\n max: v(a)\n };\n },\n getExtremes: function (b, c) {\n var d = this.xAxis,\n k = this.yAxis,\n e = this.processedXData || this.xData,\n f = [],\n l = 0,\n h = 0;\n var q = 0;\n var n = this.requireSorting ? this.cropShoulder : 0,\n u = k ? k.positiveValuesOnly : !1,\n r;\n b = b || this.stackedYData || this.processedYData || [];\n k = b.length;\n d && (q = d.getExtremes(), h = q.min, q = q.max);\n for (r = 0; r < k; r++) {\n var m = e[r];\n var w = b[r];\n var A = (p(w) || a(w)) && (w.length || 0 < w || !u);\n m = c || this.getExtremesFromAll || this.options.getExtremesFromAll || this.cropped || !d || (e[r + n] || m) >= h && (e[r - n] || m) <= q;\n if (A && m) if (A = w.length) for (; A--;) p(w[A]) && (f[l++] = w[A]);else f[l++] = w;\n }\n b = {\n dataMin: x(f),\n dataMax: v(f)\n };\n g(this, \"afterGetExtremes\", {\n dataExtremes: b\n });\n return b;\n },\n applyExtremes: function () {\n var a = this.getExtremes();\n this.dataMin = a.dataMin;\n this.dataMax = a.dataMax;\n return a;\n },\n getFirstValidPoint: function (a) {\n for (var b = null, c = a.length, d = 0; null === b && d < c;) b = a[d], d++;\n return b;\n },\n translate: function () {\n this.processedXData || this.processData();\n this.generatePoints();\n var b = this.options,\n c = b.stacking,\n d = this.xAxis,\n e = d.categories,\n f = this.enabledDataSorting,\n h = this.yAxis,\n q = this.points,\n u = q.length,\n r = !!this.modifyValue,\n m,\n w = this.pointPlacementToXValue(),\n v = !!w,\n A = b.threshold,\n B = b.startFromThreshold ? A : 0,\n E,\n O = this.zoneAxis || \"y\",\n G = Number.MAX_VALUE;\n for (m = 0; m < u; m++) {\n var x = q[m],\n y = x.x,\n z = x.y,\n C = x.low,\n J = c && h.stacking && h.stacking.stacks[(this.negStacks && z < (B ? 0 : A) ? \"-\" : \"\") + this.stackKey];\n if (h.positiveValuesOnly && !h.validatePositiveValue(z) || d.positiveValuesOnly && !d.validatePositiveValue(y)) x.isNull = !0;\n x.plotX = E = n(D(d.translate(y, 0, 0, 0, 1, w, \"flags\" === this.type), -1E5, 1E5));\n if (c && this.visible && J && J[y]) {\n var F = this.getStackIndicator(F, y, this.index);\n if (!x.isNull) {\n var Q = J[y];\n var I = Q.points[F.key];\n }\n }\n a(I) && (C = I[0], z = I[1], C === B && F.key === J[y].base && (C = M(p(A) && A, h.min)), h.positiveValuesOnly && 0 >= C && (C = null), x.total = x.stackTotal = Q.total, x.percentage = Q.total && x.y / Q.total * 100, x.stackY = z, this.irregularWidths || Q.setOffset(this.pointXOffset || 0, this.barW || 0));\n x.yBottom = l(C) ? D(h.translate(C, 0, 1, 0, 1), -1E5, 1E5) : null;\n r && (z = this.modifyValue(z, x));\n x.plotY = \"number\" === typeof z && Infinity !== z ? D(h.translate(z, 0, 1, 0, 1), -1E5, 1E5) : void 0;\n x.isInside = this.isPointInside(x);\n x.clientX = v ? n(d.translate(y, 0, 0, 0, 1, w)) : E;\n x.negative = x[O] < (b[O + \"Threshold\"] || A || 0);\n x.category = e && \"undefined\" !== typeof e[x.x] ? e[x.x] : x.x;\n if (!x.isNull && !1 !== x.visible) {\n \"undefined\" !== typeof K && (G = Math.min(G, Math.abs(E - K)));\n var K = E;\n }\n x.zone = this.zones.length && x.getZone();\n !x.graphic && this.group && f && (x.isNew = !0);\n }\n this.closestPointRangePx = G;\n g(this, \"afterTranslate\");\n },\n getValidPoints: function (a, c, d) {\n var b = this.chart;\n return (a || this.points || []).filter(function (a) {\n return c && !b.isInsidePlot(a.plotX, a.plotY, b.inverted) ? !1 : !1 !== a.visible && (d || !a.isNull);\n });\n },\n getClipBox: function (a, c) {\n var b = this.options,\n d = this.chart,\n g = d.inverted,\n k = this.xAxis,\n e = k && this.yAxis,\n f = d.options.chart.scrollablePlotArea || {};\n a && !1 === b.clip && e ? a = g ? {\n y: -d.chartWidth + e.len + e.pos,\n height: d.chartWidth,\n width: d.chartHeight,\n x: -d.chartHeight + k.len + k.pos\n } : {\n y: -e.pos,\n height: d.chartHeight,\n width: d.chartWidth,\n x: -k.pos\n } : (a = this.clipBox || d.clipBox, c && (a.width = d.plotSizeX, a.x = (d.scrollablePixelsX || 0) * (f.scrollPositionX || 0)));\n return c ? {\n width: a.width,\n x: a.x\n } : a;\n },\n setClip: function (a) {\n var b = this.chart,\n c = this.options,\n d = b.renderer,\n g = b.inverted,\n e = this.clipBox,\n f = this.getClipBox(a),\n p = this.sharedClipKey || [\"_sharedClip\", a && a.duration, a && a.easing, f.height, c.xAxis, c.yAxis].join(),\n l = b[p],\n h = b[p + \"m\"];\n a && (f.width = 0, g && (f.x = b.plotHeight + (!1 !== c.clip ? 0 : b.plotTop)));\n l ? b.hasLoaded || l.attr(f) : (a && (b[p + \"m\"] = h = d.clipRect(g ? b.plotSizeX + 99 : -99, g ? -b.plotLeft : -b.plotTop, 99, g ? b.chartWidth : b.chartHeight)), b[p] = l = d.clipRect(f), l.count = {\n length: 0\n });\n a && !l.count[this.index] && (l.count[this.index] = !0, l.count.length += 1);\n if (!1 !== c.clip || a) this.group.clip(a || e ? l : b.clipRect), this.markerGroup.clip(h), this.sharedClipKey = p;\n a || (l.count[this.index] && (delete l.count[this.index], --l.count.length), 0 === l.count.length && p && b[p] && (e || (b[p] = b[p].destroy()), b[p + \"m\"] && (b[p + \"m\"] = b[p + \"m\"].destroy())));\n },\n animate: function (a) {\n var b = this.chart,\n c = y(this.options.animation);\n if (!b.hasRendered) if (a) this.setClip(c);else {\n var d = this.sharedClipKey;\n a = b[d];\n var g = this.getClipBox(c, !0);\n a && a.animate(g, c);\n b[d + \"m\"] && b[d + \"m\"].animate({\n width: g.width + 99,\n x: g.x - (b.inverted ? 0 : 99)\n }, c);\n }\n },\n afterAnimate: function () {\n this.setClip();\n g(this, \"afterAnimate\");\n this.finishedAnimating = !0;\n },\n drawPoints: function () {\n var a = this.points,\n c = this.chart,\n d,\n g,\n e = this.options.marker,\n f = this[this.specialGroup] || this.markerGroup,\n p = this.xAxis,\n l = M(e.enabled, !p || p.isRadial ? !0 : null, this.closestPointRangePx >= e.enabledThreshold * e.radius);\n if (!1 !== e.enabled || this._hasPointMarkers) for (d = 0; d < a.length; d++) {\n var h = a[d];\n var q = (g = h.graphic) ? \"animate\" : \"attr\";\n var n = h.marker || {};\n var u = !!h.marker;\n if ((l && \"undefined\" === typeof n.enabled || n.enabled) && !h.isNull && !1 !== h.visible) {\n var r = M(n.symbol, this.symbol);\n var m = this.markerAttribs(h, h.selected && \"select\");\n this.enabledDataSorting && (h.startXPos = p.reversed ? -m.width : p.width);\n var w = !1 !== h.isInside;\n g ? g[w ? \"show\" : \"hide\"](w).animate(m) : w && (0 < m.width || h.hasImage) && (h.graphic = g = c.renderer.symbol(r, m.x, m.y, m.width, m.height, u ? n : e).add(f), this.enabledDataSorting && c.hasRendered && (g.attr({\n x: h.startXPos\n }), q = \"animate\"));\n g && \"animate\" === q && g[w ? \"show\" : \"hide\"](w).animate(m);\n if (g && !c.styledMode) g[q](this.pointAttribs(h, h.selected && \"select\"));\n g && g.addClass(h.getClassName(), !0);\n } else g && (h.graphic = g.destroy());\n }\n },\n markerAttribs: function (a, c) {\n var b = this.options,\n d = b.marker,\n g = a.marker || {},\n e = g.symbol || d.symbol,\n k = M(g.radius, d.radius);\n c && (d = d.states[c], c = g.states && g.states[c], k = M(c && c.radius, d && d.radius, k + (d && d.radiusPlus || 0)));\n a.hasImage = e && 0 === e.indexOf(\"url\");\n a.hasImage && (k = 0);\n a = {\n x: b.crisp ? Math.floor(a.plotX) - k : a.plotX - k,\n y: a.plotY - k\n };\n k && (a.width = a.height = 2 * k);\n return a;\n },\n pointAttribs: function (a, c) {\n var b = this.options.marker,\n d = a && a.options,\n g = d && d.marker || {},\n e = this.color,\n k = d && d.color,\n f = a && a.color;\n d = M(g.lineWidth, b.lineWidth);\n var p = a && a.zone && a.zone.color;\n a = 1;\n e = k || p || f || e;\n k = g.fillColor || b.fillColor || e;\n e = g.lineColor || b.lineColor || e;\n c = c || \"normal\";\n b = b.states[c];\n c = g.states && g.states[c] || {};\n d = M(c.lineWidth, b.lineWidth, d + M(c.lineWidthPlus, b.lineWidthPlus, 0));\n k = c.fillColor || b.fillColor || k;\n e = c.lineColor || b.lineColor || e;\n a = M(c.opacity, b.opacity, a);\n return {\n stroke: e,\n \"stroke-width\": d,\n fill: k,\n opacity: a\n };\n },\n destroy: function (a) {\n var b = this,\n c = b.chart,\n d = /AppleWebKit\\/533/.test(u.navigator.userAgent),\n e,\n f,\n p = b.data || [],\n h,\n l;\n g(b, \"destroy\");\n this.removeEvents(a);\n (b.axisTypes || []).forEach(function (a) {\n (l = b[a]) && l.series && (J(l.series, b), l.isDirty = l.forceRedraw = !0);\n });\n b.legendItem && b.chart.legend.destroyItem(b);\n for (f = p.length; f--;) (h = p[f]) && h.destroy && h.destroy();\n b.points = null;\n C.clearTimeout(b.animationTimeout);\n G(b, function (a, b) {\n a instanceof K && !a.survive && (e = d && \"group\" === b ? \"hide\" : \"destroy\", a[e]());\n });\n c.hoverSeries === b && (c.hoverSeries = null);\n J(c.series, b);\n c.orderSeries();\n G(b, function (c, d) {\n a && \"hcEvents\" === d || delete b[d];\n });\n },\n getGraphPath: function (a, c, d) {\n var b = this,\n g = b.options,\n e = g.step,\n k,\n f = [],\n p = [],\n h;\n a = a || b.points;\n (k = a.reversed) && a.reverse();\n (e = {\n right: 1,\n center: 2\n }[e] || e && 3) && k && (e = 4 - e);\n a = this.getValidPoints(a, !1, !(g.connectNulls && !c && !d));\n a.forEach(function (k, q) {\n var t = k.plotX,\n n = k.plotY,\n u = a[q - 1];\n (k.leftCliff || u && u.rightCliff) && !d && (h = !0);\n k.isNull && !l(c) && 0 < q ? h = !g.connectNulls : k.isNull && !c ? h = !0 : (0 === q || h ? q = [[\"M\", k.plotX, k.plotY]] : b.getPointSpline ? q = [b.getPointSpline(a, k, q)] : e ? (q = 1 === e ? [[\"L\", u.plotX, n]] : 2 === e ? [[\"L\", (u.plotX + t) / 2, u.plotY], [\"L\", (u.plotX + t) / 2, n]] : [[\"L\", t, u.plotY]], q.push([\"L\", t, n])) : q = [[\"L\", t, n]], p.push(k.x), e && (p.push(k.x), 2 === e && p.push(k.x)), f.push.apply(f, q), h = !1);\n });\n f.xMap = p;\n return b.graphPath = f;\n },\n drawGraph: function () {\n var a = this,\n c = this.options,\n d = (this.gappedPath || this.getGraphPath).call(this),\n g = this.chart.styledMode,\n e = [[\"graph\", \"highcharts-graph\"]];\n g || e[0].push(c.lineColor || this.color || \"#cccccc\", c.dashStyle);\n e = a.getZonesGraphs(e);\n e.forEach(function (b, e) {\n var k = b[0],\n f = a[k],\n p = f ? \"animate\" : \"attr\";\n f ? (f.endX = a.preventGraphAnimation ? null : d.xMap, f.animate({\n d: d\n })) : d.length && (a[k] = f = a.chart.renderer.path(d).addClass(b[1]).attr({\n zIndex: 1\n }).add(a.group));\n f && !g && (k = {\n stroke: b[2],\n \"stroke-width\": c.lineWidth,\n fill: a.fillGraph && a.color || \"none\"\n }, b[3] ? k.dashstyle = b[3] : \"square\" !== c.linecap && (k[\"stroke-linecap\"] = k[\"stroke-linejoin\"] = \"round\"), f[p](k).shadow(2 > e && c.shadow));\n f && (f.startX = d.xMap, f.isArea = d.isArea);\n });\n },\n getZonesGraphs: function (a) {\n this.zones.forEach(function (b, c) {\n c = [\"zone-graph-\" + c, \"highcharts-graph highcharts-zone-graph-\" + c + \" \" + (b.className || \"\")];\n this.chart.styledMode || c.push(b.color || this.color, b.dashStyle || this.options.dashStyle);\n a.push(c);\n }, this);\n return a;\n },\n applyZones: function () {\n var a = this,\n c = this.chart,\n d = c.renderer,\n g = this.zones,\n e,\n f,\n p = this.clips || [],\n h,\n l = this.graph,\n q = this.area,\n n = Math.max(c.chartWidth, c.chartHeight),\n u = this[(this.zoneAxis || \"y\") + \"Axis\"],\n r = c.inverted,\n m,\n w,\n v,\n A = !1,\n B,\n E;\n if (g.length && (l || q) && u && \"undefined\" !== typeof u.min) {\n var O = u.reversed;\n var G = u.horiz;\n l && !this.showLine && l.hide();\n q && q.hide();\n var x = u.getExtremes();\n g.forEach(function (b, g) {\n e = O ? G ? c.plotWidth : 0 : G ? 0 : u.toPixels(x.min) || 0;\n e = D(M(f, e), 0, n);\n f = D(Math.round(u.toPixels(M(b.value, x.max), !0) || 0), 0, n);\n A && (e = f = u.toPixels(x.max));\n m = Math.abs(e - f);\n w = Math.min(e, f);\n v = Math.max(e, f);\n u.isXAxis ? (h = {\n x: r ? v : w,\n y: 0,\n width: m,\n height: n\n }, G || (h.x = c.plotHeight - h.x)) : (h = {\n x: 0,\n y: r ? v : w,\n width: n,\n height: m\n }, G && (h.y = c.plotWidth - h.y));\n r && d.isVML && (h = u.isXAxis ? {\n x: 0,\n y: O ? w : v,\n height: h.width,\n width: c.chartWidth\n } : {\n x: h.y - c.plotLeft - c.spacingBox.x,\n y: 0,\n width: h.height,\n height: c.chartHeight\n });\n p[g] ? p[g].animate(h) : p[g] = d.clipRect(h);\n B = a[\"zone-area-\" + g];\n E = a[\"zone-graph-\" + g];\n l && E && E.clip(p[g]);\n q && B && B.clip(p[g]);\n A = b.value > x.max;\n a.resetZones && 0 === f && (f = void 0);\n });\n this.clips = p;\n } else a.visible && (l && l.show(!0), q && q.show(!0));\n },\n invertGroups: function (a) {\n function b() {\n [\"group\", \"markerGroup\"].forEach(function (b) {\n c[b] && (d.renderer.isVML && c[b].attr({\n width: c.yAxis.len,\n height: c.xAxis.len\n }), c[b].width = c.yAxis.len, c[b].height = c.xAxis.len, c[b].invert(c.isRadialSeries ? !1 : a));\n });\n }\n var c = this,\n d = c.chart;\n c.xAxis && (c.eventsToUnbind.push(I(d, \"resize\", b)), b(), c.invertGroups = b);\n },\n plotGroup: function (a, c, d, g, e) {\n var b = this[a],\n k = !b;\n d = {\n visibility: d,\n zIndex: g || .1\n };\n \"undefined\" === typeof this.opacity || this.chart.styledMode || \"inactive\" === this.state || (d.opacity = this.opacity);\n k && (this[a] = b = this.chart.renderer.g().add(e));\n b.addClass(\"highcharts-\" + c + \" highcharts-series-\" + this.index + \" highcharts-\" + this.type + \"-series \" + (l(this.colorIndex) ? \"highcharts-color-\" + this.colorIndex + \" \" : \"\") + (this.options.className || \"\") + (b.hasClass(\"highcharts-tracker\") ? \" highcharts-tracker\" : \"\"), !0);\n b.attr(d)[k ? \"attr\" : \"animate\"](this.getPlotBox());\n return b;\n },\n getPlotBox: function () {\n var a = this.chart,\n c = this.xAxis,\n d = this.yAxis;\n a.inverted && (c = d, d = this.xAxis);\n return {\n translateX: c ? c.left : a.plotLeft,\n translateY: d ? d.top : a.plotTop,\n scaleX: 1,\n scaleY: 1\n };\n },\n removeEvents: function (a) {\n a ? this.eventsToUnbind.length && (this.eventsToUnbind.forEach(function (a) {\n a();\n }), this.eventsToUnbind.length = 0) : T(this);\n },\n render: function () {\n var a = this,\n c = a.chart,\n d = a.options,\n e = y(d.animation),\n f = !a.finishedAnimating && c.renderer.isSVG && e.duration,\n p = a.visible ? \"inherit\" : \"hidden\",\n h = d.zIndex,\n l = a.hasRendered,\n q = c.seriesGroup,\n n = c.inverted;\n g(this, \"render\");\n var u = a.plotGroup(\"group\", \"series\", p, h, q);\n a.markerGroup = a.plotGroup(\"markerGroup\", \"markers\", p, h, q);\n f && a.animate && a.animate(!0);\n u.inverted = a.isCartesian || a.invertable ? n : !1;\n a.drawGraph && (a.drawGraph(), a.applyZones());\n a.visible && a.drawPoints();\n a.drawDataLabels && a.drawDataLabels();\n a.redrawPoints && a.redrawPoints();\n a.drawTracker && !1 !== a.options.enableMouseTracking && a.drawTracker();\n a.invertGroups(n);\n !1 === d.clip || a.sharedClipKey || l || u.clip(c.clipRect);\n f && a.animate && a.animate();\n l || (f && e.defer && (f += e.defer), a.animationTimeout = O(function () {\n a.afterAnimate();\n }, f || 0));\n a.isDirty = !1;\n a.hasRendered = !0;\n g(a, \"afterRender\");\n },\n redraw: function () {\n var a = this.chart,\n c = this.isDirty || this.isDirtyData,\n d = this.group,\n g = this.xAxis,\n e = this.yAxis;\n d && (a.inverted && d.attr({\n width: a.plotWidth,\n height: a.plotHeight\n }), d.animate({\n translateX: M(g && g.left, a.plotLeft),\n translateY: M(e && e.top, a.plotTop)\n }));\n this.translate();\n this.render();\n c && delete this.kdTree;\n },\n kdAxisArray: [\"clientX\", \"plotY\"],\n searchPoint: function (a, c) {\n var b = this.xAxis,\n d = this.yAxis,\n g = this.chart.inverted;\n return this.searchKDTree({\n clientX: g ? b.len - a.chartY + b.pos : a.chartX - b.pos,\n plotY: g ? d.len - a.chartX + d.pos : a.chartY - d.pos\n }, c, a);\n },\n buildKDTree: function (a) {\n function b(a, d, g) {\n var e;\n if (e = a && a.length) {\n var f = c.kdAxisArray[d % g];\n a.sort(function (a, b) {\n return a[f] - b[f];\n });\n e = Math.floor(e / 2);\n return {\n point: a[e],\n left: b(a.slice(0, e), d + 1, g),\n right: b(a.slice(e + 1), d + 1, g)\n };\n }\n }\n this.buildingKdTree = !0;\n var c = this,\n d = -1 < c.options.findNearestPointBy.indexOf(\"y\") ? 2 : 1;\n delete c.kdTree;\n O(function () {\n c.kdTree = b(c.getValidPoints(null, !c.directTouch), d, d);\n c.buildingKdTree = !1;\n }, c.options.kdNow || a && \"touchstart\" === a.type ? 0 : 1);\n },\n searchKDTree: function (a, c, d) {\n function b(a, c, d, p) {\n var h = c.point,\n q = g.kdAxisArray[d % p],\n n = h;\n var u = l(a[e]) && l(h[e]) ? Math.pow(a[e] - h[e], 2) : null;\n var t = l(a[f]) && l(h[f]) ? Math.pow(a[f] - h[f], 2) : null;\n t = (u || 0) + (t || 0);\n h.dist = l(t) ? Math.sqrt(t) : Number.MAX_VALUE;\n h.distX = l(u) ? Math.sqrt(u) : Number.MAX_VALUE;\n q = a[q] - h[q];\n t = 0 > q ? \"left\" : \"right\";\n u = 0 > q ? \"right\" : \"left\";\n c[t] && (t = b(a, c[t], d + 1, p), n = t[k] < n[k] ? t : h);\n c[u] && Math.sqrt(q * q) < n[k] && (a = b(a, c[u], d + 1, p), n = a[k] < n[k] ? a : n);\n return n;\n }\n var g = this,\n e = this.kdAxisArray[0],\n f = this.kdAxisArray[1],\n k = c ? \"distX\" : \"dist\";\n c = -1 < g.options.findNearestPointBy.indexOf(\"y\") ? 2 : 1;\n this.kdTree || this.buildingKdTree || this.buildKDTree(d);\n if (this.kdTree) return b(a, this.kdTree, c, c);\n },\n pointPlacementToXValue: function () {\n var a = this.options,\n c = a.pointRange,\n d = this.xAxis;\n a = a.pointPlacement;\n \"between\" === a && (a = d.reversed ? -.5 : .5);\n return p(a) ? a * M(c, d.pointRange) : 0;\n },\n isPointInside: function (a) {\n return \"undefined\" !== typeof a.plotY && \"undefined\" !== typeof a.plotX && 0 <= a.plotY && a.plotY <= this.yAxis.len && 0 <= a.plotX && a.plotX <= this.xAxis.len;\n }\n });\n \"\";\n return f;\n });\n N(m, \"Series/LineSeries.js\", [m[\"Core/Series/CartesianSeries.js\"], m[\"Core/Globals.js\"]], function (f, h) {\n h.Series = f;\n return h.Series;\n });\n N(m, \"Extensions/Stacking.js\", [m[\"Core/Axis/Axis.js\"], m[\"Core/Chart/Chart.js\"], m[\"Core/Globals.js\"], m[\"Core/Axis/StackingAxis.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z, F) {\n var L = F.correctFloat,\n K = F.defined,\n C = F.destroyObjectProperties,\n y = F.format,\n e = F.isNumber,\n I = F.pick;\n \"\";\n var v = m.Series,\n x = function () {\n function f(e, f, h, m, r) {\n var d = e.chart.inverted;\n this.axis = e;\n this.isNegative = h;\n this.options = f = f || {};\n this.x = m;\n this.total = null;\n this.points = {};\n this.hasValidPoints = !1;\n this.stack = r;\n this.rightCliff = this.leftCliff = 0;\n this.alignOptions = {\n align: f.align || (d ? h ? \"left\" : \"right\" : \"center\"),\n verticalAlign: f.verticalAlign || (d ? \"middle\" : h ? \"bottom\" : \"top\"),\n y: f.y,\n x: f.x\n };\n this.textAlign = f.textAlign || (d ? h ? \"right\" : \"left\" : \"center\");\n }\n f.prototype.destroy = function () {\n C(this, this.axis);\n };\n f.prototype.render = function (e) {\n var f = this.axis.chart,\n h = this.options,\n n = h.format;\n n = n ? y(n, this, f) : h.formatter.call(this);\n this.label ? this.label.attr({\n text: n,\n visibility: \"hidden\"\n }) : (this.label = f.renderer.label(n, null, null, h.shape, null, null, h.useHTML, !1, \"stack-labels\"), n = {\n r: h.borderRadius || 0,\n text: n,\n rotation: h.rotation,\n padding: I(h.padding, 5),\n visibility: \"hidden\"\n }, f.styledMode || (n.fill = h.backgroundColor, n.stroke = h.borderColor, n[\"stroke-width\"] = h.borderWidth, this.label.css(h.style)), this.label.attr(n), this.label.added || this.label.add(e));\n this.label.labelrank = f.plotHeight;\n };\n f.prototype.setOffset = function (f, h, m, w, r) {\n var d = this.axis,\n g = d.chart;\n w = d.translate(d.stacking.usePercentage ? 100 : w ? w : this.total, 0, 0, 0, 1);\n m = d.translate(m ? m : 0);\n m = K(w) && Math.abs(w - m);\n f = I(r, g.xAxis[0].translate(this.x)) + f;\n d = K(w) && this.getStackBox(g, this, f, w, h, m, d);\n h = this.label;\n m = this.isNegative;\n f = \"justify\" === I(this.options.overflow, \"justify\");\n var c = this.textAlign;\n h && d && (r = h.getBBox(), w = h.padding, c = \"left\" === c ? g.inverted ? -w : w : \"right\" === c ? r.width : g.inverted && \"center\" === c ? r.width / 2 : g.inverted ? m ? r.width + w : -w : r.width / 2, m = g.inverted ? r.height / 2 : m ? -w : r.height, this.alignOptions.x = I(this.options.x, 0), this.alignOptions.y = I(this.options.y, 0), d.x -= c, d.y -= m, h.align(this.alignOptions, null, d), g.isInsidePlot(h.alignAttr.x + c - this.alignOptions.x, h.alignAttr.y + m - this.alignOptions.y) ? h.show() : (h.alignAttr.y = -9999, f = !1), f && v.prototype.justifyDataLabel.call(this.axis, h, this.alignOptions, h.alignAttr, r, d), h.attr({\n x: h.alignAttr.x,\n y: h.alignAttr.y\n }), I(!f && this.options.crop, !0) && ((g = e(h.x) && e(h.y) && g.isInsidePlot(h.x - w + h.width, h.y) && g.isInsidePlot(h.x + w, h.y)) || h.hide()));\n };\n f.prototype.getStackBox = function (e, f, h, m, r, d, g) {\n var c = f.axis.reversed,\n a = e.inverted,\n q = g.height + g.pos - (a ? e.plotLeft : e.plotTop);\n f = f.isNegative && !c || !f.isNegative && c;\n return {\n x: a ? f ? m - g.right : m - d + g.pos - e.plotLeft : h + e.xAxis[0].transB - e.plotLeft,\n y: a ? g.height - h - r : f ? q - m - d : q - m,\n width: a ? d : r,\n height: a ? r : d\n };\n };\n return f;\n }();\n h.prototype.getStacks = function () {\n var e = this,\n f = e.inverted;\n e.yAxis.forEach(function (e) {\n e.stacking && e.stacking.stacks && e.hasVisibleSeries && (e.stacking.oldStacks = e.stacking.stacks);\n });\n e.series.forEach(function (h) {\n var l = h.xAxis && h.xAxis.options || {};\n !h.options.stacking || !0 !== h.visible && !1 !== e.options.chart.ignoreHiddenSeries || (h.stackKey = [h.type, I(h.options.stack, \"\"), f ? l.top : l.left, f ? l.height : l.width].join());\n });\n };\n z.compose(f);\n v.prototype.setGroupedPoints = function () {\n this.options.centerInCategory && (this.is(\"column\") || this.is(\"columnrange\")) && !this.options.stacking && 1 < this.chart.series.length && v.prototype.setStackedPoints.call(this, \"group\");\n };\n v.prototype.setStackedPoints = function (e) {\n var f = e || this.options.stacking;\n if (f && (!0 === this.visible || !1 === this.chart.options.chart.ignoreHiddenSeries)) {\n var h = this.processedXData,\n m = this.processedYData,\n w = [],\n r = m.length,\n d = this.options,\n g = d.threshold,\n c = I(d.startFromThreshold && g, 0);\n d = d.stack;\n e = e ? this.type + \",\" + f : this.stackKey;\n var a = \"-\" + e,\n q = this.negStacks,\n p = this.yAxis,\n v = p.stacking.stacks,\n A = p.stacking.oldStacks,\n G,\n D;\n p.stacking.stacksTouched += 1;\n for (D = 0; D < r; D++) {\n var y = h[D];\n var z = m[D];\n var O = this.getStackIndicator(O, y, this.index);\n var E = O.key;\n var u = (G = q && z < (c ? 0 : g)) ? a : e;\n v[u] || (v[u] = {});\n v[u][y] || (A[u] && A[u][y] ? (v[u][y] = A[u][y], v[u][y].total = null) : v[u][y] = new x(p, p.options.stackLabels, G, y, d));\n u = v[u][y];\n null !== z ? (u.points[E] = u.points[this.index] = [I(u.cumulative, c)], K(u.cumulative) || (u.base = E), u.touched = p.stacking.stacksTouched, 0 < O.index && !1 === this.singleStacks && (u.points[E][0] = u.points[this.index + \",\" + y + \",0\"][0])) : u.points[E] = u.points[this.index] = null;\n \"percent\" === f ? (G = G ? e : a, q && v[G] && v[G][y] ? (G = v[G][y], u.total = G.total = Math.max(G.total, u.total) + Math.abs(z) || 0) : u.total = L(u.total + (Math.abs(z) || 0))) : \"group\" === f ? null !== z && (u.total = (u.total || 0) + 1) : u.total = L(u.total + (z || 0));\n u.cumulative = \"group\" === f ? (u.total || 1) - 1 : I(u.cumulative, c) + (z || 0);\n null !== z && (u.points[E].push(u.cumulative), w[D] = u.cumulative, u.hasValidPoints = !0);\n }\n \"percent\" === f && (p.stacking.usePercentage = !0);\n \"group\" !== f && (this.stackedYData = w);\n p.stacking.oldStacks = {};\n }\n };\n v.prototype.modifyStacks = function () {\n var e = this,\n f = e.stackKey,\n h = e.yAxis.stacking.stacks,\n m = e.processedXData,\n w,\n r = e.options.stacking;\n e[r + \"Stacker\"] && [f, \"-\" + f].forEach(function (d) {\n for (var g = m.length, c, a; g--;) if (c = m[g], w = e.getStackIndicator(w, c, e.index, d), a = (c = h[d] && h[d][c]) && c.points[w.key]) e[r + \"Stacker\"](a, c, g);\n });\n };\n v.prototype.percentStacker = function (e, f, h) {\n f = f.total ? 100 / f.total : 0;\n e[0] = L(e[0] * f);\n e[1] = L(e[1] * f);\n this.stackedYData[h] = e[1];\n };\n v.prototype.getStackIndicator = function (e, f, h, m) {\n !K(e) || e.x !== f || m && e.key !== m ? e = {\n x: f,\n index: 0,\n key: m\n } : e.index++;\n e.key = [h, f, e.index].join();\n return e;\n };\n m.StackItem = x;\n return m.StackItem;\n });\n N(m, \"Core/Dynamics.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Axis/Axis.js\"], m[\"Core/Series/Series.js\"], m[\"Core/Chart/Chart.js\"], m[\"Core/Globals.js\"], m[\"Series/LineSeries.js\"], m[\"Core/Options.js\"], m[\"Core/Series/Point.js\"], m[\"Core/Time.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z, F, L, K, C, y, e) {\n var I = f.animate,\n v = f.setAnimation,\n x = m.seriesTypes,\n D = K.time,\n n = e.addEvent,\n l = e.createElement,\n J = e.css,\n w = e.defined,\n r = e.erase,\n d = e.error,\n g = e.extend,\n c = e.fireEvent,\n a = e.isArray,\n q = e.isNumber,\n p = e.isObject,\n B = e.isString,\n A = e.merge,\n G = e.objectEach,\n M = e.pick,\n T = e.relativeLength,\n Q = e.splat;\n F.cleanRecursively = function (a, c) {\n var d = {};\n G(a, function (b, g) {\n if (p(a[g], !0) && !a.nodeType && c[g]) b = F.cleanRecursively(a[g], c[g]), Object.keys(b).length && (d[g] = b);else if (p(a[g]) || a[g] !== c[g]) d[g] = a[g];\n });\n return d;\n };\n g(z.prototype, {\n addSeries: function (a, d, g) {\n var b,\n e = this;\n a && (d = M(d, !0), c(e, \"addSeries\", {\n options: a\n }, function () {\n b = e.initSeries(a);\n e.isDirtyLegend = !0;\n e.linkSeries();\n b.enabledDataSorting && b.setData(a.data, !1);\n c(e, \"afterAddSeries\", {\n series: b\n });\n d && e.redraw(g);\n }));\n return b;\n },\n addAxis: function (a, c, d, b) {\n return this.createAxis(c ? \"xAxis\" : \"yAxis\", {\n axis: a,\n redraw: d,\n animation: b\n });\n },\n addColorAxis: function (a, c, d) {\n return this.createAxis(\"colorAxis\", {\n axis: a,\n redraw: c,\n animation: d\n });\n },\n createAxis: function (a, c) {\n var d = this.options,\n b = \"colorAxis\" === a,\n g = c.redraw,\n e = c.animation;\n c = A(c.axis, {\n index: this[a].length,\n isX: \"xAxis\" === a\n });\n var f = b ? new F.ColorAxis(this, c) : new h(this, c);\n d[a] = Q(d[a] || {});\n d[a].push(c);\n b && (this.isDirtyLegend = !0, this.axes.forEach(function (a) {\n a.series = [];\n }), this.series.forEach(function (a) {\n a.bindAxes();\n a.isDirtyData = !0;\n }));\n M(g, !0) && this.redraw(e);\n return f;\n },\n showLoading: function (a) {\n var c = this,\n d = c.options,\n b = c.loadingDiv,\n e = d.loading,\n f = function () {\n b && J(b, {\n left: c.plotLeft + \"px\",\n top: c.plotTop + \"px\",\n width: c.plotWidth + \"px\",\n height: c.plotHeight + \"px\"\n });\n };\n b || (c.loadingDiv = b = l(\"div\", {\n className: \"highcharts-loading highcharts-loading-hidden\"\n }, null, c.container), c.loadingSpan = l(\"span\", {\n className: \"highcharts-loading-inner\"\n }, null, b), n(c, \"redraw\", f));\n b.className = \"highcharts-loading\";\n c.loadingSpan.innerHTML = M(a, d.lang.loading, \"\");\n c.styledMode || (J(b, g(e.style, {\n zIndex: 10\n })), J(c.loadingSpan, e.labelStyle), c.loadingShown || (J(b, {\n opacity: 0,\n display: \"\"\n }), I(b, {\n opacity: e.style.opacity || .5\n }, {\n duration: e.showDuration || 0\n })));\n c.loadingShown = !0;\n f();\n },\n hideLoading: function () {\n var a = this.options,\n c = this.loadingDiv;\n c && (c.className = \"highcharts-loading highcharts-loading-hidden\", this.styledMode || I(c, {\n opacity: 0\n }, {\n duration: a.loading.hideDuration || 100,\n complete: function () {\n J(c, {\n display: \"none\"\n });\n }\n }));\n this.loadingShown = !1;\n },\n propsRequireDirtyBox: \"backgroundColor borderColor borderWidth borderRadius plotBackgroundColor plotBackgroundImage plotBorderColor plotBorderWidth plotShadow shadow\".split(\" \"),\n propsRequireReflow: \"margin marginTop marginRight marginBottom marginLeft spacing spacingTop spacingRight spacingBottom spacingLeft\".split(\" \"),\n propsRequireUpdateSeries: \"chart.inverted chart.polar chart.ignoreHiddenSeries chart.type colors plotOptions time tooltip\".split(\" \"),\n collectionsWithUpdate: [\"xAxis\", \"yAxis\", \"zAxis\", \"series\"],\n update: function (a, d, g, b) {\n var e = this,\n f = {\n credits: \"addCredits\",\n title: \"setTitle\",\n subtitle: \"setSubtitle\",\n caption: \"setCaption\"\n },\n p,\n h,\n l,\n n = a.isResponsiveOptions,\n u = [];\n c(e, \"update\", {\n options: a\n });\n n || e.setResponsive(!1, !0);\n a = F.cleanRecursively(a, e.options);\n A(!0, e.userOptions, a);\n if (p = a.chart) {\n A(!0, e.options.chart, p);\n \"className\" in p && e.setClassName(p.className);\n \"reflow\" in p && e.setReflow(p.reflow);\n if (\"inverted\" in p || \"polar\" in p || \"type\" in p) {\n e.propFromSeries();\n var m = !0;\n }\n \"alignTicks\" in p && (m = !0);\n G(p, function (a, b) {\n -1 !== e.propsRequireUpdateSeries.indexOf(\"chart.\" + b) && (h = !0);\n -1 !== e.propsRequireDirtyBox.indexOf(b) && (e.isDirtyBox = !0);\n -1 !== e.propsRequireReflow.indexOf(b) && (n ? e.isDirtyBox = !0 : l = !0);\n });\n !e.styledMode && \"style\" in p && e.renderer.setStyle(p.style);\n }\n !e.styledMode && a.colors && (this.options.colors = a.colors);\n a.time && (this.time === D && (this.time = new y(a.time)), A(!0, e.options.time, a.time));\n G(a, function (b, c) {\n if (e[c] && \"function\" === typeof e[c].update) e[c].update(b, !1);else if (\"function\" === typeof e[f[c]]) e[f[c]](b);else \"color\" !== c && -1 === e.collectionsWithUpdate.indexOf(c) && A(!0, e.options[c], a[c]);\n \"chart\" !== c && -1 !== e.propsRequireUpdateSeries.indexOf(c) && (h = !0);\n });\n this.collectionsWithUpdate.forEach(function (b) {\n if (a[b]) {\n if (\"series\" === b) {\n var c = [];\n e[b].forEach(function (a, b) {\n a.options.isInternal || c.push(M(a.options.index, b));\n });\n }\n Q(a[b]).forEach(function (a, d) {\n var f = w(a.id),\n k;\n f && (k = e.get(a.id));\n k || (k = e[b][c ? c[d] : d]) && f && w(k.options.id) && (k = void 0);\n k && k.coll === b && (k.update(a, !1), g && (k.touched = !0));\n !k && g && e.collectionsWithInit[b] && (e.collectionsWithInit[b][0].apply(e, [a].concat(e.collectionsWithInit[b][1] || []).concat([!1])).touched = !0);\n });\n g && e[b].forEach(function (a) {\n a.touched || a.options.isInternal ? delete a.touched : u.push(a);\n });\n }\n });\n u.forEach(function (a) {\n a.remove && a.remove(!1);\n });\n m && e.axes.forEach(function (a) {\n a.update({}, !1);\n });\n h && e.getSeriesOrderByLinks().forEach(function (a) {\n a.chart && a.update({}, !1);\n }, this);\n m = p && p.width;\n p = p && p.height;\n B(p) && (p = T(p, m || e.chartWidth));\n l || q(m) && m !== e.chartWidth || q(p) && p !== e.chartHeight ? e.setSize(m, p, b) : M(d, !0) && e.redraw(b);\n c(e, \"afterUpdate\", {\n options: a,\n redraw: d,\n animation: b\n });\n },\n setSubtitle: function (a, c) {\n this.applyDescription(\"subtitle\", a);\n this.layOutTitles(c);\n },\n setCaption: function (a, c) {\n this.applyDescription(\"caption\", a);\n this.layOutTitles(c);\n }\n });\n z.prototype.collectionsWithInit = {\n xAxis: [z.prototype.addAxis, [!0]],\n yAxis: [z.prototype.addAxis, [!1]],\n series: [z.prototype.addSeries]\n };\n g(C.prototype, {\n update: function (a, c, d, b) {\n function g() {\n e.applyOptions(a);\n var b = h && e.hasDummyGraphic;\n b = null === e.y ? !b : b;\n h && b && (e.graphic = h.destroy(), delete e.hasDummyGraphic);\n p(a, !0) && (h && h.element && a && a.marker && \"undefined\" !== typeof a.marker.symbol && (e.graphic = h.destroy()), a && a.dataLabels && e.dataLabel && (e.dataLabel = e.dataLabel.destroy()), e.connector && (e.connector = e.connector.destroy()));\n q = e.index;\n f.updateParallelArrays(e, q);\n n.data[q] = p(n.data[q], !0) || p(a, !0) ? e.options : M(a, n.data[q]);\n f.isDirty = f.isDirtyData = !0;\n !f.fixedBox && f.hasCartesianSeries && (l.isDirtyBox = !0);\n \"point\" === n.legendType && (l.isDirtyLegend = !0);\n c && l.redraw(d);\n }\n var e = this,\n f = e.series,\n h = e.graphic,\n q,\n l = f.chart,\n n = f.options;\n c = M(c, !0);\n !1 === b ? g() : e.firePointEvent(\"update\", {\n options: a\n }, g);\n },\n remove: function (a, c) {\n this.series.removePoint(this.series.data.indexOf(this), a, c);\n }\n });\n g(L.prototype, {\n addPoint: function (a, d, g, b, e) {\n var f = this.options,\n k = this.data,\n p = this.chart,\n h = this.xAxis;\n h = h && h.hasNames && h.names;\n var q = f.data,\n l = this.xData,\n n;\n d = M(d, !0);\n var u = {\n series: this\n };\n this.pointClass.prototype.applyOptions.apply(u, [a]);\n var m = u.x;\n var r = l.length;\n if (this.requireSorting && m < l[r - 1]) for (n = !0; r && l[r - 1] > m;) r--;\n this.updateParallelArrays(u, \"splice\", r, 0, 0);\n this.updateParallelArrays(u, r);\n h && u.name && (h[m] = u.name);\n q.splice(r, 0, a);\n n && (this.data.splice(r, 0, null), this.processData());\n \"point\" === f.legendType && this.generatePoints();\n g && (k[0] && k[0].remove ? k[0].remove(!1) : (k.shift(), this.updateParallelArrays(u, \"shift\"), q.shift()));\n !1 !== e && c(this, \"addPoint\", {\n point: u\n });\n this.isDirtyData = this.isDirty = !0;\n d && p.redraw(b);\n },\n removePoint: function (a, c, d) {\n var b = this,\n g = b.data,\n e = g[a],\n f = b.points,\n p = b.chart,\n h = function () {\n f && f.length === g.length && f.splice(a, 1);\n g.splice(a, 1);\n b.options.data.splice(a, 1);\n b.updateParallelArrays(e || {\n series: b\n }, \"splice\", a, 1);\n e && e.destroy();\n b.isDirty = !0;\n b.isDirtyData = !0;\n c && p.redraw();\n };\n v(d, p);\n c = M(c, !0);\n e ? e.firePointEvent(\"remove\", null, h) : h();\n },\n remove: function (a, d, g, b) {\n function e() {\n f.destroy(b);\n f.remove = null;\n p.isDirtyLegend = p.isDirtyBox = !0;\n p.linkSeries();\n M(a, !0) && p.redraw(d);\n }\n var f = this,\n p = f.chart;\n !1 !== g ? c(f, \"remove\", null, e) : e();\n },\n update: function (a, e) {\n a = F.cleanRecursively(a, this.userOptions);\n c(this, \"update\", {\n options: a\n });\n var f = this,\n b = f.chart,\n k = f.userOptions,\n p = f.initialType || f.type,\n h = b.options.plotOptions,\n q = a.type || k.type || b.options.chart.type,\n l = !(this.hasDerivedData || q && q !== this.type || \"undefined\" !== typeof a.pointStart || \"undefined\" !== typeof a.pointInterval || f.hasOptionChanged(\"dataGrouping\") || f.hasOptionChanged(\"pointStart\") || f.hasOptionChanged(\"pointInterval\") || f.hasOptionChanged(\"pointIntervalUnit\") || f.hasOptionChanged(\"keys\")),\n n = x[p].prototype,\n m,\n r = [\"eventOptions\", \"navigatorSeries\", \"baseSeries\"],\n w = f.finishedAnimating && {\n animation: !1\n },\n v = {};\n l && (r.push(\"data\", \"isDirtyData\", \"points\", \"processedXData\", \"processedYData\", \"xIncrement\", \"cropped\", \"_hasPointMarkers\", \"_hasPointLabels\", \"mapMap\", \"mapData\", \"minY\", \"maxY\", \"minX\", \"maxX\"), !1 !== a.visible && r.push(\"area\", \"graph\"), f.parallelArrays.forEach(function (a) {\n r.push(a + \"Data\");\n }), a.data && (a.dataSorting && g(f.options.dataSorting, a.dataSorting), this.setData(a.data, !1)));\n a = A(k, w, {\n index: \"undefined\" === typeof k.index ? f.index : k.index,\n pointStart: M(h && h.series && h.series.pointStart, k.pointStart, f.xData[0])\n }, !l && {\n data: f.options.data\n }, a);\n l && a.data && (a.data = f.options.data);\n r = [\"group\", \"markerGroup\", \"dataLabelsGroup\", \"transformGroup\"].concat(r);\n r.forEach(function (a) {\n r[a] = f[a];\n delete f[a];\n });\n f.remove(!1, null, !1, !0);\n for (m in n) f[m] = void 0;\n x[q || p] ? g(f, x[q || p].prototype) : d(17, !0, b, {\n missingModuleFor: q || p\n });\n r.forEach(function (a) {\n f[a] = r[a];\n });\n f.init(b, a);\n if (l && this.points) {\n var B = f.options;\n !1 === B.visible ? (v.graphic = 1, v.dataLabel = 1) : f._hasPointLabels || (a = B.marker, k = B.dataLabels, a && (!1 === a.enabled || \"symbol\" in a) && (v.graphic = 1), k && !1 === k.enabled && (v.dataLabel = 1));\n this.points.forEach(function (a) {\n a && a.series && (a.resolveColor(), Object.keys(v).length && a.destroyElements(v), !1 === B.showInLegend && a.legendItem && b.legend.destroyItem(a));\n }, this);\n }\n f.initialType = p;\n b.linkSeries();\n c(this, \"afterUpdate\");\n M(e, !0) && b.redraw(l ? void 0 : !1);\n },\n setName: function (a) {\n this.name = this.options.name = this.userOptions.name = a;\n this.chart.isDirtyLegend = !0;\n },\n hasOptionChanged: function (a) {\n var c = this.options[a],\n d = this.chart.options.plotOptions,\n b = this.userOptions[a];\n return b ? c !== b : c !== M(d && d[this.type] && d[this.type][a], d && d.series && d.series[a], c);\n }\n });\n g(h.prototype, {\n update: function (a, c) {\n var d = this.chart,\n b = a && a.events || {};\n a = A(this.userOptions, a);\n d.options[this.coll].indexOf && (d.options[this.coll][d.options[this.coll].indexOf(this.userOptions)] = a);\n G(d.options[this.coll].events, function (a, c) {\n \"undefined\" === typeof b[c] && (b[c] = void 0);\n });\n this.destroy(!0);\n this.init(d, g(a, {\n events: b\n }));\n d.isDirtyBox = !0;\n M(c, !0) && d.redraw();\n },\n remove: function (c) {\n for (var d = this.chart, g = this.coll, b = this.series, e = b.length; e--;) b[e] && b[e].remove(!1);\n r(d.axes, this);\n r(d[g], this);\n a(d.options[g]) ? d.options[g].splice(this.options.index, 1) : delete d.options[g];\n d[g].forEach(function (a, b) {\n a.options.index = a.userOptions.index = b;\n });\n this.destroy();\n d.isDirtyBox = !0;\n M(c, !0) && d.redraw();\n },\n setTitle: function (a, c) {\n this.update({\n title: a\n }, c);\n },\n setCategories: function (a, c) {\n this.update({\n categories: a\n }, c);\n }\n });\n });\n N(m, \"Series/AreaSeries.js\", [m[\"Core/Series/Series.js\"], m[\"Core/Color/Color.js\"], m[\"Core/Globals.js\"], m[\"Mixins/LegendSymbol.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z, F) {\n var L = h.parse,\n K = F.objectEach,\n C = F.pick,\n y = m.Series;\n f.seriesType(\"area\", \"line\", {\n threshold: 0\n }, {\n singleStacks: !1,\n getStackPoints: function (e) {\n var f = [],\n h = [],\n m = this.xAxis,\n D = this.yAxis,\n n = D.stacking.stacks[this.stackKey],\n l = {},\n y = this.index,\n w = D.series,\n r = w.length,\n d = C(D.options.reversedStacks, !0) ? 1 : -1,\n g;\n e = e || this.points;\n if (this.options.stacking) {\n for (g = 0; g < e.length; g++) e[g].leftNull = e[g].rightNull = void 0, l[e[g].x] = e[g];\n K(n, function (a, c) {\n null !== a.total && h.push(c);\n });\n h.sort(function (a, c) {\n return a - c;\n });\n var c = w.map(function (a) {\n return a.visible;\n });\n h.forEach(function (a, e) {\n var p = 0,\n q,\n w;\n if (l[a] && !l[a].isNull) f.push(l[a]), [-1, 1].forEach(function (f) {\n var p = 1 === f ? \"rightNull\" : \"leftNull\",\n m = 0,\n v = n[h[e + f]];\n if (v) for (g = y; 0 <= g && g < r;) q = v.points[g], q || (g === y ? l[a][p] = !0 : c[g] && (w = n[a].points[g]) && (m -= w[1] - w[0])), g += d;\n l[a][1 === f ? \"rightCliff\" : \"leftCliff\"] = m;\n });else {\n for (g = y; 0 <= g && g < r;) {\n if (q = n[a].points[g]) {\n p = q[1];\n break;\n }\n g += d;\n }\n p = D.translate(p, 0, 1, 0, 1);\n f.push({\n isNull: !0,\n plotX: m.translate(a, 0, 0, 0, 1),\n x: a,\n plotY: p,\n yBottom: p\n });\n }\n });\n }\n return f;\n },\n getGraphPath: function (e) {\n var f = y.prototype.getGraphPath,\n h = this.options,\n m = h.stacking,\n D = this.yAxis,\n n,\n l = [],\n z = [],\n w = this.index,\n r = D.stacking.stacks[this.stackKey],\n d = h.threshold,\n g = Math.round(D.getThreshold(h.threshold));\n h = C(h.connectNulls, \"percent\" === m);\n var c = function (a, c, f) {\n var p = e[a];\n a = m && r[p.x].points[w];\n var h = p[f + \"Null\"] || 0;\n f = p[f + \"Cliff\"] || 0;\n p = !0;\n if (f || h) {\n var n = (h ? a[0] : a[1]) + f;\n var v = a[0] + f;\n p = !!h;\n } else !m && e[c] && e[c].isNull && (n = v = d);\n \"undefined\" !== typeof n && (z.push({\n plotX: q,\n plotY: null === n ? g : D.getThreshold(n),\n isNull: p,\n isCliff: !0\n }), l.push({\n plotX: q,\n plotY: null === v ? g : D.getThreshold(v),\n doCurve: !1\n }));\n };\n e = e || this.points;\n m && (e = this.getStackPoints(e));\n for (n = 0; n < e.length; n++) {\n m || (e[n].leftCliff = e[n].rightCliff = e[n].leftNull = e[n].rightNull = void 0);\n var a = e[n].isNull;\n var q = C(e[n].rectPlotX, e[n].plotX);\n var p = m ? e[n].yBottom : g;\n if (!a || h) h || c(n, n - 1, \"left\"), a && !m && h || (z.push(e[n]), l.push({\n x: n,\n plotX: q,\n plotY: p\n })), h || c(n, n + 1, \"right\");\n }\n n = f.call(this, z, !0, !0);\n l.reversed = !0;\n a = f.call(this, l, !0, !0);\n (p = a[0]) && \"M\" === p[0] && (a[0] = [\"L\", p[1], p[2]]);\n a = n.concat(a);\n f = f.call(this, z, !1, h);\n a.xMap = n.xMap;\n this.areaPath = a;\n return f;\n },\n drawGraph: function () {\n this.areaPath = [];\n y.prototype.drawGraph.apply(this);\n var e = this,\n f = this.areaPath,\n h = this.options,\n m = [[\"area\", \"highcharts-area\", this.color, h.fillColor]];\n this.zones.forEach(function (f, n) {\n m.push([\"zone-area-\" + n, \"highcharts-area highcharts-zone-area-\" + n + \" \" + f.className, f.color || e.color, f.fillColor || h.fillColor]);\n });\n m.forEach(function (m) {\n var n = m[0],\n l = e[n],\n v = l ? \"animate\" : \"attr\",\n w = {};\n l ? (l.endX = e.preventGraphAnimation ? null : f.xMap, l.animate({\n d: f\n })) : (w.zIndex = 0, l = e[n] = e.chart.renderer.path(f).addClass(m[1]).add(e.group), l.isArea = !0);\n e.chart.styledMode || (w.fill = C(m[3], L(m[2]).setOpacity(C(h.fillOpacity, .75)).get()));\n l[v](w);\n l.startX = f.xMap;\n l.shiftUnit = h.step ? 2 : 1;\n });\n },\n drawLegendSymbol: z.drawRectangle\n });\n \"\";\n });\n N(m, \"Series/SplineSeries.js\", [m[\"Core/Series/Series.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = h.pick;\n f.seriesType(\"spline\", \"line\", {}, {\n getPointSpline: function (f, h, L) {\n var z = h.plotX || 0,\n C = h.plotY || 0,\n y = f[L - 1];\n L = f[L + 1];\n if (y && !y.isNull && !1 !== y.doCurve && !h.isCliff && L && !L.isNull && !1 !== L.doCurve && !h.isCliff) {\n f = y.plotY || 0;\n var e = L.plotX || 0;\n L = L.plotY || 0;\n var F = 0;\n var v = (1.5 * z + (y.plotX || 0)) / 2.5;\n var x = (1.5 * C + f) / 2.5;\n e = (1.5 * z + e) / 2.5;\n var D = (1.5 * C + L) / 2.5;\n e !== v && (F = (D - x) * (e - z) / (e - v) + C - D);\n x += F;\n D += F;\n x > f && x > C ? (x = Math.max(f, C), D = 2 * C - x) : x < f && x < C && (x = Math.min(f, C), D = 2 * C - x);\n D > L && D > C ? (D = Math.max(L, C), x = 2 * C - D) : D < L && D < C && (D = Math.min(L, C), x = 2 * C - D);\n h.rightContX = e;\n h.rightContY = D;\n }\n h = [\"C\", m(y.rightContX, y.plotX, 0), m(y.rightContY, y.plotY, 0), m(v, z, 0), m(x, C, 0), z, C];\n y.rightContX = y.rightContY = void 0;\n return h;\n }\n });\n \"\";\n });\n N(m, \"Series/AreaSplineSeries.js\", [m[\"Core/Series/Series.js\"], m[\"Mixins/LegendSymbol.js\"], m[\"Core/Options.js\"]], function (f, h, m) {\n var z = f.seriesTypes.area.prototype;\n f.seriesType(\"areaspline\", \"spline\", m.defaultOptions.plotOptions.area, {\n getStackPoints: z.getStackPoints,\n getGraphPath: z.getGraphPath,\n drawGraph: z.drawGraph,\n drawLegendSymbol: h.drawRectangle\n });\n \"\";\n });\n N(m, \"Series/ColumnSeries.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Series/Series.js\"], m[\"Core/Color/Color.js\"], m[\"Core/Globals.js\"], m[\"Mixins/LegendSymbol.js\"], m[\"Series/LineSeries.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z, F, L, K) {\n var C = f.animObject,\n y = m.parse;\n f = z.noop;\n var e = K.clamp,\n I = K.defined,\n v = K.extend,\n x = K.isArray,\n D = K.isNumber,\n n = K.merge,\n l = K.pick,\n J = K.objectEach;\n \"\";\n h = h.seriesType(\"column\", \"line\", {\n borderRadius: 0,\n centerInCategory: !1,\n groupPadding: .2,\n marker: null,\n pointPadding: .1,\n minPointLength: 0,\n cropThreshold: 50,\n pointRange: null,\n states: {\n hover: {\n halo: !1,\n brightness: .1\n },\n select: {\n color: \"#cccccc\",\n borderColor: \"#000000\"\n }\n },\n dataLabels: {\n align: void 0,\n verticalAlign: void 0,\n y: void 0\n },\n startFromThreshold: !0,\n stickyTracking: !1,\n tooltip: {\n distance: 6\n },\n threshold: 0,\n borderColor: \"#ffffff\"\n }, {\n cropShoulder: 0,\n directTouch: !0,\n trackerGroups: [\"group\", \"dataLabelsGroup\"],\n negStacks: !0,\n init: function () {\n L.prototype.init.apply(this, arguments);\n var e = this,\n f = e.chart;\n f.hasRendered && f.series.forEach(function (d) {\n d.type === e.type && (d.isDirty = !0);\n });\n },\n getColumnMetrics: function () {\n var e = this,\n f = e.options,\n d = e.xAxis,\n g = e.yAxis,\n c = d.options.reversedStacks;\n c = d.reversed && !c || !d.reversed && c;\n var a,\n h = {},\n p = 0;\n !1 === f.grouping ? p = 1 : e.chart.series.forEach(function (c) {\n var d = c.yAxis,\n f = c.options;\n if (c.type === e.type && (c.visible || !e.chart.options.chart.ignoreHiddenSeries) && g.len === d.len && g.pos === d.pos) {\n if (f.stacking && \"group\" !== f.stacking) {\n a = c.stackKey;\n \"undefined\" === typeof h[a] && (h[a] = p++);\n var q = h[a];\n } else !1 !== f.grouping && (q = p++);\n c.columnIndex = q;\n }\n });\n var n = Math.min(Math.abs(d.transA) * (d.ordinal && d.ordinal.slope || f.pointRange || d.closestPointRange || d.tickInterval || 1), d.len),\n m = n * f.groupPadding,\n v = (n - 2 * m) / (p || 1);\n f = Math.min(f.maxPointWidth || d.len, l(f.pointWidth, v * (1 - 2 * f.pointPadding)));\n e.columnMetrics = {\n width: f,\n offset: (v - f) / 2 + (m + ((e.columnIndex || 0) + (c ? 1 : 0)) * v - n / 2) * (c ? -1 : 1),\n paddedWidth: v,\n columnCount: p\n };\n return e.columnMetrics;\n },\n crispCol: function (e, f, d, g) {\n var c = this.chart,\n a = this.borderWidth,\n h = -(a % 2 ? .5 : 0);\n a = a % 2 ? .5 : 1;\n c.inverted && c.renderer.isVML && (a += 1);\n this.options.crisp && (d = Math.round(e + d) + h, e = Math.round(e) + h, d -= e);\n g = Math.round(f + g) + a;\n h = .5 >= Math.abs(f) && .5 < g;\n f = Math.round(f) + a;\n g -= f;\n h && g && (--f, g += 1);\n return {\n x: e,\n y: f,\n width: d,\n height: g\n };\n },\n adjustForMissingColumns: function (e, f, d, g) {\n var c = this,\n a = this.options.stacking;\n if (!d.isNull && 1 < g.columnCount) {\n var h = 0,\n p = 0;\n J(this.yAxis.stacking && this.yAxis.stacking.stacks, function (g) {\n if (\"number\" === typeof d.x && (g = g[d.x.toString()])) {\n var e = g.points[c.index],\n f = g.total;\n a ? (e && (h = p), g.hasValidPoints && p++) : x(e) && (h = e[1], p = f || 0);\n }\n });\n e = (d.plotX || 0) + ((p - 1) * g.paddedWidth + f) / 2 - f - h * g.paddedWidth;\n }\n return e;\n },\n translate: function () {\n var f = this,\n h = f.chart,\n d = f.options,\n g = f.dense = 2 > f.closestPointRange * f.xAxis.transA;\n g = f.borderWidth = l(d.borderWidth, g ? 0 : 1);\n var c = f.xAxis,\n a = f.yAxis,\n q = d.threshold,\n p = f.translatedThreshold = a.getThreshold(q),\n n = l(d.minPointLength, 5),\n m = f.getColumnMetrics(),\n v = m.width,\n x = f.barW = Math.max(v, 1 + 2 * g),\n y = f.pointXOffset = m.offset,\n z = f.dataMin,\n C = f.dataMax;\n h.inverted && (p -= .5);\n d.pointPadding && (x = Math.ceil(x));\n L.prototype.translate.apply(f);\n f.points.forEach(function (g) {\n var u = l(g.yBottom, p),\n b = 999 + Math.abs(u),\n k = v,\n t = g.plotX || 0;\n b = e(g.plotY, -b, a.len + b);\n var r = t + y,\n w = x,\n A = Math.min(b, u),\n B = Math.max(b, u) - A;\n if (n && Math.abs(B) < n) {\n B = n;\n var E = !a.reversed && !g.negative || a.reversed && g.negative;\n D(q) && D(C) && g.y === q && C <= q && (a.min || 0) < q && z !== C && (E = !E);\n A = Math.abs(A - p) > n ? u - n : p - (E ? n : 0);\n }\n I(g.options.pointWidth) && (k = w = Math.ceil(g.options.pointWidth), r -= Math.round((k - v) / 2));\n d.centerInCategory && (r = f.adjustForMissingColumns(r, k, g, m));\n g.barX = r;\n g.pointWidth = k;\n g.tooltipPos = h.inverted ? [a.len + a.pos - h.plotLeft - b, c.len + c.pos - h.plotTop - (t || 0) - y - w / 2, B] : [r + w / 2, b + a.pos - h.plotTop, B];\n g.shapeType = f.pointClass.prototype.shapeType || \"rect\";\n g.shapeArgs = f.crispCol.apply(f, g.isNull ? [r, p, w, 0] : [r, A, w, B]);\n });\n },\n getSymbol: f,\n drawLegendSymbol: F.drawRectangle,\n drawGraph: function () {\n this.group[this.dense ? \"addClass\" : \"removeClass\"](\"highcharts-dense-data\");\n },\n pointAttribs: function (e, f) {\n var d = this.options,\n g = this.pointAttrToOptions || {};\n var c = g.stroke || \"borderColor\";\n var a = g[\"stroke-width\"] || \"borderWidth\",\n h = e && e.color || this.color,\n p = e && e[c] || d[c] || this.color || h,\n m = e && e[a] || d[a] || this[a] || 0;\n g = e && e.options.dashStyle || d.dashStyle;\n var r = l(e && e.opacity, d.opacity, 1);\n if (e && this.zones.length) {\n var v = e.getZone();\n h = e.options.color || v && (v.color || e.nonZonedColor) || this.color;\n v && (p = v.borderColor || p, g = v.dashStyle || g, m = v.borderWidth || m);\n }\n f && e && (e = n(d.states[f], e.options.states && e.options.states[f] || {}), f = e.brightness, h = e.color || \"undefined\" !== typeof f && y(h).brighten(e.brightness).get() || h, p = e[c] || p, m = e[a] || m, g = e.dashStyle || g, r = l(e.opacity, r));\n c = {\n fill: h,\n stroke: p,\n \"stroke-width\": m,\n opacity: r\n };\n g && (c.dashstyle = g);\n return c;\n },\n drawPoints: function () {\n var e = this,\n f = this.chart,\n d = e.options,\n g = f.renderer,\n c = d.animationLimit || 250,\n a;\n e.points.forEach(function (h) {\n var p = h.graphic,\n l = !!p,\n q = p && f.pointCount < c ? \"animate\" : \"attr\";\n if (D(h.plotY) && null !== h.y) {\n a = h.shapeArgs;\n p && h.hasNewShapeType() && (p = p.destroy());\n e.enabledDataSorting && (h.startXPos = e.xAxis.reversed ? -(a ? a.width : 0) : e.xAxis.width);\n p || (h.graphic = p = g[h.shapeType](a).add(h.group || e.group)) && e.enabledDataSorting && f.hasRendered && f.pointCount < c && (p.attr({\n x: h.startXPos\n }), l = !0, q = \"animate\");\n if (p && l) p[q](n(a));\n if (d.borderRadius) p[q]({\n r: d.borderRadius\n });\n f.styledMode || p[q](e.pointAttribs(h, h.selected && \"select\")).shadow(!1 !== h.allowShadow && d.shadow, null, d.stacking && !d.borderRadius);\n p.addClass(h.getClassName(), !0);\n } else p && (h.graphic = p.destroy());\n });\n },\n animate: function (f) {\n var h = this,\n d = this.yAxis,\n g = h.options,\n c = this.chart.inverted,\n a = {},\n l = c ? \"translateX\" : \"translateY\";\n if (f) a.scaleY = .001, f = e(d.toPixels(g.threshold), d.pos, d.pos + d.len), c ? a.translateX = f - d.len : a.translateY = f, h.clipBox && h.setClip(), h.group.attr(a);else {\n var p = h.group.attr(l);\n h.group.animate({\n scaleY: 1\n }, v(C(h.options.animation), {\n step: function (c, g) {\n h.group && (a[l] = p + g.pos * (d.pos - p), h.group.attr(a));\n }\n }));\n }\n },\n remove: function () {\n var e = this,\n f = e.chart;\n f.hasRendered && f.series.forEach(function (d) {\n d.type === e.type && (d.isDirty = !0);\n });\n L.prototype.remove.apply(e, arguments);\n }\n });\n \"\";\n return h;\n });\n N(m, \"Series/BarSeries.js\", [m[\"Core/Series/Series.js\"]], function (f) {\n f.seriesType(\"bar\", \"column\", null, {\n inverted: !0\n });\n \"\";\n });\n N(m, \"Series/ScatterSeries.js\", [m[\"Core/Series/Series.js\"], m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h, m) {\n m = m.addEvent;\n var z = h.Series;\n f.seriesType(\"scatter\", \"line\", {\n lineWidth: 0,\n findNearestPointBy: \"xy\",\n jitter: {\n x: 0,\n y: 0\n },\n marker: {\n enabled: !0\n },\n tooltip: {\n headerFormat: '\\u25cf {series.name}
',\n pointFormat: \"x: {point.x}
y: {point.y}
\"\n }\n }, {\n sorted: !1,\n requireSorting: !1,\n noSharedTooltip: !0,\n trackerGroups: [\"group\", \"markerGroup\", \"dataLabelsGroup\"],\n takeOrdinalPosition: !1,\n drawGraph: function () {\n (this.options.lineWidth || 0 === this.options.lineWidth && this.graph && this.graph.strokeWidth()) && z.prototype.drawGraph.call(this);\n },\n applyJitter: function () {\n var f = this,\n h = this.options.jitter,\n m = this.points.length;\n h && this.points.forEach(function (z, y) {\n [\"x\", \"y\"].forEach(function (e, C) {\n var v = \"plot\" + e.toUpperCase();\n if (h[e] && !z.isNull) {\n var x = f[e + \"Axis\"];\n var D = h[e] * x.transA;\n if (x && !x.isLog) {\n var n = Math.max(0, z[v] - D);\n x = Math.min(x.len, z[v] + D);\n C = 1E4 * Math.sin(y + C * m);\n z[v] = n + (x - n) * (C - Math.floor(C));\n \"x\" === e && (z.clientX = z.plotX);\n }\n }\n });\n });\n }\n });\n m(z, \"afterTranslate\", function () {\n this.applyJitter && this.applyJitter();\n });\n \"\";\n });\n N(m, \"Mixins/CenteredSeries.js\", [m[\"Core/Globals.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = h.isNumber,\n z = h.pick,\n F = h.relativeLength,\n L = f.deg2rad;\n return f.CenteredSeriesMixin = {\n getCenter: function () {\n var h = this.options,\n m = this.chart,\n y = 2 * (h.slicedOffset || 0),\n e = m.plotWidth - 2 * y,\n I = m.plotHeight - 2 * y,\n v = h.center,\n x = Math.min(e, I),\n D = h.size,\n n = h.innerSize || 0;\n \"string\" === typeof D && (D = parseFloat(D));\n \"string\" === typeof n && (n = parseFloat(n));\n h = [z(v[0], \"50%\"), z(v[1], \"50%\"), z(D && 0 > D ? void 0 : h.size, \"100%\"), z(n && 0 > n ? void 0 : h.innerSize || 0, \"0%\")];\n !m.angular || this instanceof f.Series || (h[3] = 0);\n for (v = 0; 4 > v; ++v) D = h[v], m = 2 > v || 2 === v && /%$/.test(D), h[v] = F(D, [e, I, x, h[2]][v]) + (m ? y : 0);\n h[3] > h[2] && (h[3] = h[2]);\n return h;\n },\n getStartAndEndRadians: function (f, h) {\n f = m(f) ? f : 0;\n h = m(h) && h > f && 360 > h - f ? h : f + 360;\n return {\n start: L * (f + -90),\n end: L * (h + -90)\n };\n }\n };\n });\n N(m, \"Series/PieSeries.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Series/Series.js\"], m[\"Mixins/CenteredSeries.js\"], m[\"Core/Globals.js\"], m[\"Mixins/LegendSymbol.js\"], m[\"Series/LineSeries.js\"], m[\"Core/Series/Point.js\"], m[\"Core/Renderer/SVG/SVGRenderer.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z, F, L, K, C, y) {\n var e = f.setAnimation,\n I = m.getStartAndEndRadians;\n f = z.noop;\n var v = y.addEvent,\n x = y.clamp,\n D = y.defined,\n n = y.fireEvent,\n l = y.isNumber,\n J = y.merge,\n w = y.pick,\n r = y.relativeLength;\n h.seriesType(\"pie\", \"line\", {\n center: [null, null],\n clip: !1,\n colorByPoint: !0,\n dataLabels: {\n allowOverlap: !0,\n connectorPadding: 5,\n connectorShape: \"fixedOffset\",\n crookDistance: \"70%\",\n distance: 30,\n enabled: !0,\n formatter: function () {\n return this.point.isNull ? void 0 : this.point.name;\n },\n softConnector: !0,\n x: 0\n },\n fillColor: void 0,\n ignoreHiddenPoint: !0,\n inactiveOtherPoints: !0,\n legendType: \"point\",\n marker: null,\n size: null,\n showInLegend: !1,\n slicedOffset: 10,\n stickyTracking: !1,\n tooltip: {\n followPointer: !0\n },\n borderColor: \"#ffffff\",\n borderWidth: 1,\n lineWidth: void 0,\n states: {\n hover: {\n brightness: .1\n }\n }\n }, {\n isCartesian: !1,\n requireSorting: !1,\n directTouch: !0,\n noSharedTooltip: !0,\n trackerGroups: [\"group\", \"dataLabelsGroup\"],\n axisTypes: [],\n pointAttribs: h.seriesTypes.column.prototype.pointAttribs,\n animate: function (d) {\n var g = this,\n c = g.points,\n a = g.startAngleRad;\n d || c.forEach(function (c) {\n var d = c.graphic,\n e = c.shapeArgs;\n d && e && (d.attr({\n r: w(c.startR, g.center && g.center[3] / 2),\n start: a,\n end: a\n }), d.animate({\n r: e.r,\n start: e.start,\n end: e.end\n }, g.options.animation));\n });\n },\n hasData: function () {\n return !!this.processedXData.length;\n },\n updateTotals: function () {\n var d,\n g = 0,\n c = this.points,\n a = c.length,\n e = this.options.ignoreHiddenPoint;\n for (d = 0; d < a; d++) {\n var f = c[d];\n g += e && !f.visible ? 0 : f.isNull ? 0 : f.y;\n }\n this.total = g;\n for (d = 0; d < a; d++) f = c[d], f.percentage = 0 < g && (f.visible || !e) ? f.y / g * 100 : 0, f.total = g;\n },\n generatePoints: function () {\n L.prototype.generatePoints.call(this);\n this.updateTotals();\n },\n getX: function (d, g, c) {\n var a = this.center,\n e = this.radii ? this.radii[c.index] : a[2] / 2;\n d = Math.asin(x((d - a[1]) / (e + c.labelDistance), -1, 1));\n return a[0] + (g ? -1 : 1) * Math.cos(d) * (e + c.labelDistance) + (0 < c.labelDistance ? (g ? -1 : 1) * this.options.dataLabels.padding : 0);\n },\n translate: function (d) {\n this.generatePoints();\n var g = 0,\n c = this.options,\n a = c.slicedOffset,\n e = a + (c.borderWidth || 0),\n f = I(c.startAngle, c.endAngle),\n h = this.startAngleRad = f.start;\n f = (this.endAngleRad = f.end) - h;\n var l = this.points,\n m = c.dataLabels.distance;\n c = c.ignoreHiddenPoint;\n var v,\n x = l.length;\n d || (this.center = d = this.getCenter());\n for (v = 0; v < x; v++) {\n var y = l[v];\n var z = h + g * f;\n if (!c || y.visible) g += y.percentage / 100;\n var E = h + g * f;\n y.shapeType = \"arc\";\n y.shapeArgs = {\n x: d[0],\n y: d[1],\n r: d[2] / 2,\n innerR: d[3] / 2,\n start: Math.round(1E3 * z) / 1E3,\n end: Math.round(1E3 * E) / 1E3\n };\n y.labelDistance = w(y.options.dataLabels && y.options.dataLabels.distance, m);\n y.labelDistance = r(y.labelDistance, y.shapeArgs.r);\n this.maxLabelDistance = Math.max(this.maxLabelDistance || 0, y.labelDistance);\n E = (E + z) / 2;\n E > 1.5 * Math.PI ? E -= 2 * Math.PI : E < -Math.PI / 2 && (E += 2 * Math.PI);\n y.slicedTranslation = {\n translateX: Math.round(Math.cos(E) * a),\n translateY: Math.round(Math.sin(E) * a)\n };\n var u = Math.cos(E) * d[2] / 2;\n var b = Math.sin(E) * d[2] / 2;\n y.tooltipPos = [d[0] + .7 * u, d[1] + .7 * b];\n y.half = E < -Math.PI / 2 || E > Math.PI / 2 ? 1 : 0;\n y.angle = E;\n z = Math.min(e, y.labelDistance / 5);\n y.labelPosition = {\n natural: {\n x: d[0] + u + Math.cos(E) * y.labelDistance,\n y: d[1] + b + Math.sin(E) * y.labelDistance\n },\n \"final\": {},\n alignment: 0 > y.labelDistance ? \"center\" : y.half ? \"right\" : \"left\",\n connectorPosition: {\n breakAt: {\n x: d[0] + u + Math.cos(E) * z,\n y: d[1] + b + Math.sin(E) * z\n },\n touchingSliceAt: {\n x: d[0] + u,\n y: d[1] + b\n }\n }\n };\n }\n n(this, \"afterTranslate\");\n },\n drawEmpty: function () {\n var d = this.startAngleRad,\n g = this.endAngleRad,\n c = this.options;\n if (0 === this.total && this.center) {\n var a = this.center[0];\n var e = this.center[1];\n this.graph || (this.graph = this.chart.renderer.arc(a, e, this.center[1] / 2, 0, d, g).addClass(\"highcharts-empty-series\").add(this.group));\n this.graph.attr({\n d: C.prototype.symbols.arc(a, e, this.center[2] / 2, 0, {\n start: d,\n end: g,\n innerR: this.center[3] / 2\n })\n });\n this.chart.styledMode || this.graph.attr({\n \"stroke-width\": c.borderWidth,\n fill: c.fillColor || \"none\",\n stroke: c.color || \"#cccccc\"\n });\n } else this.graph && (this.graph = this.graph.destroy());\n },\n redrawPoints: function () {\n var d = this,\n e = d.chart,\n c = e.renderer,\n a,\n f,\n h,\n l,\n n = d.options.shadow;\n this.drawEmpty();\n !n || d.shadowGroup || e.styledMode || (d.shadowGroup = c.g(\"shadow\").attr({\n zIndex: -1\n }).add(d.group));\n d.points.forEach(function (g) {\n var p = {};\n f = g.graphic;\n if (!g.isNull && f) {\n l = g.shapeArgs;\n a = g.getTranslate();\n if (!e.styledMode) {\n var q = g.shadowGroup;\n n && !q && (q = g.shadowGroup = c.g(\"shadow\").add(d.shadowGroup));\n q && q.attr(a);\n h = d.pointAttribs(g, g.selected && \"select\");\n }\n g.delayedRendering ? (f.setRadialReference(d.center).attr(l).attr(a), e.styledMode || f.attr(h).attr({\n \"stroke-linejoin\": \"round\"\n }).shadow(n, q), g.delayedRendering = !1) : (f.setRadialReference(d.center), e.styledMode || J(!0, p, h), J(!0, p, l, a), f.animate(p));\n f.attr({\n visibility: g.visible ? \"inherit\" : \"hidden\"\n });\n f.addClass(g.getClassName());\n } else f && (g.graphic = f.destroy());\n });\n },\n drawPoints: function () {\n var d = this.chart.renderer;\n this.points.forEach(function (e) {\n e.graphic && e.hasNewShapeType() && (e.graphic = e.graphic.destroy());\n e.graphic || (e.graphic = d[e.shapeType](e.shapeArgs).add(e.series.group), e.delayedRendering = !0);\n });\n },\n searchPoint: f,\n sortByAngle: function (d, e) {\n d.sort(function (c, a) {\n return \"undefined\" !== typeof c.angle && (a.angle - c.angle) * e;\n });\n },\n drawLegendSymbol: F.drawRectangle,\n getCenter: m.getCenter,\n getSymbol: f,\n drawGraph: null\n }, {\n init: function () {\n K.prototype.init.apply(this, arguments);\n var d = this;\n d.name = w(d.name, \"Slice\");\n var e = function (c) {\n d.slice(\"select\" === c.type);\n };\n v(d, \"select\", e);\n v(d, \"unselect\", e);\n return d;\n },\n isValid: function () {\n return l(this.y) && 0 <= this.y;\n },\n setVisible: function (d, e) {\n var c = this,\n a = c.series,\n g = a.chart,\n f = a.options.ignoreHiddenPoint;\n e = w(e, f);\n d !== c.visible && (c.visible = c.options.visible = d = \"undefined\" === typeof d ? !c.visible : d, a.options.data[a.data.indexOf(c)] = c.options, [\"graphic\", \"dataLabel\", \"connector\", \"shadowGroup\"].forEach(function (a) {\n if (c[a]) c[a][d ? \"show\" : \"hide\"](!0);\n }), c.legendItem && g.legend.colorizeItem(c, d), d || \"hover\" !== c.state || c.setState(\"\"), f && (a.isDirty = !0), e && g.redraw());\n },\n slice: function (d, g, c) {\n var a = this.series;\n e(c, a.chart);\n w(g, !0);\n this.sliced = this.options.sliced = D(d) ? d : !this.sliced;\n a.options.data[a.data.indexOf(this)] = this.options;\n this.graphic && this.graphic.animate(this.getTranslate());\n this.shadowGroup && this.shadowGroup.animate(this.getTranslate());\n },\n getTranslate: function () {\n return this.sliced ? this.slicedTranslation : {\n translateX: 0,\n translateY: 0\n };\n },\n haloPath: function (d) {\n var e = this.shapeArgs;\n return this.sliced || !this.visible ? [] : this.series.chart.renderer.symbols.arc(e.x, e.y, e.r + d, e.r + d, {\n innerR: e.r - 1,\n start: e.start,\n end: e.end\n });\n },\n connectorShapes: {\n fixedOffset: function (d, e, c) {\n var a = e.breakAt;\n e = e.touchingSliceAt;\n return [[\"M\", d.x, d.y], c.softConnector ? [\"C\", d.x + (\"left\" === d.alignment ? -5 : 5), d.y, 2 * a.x - e.x, 2 * a.y - e.y, a.x, a.y] : [\"L\", a.x, a.y], [\"L\", e.x, e.y]];\n },\n straight: function (d, e) {\n e = e.touchingSliceAt;\n return [[\"M\", d.x, d.y], [\"L\", e.x, e.y]];\n },\n crookedLine: function (d, e, c) {\n e = e.touchingSliceAt;\n var a = this.series,\n g = a.center[0],\n f = a.chart.plotWidth,\n h = a.chart.plotLeft;\n a = d.alignment;\n var l = this.shapeArgs.r;\n c = r(c.crookDistance, 1);\n f = \"left\" === a ? g + l + (f + h - g - l) * (1 - c) : h + (g - l) * c;\n c = [\"L\", f, d.y];\n g = !0;\n if (\"left\" === a ? f > d.x || f < e.x : f < d.x || f > e.x) g = !1;\n d = [[\"M\", d.x, d.y]];\n g && d.push(c);\n d.push([\"L\", e.x, e.y]);\n return d;\n }\n },\n getConnectorPath: function () {\n var d = this.labelPosition,\n e = this.series.options.dataLabels,\n c = e.connectorShape,\n a = this.connectorShapes;\n a[c] && (c = a[c]);\n return c.call(this, {\n x: d.final.x,\n y: d.final.y,\n alignment: d.alignment\n }, d.connectorPosition, e);\n }\n });\n \"\";\n });\n N(m, \"Core/Series/DataLabels.js\", [m[\"Core/Animation/AnimationUtilities.js\"], m[\"Core/Globals.js\"], m[\"Core/Series/CartesianSeries.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z) {\n var F = f.getDeferredAnimation;\n f = h.noop;\n var L = h.seriesTypes,\n K = z.arrayMax,\n C = z.clamp,\n y = z.defined,\n e = z.extend,\n I = z.fireEvent,\n v = z.format,\n x = z.isArray,\n D = z.merge,\n n = z.objectEach,\n l = z.pick,\n J = z.relativeLength,\n w = z.splat,\n r = z.stableSort;\n \"\";\n h.distribute = function (d, e, c) {\n function a(a, c) {\n return a.target - c.target;\n }\n var f,\n g = !0,\n n = d,\n m = [];\n var v = 0;\n var w = n.reducedLen || e;\n for (f = d.length; f--;) v += d[f].size;\n if (v > w) {\n r(d, function (a, c) {\n return (c.rank || 0) - (a.rank || 0);\n });\n for (v = f = 0; v <= w;) v += d[f].size, f++;\n m = d.splice(f - 1, d.length);\n }\n r(d, a);\n for (d = d.map(function (a) {\n return {\n size: a.size,\n targets: [a.target],\n align: l(a.align, .5)\n };\n }); g;) {\n for (f = d.length; f--;) g = d[f], v = (Math.min.apply(0, g.targets) + Math.max.apply(0, g.targets)) / 2, g.pos = C(v - g.size * g.align, 0, e - g.size);\n f = d.length;\n for (g = !1; f--;) 0 < f && d[f - 1].pos + d[f - 1].size > d[f].pos && (d[f - 1].size += d[f].size, d[f - 1].targets = d[f - 1].targets.concat(d[f].targets), d[f - 1].align = .5, d[f - 1].pos + d[f - 1].size > e && (d[f - 1].pos = e - d[f - 1].size), d.splice(f, 1), g = !0);\n }\n n.push.apply(n, m);\n f = 0;\n d.some(function (a) {\n var d = 0;\n if (a.targets.some(function () {\n n[f].pos = a.pos + d;\n if (\"undefined\" !== typeof c && Math.abs(n[f].pos - n[f].target) > c) return n.slice(0, f + 1).forEach(function (a) {\n delete a.pos;\n }), n.reducedLen = (n.reducedLen || e) - .1 * e, n.reducedLen > .1 * e && h.distribute(n, e, c), !0;\n d += n[f].size;\n f++;\n })) return !0;\n });\n r(n, a);\n };\n m.prototype.drawDataLabels = function () {\n function d(a, c) {\n var d = c.filter;\n return d ? (c = d.operator, a = a[d.property], d = d.value, \">\" === c && a > d || \"<\" === c && a < d || \">=\" === c && a >= d || \"<=\" === c && a <= d || \"==\" === c && a == d || \"===\" === c && a === d ? !0 : !1) : !0;\n }\n function e(a, c) {\n var d = [],\n b;\n if (x(a) && !x(c)) d = a.map(function (a) {\n return D(a, c);\n });else if (x(c) && !x(a)) d = c.map(function (b) {\n return D(a, b);\n });else if (x(a) || x(c)) for (b = Math.max(a.length, c.length); b--;) d[b] = D(a[b], c[b]);else d = D(a, c);\n return d;\n }\n var c = this,\n a = c.chart,\n f = c.options,\n h = f.dataLabels,\n m = c.points,\n r,\n G = c.hasRendered || 0,\n z = h.animation;\n z = h.defer ? F(a, z, c) : {\n defer: 0,\n duration: 0\n };\n var C = a.renderer;\n h = e(e(a.options.plotOptions && a.options.plotOptions.series && a.options.plotOptions.series.dataLabels, a.options.plotOptions && a.options.plotOptions[c.type] && a.options.plotOptions[c.type].dataLabels), h);\n I(this, \"drawDataLabels\");\n if (x(h) || h.enabled || c._hasPointLabels) {\n var J = c.plotGroup(\"dataLabelsGroup\", \"data-labels\", G ? \"inherit\" : \"hidden\", h.zIndex || 6);\n J.attr({\n opacity: +G\n });\n !G && (G = c.dataLabelsGroup) && (c.visible && J.show(!0), G[f.animation ? \"animate\" : \"attr\"]({\n opacity: 1\n }, z));\n m.forEach(function (g) {\n r = w(e(h, g.dlOptions || g.options && g.options.dataLabels));\n r.forEach(function (e, h) {\n var b = e.enabled && (!g.isNull || g.dataLabelOnNull) && d(g, e),\n k = g.dataLabels ? g.dataLabels[h] : g.dataLabel,\n p = g.connectors ? g.connectors[h] : g.connector,\n m = l(e.distance, g.labelDistance),\n q = !k;\n if (b) {\n var u = g.getLabelConfig();\n var r = l(e[g.formatPrefix + \"Format\"], e.format);\n u = y(r) ? v(r, u, a) : (e[g.formatPrefix + \"Formatter\"] || e.formatter).call(u, e);\n r = e.style;\n var A = e.rotation;\n a.styledMode || (r.color = l(e.color, r.color, c.color, \"#000000\"), \"contrast\" === r.color ? (g.contrastColor = C.getContrast(g.color || c.color), r.color = !y(m) && e.inside || 0 > m || f.stacking ? g.contrastColor : \"#000000\") : delete g.contrastColor, f.cursor && (r.cursor = f.cursor));\n var w = {\n r: e.borderRadius || 0,\n rotation: A,\n padding: e.padding,\n zIndex: 1\n };\n a.styledMode || (w.fill = e.backgroundColor, w.stroke = e.borderColor, w[\"stroke-width\"] = e.borderWidth);\n n(w, function (a, b) {\n \"undefined\" === typeof a && delete w[b];\n });\n }\n !k || b && y(u) ? b && y(u) && (k ? w.text = u : (g.dataLabels = g.dataLabels || [], k = g.dataLabels[h] = A ? C.text(u, 0, -9999, e.useHTML).addClass(\"highcharts-data-label\") : C.label(u, 0, -9999, e.shape, null, null, e.useHTML, null, \"data-label\"), h || (g.dataLabel = k), k.addClass(\" highcharts-data-label-color-\" + g.colorIndex + \" \" + (e.className || \"\") + (e.useHTML ? \" highcharts-tracker\" : \"\"))), k.options = e, k.attr(w), a.styledMode || k.css(r).shadow(e.shadow), k.added || k.add(J), e.textPath && !e.useHTML && (k.setTextPath(g.getDataLabelPath && g.getDataLabelPath(k) || g.graphic, e.textPath), g.dataLabelPath && !e.textPath.enabled && (g.dataLabelPath = g.dataLabelPath.destroy())), c.alignDataLabel(g, k, e, null, q)) : (g.dataLabel = g.dataLabel && g.dataLabel.destroy(), g.dataLabels && (1 === g.dataLabels.length ? delete g.dataLabels : delete g.dataLabels[h]), h || delete g.dataLabel, p && (g.connector = g.connector.destroy(), g.connectors && (1 === g.connectors.length ? delete g.connectors : delete g.connectors[h])));\n });\n });\n }\n I(this, \"afterDrawDataLabels\");\n };\n m.prototype.alignDataLabel = function (d, g, c, a, f) {\n var h = this,\n n = this.chart,\n m = this.isCartesian && n.inverted,\n q = this.enabledDataSorting,\n r = l(d.dlBox && d.dlBox.centerX, d.plotX, -9999),\n v = l(d.plotY, -9999),\n w = g.getBBox(),\n x = c.rotation,\n y = c.align,\n u = n.isInsidePlot(r, Math.round(v), m),\n b = \"justify\" === l(c.overflow, q ? \"none\" : \"justify\"),\n k = this.visible && !1 !== d.visible && (d.series.forceDL || q && !b || u || c.inside && a && n.isInsidePlot(r, m ? a.x + 1 : a.y + a.height - 1, m));\n var t = function (a) {\n q && h.xAxis && !b && h.setDataLabelStartPos(d, g, f, u, a);\n };\n if (k) {\n var z = n.renderer.fontMetrics(n.styledMode ? void 0 : c.style.fontSize, g).b;\n a = e({\n x: m ? this.yAxis.len - v : r,\n y: Math.round(m ? this.xAxis.len - r : v),\n width: 0,\n height: 0\n }, a);\n e(c, {\n width: w.width,\n height: w.height\n });\n x ? (b = !1, r = n.renderer.rotCorr(z, x), r = {\n x: a.x + (c.x || 0) + a.width / 2 + r.x,\n y: a.y + (c.y || 0) + {\n top: 0,\n middle: .5,\n bottom: 1\n }[c.verticalAlign] * a.height\n }, t(r), g[f ? \"attr\" : \"animate\"](r).attr({\n align: y\n }), t = (x + 720) % 360, t = 180 < t && 360 > t, \"left\" === y ? r.y -= t ? w.height : 0 : \"center\" === y ? (r.x -= w.width / 2, r.y -= w.height / 2) : \"right\" === y && (r.x -= w.width, r.y -= t ? 0 : w.height), g.placed = !0, g.alignAttr = r) : (t(a), g.align(c, null, a), r = g.alignAttr);\n b && 0 <= a.height ? this.justifyDataLabel(g, c, r, w, a, f) : l(c.crop, !0) && (k = n.isInsidePlot(r.x, r.y) && n.isInsidePlot(r.x + w.width, r.y + w.height));\n if (c.shape && !x) g[f ? \"attr\" : \"animate\"]({\n anchorX: m ? n.plotWidth - d.plotY : d.plotX,\n anchorY: m ? n.plotHeight - d.plotX : d.plotY\n });\n }\n f && q && (g.placed = !1);\n k || q && !b || (g.hide(!0), g.placed = !1);\n };\n m.prototype.setDataLabelStartPos = function (d, e, c, a, f) {\n var g = this.chart,\n h = g.inverted,\n l = this.xAxis,\n n = l.reversed,\n m = h ? e.height / 2 : e.width / 2;\n d = (d = d.pointWidth) ? d / 2 : 0;\n l = h ? f.x : n ? -m - d : l.width - m + d;\n f = h ? n ? this.yAxis.height - m + d : -m - d : f.y;\n e.startXPos = l;\n e.startYPos = f;\n a ? \"hidden\" === e.visibility && (e.show(), e.attr({\n opacity: 0\n }).animate({\n opacity: 1\n })) : e.attr({\n opacity: 1\n }).animate({\n opacity: 0\n }, void 0, e.hide);\n g.hasRendered && (c && e.attr({\n x: e.startXPos,\n y: e.startYPos\n }), e.placed = !0);\n };\n m.prototype.justifyDataLabel = function (d, e, c, a, f, h) {\n var g = this.chart,\n p = e.align,\n l = e.verticalAlign,\n n = d.box ? 0 : d.padding || 0,\n m = e.x;\n m = void 0 === m ? 0 : m;\n var q = e.y;\n var r = void 0 === q ? 0 : q;\n q = c.x + n;\n if (0 > q) {\n \"right\" === p && 0 <= m ? (e.align = \"left\", e.inside = !0) : m -= q;\n var v = !0;\n }\n q = c.x + a.width - n;\n q > g.plotWidth && (\"left\" === p && 0 >= m ? (e.align = \"right\", e.inside = !0) : m += g.plotWidth - q, v = !0);\n q = c.y + n;\n 0 > q && (\"bottom\" === l && 0 <= r ? (e.verticalAlign = \"top\", e.inside = !0) : r -= q, v = !0);\n q = c.y + a.height - n;\n q > g.plotHeight && (\"top\" === l && 0 >= r ? (e.verticalAlign = \"bottom\", e.inside = !0) : r += g.plotHeight - q, v = !0);\n v && (e.x = m, e.y = r, d.placed = !h, d.align(e, void 0, f));\n return v;\n };\n L.pie && (L.pie.prototype.dataLabelPositioners = {\n radialDistributionY: function (d) {\n return d.top + d.distributeBox.pos;\n },\n radialDistributionX: function (d, e, c, a) {\n return d.getX(c < e.top + 2 || c > e.bottom - 2 ? a : c, e.half, e);\n },\n justify: function (d, e, c) {\n return c[0] + (d.half ? -1 : 1) * (e + d.labelDistance);\n },\n alignToPlotEdges: function (d, e, c, a) {\n d = d.getBBox().width;\n return e ? d + a : c - d - a;\n },\n alignToConnectors: function (d, e, c, a) {\n var f = 0,\n g;\n d.forEach(function (a) {\n g = a.dataLabel.getBBox().width;\n g > f && (f = g);\n });\n return e ? f + a : c - f - a;\n }\n }, L.pie.prototype.drawDataLabels = function () {\n var d = this,\n e = d.data,\n c,\n a = d.chart,\n f = d.options.dataLabels || {},\n p = f.connectorPadding,\n n,\n r = a.plotWidth,\n v = a.plotHeight,\n w = a.plotLeft,\n x = Math.round(a.chartWidth / 3),\n z,\n C = d.center,\n E = C[2] / 2,\n u = C[1],\n b,\n k,\n t,\n F,\n I = [[], []],\n J,\n L,\n N,\n P,\n S = [0, 0, 0, 0],\n Y = d.dataLabelPositioners,\n W;\n d.visible && (f.enabled || d._hasPointLabels) && (e.forEach(function (a) {\n a.dataLabel && a.visible && a.dataLabel.shortened && (a.dataLabel.attr({\n width: \"auto\"\n }).css({\n width: \"auto\",\n textOverflow: \"clip\"\n }), a.dataLabel.shortened = !1);\n }), m.prototype.drawDataLabels.apply(d), e.forEach(function (a) {\n a.dataLabel && (a.visible ? (I[a.half].push(a), a.dataLabel._pos = null, !y(f.style.width) && !y(a.options.dataLabels && a.options.dataLabels.style && a.options.dataLabels.style.width) && a.dataLabel.getBBox().width > x && (a.dataLabel.css({\n width: Math.round(.7 * x) + \"px\"\n }), a.dataLabel.shortened = !0)) : (a.dataLabel = a.dataLabel.destroy(), a.dataLabels && 1 === a.dataLabels.length && delete a.dataLabels));\n }), I.forEach(function (e, g) {\n var n = e.length,\n m = [],\n q;\n if (n) {\n d.sortByAngle(e, g - .5);\n if (0 < d.maxLabelDistance) {\n var A = Math.max(0, u - E - d.maxLabelDistance);\n var B = Math.min(u + E + d.maxLabelDistance, a.plotHeight);\n e.forEach(function (b) {\n 0 < b.labelDistance && b.dataLabel && (b.top = Math.max(0, u - E - b.labelDistance), b.bottom = Math.min(u + E + b.labelDistance, a.plotHeight), q = b.dataLabel.getBBox().height || 21, b.distributeBox = {\n target: b.labelPosition.natural.y - b.top + q / 2,\n size: q,\n rank: b.y\n }, m.push(b.distributeBox));\n });\n A = B + q - A;\n h.distribute(m, A, A / 5);\n }\n for (P = 0; P < n; P++) {\n c = e[P];\n t = c.labelPosition;\n b = c.dataLabel;\n N = !1 === c.visible ? \"hidden\" : \"inherit\";\n L = A = t.natural.y;\n m && y(c.distributeBox) && (\"undefined\" === typeof c.distributeBox.pos ? N = \"hidden\" : (F = c.distributeBox.size, L = Y.radialDistributionY(c)));\n delete c.positionIndex;\n if (f.justify) J = Y.justify(c, E, C);else switch (f.alignTo) {\n case \"connectors\":\n J = Y.alignToConnectors(e, g, r, w);\n break;\n case \"plotEdges\":\n J = Y.alignToPlotEdges(b, g, r, w);\n break;\n default:\n J = Y.radialDistributionX(d, c, L, A);\n }\n b._attr = {\n visibility: N,\n align: t.alignment\n };\n W = c.options.dataLabels || {};\n b._pos = {\n x: J + l(W.x, f.x) + ({\n left: p,\n right: -p\n }[t.alignment] || 0),\n y: L + l(W.y, f.y) - 10\n };\n t.final.x = J;\n t.final.y = L;\n l(f.crop, !0) && (k = b.getBBox().width, A = null, J - k < p && 1 === g ? (A = Math.round(k - J + p), S[3] = Math.max(A, S[3])) : J + k > r - p && 0 === g && (A = Math.round(J + k - r + p), S[1] = Math.max(A, S[1])), 0 > L - F / 2 ? S[0] = Math.max(Math.round(-L + F / 2), S[0]) : L + F / 2 > v && (S[2] = Math.max(Math.round(L + F / 2 - v), S[2])), b.sideOverflow = A);\n }\n }\n }), 0 === K(S) || this.verifyDataLabelOverflow(S)) && (this.placeDataLabels(), this.points.forEach(function (c) {\n W = D(f, c.options.dataLabels);\n if (n = l(W.connectorWidth, 1)) {\n var e;\n z = c.connector;\n if ((b = c.dataLabel) && b._pos && c.visible && 0 < c.labelDistance) {\n N = b._attr.visibility;\n if (e = !z) c.connector = z = a.renderer.path().addClass(\"highcharts-data-label-connector highcharts-color-\" + c.colorIndex + (c.className ? \" \" + c.className : \"\")).add(d.dataLabelsGroup), a.styledMode || z.attr({\n \"stroke-width\": n,\n stroke: W.connectorColor || c.color || \"#666666\"\n });\n z[e ? \"attr\" : \"animate\"]({\n d: c.getConnectorPath()\n });\n z.attr(\"visibility\", N);\n } else z && (c.connector = z.destroy());\n }\n }));\n }, L.pie.prototype.placeDataLabels = function () {\n this.points.forEach(function (d) {\n var e = d.dataLabel,\n c;\n e && d.visible && ((c = e._pos) ? (e.sideOverflow && (e._attr.width = Math.max(e.getBBox().width - e.sideOverflow, 0), e.css({\n width: e._attr.width + \"px\",\n textOverflow: (this.options.dataLabels.style || {}).textOverflow || \"ellipsis\"\n }), e.shortened = !0), e.attr(e._attr), e[e.moved ? \"animate\" : \"attr\"](c), e.moved = !0) : e && e.attr({\n y: -9999\n }));\n delete d.distributeBox;\n }, this);\n }, L.pie.prototype.alignDataLabel = f, L.pie.prototype.verifyDataLabelOverflow = function (d) {\n var e = this.center,\n c = this.options,\n a = c.center,\n f = c.minSize || 80,\n h = null !== c.size;\n if (!h) {\n if (null !== a[0]) var l = Math.max(e[2] - Math.max(d[1], d[3]), f);else l = Math.max(e[2] - d[1] - d[3], f), e[0] += (d[3] - d[1]) / 2;\n null !== a[1] ? l = C(l, f, e[2] - Math.max(d[0], d[2])) : (l = C(l, f, e[2] - d[0] - d[2]), e[1] += (d[0] - d[2]) / 2);\n l < e[2] ? (e[2] = l, e[3] = Math.min(J(c.innerSize || 0, l), l), this.translate(e), this.drawDataLabels && this.drawDataLabels()) : h = !0;\n }\n return h;\n });\n L.column && (L.column.prototype.alignDataLabel = function (d, e, c, a, f) {\n var g = this.chart.inverted,\n h = d.series,\n n = d.dlBox || d.shapeArgs,\n q = l(d.below, d.plotY > l(this.translatedThreshold, h.yAxis.len)),\n r = l(c.inside, !!this.options.stacking);\n n && (a = D(n), 0 > a.y && (a.height += a.y, a.y = 0), n = a.y + a.height - h.yAxis.len, 0 < n && n < a.height && (a.height -= n), g && (a = {\n x: h.yAxis.len - a.y - a.height,\n y: h.xAxis.len - a.x - a.width,\n width: a.height,\n height: a.width\n }), r || (g ? (a.x += q ? 0 : a.width, a.width = 0) : (a.y += q ? a.height : 0, a.height = 0)));\n c.align = l(c.align, !g || r ? \"center\" : q ? \"right\" : \"left\");\n c.verticalAlign = l(c.verticalAlign, g || r ? \"middle\" : q ? \"top\" : \"bottom\");\n m.prototype.alignDataLabel.call(this, d, e, c, a, f);\n c.inside && d.contrastColor && e.css({\n color: d.contrastColor\n });\n });\n });\n N(m, \"Extensions/OverlappingDataLabels.js\", [m[\"Core/Chart/Chart.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = h.addEvent,\n z = h.fireEvent,\n F = h.isArray,\n L = h.isNumber,\n K = h.objectEach,\n C = h.pick;\n m(f, \"render\", function () {\n var f = [];\n (this.labelCollectors || []).forEach(function (e) {\n f = f.concat(e());\n });\n (this.yAxis || []).forEach(function (e) {\n e.stacking && e.options.stackLabels && !e.options.stackLabels.allowOverlap && K(e.stacking.stacks, function (e) {\n K(e, function (e) {\n f.push(e.label);\n });\n });\n });\n (this.series || []).forEach(function (e) {\n var h = e.options.dataLabels;\n e.visible && (!1 !== h.enabled || e._hasPointLabels) && (e.nodes || e.points).forEach(function (e) {\n e.visible && (F(e.dataLabels) ? e.dataLabels : e.dataLabel ? [e.dataLabel] : []).forEach(function (h) {\n var m = h.options;\n h.labelrank = C(m.labelrank, e.labelrank, e.shapeArgs && e.shapeArgs.height);\n m.allowOverlap || f.push(h);\n });\n });\n });\n this.hideOverlappingLabels(f);\n });\n f.prototype.hideOverlappingLabels = function (f) {\n var e = this,\n h = f.length,\n m = e.renderer,\n x,\n y,\n n,\n l = !1;\n var C = function (d) {\n var e,\n c = d.box ? 0 : d.padding || 0,\n a = e = 0,\n f;\n if (d && (!d.alignAttr || d.placed)) {\n var h = d.alignAttr || {\n x: d.attr(\"x\"),\n y: d.attr(\"y\")\n };\n var l = d.parentGroup;\n d.width || (e = d.getBBox(), d.width = e.width, d.height = e.height, e = m.fontMetrics(null, d.element).h);\n var n = d.width - 2 * c;\n (f = {\n left: \"0\",\n center: \"0.5\",\n right: \"1\"\n }[d.alignValue]) ? a = +f * n : L(d.x) && Math.round(d.x) !== d.translateX && (a = d.x - d.translateX);\n return {\n x: h.x + (l.translateX || 0) + c - (a || 0),\n y: h.y + (l.translateY || 0) + c - e,\n width: d.width - 2 * c,\n height: d.height - 2 * c\n };\n }\n };\n for (y = 0; y < h; y++) if (x = f[y]) x.oldOpacity = x.opacity, x.newOpacity = 1, x.absoluteBox = C(x);\n f.sort(function (d, e) {\n return (e.labelrank || 0) - (d.labelrank || 0);\n });\n for (y = 0; y < h; y++) {\n var w = (C = f[y]) && C.absoluteBox;\n for (x = y + 1; x < h; ++x) {\n var r = (n = f[x]) && n.absoluteBox;\n !w || !r || C === n || 0 === C.newOpacity || 0 === n.newOpacity || r.x >= w.x + w.width || r.x + r.width <= w.x || r.y >= w.y + w.height || r.y + r.height <= w.y || ((C.labelrank < n.labelrank ? C : n).newOpacity = 0);\n }\n }\n f.forEach(function (d) {\n if (d) {\n var f = d.newOpacity;\n d.oldOpacity !== f && (d.alignAttr && d.placed ? (d[f ? \"removeClass\" : \"addClass\"](\"highcharts-data-label-hidden\"), l = !0, d.alignAttr.opacity = f, d[d.isOld ? \"animate\" : \"attr\"](d.alignAttr, null, function () {\n e.styledMode || d.css({\n pointerEvents: f ? \"auto\" : \"none\"\n });\n d.visibility = f ? \"inherit\" : \"hidden\";\n }), z(e, \"afterHideOverlappingLabel\")) : d.attr({\n opacity: f\n }));\n d.isOld = !0;\n }\n });\n l && z(e, \"afterHideAllOverlappingLabels\");\n };\n });\n N(m, \"Core/Interaction.js\", [m[\"Core/Series/Series.js\"], m[\"Core/Chart/Chart.js\"], m[\"Core/Globals.js\"], m[\"Core/Legend.js\"], m[\"Series/LineSeries.js\"], m[\"Core/Options.js\"], m[\"Core/Series/Point.js\"], m[\"Core/Utilities.js\"]], function (f, h, m, z, F, L, K, C) {\n f = f.seriesTypes;\n var y = m.hasTouch,\n e = m.svg,\n I = L.defaultOptions,\n v = C.addEvent,\n x = C.createElement,\n D = C.css,\n n = C.defined,\n l = C.extend,\n J = C.fireEvent,\n w = C.isArray,\n r = C.isFunction,\n d = C.isNumber,\n g = C.isObject,\n c = C.merge,\n a = C.objectEach,\n q = C.pick;\n \"\";\n m = m.TrackerMixin = {\n drawTrackerPoint: function () {\n var a = this,\n c = a.chart,\n d = c.pointer,\n e = function (a) {\n var c = d.getPointFromEvent(a);\n \"undefined\" !== typeof c && (d.isDirectTouch = !0, c.onMouseOver(a));\n },\n f;\n a.points.forEach(function (a) {\n f = w(a.dataLabels) ? a.dataLabels : a.dataLabel ? [a.dataLabel] : [];\n a.graphic && (a.graphic.element.point = a);\n f.forEach(function (c) {\n c.div ? c.div.point = a : c.element.point = a;\n });\n });\n a._hasTracking || (a.trackerGroups.forEach(function (f) {\n if (a[f]) {\n a[f].addClass(\"highcharts-tracker\").on(\"mouseover\", e).on(\"mouseout\", function (a) {\n d.onTrackerMouseOut(a);\n });\n if (y) a[f].on(\"touchstart\", e);\n !c.styledMode && a.options.cursor && a[f].css(D).css({\n cursor: a.options.cursor\n });\n }\n }), a._hasTracking = !0);\n J(this, \"afterDrawTracker\");\n },\n drawTrackerGraph: function () {\n var a = this,\n c = a.options,\n d = c.trackByArea,\n f = [].concat(d ? a.areaPath : a.graphPath),\n g = a.chart,\n h = g.pointer,\n l = g.renderer,\n n = g.options.tooltip.snap,\n m = a.tracker,\n q = function (b) {\n if (g.hoverSeries !== a) a.onMouseOver();\n },\n b = \"rgba(192,192,192,\" + (e ? .0001 : .002) + \")\";\n m ? m.attr({\n d: f\n }) : a.graph && (a.tracker = l.path(f).attr({\n visibility: a.visible ? \"visible\" : \"hidden\",\n zIndex: 2\n }).addClass(d ? \"highcharts-tracker-area\" : \"highcharts-tracker-line\").add(a.group), g.styledMode || a.tracker.attr({\n \"stroke-linecap\": \"round\",\n \"stroke-linejoin\": \"round\",\n stroke: b,\n fill: d ? b : \"none\",\n \"stroke-width\": a.graph.strokeWidth() + (d ? 0 : 2 * n)\n }), [a.tracker, a.markerGroup].forEach(function (a) {\n a.addClass(\"highcharts-tracker\").on(\"mouseover\", q).on(\"mouseout\", function (a) {\n h.onTrackerMouseOut(a);\n });\n c.cursor && !g.styledMode && a.css({\n cursor: c.cursor\n });\n if (y) a.on(\"touchstart\", q);\n }));\n J(this, \"afterDrawTracker\");\n }\n };\n f.column && (f.column.prototype.drawTracker = m.drawTrackerPoint);\n f.pie && (f.pie.prototype.drawTracker = m.drawTrackerPoint);\n f.scatter && (f.scatter.prototype.drawTracker = m.drawTrackerPoint);\n l(z.prototype, {\n setItemEvents: function (a, d, e) {\n var f = this,\n g = f.chart.renderer.boxWrapper,\n h = a instanceof K,\n p = \"highcharts-legend-\" + (h ? \"point\" : \"series\") + \"-active\",\n l = f.chart.styledMode;\n (e ? [d, a.legendSymbol] : [a.legendGroup]).forEach(function (e) {\n if (e) e.on(\"mouseover\", function () {\n a.visible && f.allItems.forEach(function (c) {\n a !== c && c.setState(\"inactive\", !h);\n });\n a.setState(\"hover\");\n a.visible && g.addClass(p);\n l || d.css(f.options.itemHoverStyle);\n }).on(\"mouseout\", function () {\n f.chart.styledMode || d.css(c(a.visible ? f.itemStyle : f.itemHiddenStyle));\n f.allItems.forEach(function (c) {\n a !== c && c.setState(\"\", !h);\n });\n g.removeClass(p);\n a.setState();\n }).on(\"click\", function (c) {\n var b = function () {\n a.setVisible && a.setVisible();\n f.allItems.forEach(function (b) {\n a !== b && b.setState(a.visible ? \"inactive\" : \"\", !h);\n });\n };\n g.removeClass(p);\n c = {\n browserEvent: c\n };\n a.firePointEvent ? a.firePointEvent(\"legendItemClick\", c, b) : J(a, \"legendItemClick\", c, b);\n });\n });\n },\n createCheckboxForItem: function (a) {\n a.checkbox = x(\"input\", {\n type: \"checkbox\",\n className: \"highcharts-legend-checkbox\",\n checked: a.selected,\n defaultChecked: a.selected\n }, this.options.itemCheckboxStyle, this.chart.container);\n v(a.checkbox, \"click\", function (c) {\n J(a.series || a, \"checkboxClick\", {\n checked: c.target.checked,\n item: a\n }, function () {\n a.select();\n });\n });\n }\n });\n l(h.prototype, {\n showResetZoom: function () {\n function a() {\n c.zoomOut();\n }\n var c = this,\n d = I.lang,\n e = c.options.chart.resetZoomButton,\n f = e.theme,\n g = f.states,\n h = \"chart\" === e.relativeTo || \"spaceBox\" === e.relativeTo ? null : \"plotBox\";\n J(this, \"beforeShowResetZoom\", null, function () {\n c.resetZoomButton = c.renderer.button(d.resetZoom, null, null, a, f, g && g.hover).attr({\n align: e.position.align,\n title: d.resetZoomTitle\n }).addClass(\"highcharts-reset-zoom\").add().align(e.position, !1, h);\n });\n J(this, \"afterShowResetZoom\");\n },\n zoomOut: function () {\n J(this, \"selection\", {\n resetSelection: !0\n }, this.zoom);\n },\n zoom: function (a) {\n var c = this,\n d,\n e = c.pointer,\n f = !1,\n h = c.inverted ? e.mouseDownX : e.mouseDownY;\n !a || a.resetSelection ? (c.axes.forEach(function (a) {\n d = a.zoom();\n }), e.initiated = !1) : a.xAxis.concat(a.yAxis).forEach(function (a) {\n var g = a.axis,\n p = c.inverted ? g.left : g.top,\n b = c.inverted ? p + g.width : p + g.height,\n k = g.isXAxis,\n l = !1;\n if (!k && h >= p && h <= b || k || !n(h)) l = !0;\n e[k ? \"zoomX\" : \"zoomY\"] && l && (d = g.zoom(a.min, a.max), g.displayBtn && (f = !0));\n });\n var p = c.resetZoomButton;\n f && !p ? c.showResetZoom() : !f && g(p) && (c.resetZoomButton = p.destroy());\n d && c.redraw(q(c.options.chart.animation, a && a.animation, 100 > c.pointCount));\n },\n pan: function (a, c) {\n var e = this,\n f = e.hoverPoints,\n g = e.options.chart,\n h = e.options.mapNavigation && e.options.mapNavigation.enabled,\n p;\n c = \"object\" === typeof c ? c : {\n enabled: c,\n type: \"x\"\n };\n g && g.panning && (g.panning = c);\n var l = c.type;\n J(this, \"pan\", {\n originalEvent: a\n }, function () {\n f && f.forEach(function (a) {\n a.setState();\n });\n var c = [1];\n \"xy\" === l ? c = [1, 0] : \"y\" === l && (c = [0]);\n c.forEach(function (c) {\n var b = e[c ? \"xAxis\" : \"yAxis\"][0],\n f = b.horiz,\n g = a[f ? \"chartX\" : \"chartY\"];\n f = f ? \"mouseDownX\" : \"mouseDownY\";\n var n = e[f],\n m = (b.pointRange || 0) / 2,\n r = b.reversed && !e.inverted || !b.reversed && e.inverted ? -1 : 1,\n u = b.getExtremes(),\n v = b.toValue(n - g, !0) + m * r;\n r = b.toValue(n + b.len - g, !0) - m * r;\n var w = r < v;\n n = w ? r : v;\n v = w ? v : r;\n var A = b.hasVerticalPanning(),\n x = b.panningState;\n b.series.forEach(function (a) {\n if (A && !c && (!x || x.isDirty)) {\n var b = a.getProcessedData(!0);\n a = a.getExtremes(b.yData, !0);\n x || (x = {\n startMin: Number.MAX_VALUE,\n startMax: -Number.MAX_VALUE\n });\n d(a.dataMin) && d(a.dataMax) && (x.startMin = Math.min(a.dataMin, x.startMin), x.startMax = Math.max(a.dataMax, x.startMax));\n }\n });\n r = Math.min(q(null === x || void 0 === x ? void 0 : x.startMin, u.dataMin), m ? u.min : b.toValue(b.toPixels(u.min) - b.minPixelPadding));\n m = Math.max(q(null === x || void 0 === x ? void 0 : x.startMax, u.dataMax), m ? u.max : b.toValue(b.toPixels(u.max) + b.minPixelPadding));\n b.panningState = x;\n b.isOrdinal || (w = r - n, 0 < w && (v += w, n = r), w = v - m, 0 < w && (v = m, n -= w), b.series.length && n !== u.min && v !== u.max && n >= r && v <= m && (b.setExtremes(n, v, !1, !1, {\n trigger: \"pan\"\n }), e.resetZoomButton || h || n === r || v === m || !l.match(\"y\") || (e.showResetZoom(), b.displayBtn = !1), p = !0), e[f] = g);\n });\n p && e.redraw(!1);\n D(e.container, {\n cursor: \"move\"\n });\n });\n }\n });\n l(K.prototype, {\n select: function (a, c) {\n var d = this,\n e = d.series,\n f = e.chart;\n this.selectedStaging = a = q(a, !d.selected);\n d.firePointEvent(a ? \"select\" : \"unselect\", {\n accumulate: c\n }, function () {\n d.selected = d.options.selected = a;\n e.options.data[e.data.indexOf(d)] = d.options;\n d.setState(a && \"select\");\n c || f.getSelectedPoints().forEach(function (a) {\n var c = a.series;\n a.selected && a !== d && (a.selected = a.options.selected = !1, c.options.data[c.data.indexOf(a)] = a.options, a.setState(f.hoverPoints && c.options.inactiveOtherPoints ? \"inactive\" : \"\"), a.firePointEvent(\"unselect\"));\n });\n });\n delete this.selectedStaging;\n },\n onMouseOver: function (a) {\n var c = this.series.chart,\n d = c.pointer;\n a = a ? d.normalize(a) : d.getChartCoordinatesFromPoint(this, c.inverted);\n d.runPointActions(a, this);\n },\n onMouseOut: function () {\n var a = this.series.chart;\n this.firePointEvent(\"mouseOut\");\n this.series.options.inactiveOtherPoints || (a.hoverPoints || []).forEach(function (a) {\n a.setState();\n });\n a.hoverPoints = a.hoverPoint = null;\n },\n importEvents: function () {\n if (!this.hasImportedEvents) {\n var d = this,\n e = c(d.series.options.point, d.options).events;\n d.events = e;\n a(e, function (a, c) {\n r(a) && v(d, c, a);\n });\n this.hasImportedEvents = !0;\n }\n },\n setState: function (a, c) {\n var d = this.series,\n e = this.state,\n f = d.options.states[a || \"normal\"] || {},\n g = I.plotOptions[d.type].marker && d.options.marker,\n h = g && !1 === g.enabled,\n p = g && g.states && g.states[a || \"normal\"] || {},\n n = !1 === p.enabled,\n m = d.stateMarkerGraphic,\n b = this.marker || {},\n k = d.chart,\n r = d.halo,\n v,\n w = g && d.markerAttribs;\n a = a || \"\";\n if (!(a === this.state && !c || this.selected && \"select\" !== a || !1 === f.enabled || a && (n || h && !1 === p.enabled) || a && b.states && b.states[a] && !1 === b.states[a].enabled)) {\n this.state = a;\n w && (v = d.markerAttribs(this, a));\n if (this.graphic) {\n e && this.graphic.removeClass(\"highcharts-point-\" + e);\n a && this.graphic.addClass(\"highcharts-point-\" + a);\n if (!k.styledMode) {\n var x = d.pointAttribs(this, a);\n var y = q(k.options.chart.animation, f.animation);\n d.options.inactiveOtherPoints && x.opacity && ((this.dataLabels || []).forEach(function (a) {\n a && a.animate({\n opacity: x.opacity\n }, y);\n }), this.connector && this.connector.animate({\n opacity: x.opacity\n }, y));\n this.graphic.animate(x, y);\n }\n v && this.graphic.animate(v, q(k.options.chart.animation, p.animation, g.animation));\n m && m.hide();\n } else {\n if (a && p) {\n e = b.symbol || d.symbol;\n m && m.currentSymbol !== e && (m = m.destroy());\n if (v) if (m) m[c ? \"animate\" : \"attr\"]({\n x: v.x,\n y: v.y\n });else e && (d.stateMarkerGraphic = m = k.renderer.symbol(e, v.x, v.y, v.width, v.height).add(d.markerGroup), m.currentSymbol = e);\n !k.styledMode && m && m.attr(d.pointAttribs(this, a));\n }\n m && (m[a && this.isInside ? \"show\" : \"hide\"](), m.element.point = this);\n }\n a = f.halo;\n f = (m = this.graphic || m) && m.visibility || \"inherit\";\n a && a.size && m && \"hidden\" !== f && !this.isCluster ? (r || (d.halo = r = k.renderer.path().add(m.parentGroup)), r.show()[c ? \"animate\" : \"attr\"]({\n d: this.haloPath(a.size)\n }), r.attr({\n \"class\": \"highcharts-halo highcharts-color-\" + q(this.colorIndex, d.colorIndex) + (this.className ? \" \" + this.className : \"\"),\n visibility: f,\n zIndex: -1\n }), r.point = this, k.styledMode || r.attr(l({\n fill: this.color || d.color,\n \"fill-opacity\": a.opacity\n }, a.attributes))) : r && r.point && r.point.haloPath && r.animate({\n d: r.point.haloPath(0)\n }, null, r.hide);\n J(this, \"afterSetState\");\n }\n },\n haloPath: function (a) {\n return this.series.chart.renderer.symbols.circle(Math.floor(this.plotX) - a, this.plotY - a, 2 * a, 2 * a);\n }\n });\n l(F.prototype, {\n onMouseOver: function () {\n var a = this.chart,\n c = a.hoverSeries;\n a.pointer.setHoverChartIndex();\n if (c && c !== this) c.onMouseOut();\n this.options.events.mouseOver && J(this, \"mouseOver\");\n this.setState(\"hover\");\n a.hoverSeries = this;\n },\n onMouseOut: function () {\n var a = this.options,\n c = this.chart,\n d = c.tooltip,\n e = c.hoverPoint;\n c.hoverSeries = null;\n if (e) e.onMouseOut();\n this && a.events.mouseOut && J(this, \"mouseOut\");\n !d || this.stickyTracking || d.shared && !this.noSharedTooltip || d.hide();\n c.series.forEach(function (a) {\n a.setState(\"\", !0);\n });\n },\n setState: function (a, c) {\n var d = this,\n e = d.options,\n f = d.graph,\n g = e.inactiveOtherPoints,\n h = e.states,\n l = e.lineWidth,\n m = e.opacity,\n n = q(h[a || \"normal\"] && h[a || \"normal\"].animation, d.chart.options.chart.animation);\n e = 0;\n a = a || \"\";\n if (d.state !== a && ([d.group, d.markerGroup, d.dataLabelsGroup].forEach(function (b) {\n b && (d.state && b.removeClass(\"highcharts-series-\" + d.state), a && b.addClass(\"highcharts-series-\" + a));\n }), d.state = a, !d.chart.styledMode)) {\n if (h[a] && !1 === h[a].enabled) return;\n a && (l = h[a].lineWidth || l + (h[a].lineWidthPlus || 0), m = q(h[a].opacity, m));\n if (f && !f.dashstyle) for (h = {\n \"stroke-width\": l\n }, f.animate(h, n); d[\"zone-graph-\" + e];) d[\"zone-graph-\" + e].attr(h), e += 1;\n g || [d.group, d.markerGroup, d.dataLabelsGroup, d.labelBySeries].forEach(function (a) {\n a && a.animate({\n opacity: m\n }, n);\n });\n }\n c && g && d.points && d.setAllPointsToState(a);\n },\n setAllPointsToState: function (a) {\n this.points.forEach(function (c) {\n c.setState && c.setState(a);\n });\n },\n setVisible: function (a, c) {\n var d = this,\n e = d.chart,\n f = d.legendItem,\n g = e.options.chart.ignoreHiddenSeries,\n h = d.visible;\n var l = (d.visible = a = d.options.visible = d.userOptions.visible = \"undefined\" === typeof a ? !h : a) ? \"show\" : \"hide\";\n [\"group\", \"dataLabelsGroup\", \"markerGroup\", \"tracker\", \"tt\"].forEach(function (a) {\n if (d[a]) d[a][l]();\n });\n if (e.hoverSeries === d || (e.hoverPoint && e.hoverPoint.series) === d) d.onMouseOut();\n f && e.legend.colorizeItem(d, a);\n d.isDirty = !0;\n d.options.stacking && e.series.forEach(function (a) {\n a.options.stacking && a.visible && (a.isDirty = !0);\n });\n d.linkedSeries.forEach(function (c) {\n c.setVisible(a, !1);\n });\n g && (e.isDirtyBox = !0);\n J(d, l);\n !1 !== c && e.redraw();\n },\n show: function () {\n this.setVisible(!0);\n },\n hide: function () {\n this.setVisible(!1);\n },\n select: function (a) {\n this.selected = a = this.options.selected = \"undefined\" === typeof a ? !this.selected : a;\n this.checkbox && (this.checkbox.checked = a);\n J(this, a ? \"select\" : \"unselect\");\n },\n drawTracker: m.drawTrackerGraph\n });\n });\n N(m, \"Core/Responsive.js\", [m[\"Core/Chart/Chart.js\"], m[\"Core/Utilities.js\"]], function (f, h) {\n var m = h.find,\n z = h.isArray,\n F = h.isObject,\n L = h.merge,\n K = h.objectEach,\n C = h.pick,\n y = h.splat,\n e = h.uniqueKey;\n f.prototype.setResponsive = function (f, h) {\n var v = this.options.responsive,\n y = [],\n n = this.currentResponsive;\n !h && v && v.rules && v.rules.forEach(function (f) {\n \"undefined\" === typeof f._id && (f._id = e());\n this.matchResponsiveRule(f, y);\n }, this);\n h = L.apply(0, y.map(function (e) {\n return m(v.rules, function (f) {\n return f._id === e;\n }).chartOptions;\n }));\n h.isResponsiveOptions = !0;\n y = y.toString() || void 0;\n y !== (n && n.ruleIds) && (n && this.update(n.undoOptions, f, !0), y ? (n = this.currentOptions(h), n.isResponsiveOptions = !0, this.currentResponsive = {\n ruleIds: y,\n mergedOptions: h,\n undoOptions: n\n }, this.update(h, f, !0)) : this.currentResponsive = void 0);\n };\n f.prototype.matchResponsiveRule = function (e, f) {\n var h = e.condition;\n (h.callback || function () {\n return this.chartWidth <= C(h.maxWidth, Number.MAX_VALUE) && this.chartHeight <= C(h.maxHeight, Number.MAX_VALUE) && this.chartWidth >= C(h.minWidth, 0) && this.chartHeight >= C(h.minHeight, 0);\n }).call(this) && f.push(e._id);\n };\n f.prototype.currentOptions = function (e) {\n function f(e, l, m, v) {\n var n;\n K(e, function (d, e) {\n if (!v && -1 < h.collectionsWithUpdate.indexOf(e)) for (d = y(d), m[e] = [], n = 0; n < Math.max(d.length, l[e].length); n++) l[e][n] && (void 0 === d[n] ? m[e][n] = l[e][n] : (m[e][n] = {}, f(d[n], l[e][n], m[e][n], v + 1)));else F(d) ? (m[e] = z(d) ? [] : {}, f(d, l[e] || {}, m[e], v + 1)) : m[e] = \"undefined\" === typeof l[e] ? null : l[e];\n });\n }\n var h = this,\n m = {};\n f(e, this.options, m, 0);\n return m;\n };\n });\n N(m, \"masters/highcharts.src.js\", [m[\"Core/Globals.js\"]], function (f) {\n return f;\n });\n m[\"masters/highcharts.src.js\"]._modules = m;\n return m[\"masters/highcharts.src.js\"];\n});","var isObject = require('./_is-object');\nmodule.exports = function (it) {\n if (!isObject(it)) throw TypeError(it + ' is not an object!');\n return it;\n};\n","import React from \"react\";\nimport LoadingModal from './LoadingModal'\nclass LoadingDialog extends React.Component {\n \n constructor(props) {\n super(props);\n this.state = {\n opened: this.props.open,\n balanceSheet: {}\n }\n \n }\n\n handleClickOpen(){\n this.setState({opened: true});\n };\n\n handleClose(value){\n this.setState({opened: false});\n try{\n setSelectedValue(value);\n }\n catch(e){}\n };\n\n render() {\n \n return (\n
\n
\n );\n }\n}\n\nexport default LoadingDialog;\n","var setPrototypeOf = require(\"./setPrototypeOf.js\");\nfunction _inheritsLoose(subClass, superClass) {\n subClass.prototype = Object.create(superClass.prototype);\n subClass.prototype.constructor = subClass;\n setPrototypeOf(subClass, superClass);\n}\nmodule.exports = _inheritsLoose, module.exports.__esModule = true, module.exports[\"default\"] = module.exports;","/*! safe-buffer. MIT License. Feross Aboukhadijeh \n :
\n \n {props.children ? props.children : renderIco()}\n \n \n \n {props.description} \n \n
\n );\n}","import _extends from \"@babel/runtime/helpers/esm/extends\";\nimport _objectWithoutProperties from \"@babel/runtime/helpers/esm/objectWithoutProperties\";\nimport * as React from 'react';\nimport clsx from 'clsx';\nimport { chainPropTypes } from '@material-ui/utils';\nimport withStyles from '../styles/withStyles';\nimport capitalize from '../utils/capitalize';\nexport var styles = function styles(theme) {\n return {\n /* Styles applied to the root element. */\n root: {\n userSelect: 'none',\n width: '1em',\n height: '1em',\n display: 'inline-block',\n fill: 'currentColor',\n flexShrink: 0,\n fontSize: theme.typography.pxToRem(24),\n transition: theme.transitions.create('fill', {\n duration: theme.transitions.duration.shorter\n })\n },\n /* Styles applied to the root element if `color=\"primary\"`. */\n colorPrimary: {\n color: theme.palette.primary.main\n },\n /* Styles applied to the root element if `color=\"secondary\"`. */\n colorSecondary: {\n color: theme.palette.secondary.main\n },\n /* Styles applied to the root element if `color=\"action\"`. */\n colorAction: {\n color: theme.palette.action.active\n },\n /* Styles applied to the root element if `color=\"error\"`. */\n colorError: {\n color: theme.palette.error.main\n },\n /* Styles applied to the root element if `color=\"disabled\"`. */\n colorDisabled: {\n color: theme.palette.action.disabled\n },\n /* Styles applied to the root element if `fontSize=\"inherit\"`. */\n fontSizeInherit: {\n fontSize: 'inherit'\n },\n /* Styles applied to the root element if `fontSize=\"small\"`. */\n fontSizeSmall: {\n fontSize: theme.typography.pxToRem(20)\n },\n /* Styles applied to the root element if `fontSize=\"large\"`. */\n fontSizeLarge: {\n fontSize: theme.typography.pxToRem(35)\n }\n };\n};\nvar SvgIcon = /*#__PURE__*/React.forwardRef(function SvgIcon(props, ref) {\n var children = props.children,\n classes = props.classes,\n className = props.className,\n _props$color = props.color,\n color = _props$color === void 0 ? 'inherit' : _props$color,\n _props$component = props.component,\n Component = _props$component === void 0 ? 'svg' : _props$component,\n _props$fontSize = props.fontSize,\n fontSize = _props$fontSize === void 0 ? 'medium' : _props$fontSize,\n htmlColor = props.htmlColor,\n titleAccess = props.titleAccess,\n _props$viewBox = props.viewBox,\n viewBox = _props$viewBox === void 0 ? '0 0 24 24' : _props$viewBox,\n other = _objectWithoutProperties(props, [\"children\", \"classes\", \"className\", \"color\", \"component\", \"fontSize\", \"htmlColor\", \"titleAccess\", \"viewBox\"]);\n return /*#__PURE__*/React.createElement(Component, _extends({\n className: clsx(classes.root, className, color !== 'inherit' && classes[\"color\".concat(capitalize(color))], fontSize !== 'default' && fontSize !== 'medium' && classes[\"fontSize\".concat(capitalize(fontSize))]),\n focusable: \"false\",\n viewBox: viewBox,\n color: htmlColor,\n \"aria-hidden\": titleAccess ? undefined : true,\n role: titleAccess ? 'img' : undefined,\n ref: ref\n }, other), children, titleAccess ? /*#__PURE__*/React.createElement(\"title\", null, titleAccess) : null);\n});\nprocess.env.NODE_ENV !== \"production\" ? void 0 : void 0;\nSvgIcon.muiName = 'SvgIcon';\nexport default withStyles(styles, {\n name: 'MuiSvgIcon'\n})(SvgIcon);","import _extends from \"@babel/runtime/helpers/esm/extends\";\nimport React from 'react';\nimport SvgIcon from '../SvgIcon';\n/**\n * Private module reserved for @material-ui/x packages.\n */\n\nexport default function createSvgIcon(path, displayName) {\n var Component = function Component(props, ref) {\n return /*#__PURE__*/React.createElement(SvgIcon, _extends({\n ref: ref\n }, props), path);\n };\n if (process.env.NODE_ENV !== 'production') {\n // Need to set `displayName` on the inner component for React.memo.\n // React prior to 16.14 ignores `displayName` on the wrapper.\n Component.displayName = \"\".concat(displayName, \"Icon\");\n }\n Component.muiName = SvgIcon.muiName;\n return /*#__PURE__*/React.memo( /*#__PURE__*/React.forwardRef(Component));\n}","export default function ownerDocument(node) {\n return node && node.ownerDocument || document;\n}","export const popupCenter = ({url, title, w=window.innerWidth * 0.8, h=window.innerHeight * 0.8}) => {\n // Fixes dual-screen position Most browsers Firefox\n const dualScreenLeft = window.screenLeft !== undefined ? window.screenLeft : window.screenX;\n const dualScreenTop = window.screenTop !== undefined ? window.screenTop : window.screenY;\n\n const width = window.innerWidth ? window.innerWidth : document.documentElement.clientWidth ? document.documentElement.clientWidth : screen.width;\n const height = window.innerHeight ? window.innerHeight : document.documentElement.clientHeight ? document.documentElement.clientHeight : screen.height;\n\n const systemZoom = width / window.screen.availWidth;\n const left = (width - w) / 2 / systemZoom + dualScreenLeft\n const top = (height - h) / 2 / systemZoom + dualScreenTop\n const newWindow = window.open(url, title, \n `\n scrollbars=yes,\n width=${w / systemZoom}, \n height=${h / systemZoom}, \n top=${top}, \n left=${left}\n `\n )\n\n if (window.focus) newWindow.focus();\n}\n","\"use strict\";\n\nexports.__esModule = true;\n\nvar _typeof2 = require(\"../helpers/typeof\");\n\nvar _typeof3 = _interopRequireDefault(_typeof2);\n\nfunction _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }\n\nexports.default = function (self, call) {\n if (!self) {\n throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\");\n }\n\n return call && ((typeof call === \"undefined\" ? \"undefined\" : (0, _typeof3.default)(call)) === \"object\" || typeof call === \"function\") ? call : self;\n};","// 7.1.13 ToObject(argument)\nvar defined = require('./_defined');\nmodule.exports = function (it) {\n return Object(defined(it));\n};\n","var defaultOptions = {};\nexport function getDefaultOptions() {\n return defaultOptions;\n}\nexport function setDefaultOptions(newOptions) {\n defaultOptions = newOptions;\n}","export const overlayStyle = {\n position: 'fixed',\n top: 0,\n left: 0,\n right: 0,\n bottom: 0,\n backgroundColor: 'transparent',\n display: 'flex',\n alignItems: 'center',\n justifyContent: 'center',\n zIndex: 1000\n};\n\nexport const modalStyle = {\n position: 'relative',\n overflow: 'visible',\n width: '700px',\n backgroundColor: '#617E94',\n padding: '20px',\n boxShadow: '0 4px 8px rgba(0, 0, 0, 0.1)',\n zIndex: 1001,\n borderRadius: '4px'\n};\n\nexport const modalContentStyle = {\n position: 'relative',\n padding: '5px'\n};\n\nexport const modalTitleStyle = {\n fontSize: '20px',\n fontWeight: 'bold',\n marginBottom: '5px',\n color: 'white'\n};\n\nexport const modalDescriptionStyle = {\n color: 'rgba(255, 255, 255, 0.7)'\n};\n\nexport const closeButtonStyle = {\n position: 'absolute',\n right: '10px',\n top: '10px',\n background: 'none',\n border: 'none',\n fontSize: '35px',\n color: 'white',\n cursor: 'pointer',\n zIndex: 1100\n};\n","function asyncGeneratorStep(gen, resolve, reject, _next, _throw, key, arg) {\n try {\n var info = gen[key](arg);\n var value = info.value;\n } catch (error) {\n reject(error);\n return;\n }\n if (info.done) {\n resolve(value);\n } else {\n Promise.resolve(value).then(_next, _throw);\n }\n}\nfunction _asyncToGenerator(fn) {\n return function () {\n var self = this,\n args = arguments;\n return new Promise(function (resolve, reject) {\n var gen = fn.apply(self, args);\n function _next(value) {\n asyncGeneratorStep(gen, resolve, reject, _next, _throw, \"next\", value);\n }\n function _throw(err) {\n asyncGeneratorStep(gen, resolve, reject, _next, _throw, \"throw\", err);\n }\n _next(undefined);\n });\n };\n}\nmodule.exports = _asyncToGenerator, module.exports.__esModule = true, module.exports[\"default\"] = module.exports;","(function (module, exports) {\n 'use strict';\n\n // Utils\n function assert(val, msg) {\n if (!val) throw new Error(msg || 'Assertion failed');\n }\n\n // Could use `inherits` module, but don't want to move from single file\n // architecture yet.\n function inherits(ctor, superCtor) {\n ctor.super_ = superCtor;\n var TempCtor = function () {};\n TempCtor.prototype = superCtor.prototype;\n ctor.prototype = new TempCtor();\n ctor.prototype.constructor = ctor;\n }\n\n // BN\n\n function BN(number, base, endian) {\n if (BN.isBN(number)) {\n return number;\n }\n this.negative = 0;\n this.words = null;\n this.length = 0;\n\n // Reduction context\n this.red = null;\n if (number !== null) {\n if (base === 'le' || base === 'be') {\n endian = base;\n base = 10;\n }\n this._init(number || 0, base || 10, endian || 'be');\n }\n }\n if (typeof module === 'object') {\n module.exports = BN;\n } else {\n exports.BN = BN;\n }\n BN.BN = BN;\n BN.wordSize = 26;\n var Buffer;\n try {\n if (typeof window !== 'undefined' && typeof window.Buffer !== 'undefined') {\n Buffer = window.Buffer;\n } else {\n Buffer = require('buffer').Buffer;\n }\n } catch (e) {}\n BN.isBN = function isBN(num) {\n if (num instanceof BN) {\n return true;\n }\n return num !== null && typeof num === 'object' && num.constructor.wordSize === BN.wordSize && Array.isArray(num.words);\n };\n BN.max = function max(left, right) {\n if (left.cmp(right) > 0) return left;\n return right;\n };\n BN.min = function min(left, right) {\n if (left.cmp(right) < 0) return left;\n return right;\n };\n BN.prototype._init = function init(number, base, endian) {\n if (typeof number === 'number') {\n return this._initNumber(number, base, endian);\n }\n if (typeof number === 'object') {\n return this._initArray(number, base, endian);\n }\n if (base === 'hex') {\n base = 16;\n }\n assert(base === (base | 0) && base >= 2 && base <= 36);\n number = number.toString().replace(/\\s+/g, '');\n var start = 0;\n if (number[0] === '-') {\n start++;\n this.negative = 1;\n }\n if (start < number.length) {\n if (base === 16) {\n this._parseHex(number, start, endian);\n } else {\n this._parseBase(number, base, start);\n if (endian === 'le') {\n this._initArray(this.toArray(), base, endian);\n }\n }\n }\n };\n BN.prototype._initNumber = function _initNumber(number, base, endian) {\n if (number < 0) {\n this.negative = 1;\n number = -number;\n }\n if (number < 0x4000000) {\n this.words = [number & 0x3ffffff];\n this.length = 1;\n } else if (number < 0x10000000000000) {\n this.words = [number & 0x3ffffff, number / 0x4000000 & 0x3ffffff];\n this.length = 2;\n } else {\n assert(number < 0x20000000000000); // 2 ^ 53 (unsafe)\n this.words = [number & 0x3ffffff, number / 0x4000000 & 0x3ffffff, 1];\n this.length = 3;\n }\n if (endian !== 'le') return;\n\n // Reverse the bytes\n this._initArray(this.toArray(), base, endian);\n };\n BN.prototype._initArray = function _initArray(number, base, endian) {\n // Perhaps a Uint8Array\n assert(typeof number.length === 'number');\n if (number.length <= 0) {\n this.words = [0];\n this.length = 1;\n return this;\n }\n this.length = Math.ceil(number.length / 3);\n this.words = new Array(this.length);\n for (var i = 0; i < this.length; i++) {\n this.words[i] = 0;\n }\n var j, w;\n var off = 0;\n if (endian === 'be') {\n for (i = number.length - 1, j = 0; i >= 0; i -= 3) {\n w = number[i] | number[i - 1] << 8 | number[i - 2] << 16;\n this.words[j] |= w << off & 0x3ffffff;\n this.words[j + 1] = w >>> 26 - off & 0x3ffffff;\n off += 24;\n if (off >= 26) {\n off -= 26;\n j++;\n }\n }\n } else if (endian === 'le') {\n for (i = 0, j = 0; i < number.length; i += 3) {\n w = number[i] | number[i + 1] << 8 | number[i + 2] << 16;\n this.words[j] |= w << off & 0x3ffffff;\n this.words[j + 1] = w >>> 26 - off & 0x3ffffff;\n off += 24;\n if (off >= 26) {\n off -= 26;\n j++;\n }\n }\n }\n return this.strip();\n };\n function parseHex4Bits(string, index) {\n var c = string.charCodeAt(index);\n // 'A' - 'F'\n if (c >= 65 && c <= 70) {\n return c - 55;\n // 'a' - 'f'\n } else if (c >= 97 && c <= 102) {\n return c - 87;\n // '0' - '9'\n } else {\n return c - 48 & 0xf;\n }\n }\n function parseHexByte(string, lowerBound, index) {\n var r = parseHex4Bits(string, index);\n if (index - 1 >= lowerBound) {\n r |= parseHex4Bits(string, index - 1) << 4;\n }\n return r;\n }\n BN.prototype._parseHex = function _parseHex(number, start, endian) {\n // Create possibly bigger array to ensure that it fits the number\n this.length = Math.ceil((number.length - start) / 6);\n this.words = new Array(this.length);\n for (var i = 0; i < this.length; i++) {\n this.words[i] = 0;\n }\n\n // 24-bits chunks\n var off = 0;\n var j = 0;\n var w;\n if (endian === 'be') {\n for (i = number.length - 1; i >= start; i -= 2) {\n w = parseHexByte(number, start, i) << off;\n this.words[j] |= w & 0x3ffffff;\n if (off >= 18) {\n off -= 18;\n j += 1;\n this.words[j] |= w >>> 26;\n } else {\n off += 8;\n }\n }\n } else {\n var parseLength = number.length - start;\n for (i = parseLength % 2 === 0 ? start + 1 : start; i < number.length; i += 2) {\n w = parseHexByte(number, start, i) << off;\n this.words[j] |= w & 0x3ffffff;\n if (off >= 18) {\n off -= 18;\n j += 1;\n this.words[j] |= w >>> 26;\n } else {\n off += 8;\n }\n }\n }\n this.strip();\n };\n function parseBase(str, start, end, mul) {\n var r = 0;\n var len = Math.min(str.length, end);\n for (var i = start; i < len; i++) {\n var c = str.charCodeAt(i) - 48;\n r *= mul;\n\n // 'a'\n if (c >= 49) {\n r += c - 49 + 0xa;\n\n // 'A'\n } else if (c >= 17) {\n r += c - 17 + 0xa;\n\n // '0' - '9'\n } else {\n r += c;\n }\n }\n return r;\n }\n BN.prototype._parseBase = function _parseBase(number, base, start) {\n // Initialize as zero\n this.words = [0];\n this.length = 1;\n\n // Find length of limb in base\n for (var limbLen = 0, limbPow = 1; limbPow <= 0x3ffffff; limbPow *= base) {\n limbLen++;\n }\n limbLen--;\n limbPow = limbPow / base | 0;\n var total = number.length - start;\n var mod = total % limbLen;\n var end = Math.min(total, total - mod) + start;\n var word = 0;\n for (var i = start; i < end; i += limbLen) {\n word = parseBase(number, i, i + limbLen, base);\n this.imuln(limbPow);\n if (this.words[0] + word < 0x4000000) {\n this.words[0] += word;\n } else {\n this._iaddn(word);\n }\n }\n if (mod !== 0) {\n var pow = 1;\n word = parseBase(number, i, number.length, base);\n for (i = 0; i < mod; i++) {\n pow *= base;\n }\n this.imuln(pow);\n if (this.words[0] + word < 0x4000000) {\n this.words[0] += word;\n } else {\n this._iaddn(word);\n }\n }\n this.strip();\n };\n BN.prototype.copy = function copy(dest) {\n dest.words = new Array(this.length);\n for (var i = 0; i < this.length; i++) {\n dest.words[i] = this.words[i];\n }\n dest.length = this.length;\n dest.negative = this.negative;\n dest.red = this.red;\n };\n BN.prototype.clone = function clone() {\n var r = new BN(null);\n this.copy(r);\n return r;\n };\n BN.prototype._expand = function _expand(size) {\n while (this.length < size) {\n this.words[this.length++] = 0;\n }\n return this;\n };\n\n // Remove leading `0` from `this`\n BN.prototype.strip = function strip() {\n while (this.length > 1 && this.words[this.length - 1] === 0) {\n this.length--;\n }\n return this._normSign();\n };\n BN.prototype._normSign = function _normSign() {\n // -0 = 0\n if (this.length === 1 && this.words[0] === 0) {\n this.negative = 0;\n }\n return this;\n };\n BN.prototype.inspect = function inspect() {\n return (this.red ? ' this.setState({selectorOpen: true})}>\n 
\n
\n \n \n }\n\n setCurrentStartMonth(month){\n const {year, lastYear} = this.state;\n let self = this;\n if((parseFloat(month) <= parseFloat(this.state.endMonth)) || this.state.singleDate || (year != lastYear)){\n this.setState({\n startMonth: month\n })\n }\n\n if(this.state.singleDate){\n setTimeout(()=>{\n self.setupData()\n }, 100)\n \n }\n \n }\n setCurrentEndMonth(month){\n const {year, lastYear} = this.state;\n if((parseFloat(month) >= parseFloat(this.state.startMonth)) || (year != lastYear)){\n this.setState({\n endMonth: month\n })\n }\n }\n\n setupData(){\n this.setState({isSaving: true})\n var startDate = new Date(this.state.year,this.state.startMonth - 1, 1);\n if(this.props.yearRange){\n var endDate = new Date(this.state.lastYear,this.state.endMonth - 1 , 1);\n }else{\n var endDate = new Date(this.state.year,this.state.endMonth - 1 , 1);\n }\n \n this.setState({\n selectorOpen: false,\n })\n try{\n this.props.onChange(startDate, endDate)\n }catch(e){}\n \n }\n\n resetState(){\n if(!this.state.singleDate){\n this.setState({\n startMonth: this.props.startDate.getMonth() + 1,\n endMonth: this.props.endDate.getMonth() + 1,\n year: this.props.startDate.getFullYear(),\n lastYear: this.props.endDate.getFullYear(),\n })\n }\n \n this.setState({selectorOpen: false})\n this.setState({isSaving: false})\n\n\n }\n\n renderSelector(){\n\n const {startMonth, endMonth, singleDate, year, lastYear} = this.state;\n const {minYear, maxYear} = this.props;\n return (\n \n
\n \n \n
\n \n {singleDate ?\n {year}
\n {this.props.yearRange && {lastYear}
}\n \n {monthsDict[startMonth]?.substring(0,3)}\n
:\n \n {monthsDict[startMonth]?.substring(0,3)} - {monthsDict[endMonth]?.substring(0,3)}\n
\n }\n \n
\n )\n }\n\n render(){\n return \n
\n {isMobile ? \n \n
\n {\n this.props.yearRange && {\n debugger\n if(minYear && year == parseInt(minYear)){\n alert(\"Não existem dados para o ano de \"+ (parseInt(minYear) - 1))\n }else{\n this.setState({year: year - 1})\n }\n \n }}>\n \n
\n \n {year}\n
\n {\n if(maxYear && year == parseInt(maxYear)){\n alert(\"Não existem dados para o ano de \"+ (parseInt(maxYear) + 1))\n }else{\n this.setState({year: year + 1})\n }\n \n }}>\n \n
\n \n
\n }\n \n this.setState({lastYear: this.state.lastYear - 1})}>\n \n
\n \n {this.state.lastYear}\n
\n this.setState({lastYear: this.state.lastYear + 1})}>\n \n
\n this.resetState()}>\n \n \n }\n
\n : {\n Object.entries(monthsDict).map(([key, value])=>(\n
\n {!singleDate && this.setCurrentStartMonth(key)} className={`month-row ${\n key == startMonth ? 'active' : ''\n }${\n !singleDate && (lastYear ? year == lastYear : true) && (parseFloat(key) > parseFloat(endMonth)) ? 'disabled' : ''\n }`}>{value.substring(0,3)}
\n ))\n }{\n Object.entries(monthsDict).map(([key, value])=>(\n
\n this.setCurrentEndMonth(key)} className={`month-row ${\n key == endMonth ? 'active' : ''\n }${\n (lastYear ? year == lastYear : true) && parseFloat(key) < parseFloat(startMonth) ? 'disabled' : ''\n }`}>{value.substring(0,3)}
\n ))\n }\n \n \n }\n
}\n {!singleDate && {\n Object.entries(monthsDict).map(([key, value])=>(\n
\n {!singleDate && this.setCurrentStartMonth(key)} className={`month-row ${\n key == startMonth ? 'active' : ''\n }${\n !singleDate && (lastYear ? year == lastYear : true) && (parseFloat(key) > parseFloat(endMonth)) ? 'disabled' : ''\n }`}>{value}
\n ))\n }{\n Object.entries(monthsDict).map(([key, value])=>(\n
\n this.setCurrentEndMonth(key)} className={`month-row ${\n key == endMonth ? 'active' : ''\n }${\n (lastYear ? year == lastYear : true) && parseFloat(key) < parseFloat(startMonth) ? 'disabled' : ''\n }`}>{value}
\n ))\n } this.setupData()}>\n Filtrar\n
}\n this.resetState()} >\n {this.renderInput()}\n {this.state.selectorOpen && this.renderSelector()}\n
\n }\n}\nexport const isMobile = () => window.matchMedia && window.matchMedia(\"(max-width: 1000px)\").matches\n\n\nconst monthsDict = {\n 1: \"janeiro\",\n 2: \"fevereiro\",\n 3: \"março\",\n 4: \"abril\",\n 5: \"maio\",\n 6: \"junho\",\n 7: \"julho\",\n 8: \"agosto\",\n 9: \"setembro\",\n 10: \"outubro\",\n 11: \"novembro\",\n 12: \"dezembro\",\n}","module.exports = __webpack_public_path__ + \"media/images/bt_download-abc53312.svg\";","module.exports = __webpack_public_path__ + \"media/images/popup-ico-51d8e490.svg\";","var arrayWithoutHoles = require(\"./arrayWithoutHoles.js\");\nvar iterableToArray = require(\"./iterableToArray.js\");\nvar unsupportedIterableToArray = require(\"./unsupportedIterableToArray.js\");\nvar nonIterableSpread = require(\"./nonIterableSpread.js\");\nfunction _toConsumableArray(arr) {\n return arrayWithoutHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableSpread();\n}\nmodule.exports = _toConsumableArray, module.exports.__esModule = true, module.exports[\"default\"] = module.exports;","/*!\n * Chart.js v3.9.1\n * https://www.chartjs.org\n * (c) 2022 Chart.js Contributors\n * Released under the MIT License\n */\nfunction noop() {}\nconst uid = function () {\n let id = 0;\n return function () {\n return id++;\n };\n}();\nfunction isNullOrUndef(value) {\n return value === null || typeof value === 'undefined';\n}\nfunction isArray(value) {\n if (Array.isArray && Array.isArray(value)) {\n return true;\n }\n const type = Object.prototype.toString.call(value);\n if (type.slice(0, 7) === '[object' && type.slice(-6) === 'Array]') {\n return true;\n }\n return false;\n}\nfunction isObject(value) {\n return value !== null && Object.prototype.toString.call(value) === '[object Object]';\n}\nconst isNumberFinite = value => (typeof value === 'number' || value instanceof Number) && isFinite(+value);\nfunction finiteOrDefault(value, defaultValue) {\n return isNumberFinite(value) ? value : defaultValue;\n}\nfunction valueOrDefault(value, defaultValue) {\n return typeof value === 'undefined' ? defaultValue : value;\n}\nconst toPercentage = (value, dimension) => typeof value === 'string' && value.endsWith('%') ? parseFloat(value) / 100 : value / dimension;\nconst toDimension = (value, dimension) => typeof value === 'string' && value.endsWith('%') ? parseFloat(value) / 100 * dimension : +value;\nfunction callback(fn, args, thisArg) {\n if (fn && typeof fn.call === 'function') {\n return fn.apply(thisArg, args);\n }\n}\nfunction each(loopable, fn, thisArg, reverse) {\n let i, len, keys;\n if (isArray(loopable)) {\n len = loopable.length;\n if (reverse) {\n for (i = len - 1; i >= 0; i--) {\n fn.call(thisArg, loopable[i], i);\n }\n } else {\n for (i = 0; i < len; i++) {\n fn.call(thisArg, loopable[i], i);\n }\n }\n } else if (isObject(loopable)) {\n keys = Object.keys(loopable);\n len = keys.length;\n for (i = 0; i < len; i++) {\n fn.call(thisArg, loopable[keys[i]], keys[i]);\n }\n }\n}\nfunction _elementsEqual(a0, a1) {\n let i, ilen, v0, v1;\n if (!a0 || !a1 || a0.length !== a1.length) {\n return false;\n }\n for (i = 0, ilen = a0.length; i < ilen; ++i) {\n v0 = a0[i];\n v1 = a1[i];\n if (v0.datasetIndex !== v1.datasetIndex || v0.index !== v1.index) {\n return false;\n }\n }\n return true;\n}\nfunction clone$1(source) {\n if (isArray(source)) {\n return source.map(clone$1);\n }\n if (isObject(source)) {\n const target = Object.create(null);\n const keys = Object.keys(source);\n const klen = keys.length;\n let k = 0;\n for (; k < klen; ++k) {\n target[keys[k]] = clone$1(source[keys[k]]);\n }\n return target;\n }\n return source;\n}\nfunction isValidKey(key) {\n return ['__proto__', 'prototype', 'constructor'].indexOf(key) === -1;\n}\nfunction _merger(key, target, source, options) {\n if (!isValidKey(key)) {\n return;\n }\n const tval = target[key];\n const sval = source[key];\n if (isObject(tval) && isObject(sval)) {\n merge(tval, sval, options);\n } else {\n target[key] = clone$1(sval);\n }\n}\nfunction merge(target, source, options) {\n const sources = isArray(source) ? source : [source];\n const ilen = sources.length;\n if (!isObject(target)) {\n return target;\n }\n options = options || {};\n const merger = options.merger || _merger;\n for (let i = 0; i < ilen; ++i) {\n source = sources[i];\n if (!isObject(source)) {\n continue;\n }\n const keys = Object.keys(source);\n for (let k = 0, klen = keys.length; k < klen; ++k) {\n merger(keys[k], target, source, options);\n }\n }\n return target;\n}\nfunction mergeIf(target, source) {\n return merge(target, source, {\n merger: _mergerIf\n });\n}\nfunction _mergerIf(key, target, source) {\n if (!isValidKey(key)) {\n return;\n }\n const tval = target[key];\n const sval = source[key];\n if (isObject(tval) && isObject(sval)) {\n mergeIf(tval, sval);\n } else if (!Object.prototype.hasOwnProperty.call(target, key)) {\n target[key] = clone$1(sval);\n }\n}\nfunction _deprecated(scope, value, previous, current) {\n if (value !== undefined) {\n console.warn(scope + ': \"' + previous + '\" is deprecated. Please use \"' + current + '\" instead');\n }\n}\nconst keyResolvers = {\n '': v => v,\n x: o => o.x,\n y: o => o.y\n};\nfunction resolveObjectKey(obj, key) {\n const resolver = keyResolvers[key] || (keyResolvers[key] = _getKeyResolver(key));\n return resolver(obj);\n}\nfunction _getKeyResolver(key) {\n const keys = _splitKey(key);\n return obj => {\n for (const k of keys) {\n if (k === '') {\n break;\n }\n obj = obj && obj[k];\n }\n return obj;\n };\n}\nfunction _splitKey(key) {\n const parts = key.split('.');\n const keys = [];\n let tmp = '';\n for (const part of parts) {\n tmp += part;\n if (tmp.endsWith('\\\\')) {\n tmp = tmp.slice(0, -1) + '.';\n } else {\n keys.push(tmp);\n tmp = '';\n }\n }\n return keys;\n}\nfunction _capitalize(str) {\n return str.charAt(0).toUpperCase() + str.slice(1);\n}\nconst defined = value => typeof value !== 'undefined';\nconst isFunction = value => typeof value === 'function';\nconst setsEqual = (a, b) => {\n if (a.size !== b.size) {\n return false;\n }\n for (const item of a) {\n if (!b.has(item)) {\n return false;\n }\n }\n return true;\n};\nfunction _isClickEvent(e) {\n return e.type === 'mouseup' || e.type === 'click' || e.type === 'contextmenu';\n}\nconst PI = Math.PI;\nconst TAU = 2 * PI;\nconst PITAU = TAU + PI;\nconst INFINITY = Number.POSITIVE_INFINITY;\nconst RAD_PER_DEG = PI / 180;\nconst HALF_PI = PI / 2;\nconst QUARTER_PI = PI / 4;\nconst TWO_THIRDS_PI = PI * 2 / 3;\nconst log10 = Math.log10;\nconst sign = Math.sign;\nfunction niceNum(range) {\n const roundedRange = Math.round(range);\n range = almostEquals(range, roundedRange, range / 1000) ? roundedRange : range;\n const niceRange = Math.pow(10, Math.floor(log10(range)));\n const fraction = range / niceRange;\n const niceFraction = fraction <= 1 ? 1 : fraction <= 2 ? 2 : fraction <= 5 ? 5 : 10;\n return niceFraction * niceRange;\n}\nfunction _factorize(value) {\n const result = [];\n const sqrt = Math.sqrt(value);\n let i;\n for (i = 1; i < sqrt; i++) {\n if (value % i === 0) {\n result.push(i);\n result.push(value / i);\n }\n }\n if (sqrt === (sqrt | 0)) {\n result.push(sqrt);\n }\n result.sort((a, b) => a - b).pop();\n return result;\n}\nfunction isNumber(n) {\n return !isNaN(parseFloat(n)) && isFinite(n);\n}\nfunction almostEquals(x, y, epsilon) {\n return Math.abs(x - y) < epsilon;\n}\nfunction almostWhole(x, epsilon) {\n const rounded = Math.round(x);\n return rounded - epsilon <= x && rounded + epsilon >= x;\n}\nfunction _setMinAndMaxByKey(array, target, property) {\n let i, ilen, value;\n for (i = 0, ilen = array.length; i < ilen; i++) {\n value = array[i][property];\n if (!isNaN(value)) {\n target.min = Math.min(target.min, value);\n target.max = Math.max(target.max, value);\n }\n }\n}\nfunction toRadians(degrees) {\n return degrees * (PI / 180);\n}\nfunction toDegrees(radians) {\n return radians * (180 / PI);\n}\nfunction _decimalPlaces(x) {\n if (!isNumberFinite(x)) {\n return;\n }\n let e = 1;\n let p = 0;\n while (Math.round(x * e) / e !== x) {\n e *= 10;\n p++;\n }\n return p;\n}\nfunction getAngleFromPoint(centrePoint, anglePoint) {\n const distanceFromXCenter = anglePoint.x - centrePoint.x;\n const distanceFromYCenter = anglePoint.y - centrePoint.y;\n const radialDistanceFromCenter = Math.sqrt(distanceFromXCenter * distanceFromXCenter + distanceFromYCenter * distanceFromYCenter);\n let angle = Math.atan2(distanceFromYCenter, distanceFromXCenter);\n if (angle < -0.5 * PI) {\n angle += TAU;\n }\n return {\n angle,\n distance: radialDistanceFromCenter\n };\n}\nfunction distanceBetweenPoints(pt1, pt2) {\n return Math.sqrt(Math.pow(pt2.x - pt1.x, 2) + Math.pow(pt2.y - pt1.y, 2));\n}\nfunction _angleDiff(a, b) {\n return (a - b + PITAU) % TAU - PI;\n}\nfunction _normalizeAngle(a) {\n return (a % TAU + TAU) % TAU;\n}\nfunction _angleBetween(angle, start, end, sameAngleIsFullCircle) {\n const a = _normalizeAngle(angle);\n const s = _normalizeAngle(start);\n const e = _normalizeAngle(end);\n const angleToStart = _normalizeAngle(s - a);\n const angleToEnd = _normalizeAngle(e - a);\n const startToAngle = _normalizeAngle(a - s);\n const endToAngle = _normalizeAngle(a - e);\n return a === s || a === e || sameAngleIsFullCircle && s === e || angleToStart > angleToEnd && startToAngle < endToAngle;\n}\nfunction _limitValue(value, min, max) {\n return Math.max(min, Math.min(max, value));\n}\nfunction _int16Range(value) {\n return _limitValue(value, -32768, 32767);\n}\nfunction _isBetween(value, start, end) {\n let epsilon = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : 1e-6;\n return value >= Math.min(start, end) - epsilon && value <= Math.max(start, end) + epsilon;\n}\nfunction _lookup(table, value, cmp) {\n cmp = cmp || (index => table[index] < value);\n let hi = table.length - 1;\n let lo = 0;\n let mid;\n while (hi - lo > 1) {\n mid = lo + hi >> 1;\n if (cmp(mid)) {\n lo = mid;\n } else {\n hi = mid;\n }\n }\n return {\n lo,\n hi\n };\n}\nconst _lookupByKey = (table, key, value, last) => _lookup(table, value, last ? index => table[index][key] <= value : index => table[index][key] < value);\nconst _rlookupByKey = (table, key, value) => _lookup(table, value, index => table[index][key] >= value);\nfunction _filterBetween(values, min, max) {\n let start = 0;\n let end = values.length;\n while (start < end && values[start] < min) {\n start++;\n }\n while (end > start && values[end - 1] > max) {\n end--;\n }\n return start > 0 || end < values.length ? values.slice(start, end) : values;\n}\nconst arrayEvents = ['push', 'pop', 'shift', 'splice', 'unshift'];\nfunction listenArrayEvents(array, listener) {\n if (array._chartjs) {\n array._chartjs.listeners.push(listener);\n return;\n }\n Object.defineProperty(array, '_chartjs', {\n configurable: true,\n enumerable: false,\n value: {\n listeners: [listener]\n }\n });\n arrayEvents.forEach(key => {\n const method = '_onData' + _capitalize(key);\n const base = array[key];\n Object.defineProperty(array, key, {\n configurable: true,\n enumerable: false,\n value() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n const res = base.apply(this, args);\n array._chartjs.listeners.forEach(object => {\n if (typeof object[method] === 'function') {\n object[method](...args);\n }\n });\n return res;\n }\n });\n });\n}\nfunction unlistenArrayEvents(array, listener) {\n const stub = array._chartjs;\n if (!stub) {\n return;\n }\n const listeners = stub.listeners;\n const index = listeners.indexOf(listener);\n if (index !== -1) {\n listeners.splice(index, 1);\n }\n if (listeners.length > 0) {\n return;\n }\n arrayEvents.forEach(key => {\n delete array[key];\n });\n delete array._chartjs;\n}\nfunction _arrayUnique(items) {\n const set = new Set();\n let i, ilen;\n for (i = 0, ilen = items.length; i < ilen; ++i) {\n set.add(items[i]);\n }\n if (set.size === ilen) {\n return items;\n }\n return Array.from(set);\n}\nfunction fontString(pixelSize, fontStyle, fontFamily) {\n return fontStyle + ' ' + pixelSize + 'px ' + fontFamily;\n}\nconst requestAnimFrame = function () {\n if (typeof window === 'undefined') {\n return function (callback) {\n return callback();\n };\n }\n return window.requestAnimationFrame;\n}();\nfunction throttled(fn, thisArg, updateFn) {\n const updateArgs = updateFn || (args => Array.prototype.slice.call(args));\n let ticking = false;\n let args = [];\n return function () {\n for (var _len2 = arguments.length, rest = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {\n rest[_key2] = arguments[_key2];\n }\n args = updateArgs(rest);\n if (!ticking) {\n ticking = true;\n requestAnimFrame.call(window, () => {\n ticking = false;\n fn.apply(thisArg, args);\n });\n }\n };\n}\nfunction debounce(fn, delay) {\n let timeout;\n return function () {\n for (var _len3 = arguments.length, args = new Array(_len3), _key3 = 0; _key3 < _len3; _key3++) {\n args[_key3] = arguments[_key3];\n }\n if (delay) {\n clearTimeout(timeout);\n timeout = setTimeout(fn, delay, args);\n } else {\n fn.apply(this, args);\n }\n return delay;\n };\n}\nconst _toLeftRightCenter = align => align === 'start' ? 'left' : align === 'end' ? 'right' : 'center';\nconst _alignStartEnd = (align, start, end) => align === 'start' ? start : align === 'end' ? end : (start + end) / 2;\nconst _textX = (align, left, right, rtl) => {\n const check = rtl ? 'left' : 'right';\n return align === check ? right : align === 'center' ? (left + right) / 2 : left;\n};\nfunction _getStartAndCountOfVisiblePoints(meta, points, animationsDisabled) {\n const pointCount = points.length;\n let start = 0;\n let count = pointCount;\n if (meta._sorted) {\n const iScale = meta.iScale,\n _parsed = meta._parsed;\n const axis = iScale.axis;\n const _iScale$getUserBounds = iScale.getUserBounds(),\n min = _iScale$getUserBounds.min,\n max = _iScale$getUserBounds.max,\n minDefined = _iScale$getUserBounds.minDefined,\n maxDefined = _iScale$getUserBounds.maxDefined;\n if (minDefined) {\n start = _limitValue(Math.min(_lookupByKey(_parsed, iScale.axis, min).lo, animationsDisabled ? pointCount : _lookupByKey(points, axis, iScale.getPixelForValue(min)).lo), 0, pointCount - 1);\n }\n if (maxDefined) {\n count = _limitValue(Math.max(_lookupByKey(_parsed, iScale.axis, max, true).hi + 1, animationsDisabled ? 0 : _lookupByKey(points, axis, iScale.getPixelForValue(max), true).hi + 1), start, pointCount) - start;\n } else {\n count = pointCount - start;\n }\n }\n return {\n start,\n count\n };\n}\nfunction _scaleRangesChanged(meta) {\n const xScale = meta.xScale,\n yScale = meta.yScale,\n _scaleRanges = meta._scaleRanges;\n const newRanges = {\n xmin: xScale.min,\n xmax: xScale.max,\n ymin: yScale.min,\n ymax: yScale.max\n };\n if (!_scaleRanges) {\n meta._scaleRanges = newRanges;\n return true;\n }\n const changed = _scaleRanges.xmin !== xScale.min || _scaleRanges.xmax !== xScale.max || _scaleRanges.ymin !== yScale.min || _scaleRanges.ymax !== yScale.max;\n Object.assign(_scaleRanges, newRanges);\n return changed;\n}\nconst atEdge = t => t === 0 || t === 1;\nconst elasticIn = (t, s, p) => -(Math.pow(2, 10 * (t -= 1)) * Math.sin((t - s) * TAU / p));\nconst elasticOut = (t, s, p) => Math.pow(2, -10 * t) * Math.sin((t - s) * TAU / p) + 1;\nconst effects = {\n linear: t => t,\n easeInQuad: t => t * t,\n easeOutQuad: t => -t * (t - 2),\n easeInOutQuad: t => (t /= 0.5) < 1 ? 0.5 * t * t : -0.5 * (--t * (t - 2) - 1),\n easeInCubic: t => t * t * t,\n easeOutCubic: t => (t -= 1) * t * t + 1,\n easeInOutCubic: t => (t /= 0.5) < 1 ? 0.5 * t * t * t : 0.5 * ((t -= 2) * t * t + 2),\n easeInQuart: t => t * t * t * t,\n easeOutQuart: t => -((t -= 1) * t * t * t - 1),\n easeInOutQuart: t => (t /= 0.5) < 1 ? 0.5 * t * t * t * t : -0.5 * ((t -= 2) * t * t * t - 2),\n easeInQuint: t => t * t * t * t * t,\n easeOutQuint: t => (t -= 1) * t * t * t * t + 1,\n easeInOutQuint: t => (t /= 0.5) < 1 ? 0.5 * t * t * t * t * t : 0.5 * ((t -= 2) * t * t * t * t + 2),\n easeInSine: t => -Math.cos(t * HALF_PI) + 1,\n easeOutSine: t => Math.sin(t * HALF_PI),\n easeInOutSine: t => -0.5 * (Math.cos(PI * t) - 1),\n easeInExpo: t => t === 0 ? 0 : Math.pow(2, 10 * (t - 1)),\n easeOutExpo: t => t === 1 ? 1 : -Math.pow(2, -10 * t) + 1,\n easeInOutExpo: t => atEdge(t) ? t : t < 0.5 ? 0.5 * Math.pow(2, 10 * (t * 2 - 1)) : 0.5 * (-Math.pow(2, -10 * (t * 2 - 1)) + 2),\n easeInCirc: t => t >= 1 ? t : -(Math.sqrt(1 - t * t) - 1),\n easeOutCirc: t => Math.sqrt(1 - (t -= 1) * t),\n easeInOutCirc: t => (t /= 0.5) < 1 ? -0.5 * (Math.sqrt(1 - t * t) - 1) : 0.5 * (Math.sqrt(1 - (t -= 2) * t) + 1),\n easeInElastic: t => atEdge(t) ? t : elasticIn(t, 0.075, 0.3),\n easeOutElastic: t => atEdge(t) ? t : elasticOut(t, 0.075, 0.3),\n easeInOutElastic(t) {\n const s = 0.1125;\n const p = 0.45;\n return atEdge(t) ? t : t < 0.5 ? 0.5 * elasticIn(t * 2, s, p) : 0.5 + 0.5 * elasticOut(t * 2 - 1, s, p);\n },\n easeInBack(t) {\n const s = 1.70158;\n return t * t * ((s + 1) * t - s);\n },\n easeOutBack(t) {\n const s = 1.70158;\n return (t -= 1) * t * ((s + 1) * t + s) + 1;\n },\n easeInOutBack(t) {\n let s = 1.70158;\n if ((t /= 0.5) < 1) {\n return 0.5 * (t * t * (((s *= 1.525) + 1) * t - s));\n }\n return 0.5 * ((t -= 2) * t * (((s *= 1.525) + 1) * t + s) + 2);\n },\n easeInBounce: t => 1 - effects.easeOutBounce(1 - t),\n easeOutBounce(t) {\n const m = 7.5625;\n const d = 2.75;\n if (t < 1 / d) {\n return m * t * t;\n }\n if (t < 2 / d) {\n return m * (t -= 1.5 / d) * t + 0.75;\n }\n if (t < 2.5 / d) {\n return m * (t -= 2.25 / d) * t + 0.9375;\n }\n return m * (t -= 2.625 / d) * t + 0.984375;\n },\n easeInOutBounce: t => t < 0.5 ? effects.easeInBounce(t * 2) * 0.5 : effects.easeOutBounce(t * 2 - 1) * 0.5 + 0.5\n};\n\n/*!\n * @kurkle/color v0.2.1\n * https://github.com/kurkle/color#readme\n * (c) 2022 Jukka Kurkela\n * Released under the MIT License\n */\nfunction round(v) {\n return v + 0.5 | 0;\n}\nconst lim = (v, l, h) => Math.max(Math.min(v, h), l);\nfunction p2b(v) {\n return lim(round(v * 2.55), 0, 255);\n}\nfunction n2b(v) {\n return lim(round(v * 255), 0, 255);\n}\nfunction b2n(v) {\n return lim(round(v / 2.55) / 100, 0, 1);\n}\nfunction n2p(v) {\n return lim(round(v * 100), 0, 100);\n}\nconst map$1 = {\n 0: 0,\n 1: 1,\n 2: 2,\n 3: 3,\n 4: 4,\n 5: 5,\n 6: 6,\n 7: 7,\n 8: 8,\n 9: 9,\n A: 10,\n B: 11,\n C: 12,\n D: 13,\n E: 14,\n F: 15,\n a: 10,\n b: 11,\n c: 12,\n d: 13,\n e: 14,\n f: 15\n};\nconst hex = [...'0123456789ABCDEF'];\nconst h1 = b => hex[b & 0xF];\nconst h2 = b => hex[(b & 0xF0) >> 4] + hex[b & 0xF];\nconst eq = b => (b & 0xF0) >> 4 === (b & 0xF);\nconst isShort = v => eq(v.r) && eq(v.g) && eq(v.b) && eq(v.a);\nfunction hexParse(str) {\n var len = str.length;\n var ret;\n if (str[0] === '#') {\n if (len === 4 || len === 5) {\n ret = {\n r: 255 & map$1[str[1]] * 17,\n g: 255 & map$1[str[2]] * 17,\n b: 255 & map$1[str[3]] * 17,\n a: len === 5 ? map$1[str[4]] * 17 : 255\n };\n } else if (len === 7 || len === 9) {\n ret = {\n r: map$1[str[1]] << 4 | map$1[str[2]],\n g: map$1[str[3]] << 4 | map$1[str[4]],\n b: map$1[str[5]] << 4 | map$1[str[6]],\n a: len === 9 ? map$1[str[7]] << 4 | map$1[str[8]] : 255\n };\n }\n }\n return ret;\n}\nconst alpha = (a, f) => a < 255 ? f(a) : '';\nfunction hexString(v) {\n var f = isShort(v) ? h1 : h2;\n return v ? '#' + f(v.r) + f(v.g) + f(v.b) + alpha(v.a, f) : undefined;\n}\nconst HUE_RE = /^(hsla?|hwb|hsv)\\(\\s*([-+.e\\d]+)(?:deg)?[\\s,]+([-+.e\\d]+)%[\\s,]+([-+.e\\d]+)%(?:[\\s,]+([-+.e\\d]+)(%)?)?\\s*\\)$/;\nfunction hsl2rgbn(h, s, l) {\n const a = s * Math.min(l, 1 - l);\n const f = function (n) {\n let k = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : (n + h / 30) % 12;\n return l - a * Math.max(Math.min(k - 3, 9 - k, 1), -1);\n };\n return [f(0), f(8), f(4)];\n}\nfunction hsv2rgbn(h, s, v) {\n const f = function (n) {\n let k = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : (n + h / 60) % 6;\n return v - v * s * Math.max(Math.min(k, 4 - k, 1), 0);\n };\n return [f(5), f(3), f(1)];\n}\nfunction hwb2rgbn(h, w, b) {\n const rgb = hsl2rgbn(h, 1, 0.5);\n let i;\n if (w + b > 1) {\n i = 1 / (w + b);\n w *= i;\n b *= i;\n }\n for (i = 0; i < 3; i++) {\n rgb[i] *= 1 - w - b;\n rgb[i] += w;\n }\n return rgb;\n}\nfunction hueValue(r, g, b, d, max) {\n if (r === max) {\n return (g - b) / d + (g < b ? 6 : 0);\n }\n if (g === max) {\n return (b - r) / d + 2;\n }\n return (r - g) / d + 4;\n}\nfunction rgb2hsl(v) {\n const range = 255;\n const r = v.r / range;\n const g = v.g / range;\n const b = v.b / range;\n const max = Math.max(r, g, b);\n const min = Math.min(r, g, b);\n const l = (max + min) / 2;\n let h, s, d;\n if (max !== min) {\n d = max - min;\n s = l > 0.5 ? d / (2 - max - min) : d / (max + min);\n h = hueValue(r, g, b, d, max);\n h = h * 60 + 0.5;\n }\n return [h | 0, s || 0, l];\n}\nfunction calln(f, a, b, c) {\n return (Array.isArray(a) ? f(a[0], a[1], a[2]) : f(a, b, c)).map(n2b);\n}\nfunction hsl2rgb(h, s, l) {\n return calln(hsl2rgbn, h, s, l);\n}\nfunction hwb2rgb(h, w, b) {\n return calln(hwb2rgbn, h, w, b);\n}\nfunction hsv2rgb(h, s, v) {\n return calln(hsv2rgbn, h, s, v);\n}\nfunction hue(h) {\n return (h % 360 + 360) % 360;\n}\nfunction hueParse(str) {\n const m = HUE_RE.exec(str);\n let a = 255;\n let v;\n if (!m) {\n return;\n }\n if (m[5] !== v) {\n a = m[6] ? p2b(+m[5]) : n2b(+m[5]);\n }\n const h = hue(+m[2]);\n const p1 = +m[3] / 100;\n const p2 = +m[4] / 100;\n if (m[1] === 'hwb') {\n v = hwb2rgb(h, p1, p2);\n } else if (m[1] === 'hsv') {\n v = hsv2rgb(h, p1, p2);\n } else {\n v = hsl2rgb(h, p1, p2);\n }\n return {\n r: v[0],\n g: v[1],\n b: v[2],\n a: a\n };\n}\nfunction rotate(v, deg) {\n var h = rgb2hsl(v);\n h[0] = hue(h[0] + deg);\n h = hsl2rgb(h);\n v.r = h[0];\n v.g = h[1];\n v.b = h[2];\n}\nfunction hslString(v) {\n if (!v) {\n return;\n }\n const a = rgb2hsl(v);\n const h = a[0];\n const s = n2p(a[1]);\n const l = n2p(a[2]);\n return v.a < 255 ? `hsla(${h}, ${s}%, ${l}%, ${b2n(v.a)})` : `hsl(${h}, ${s}%, ${l}%)`;\n}\nconst map = {\n x: 'dark',\n Z: 'light',\n Y: 're',\n X: 'blu',\n W: 'gr',\n V: 'medium',\n U: 'slate',\n A: 'ee',\n T: 'ol',\n S: 'or',\n B: 'ra',\n C: 'lateg',\n D: 'ights',\n R: 'in',\n Q: 'turquois',\n E: 'hi',\n P: 'ro',\n O: 'al',\n N: 'le',\n M: 'de',\n L: 'yello',\n F: 'en',\n K: 'ch',\n G: 'arks',\n H: 'ea',\n I: 'ightg',\n J: 'wh'\n};\nconst names$1 = {\n OiceXe: 'f0f8ff',\n antiquewEte: 'faebd7',\n aqua: 'ffff',\n aquamarRe: '7fffd4',\n azuY: 'f0ffff',\n beige: 'f5f5dc',\n bisque: 'ffe4c4',\n black: '0',\n blanKedOmond: 'ffebcd',\n Xe: 'ff',\n XeviTet: '8a2be2',\n bPwn: 'a52a2a',\n burlywood: 'deb887',\n caMtXe: '5f9ea0',\n KartYuse: '7fff00',\n KocTate: 'd2691e',\n cSO: 'ff7f50',\n cSnflowerXe: '6495ed',\n cSnsilk: 'fff8dc',\n crimson: 'dc143c',\n cyan: 'ffff',\n xXe: '8b',\n xcyan: '8b8b',\n xgTMnPd: 'b8860b',\n xWay: 'a9a9a9',\n xgYF: '6400',\n xgYy: 'a9a9a9',\n xkhaki: 'bdb76b',\n xmagFta: '8b008b',\n xTivegYF: '556b2f',\n xSange: 'ff8c00',\n xScEd: '9932cc',\n xYd: '8b0000',\n xsOmon: 'e9967a',\n xsHgYF: '8fbc8f',\n xUXe: '483d8b',\n xUWay: '2f4f4f',\n xUgYy: '2f4f4f',\n xQe: 'ced1',\n xviTet: '9400d3',\n dAppRk: 'ff1493',\n dApskyXe: 'bfff',\n dimWay: '696969',\n dimgYy: '696969',\n dodgerXe: '1e90ff',\n fiYbrick: 'b22222',\n flSOwEte: 'fffaf0',\n foYstWAn: '228b22',\n fuKsia: 'ff00ff',\n gaRsbSo: 'dcdcdc',\n ghostwEte: 'f8f8ff',\n gTd: 'ffd700',\n gTMnPd: 'daa520',\n Way: '808080',\n gYF: '8000',\n gYFLw: 'adff2f',\n gYy: '808080',\n honeyMw: 'f0fff0',\n hotpRk: 'ff69b4',\n RdianYd: 'cd5c5c',\n Rdigo: '4b0082',\n ivSy: 'fffff0',\n khaki: 'f0e68c',\n lavFMr: 'e6e6fa',\n lavFMrXsh: 'fff0f5',\n lawngYF: '7cfc00',\n NmoncEffon: 'fffacd',\n ZXe: 'add8e6',\n ZcSO: 'f08080',\n Zcyan: 'e0ffff',\n ZgTMnPdLw: 'fafad2',\n ZWay: 'd3d3d3',\n ZgYF: '90ee90',\n ZgYy: 'd3d3d3',\n ZpRk: 'ffb6c1',\n ZsOmon: 'ffa07a',\n ZsHgYF: '20b2aa',\n ZskyXe: '87cefa',\n ZUWay: '778899',\n ZUgYy: '778899',\n ZstAlXe: 'b0c4de',\n ZLw: 'ffffe0',\n lime: 'ff00',\n limegYF: '32cd32',\n lRF: 'faf0e6',\n magFta: 'ff00ff',\n maPon: '800000',\n VaquamarRe: '66cdaa',\n VXe: 'cd',\n VScEd: 'ba55d3',\n VpurpN: '9370db',\n VsHgYF: '3cb371',\n VUXe: '7b68ee',\n VsprRggYF: 'fa9a',\n VQe: '48d1cc',\n VviTetYd: 'c71585',\n midnightXe: '191970',\n mRtcYam: 'f5fffa',\n mistyPse: 'ffe4e1',\n moccasR: 'ffe4b5',\n navajowEte: 'ffdead',\n navy: '80',\n Tdlace: 'fdf5e6',\n Tive: '808000',\n TivedBb: '6b8e23',\n Sange: 'ffa500',\n SangeYd: 'ff4500',\n ScEd: 'da70d6',\n pOegTMnPd: 'eee8aa',\n pOegYF: '98fb98',\n pOeQe: 'afeeee',\n pOeviTetYd: 'db7093',\n papayawEp: 'ffefd5',\n pHKpuff: 'ffdab9',\n peru: 'cd853f',\n pRk: 'ffc0cb',\n plum: 'dda0dd',\n powMrXe: 'b0e0e6',\n purpN: '800080',\n YbeccapurpN: '663399',\n Yd: 'ff0000',\n Psybrown: 'bc8f8f',\n PyOXe: '4169e1',\n saddNbPwn: '8b4513',\n sOmon: 'fa8072',\n sandybPwn: 'f4a460',\n sHgYF: '2e8b57',\n sHshell: 'fff5ee',\n siFna: 'a0522d',\n silver: 'c0c0c0',\n skyXe: '87ceeb',\n UXe: '6a5acd',\n UWay: '708090',\n UgYy: '708090',\n snow: 'fffafa',\n sprRggYF: 'ff7f',\n stAlXe: '4682b4',\n tan: 'd2b48c',\n teO: '8080',\n tEstN: 'd8bfd8',\n tomato: 'ff6347',\n Qe: '40e0d0',\n viTet: 'ee82ee',\n JHt: 'f5deb3',\n wEte: 'ffffff',\n wEtesmoke: 'f5f5f5',\n Lw: 'ffff00',\n LwgYF: '9acd32'\n};\nfunction unpack() {\n const unpacked = {};\n const keys = Object.keys(names$1);\n const tkeys = Object.keys(map);\n let i, j, k, ok, nk;\n for (i = 0; i < keys.length; i++) {\n ok = nk = keys[i];\n for (j = 0; j < tkeys.length; j++) {\n k = tkeys[j];\n nk = nk.replace(k, map[k]);\n }\n k = parseInt(names$1[ok], 16);\n unpacked[nk] = [k >> 16 & 0xFF, k >> 8 & 0xFF, k & 0xFF];\n }\n return unpacked;\n}\nlet names;\nfunction nameParse(str) {\n if (!names) {\n names = unpack();\n names.transparent = [0, 0, 0, 0];\n }\n const a = names[str.toLowerCase()];\n return a && {\n r: a[0],\n g: a[1],\n b: a[2],\n a: a.length === 4 ? a[3] : 255\n };\n}\nconst RGB_RE = /^rgba?\\(\\s*([-+.\\d]+)(%)?[\\s,]+([-+.e\\d]+)(%)?[\\s,]+([-+.e\\d]+)(%)?(?:[\\s,/]+([-+.e\\d]+)(%)?)?\\s*\\)$/;\nfunction rgbParse(str) {\n const m = RGB_RE.exec(str);\n let a = 255;\n let r, g, b;\n if (!m) {\n return;\n }\n if (m[7] !== r) {\n const v = +m[7];\n a = m[8] ? p2b(v) : lim(v * 255, 0, 255);\n }\n r = +m[1];\n g = +m[3];\n b = +m[5];\n r = 255 & (m[2] ? p2b(r) : lim(r, 0, 255));\n g = 255 & (m[4] ? p2b(g) : lim(g, 0, 255));\n b = 255 & (m[6] ? p2b(b) : lim(b, 0, 255));\n return {\n r: r,\n g: g,\n b: b,\n a: a\n };\n}\nfunction rgbString(v) {\n return v && (v.a < 255 ? `rgba(${v.r}, ${v.g}, ${v.b}, ${b2n(v.a)})` : `rgb(${v.r}, ${v.g}, ${v.b})`);\n}\nconst to = v => v <= 0.0031308 ? v * 12.92 : Math.pow(v, 1.0 / 2.4) * 1.055 - 0.055;\nconst from = v => v <= 0.04045 ? v / 12.92 : Math.pow((v + 0.055) / 1.055, 2.4);\nfunction interpolate(rgb1, rgb2, t) {\n const r = from(b2n(rgb1.r));\n const g = from(b2n(rgb1.g));\n const b = from(b2n(rgb1.b));\n return {\n r: n2b(to(r + t * (from(b2n(rgb2.r)) - r))),\n g: n2b(to(g + t * (from(b2n(rgb2.g)) - g))),\n b: n2b(to(b + t * (from(b2n(rgb2.b)) - b))),\n a: rgb1.a + t * (rgb2.a - rgb1.a)\n };\n}\nfunction modHSL(v, i, ratio) {\n if (v) {\n let tmp = rgb2hsl(v);\n tmp[i] = Math.max(0, Math.min(tmp[i] + tmp[i] * ratio, i === 0 ? 360 : 1));\n tmp = hsl2rgb(tmp);\n v.r = tmp[0];\n v.g = tmp[1];\n v.b = tmp[2];\n }\n}\nfunction clone(v, proto) {\n return v ? Object.assign(proto || {}, v) : v;\n}\nfunction fromObject(input) {\n var v = {\n r: 0,\n g: 0,\n b: 0,\n a: 255\n };\n if (Array.isArray(input)) {\n if (input.length >= 3) {\n v = {\n r: input[0],\n g: input[1],\n b: input[2],\n a: 255\n };\n if (input.length > 3) {\n v.a = n2b(input[3]);\n }\n }\n } else {\n v = clone(input, {\n r: 0,\n g: 0,\n b: 0,\n a: 1\n });\n v.a = n2b(v.a);\n }\n return v;\n}\nfunction functionParse(str) {\n if (str.charAt(0) === 'r') {\n return rgbParse(str);\n }\n return hueParse(str);\n}\nclass Color {\n constructor(input) {\n if (input instanceof Color) {\n return input;\n }\n const type = typeof input;\n let v;\n if (type === 'object') {\n v = fromObject(input);\n } else if (type === 'string') {\n v = hexParse(input) || nameParse(input) || functionParse(input);\n }\n this._rgb = v;\n this._valid = !!v;\n }\n get valid() {\n return this._valid;\n }\n get rgb() {\n var v = clone(this._rgb);\n if (v) {\n v.a = b2n(v.a);\n }\n return v;\n }\n set rgb(obj) {\n this._rgb = fromObject(obj);\n }\n rgbString() {\n return this._valid ? rgbString(this._rgb) : undefined;\n }\n hexString() {\n return this._valid ? hexString(this._rgb) : undefined;\n }\n hslString() {\n return this._valid ? hslString(this._rgb) : undefined;\n }\n mix(color, weight) {\n if (color) {\n const c1 = this.rgb;\n const c2 = color.rgb;\n let w2;\n const p = weight === w2 ? 0.5 : weight;\n const w = 2 * p - 1;\n const a = c1.a - c2.a;\n const w1 = ((w * a === -1 ? w : (w + a) / (1 + w * a)) + 1) / 2.0;\n w2 = 1 - w1;\n c1.r = 0xFF & w1 * c1.r + w2 * c2.r + 0.5;\n c1.g = 0xFF & w1 * c1.g + w2 * c2.g + 0.5;\n c1.b = 0xFF & w1 * c1.b + w2 * c2.b + 0.5;\n c1.a = p * c1.a + (1 - p) * c2.a;\n this.rgb = c1;\n }\n return this;\n }\n interpolate(color, t) {\n if (color) {\n this._rgb = interpolate(this._rgb, color._rgb, t);\n }\n return this;\n }\n clone() {\n return new Color(this.rgb);\n }\n alpha(a) {\n this._rgb.a = n2b(a);\n return this;\n }\n clearer(ratio) {\n const rgb = this._rgb;\n rgb.a *= 1 - ratio;\n return this;\n }\n greyscale() {\n const rgb = this._rgb;\n const val = round(rgb.r * 0.3 + rgb.g * 0.59 + rgb.b * 0.11);\n rgb.r = rgb.g = rgb.b = val;\n return this;\n }\n opaquer(ratio) {\n const rgb = this._rgb;\n rgb.a *= 1 + ratio;\n return this;\n }\n negate() {\n const v = this._rgb;\n v.r = 255 - v.r;\n v.g = 255 - v.g;\n v.b = 255 - v.b;\n return this;\n }\n lighten(ratio) {\n modHSL(this._rgb, 2, ratio);\n return this;\n }\n darken(ratio) {\n modHSL(this._rgb, 2, -ratio);\n return this;\n }\n saturate(ratio) {\n modHSL(this._rgb, 1, ratio);\n return this;\n }\n desaturate(ratio) {\n modHSL(this._rgb, 1, -ratio);\n return this;\n }\n rotate(deg) {\n rotate(this._rgb, deg);\n return this;\n }\n}\nfunction index_esm(input) {\n return new Color(input);\n}\nfunction isPatternOrGradient(value) {\n if (value && typeof value === 'object') {\n const type = value.toString();\n return type === '[object CanvasPattern]' || type === '[object CanvasGradient]';\n }\n return false;\n}\nfunction color(value) {\n return isPatternOrGradient(value) ? value : index_esm(value);\n}\nfunction getHoverColor(value) {\n return isPatternOrGradient(value) ? value : index_esm(value).saturate(0.5).darken(0.1).hexString();\n}\nconst overrides = Object.create(null);\nconst descriptors = Object.create(null);\nfunction getScope$1(node, key) {\n if (!key) {\n return node;\n }\n const keys = key.split('.');\n for (let i = 0, n = keys.length; i < n; ++i) {\n const k = keys[i];\n node = node[k] || (node[k] = Object.create(null));\n }\n return node;\n}\nfunction set(root, scope, values) {\n if (typeof scope === 'string') {\n return merge(getScope$1(root, scope), values);\n }\n return merge(getScope$1(root, ''), scope);\n}\nclass Defaults {\n constructor(_descriptors) {\n this.animation = undefined;\n this.backgroundColor = 'rgba(0,0,0,0.1)';\n this.borderColor = 'rgba(0,0,0,0.1)';\n this.color = '#666';\n this.datasets = {};\n this.devicePixelRatio = context => context.chart.platform.getDevicePixelRatio();\n this.elements = {};\n this.events = ['mousemove', 'mouseout', 'click', 'touchstart', 'touchmove'];\n this.font = {\n family: \"'Helvetica Neue', 'Helvetica', 'Arial', sans-serif\",\n size: 12,\n style: 'normal',\n lineHeight: 1.2,\n weight: null\n };\n this.hover = {};\n this.hoverBackgroundColor = (ctx, options) => getHoverColor(options.backgroundColor);\n this.hoverBorderColor = (ctx, options) => getHoverColor(options.borderColor);\n this.hoverColor = (ctx, options) => getHoverColor(options.color);\n this.indexAxis = 'x';\n this.interaction = {\n mode: 'nearest',\n intersect: true,\n includeInvisible: false\n };\n this.maintainAspectRatio = true;\n this.onHover = null;\n this.onClick = null;\n this.parsing = true;\n this.plugins = {};\n this.responsive = true;\n this.scale = undefined;\n this.scales = {};\n this.showLine = true;\n this.drawActiveElementsOnTop = true;\n this.describe(_descriptors);\n }\n set(scope, values) {\n return set(this, scope, values);\n }\n get(scope) {\n return getScope$1(this, scope);\n }\n describe(scope, values) {\n return set(descriptors, scope, values);\n }\n override(scope, values) {\n return set(overrides, scope, values);\n }\n route(scope, name, targetScope, targetName) {\n const scopeObject = getScope$1(this, scope);\n const targetScopeObject = getScope$1(this, targetScope);\n const privateName = '_' + name;\n Object.defineProperties(scopeObject, {\n [privateName]: {\n value: scopeObject[name],\n writable: true\n },\n [name]: {\n enumerable: true,\n get() {\n const local = this[privateName];\n const target = targetScopeObject[targetName];\n if (isObject(local)) {\n return Object.assign({}, target, local);\n }\n return valueOrDefault(local, target);\n },\n set(value) {\n this[privateName] = value;\n }\n }\n });\n }\n}\nvar defaults = new Defaults({\n _scriptable: name => !name.startsWith('on'),\n _indexable: name => name !== 'events',\n hover: {\n _fallback: 'interaction'\n },\n interaction: {\n _scriptable: false,\n _indexable: false\n }\n});\nfunction toFontString(font) {\n if (!font || isNullOrUndef(font.size) || isNullOrUndef(font.family)) {\n return null;\n }\n return (font.style ? font.style + ' ' : '') + (font.weight ? font.weight + ' ' : '') + font.size + 'px ' + font.family;\n}\nfunction _measureText(ctx, data, gc, longest, string) {\n let textWidth = data[string];\n if (!textWidth) {\n textWidth = data[string] = ctx.measureText(string).width;\n gc.push(string);\n }\n if (textWidth > longest) {\n longest = textWidth;\n }\n return longest;\n}\nfunction _longestText(ctx, font, arrayOfThings, cache) {\n cache = cache || {};\n let data = cache.data = cache.data || {};\n let gc = cache.garbageCollect = cache.garbageCollect || [];\n if (cache.font !== font) {\n data = cache.data = {};\n gc = cache.garbageCollect = [];\n cache.font = font;\n }\n ctx.save();\n ctx.font = font;\n let longest = 0;\n const ilen = arrayOfThings.length;\n let i, j, jlen, thing, nestedThing;\n for (i = 0; i < ilen; i++) {\n thing = arrayOfThings[i];\n if (thing !== undefined && thing !== null && isArray(thing) !== true) {\n longest = _measureText(ctx, data, gc, longest, thing);\n } else if (isArray(thing)) {\n for (j = 0, jlen = thing.length; j < jlen; j++) {\n nestedThing = thing[j];\n if (nestedThing !== undefined && nestedThing !== null && !isArray(nestedThing)) {\n longest = _measureText(ctx, data, gc, longest, nestedThing);\n }\n }\n }\n }\n ctx.restore();\n const gcLen = gc.length / 2;\n if (gcLen > arrayOfThings.length) {\n for (i = 0; i < gcLen; i++) {\n delete data[gc[i]];\n }\n gc.splice(0, gcLen);\n }\n return longest;\n}\nfunction _alignPixel(chart, pixel, width) {\n const devicePixelRatio = chart.currentDevicePixelRatio;\n const halfWidth = width !== 0 ? Math.max(width / 2, 0.5) : 0;\n return Math.round((pixel - halfWidth) * devicePixelRatio) / devicePixelRatio + halfWidth;\n}\nfunction clearCanvas(canvas, ctx) {\n ctx = ctx || canvas.getContext('2d');\n ctx.save();\n ctx.resetTransform();\n ctx.clearRect(0, 0, canvas.width, canvas.height);\n ctx.restore();\n}\nfunction drawPoint(ctx, options, x, y) {\n drawPointLegend(ctx, options, x, y, null);\n}\nfunction drawPointLegend(ctx, options, x, y, w) {\n let type, xOffset, yOffset, size, cornerRadius, width;\n const style = options.pointStyle;\n const rotation = options.rotation;\n const radius = options.radius;\n let rad = (rotation || 0) * RAD_PER_DEG;\n if (style && typeof style === 'object') {\n type = style.toString();\n if (type === '[object HTMLImageElement]' || type === '[object HTMLCanvasElement]') {\n ctx.save();\n ctx.translate(x, y);\n ctx.rotate(rad);\n ctx.drawImage(style, -style.width / 2, -style.height / 2, style.width, style.height);\n ctx.restore();\n return;\n }\n }\n if (isNaN(radius) || radius <= 0) {\n return;\n }\n ctx.beginPath();\n switch (style) {\n default:\n if (w) {\n ctx.ellipse(x, y, w / 2, radius, 0, 0, TAU);\n } else {\n ctx.arc(x, y, radius, 0, TAU);\n }\n ctx.closePath();\n break;\n case 'triangle':\n ctx.moveTo(x + Math.sin(rad) * radius, y - Math.cos(rad) * radius);\n rad += TWO_THIRDS_PI;\n ctx.lineTo(x + Math.sin(rad) * radius, y - Math.cos(rad) * radius);\n rad += TWO_THIRDS_PI;\n ctx.lineTo(x + Math.sin(rad) * radius, y - Math.cos(rad) * radius);\n ctx.closePath();\n break;\n case 'rectRounded':\n cornerRadius = radius * 0.516;\n size = radius - cornerRadius;\n xOffset = Math.cos(rad + QUARTER_PI) * size;\n yOffset = Math.sin(rad + QUARTER_PI) * size;\n ctx.arc(x - xOffset, y - yOffset, cornerRadius, rad - PI, rad - HALF_PI);\n ctx.arc(x + yOffset, y - xOffset, cornerRadius, rad - HALF_PI, rad);\n ctx.arc(x + xOffset, y + yOffset, cornerRadius, rad, rad + HALF_PI);\n ctx.arc(x - yOffset, y + xOffset, cornerRadius, rad + HALF_PI, rad + PI);\n ctx.closePath();\n break;\n case 'rect':\n if (!rotation) {\n size = Math.SQRT1_2 * radius;\n width = w ? w / 2 : size;\n ctx.rect(x - width, y - size, 2 * width, 2 * size);\n break;\n }\n rad += QUARTER_PI;\n case 'rectRot':\n xOffset = Math.cos(rad) * radius;\n yOffset = Math.sin(rad) * radius;\n ctx.moveTo(x - xOffset, y - yOffset);\n ctx.lineTo(x + yOffset, y - xOffset);\n ctx.lineTo(x + xOffset, y + yOffset);\n ctx.lineTo(x - yOffset, y + xOffset);\n ctx.closePath();\n break;\n case 'crossRot':\n rad += QUARTER_PI;\n case 'cross':\n xOffset = Math.cos(rad) * radius;\n yOffset = Math.sin(rad) * radius;\n ctx.moveTo(x - xOffset, y - yOffset);\n ctx.lineTo(x + xOffset, y + yOffset);\n ctx.moveTo(x + yOffset, y - xOffset);\n ctx.lineTo(x - yOffset, y + xOffset);\n break;\n case 'star':\n xOffset = Math.cos(rad) * radius;\n yOffset = Math.sin(rad) * radius;\n ctx.moveTo(x - xOffset, y - yOffset);\n ctx.lineTo(x + xOffset, y + yOffset);\n ctx.moveTo(x + yOffset, y - xOffset);\n ctx.lineTo(x - yOffset, y + xOffset);\n rad += QUARTER_PI;\n xOffset = Math.cos(rad) * radius;\n yOffset = Math.sin(rad) * radius;\n ctx.moveTo(x - xOffset, y - yOffset);\n ctx.lineTo(x + xOffset, y + yOffset);\n ctx.moveTo(x + yOffset, y - xOffset);\n ctx.lineTo(x - yOffset, y + xOffset);\n break;\n case 'line':\n xOffset = w ? w / 2 : Math.cos(rad) * radius;\n yOffset = Math.sin(rad) * radius;\n ctx.moveTo(x - xOffset, y - yOffset);\n ctx.lineTo(x + xOffset, y + yOffset);\n break;\n case 'dash':\n ctx.moveTo(x, y);\n ctx.lineTo(x + Math.cos(rad) * radius, y + Math.sin(rad) * radius);\n break;\n }\n ctx.fill();\n if (options.borderWidth > 0) {\n ctx.stroke();\n }\n}\nfunction _isPointInArea(point, area, margin) {\n margin = margin || 0.5;\n return !area || point && point.x > area.left - margin && point.x < area.right + margin && point.y > area.top - margin && point.y < area.bottom + margin;\n}\nfunction clipArea(ctx, area) {\n ctx.save();\n ctx.beginPath();\n ctx.rect(area.left, area.top, area.right - area.left, area.bottom - area.top);\n ctx.clip();\n}\nfunction unclipArea(ctx) {\n ctx.restore();\n}\nfunction _steppedLineTo(ctx, previous, target, flip, mode) {\n if (!previous) {\n return ctx.lineTo(target.x, target.y);\n }\n if (mode === 'middle') {\n const midpoint = (previous.x + target.x) / 2.0;\n ctx.lineTo(midpoint, previous.y);\n ctx.lineTo(midpoint, target.y);\n } else if (mode === 'after' !== !!flip) {\n ctx.lineTo(previous.x, target.y);\n } else {\n ctx.lineTo(target.x, previous.y);\n }\n ctx.lineTo(target.x, target.y);\n}\nfunction _bezierCurveTo(ctx, previous, target, flip) {\n if (!previous) {\n return ctx.lineTo(target.x, target.y);\n }\n ctx.bezierCurveTo(flip ? previous.cp1x : previous.cp2x, flip ? previous.cp1y : previous.cp2y, flip ? target.cp2x : target.cp1x, flip ? target.cp2y : target.cp1y, target.x, target.y);\n}\nfunction renderText(ctx, text, x, y, font) {\n let opts = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : {};\n const lines = isArray(text) ? text : [text];\n const stroke = opts.strokeWidth > 0 && opts.strokeColor !== '';\n let i, line;\n ctx.save();\n ctx.font = font.string;\n setRenderOpts(ctx, opts);\n for (i = 0; i < lines.length; ++i) {\n line = lines[i];\n if (stroke) {\n if (opts.strokeColor) {\n ctx.strokeStyle = opts.strokeColor;\n }\n if (!isNullOrUndef(opts.strokeWidth)) {\n ctx.lineWidth = opts.strokeWidth;\n }\n ctx.strokeText(line, x, y, opts.maxWidth);\n }\n ctx.fillText(line, x, y, opts.maxWidth);\n decorateText(ctx, x, y, line, opts);\n y += font.lineHeight;\n }\n ctx.restore();\n}\nfunction setRenderOpts(ctx, opts) {\n if (opts.translation) {\n ctx.translate(opts.translation[0], opts.translation[1]);\n }\n if (!isNullOrUndef(opts.rotation)) {\n ctx.rotate(opts.rotation);\n }\n if (opts.color) {\n ctx.fillStyle = opts.color;\n }\n if (opts.textAlign) {\n ctx.textAlign = opts.textAlign;\n }\n if (opts.textBaseline) {\n ctx.textBaseline = opts.textBaseline;\n }\n}\nfunction decorateText(ctx, x, y, line, opts) {\n if (opts.strikethrough || opts.underline) {\n const metrics = ctx.measureText(line);\n const left = x - metrics.actualBoundingBoxLeft;\n const right = x + metrics.actualBoundingBoxRight;\n const top = y - metrics.actualBoundingBoxAscent;\n const bottom = y + metrics.actualBoundingBoxDescent;\n const yDecoration = opts.strikethrough ? (top + bottom) / 2 : bottom;\n ctx.strokeStyle = ctx.fillStyle;\n ctx.beginPath();\n ctx.lineWidth = opts.decorationWidth || 2;\n ctx.moveTo(left, yDecoration);\n ctx.lineTo(right, yDecoration);\n ctx.stroke();\n }\n}\nfunction addRoundedRectPath(ctx, rect) {\n const x = rect.x,\n y = rect.y,\n w = rect.w,\n h = rect.h,\n radius = rect.radius;\n ctx.arc(x + radius.topLeft, y + radius.topLeft, radius.topLeft, -HALF_PI, PI, true);\n ctx.lineTo(x, y + h - radius.bottomLeft);\n ctx.arc(x + radius.bottomLeft, y + h - radius.bottomLeft, radius.bottomLeft, PI, HALF_PI, true);\n ctx.lineTo(x + w - radius.bottomRight, y + h);\n ctx.arc(x + w - radius.bottomRight, y + h - radius.bottomRight, radius.bottomRight, HALF_PI, 0, true);\n ctx.lineTo(x + w, y + radius.topRight);\n ctx.arc(x + w - radius.topRight, y + radius.topRight, radius.topRight, 0, -HALF_PI, true);\n ctx.lineTo(x + radius.topLeft, y);\n}\nconst LINE_HEIGHT = new RegExp(/^(normal|(\\d+(?:\\.\\d+)?)(px|em|%)?)$/);\nconst FONT_STYLE = new RegExp(/^(normal|italic|initial|inherit|unset|(oblique( -?[0-9]?[0-9]deg)?))$/);\nfunction toLineHeight(value, size) {\n const matches = ('' + value).match(LINE_HEIGHT);\n if (!matches || matches[1] === 'normal') {\n return size * 1.2;\n }\n value = +matches[2];\n switch (matches[3]) {\n case 'px':\n return value;\n case '%':\n value /= 100;\n break;\n }\n return size * value;\n}\nconst numberOrZero = v => +v || 0;\nfunction _readValueToProps(value, props) {\n const ret = {};\n const objProps = isObject(props);\n const keys = objProps ? Object.keys(props) : props;\n const read = isObject(value) ? objProps ? prop => valueOrDefault(value[prop], value[props[prop]]) : prop => value[prop] : () => value;\n for (const prop of keys) {\n ret[prop] = numberOrZero(read(prop));\n }\n return ret;\n}\nfunction toTRBL(value) {\n return _readValueToProps(value, {\n top: 'y',\n right: 'x',\n bottom: 'y',\n left: 'x'\n });\n}\nfunction toTRBLCorners(value) {\n return _readValueToProps(value, ['topLeft', 'topRight', 'bottomLeft', 'bottomRight']);\n}\nfunction toPadding(value) {\n const obj = toTRBL(value);\n obj.width = obj.left + obj.right;\n obj.height = obj.top + obj.bottom;\n return obj;\n}\nfunction toFont(options, fallback) {\n options = options || {};\n fallback = fallback || defaults.font;\n let size = valueOrDefault(options.size, fallback.size);\n if (typeof size === 'string') {\n size = parseInt(size, 10);\n }\n let style = valueOrDefault(options.style, fallback.style);\n if (style && !('' + style).match(FONT_STYLE)) {\n console.warn('Invalid font style specified: \"' + style + '\"');\n style = '';\n }\n const font = {\n family: valueOrDefault(options.family, fallback.family),\n lineHeight: toLineHeight(valueOrDefault(options.lineHeight, fallback.lineHeight), size),\n size,\n style,\n weight: valueOrDefault(options.weight, fallback.weight),\n string: ''\n };\n font.string = toFontString(font);\n return font;\n}\nfunction resolve(inputs, context, index, info) {\n let cacheable = true;\n let i, ilen, value;\n for (i = 0, ilen = inputs.length; i < ilen; ++i) {\n value = inputs[i];\n if (value === undefined) {\n continue;\n }\n if (context !== undefined && typeof value === 'function') {\n value = value(context);\n cacheable = false;\n }\n if (index !== undefined && isArray(value)) {\n value = value[index % value.length];\n cacheable = false;\n }\n if (value !== undefined) {\n if (info && !cacheable) {\n info.cacheable = false;\n }\n return value;\n }\n }\n}\nfunction _addGrace(minmax, grace, beginAtZero) {\n const min = minmax.min,\n max = minmax.max;\n const change = toDimension(grace, (max - min) / 2);\n const keepZero = (value, add) => beginAtZero && value === 0 ? 0 : value + add;\n return {\n min: keepZero(min, -Math.abs(change)),\n max: keepZero(max, change)\n };\n}\nfunction createContext(parentContext, context) {\n return Object.assign(Object.create(parentContext), context);\n}\nfunction _createResolver(scopes) {\n let prefixes = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : [''];\n let rootScopes = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : scopes;\n let fallback = arguments.length > 3 ? arguments[3] : undefined;\n let getTarget = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : () => scopes[0];\n if (!defined(fallback)) {\n fallback = _resolve('_fallback', scopes);\n }\n const cache = {\n [Symbol.toStringTag]: 'Object',\n _cacheable: true,\n _scopes: scopes,\n _rootScopes: rootScopes,\n _fallback: fallback,\n _getTarget: getTarget,\n override: scope => _createResolver([scope, ...scopes], prefixes, rootScopes, fallback)\n };\n return new Proxy(cache, {\n deleteProperty(target, prop) {\n delete target[prop];\n delete target._keys;\n delete scopes[0][prop];\n return true;\n },\n get(target, prop) {\n return _cached(target, prop, () => _resolveWithPrefixes(prop, prefixes, scopes, target));\n },\n getOwnPropertyDescriptor(target, prop) {\n return Reflect.getOwnPropertyDescriptor(target._scopes[0], prop);\n },\n getPrototypeOf() {\n return Reflect.getPrototypeOf(scopes[0]);\n },\n has(target, prop) {\n return getKeysFromAllScopes(target).includes(prop);\n },\n ownKeys(target) {\n return getKeysFromAllScopes(target);\n },\n set(target, prop, value) {\n const storage = target._storage || (target._storage = getTarget());\n target[prop] = storage[prop] = value;\n delete target._keys;\n return true;\n }\n });\n}\nfunction _attachContext(proxy, context, subProxy, descriptorDefaults) {\n const cache = {\n _cacheable: false,\n _proxy: proxy,\n _context: context,\n _subProxy: subProxy,\n _stack: new Set(),\n _descriptors: _descriptors(proxy, descriptorDefaults),\n setContext: ctx => _attachContext(proxy, ctx, subProxy, descriptorDefaults),\n override: scope => _attachContext(proxy.override(scope), context, subProxy, descriptorDefaults)\n };\n return new Proxy(cache, {\n deleteProperty(target, prop) {\n delete target[prop];\n delete proxy[prop];\n return true;\n },\n get(target, prop, receiver) {\n return _cached(target, prop, () => _resolveWithContext(target, prop, receiver));\n },\n getOwnPropertyDescriptor(target, prop) {\n return target._descriptors.allKeys ? Reflect.has(proxy, prop) ? {\n enumerable: true,\n configurable: true\n } : undefined : Reflect.getOwnPropertyDescriptor(proxy, prop);\n },\n getPrototypeOf() {\n return Reflect.getPrototypeOf(proxy);\n },\n has(target, prop) {\n return Reflect.has(proxy, prop);\n },\n ownKeys() {\n return Reflect.ownKeys(proxy);\n },\n set(target, prop, value) {\n proxy[prop] = value;\n delete target[prop];\n return true;\n }\n });\n}\nfunction _descriptors(proxy) {\n let defaults = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {\n scriptable: true,\n indexable: true\n };\n const _proxy$_scriptable = proxy._scriptable,\n _scriptable = _proxy$_scriptable === void 0 ? defaults.scriptable : _proxy$_scriptable,\n _proxy$_indexable = proxy._indexable,\n _indexable = _proxy$_indexable === void 0 ? defaults.indexable : _proxy$_indexable,\n _proxy$_allKeys = proxy._allKeys,\n _allKeys = _proxy$_allKeys === void 0 ? defaults.allKeys : _proxy$_allKeys;\n return {\n allKeys: _allKeys,\n scriptable: _scriptable,\n indexable: _indexable,\n isScriptable: isFunction(_scriptable) ? _scriptable : () => _scriptable,\n isIndexable: isFunction(_indexable) ? _indexable : () => _indexable\n };\n}\nconst readKey = (prefix, name) => prefix ? prefix + _capitalize(name) : name;\nconst needsSubResolver = (prop, value) => isObject(value) && prop !== 'adapters' && (Object.getPrototypeOf(value) === null || value.constructor === Object);\nfunction _cached(target, prop, resolve) {\n if (Object.prototype.hasOwnProperty.call(target, prop)) {\n return target[prop];\n }\n const value = resolve();\n target[prop] = value;\n return value;\n}\nfunction _resolveWithContext(target, prop, receiver) {\n const _proxy = target._proxy,\n _context = target._context,\n _subProxy = target._subProxy,\n descriptors = target._descriptors;\n let value = _proxy[prop];\n if (isFunction(value) && descriptors.isScriptable(prop)) {\n value = _resolveScriptable(prop, value, target, receiver);\n }\n if (isArray(value) && value.length) {\n value = _resolveArray(prop, value, target, descriptors.isIndexable);\n }\n if (needsSubResolver(prop, value)) {\n value = _attachContext(value, _context, _subProxy && _subProxy[prop], descriptors);\n }\n return value;\n}\nfunction _resolveScriptable(prop, value, target, receiver) {\n const _proxy = target._proxy,\n _context = target._context,\n _subProxy = target._subProxy,\n _stack = target._stack;\n if (_stack.has(prop)) {\n throw new Error('Recursion detected: ' + Array.from(_stack).join('->') + '->' + prop);\n }\n _stack.add(prop);\n value = value(_context, _subProxy || receiver);\n _stack.delete(prop);\n if (needsSubResolver(prop, value)) {\n value = createSubResolver(_proxy._scopes, _proxy, prop, value);\n }\n return value;\n}\nfunction _resolveArray(prop, value, target, isIndexable) {\n const _proxy = target._proxy,\n _context = target._context,\n _subProxy = target._subProxy,\n descriptors = target._descriptors;\n if (defined(_context.index) && isIndexable(prop)) {\n value = value[_context.index % value.length];\n } else if (isObject(value[0])) {\n const arr = value;\n const scopes = _proxy._scopes.filter(s => s !== arr);\n value = [];\n for (const item of arr) {\n const resolver = createSubResolver(scopes, _proxy, prop, item);\n value.push(_attachContext(resolver, _context, _subProxy && _subProxy[prop], descriptors));\n }\n }\n return value;\n}\nfunction resolveFallback(fallback, prop, value) {\n return isFunction(fallback) ? fallback(prop, value) : fallback;\n}\nconst getScope = (key, parent) => key === true ? parent : typeof key === 'string' ? resolveObjectKey(parent, key) : undefined;\nfunction addScopes(set, parentScopes, key, parentFallback, value) {\n for (const parent of parentScopes) {\n const scope = getScope(key, parent);\n if (scope) {\n set.add(scope);\n const fallback = resolveFallback(scope._fallback, key, value);\n if (defined(fallback) && fallback !== key && fallback !== parentFallback) {\n return fallback;\n }\n } else if (scope === false && defined(parentFallback) && key !== parentFallback) {\n return null;\n }\n }\n return false;\n}\nfunction createSubResolver(parentScopes, resolver, prop, value) {\n const rootScopes = resolver._rootScopes;\n const fallback = resolveFallback(resolver._fallback, prop, value);\n const allScopes = [...parentScopes, ...rootScopes];\n const set = new Set();\n set.add(value);\n let key = addScopesFromKey(set, allScopes, prop, fallback || prop, value);\n if (key === null) {\n return false;\n }\n if (defined(fallback) && fallback !== prop) {\n key = addScopesFromKey(set, allScopes, fallback, key, value);\n if (key === null) {\n return false;\n }\n }\n return _createResolver(Array.from(set), [''], rootScopes, fallback, () => subGetTarget(resolver, prop, value));\n}\nfunction addScopesFromKey(set, allScopes, key, fallback, item) {\n while (key) {\n key = addScopes(set, allScopes, key, fallback, item);\n }\n return key;\n}\nfunction subGetTarget(resolver, prop, value) {\n const parent = resolver._getTarget();\n if (!(prop in parent)) {\n parent[prop] = {};\n }\n const target = parent[prop];\n if (isArray(target) && isObject(value)) {\n return value;\n }\n return target;\n}\nfunction _resolveWithPrefixes(prop, prefixes, scopes, proxy) {\n let value;\n for (const prefix of prefixes) {\n value = _resolve(readKey(prefix, prop), scopes);\n if (defined(value)) {\n return needsSubResolver(prop, value) ? createSubResolver(scopes, proxy, prop, value) : value;\n }\n }\n}\nfunction _resolve(key, scopes) {\n for (const scope of scopes) {\n if (!scope) {\n continue;\n }\n const value = scope[key];\n if (defined(value)) {\n return value;\n }\n }\n}\nfunction getKeysFromAllScopes(target) {\n let keys = target._keys;\n if (!keys) {\n keys = target._keys = resolveKeysFromAllScopes(target._scopes);\n }\n return keys;\n}\nfunction resolveKeysFromAllScopes(scopes) {\n const set = new Set();\n for (const scope of scopes) {\n for (const key of Object.keys(scope).filter(k => !k.startsWith('_'))) {\n set.add(key);\n }\n }\n return Array.from(set);\n}\nfunction _parseObjectDataRadialScale(meta, data, start, count) {\n const iScale = meta.iScale;\n const _this$_parsing$key = this._parsing.key,\n key = _this$_parsing$key === void 0 ? 'r' : _this$_parsing$key;\n const parsed = new Array(count);\n let i, ilen, index, item;\n for (i = 0, ilen = count; i < ilen; ++i) {\n index = i + start;\n item = data[index];\n parsed[i] = {\n r: iScale.parse(resolveObjectKey(item, key), index)\n };\n }\n return parsed;\n}\nconst EPSILON = Number.EPSILON || 1e-14;\nconst getPoint = (points, i) => i < points.length && !points[i].skip && points[i];\nconst getValueAxis = indexAxis => indexAxis === 'x' ? 'y' : 'x';\nfunction splineCurve(firstPoint, middlePoint, afterPoint, t) {\n const previous = firstPoint.skip ? middlePoint : firstPoint;\n const current = middlePoint;\n const next = afterPoint.skip ? middlePoint : afterPoint;\n const d01 = distanceBetweenPoints(current, previous);\n const d12 = distanceBetweenPoints(next, current);\n let s01 = d01 / (d01 + d12);\n let s12 = d12 / (d01 + d12);\n s01 = isNaN(s01) ? 0 : s01;\n s12 = isNaN(s12) ? 0 : s12;\n const fa = t * s01;\n const fb = t * s12;\n return {\n previous: {\n x: current.x - fa * (next.x - previous.x),\n y: current.y - fa * (next.y - previous.y)\n },\n next: {\n x: current.x + fb * (next.x - previous.x),\n y: current.y + fb * (next.y - previous.y)\n }\n };\n}\nfunction monotoneAdjust(points, deltaK, mK) {\n const pointsLen = points.length;\n let alphaK, betaK, tauK, squaredMagnitude, pointCurrent;\n let pointAfter = getPoint(points, 0);\n for (let i = 0; i < pointsLen - 1; ++i) {\n pointCurrent = pointAfter;\n pointAfter = getPoint(points, i + 1);\n if (!pointCurrent || !pointAfter) {\n continue;\n }\n if (almostEquals(deltaK[i], 0, EPSILON)) {\n mK[i] = mK[i + 1] = 0;\n continue;\n }\n alphaK = mK[i] / deltaK[i];\n betaK = mK[i + 1] / deltaK[i];\n squaredMagnitude = Math.pow(alphaK, 2) + Math.pow(betaK, 2);\n if (squaredMagnitude <= 9) {\n continue;\n }\n tauK = 3 / Math.sqrt(squaredMagnitude);\n mK[i] = alphaK * tauK * deltaK[i];\n mK[i + 1] = betaK * tauK * deltaK[i];\n }\n}\nfunction monotoneCompute(points, mK) {\n let indexAxis = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 'x';\n const valueAxis = getValueAxis(indexAxis);\n const pointsLen = points.length;\n let delta, pointBefore, pointCurrent;\n let pointAfter = getPoint(points, 0);\n for (let i = 0; i < pointsLen; ++i) {\n pointBefore = pointCurrent;\n pointCurrent = pointAfter;\n pointAfter = getPoint(points, i + 1);\n if (!pointCurrent) {\n continue;\n }\n const iPixel = pointCurrent[indexAxis];\n const vPixel = pointCurrent[valueAxis];\n if (pointBefore) {\n delta = (iPixel - pointBefore[indexAxis]) / 3;\n pointCurrent[`cp1${indexAxis}`] = iPixel - delta;\n pointCurrent[`cp1${valueAxis}`] = vPixel - delta * mK[i];\n }\n if (pointAfter) {\n delta = (pointAfter[indexAxis] - iPixel) / 3;\n pointCurrent[`cp2${indexAxis}`] = iPixel + delta;\n pointCurrent[`cp2${valueAxis}`] = vPixel + delta * mK[i];\n }\n }\n}\nfunction splineCurveMonotone(points) {\n let indexAxis = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'x';\n const valueAxis = getValueAxis(indexAxis);\n const pointsLen = points.length;\n const deltaK = Array(pointsLen).fill(0);\n const mK = Array(pointsLen);\n let i, pointBefore, pointCurrent;\n let pointAfter = getPoint(points, 0);\n for (i = 0; i < pointsLen; ++i) {\n pointBefore = pointCurrent;\n pointCurrent = pointAfter;\n pointAfter = getPoint(points, i + 1);\n if (!pointCurrent) {\n continue;\n }\n if (pointAfter) {\n const slopeDelta = pointAfter[indexAxis] - pointCurrent[indexAxis];\n deltaK[i] = slopeDelta !== 0 ? (pointAfter[valueAxis] - pointCurrent[valueAxis]) / slopeDelta : 0;\n }\n mK[i] = !pointBefore ? deltaK[i] : !pointAfter ? deltaK[i - 1] : sign(deltaK[i - 1]) !== sign(deltaK[i]) ? 0 : (deltaK[i - 1] + deltaK[i]) / 2;\n }\n monotoneAdjust(points, deltaK, mK);\n monotoneCompute(points, mK, indexAxis);\n}\nfunction capControlPoint(pt, min, max) {\n return Math.max(Math.min(pt, max), min);\n}\nfunction capBezierPoints(points, area) {\n let i, ilen, point, inArea, inAreaPrev;\n let inAreaNext = _isPointInArea(points[0], area);\n for (i = 0, ilen = points.length; i < ilen; ++i) {\n inAreaPrev = inArea;\n inArea = inAreaNext;\n inAreaNext = i < ilen - 1 && _isPointInArea(points[i + 1], area);\n if (!inArea) {\n continue;\n }\n point = points[i];\n if (inAreaPrev) {\n point.cp1x = capControlPoint(point.cp1x, area.left, area.right);\n point.cp1y = capControlPoint(point.cp1y, area.top, area.bottom);\n }\n if (inAreaNext) {\n point.cp2x = capControlPoint(point.cp2x, area.left, area.right);\n point.cp2y = capControlPoint(point.cp2y, area.top, area.bottom);\n }\n }\n}\nfunction _updateBezierControlPoints(points, options, area, loop, indexAxis) {\n let i, ilen, point, controlPoints;\n if (options.spanGaps) {\n points = points.filter(pt => !pt.skip);\n }\n if (options.cubicInterpolationMode === 'monotone') {\n splineCurveMonotone(points, indexAxis);\n } else {\n let prev = loop ? points[points.length - 1] : points[0];\n for (i = 0, ilen = points.length; i < ilen; ++i) {\n point = points[i];\n controlPoints = splineCurve(prev, point, points[Math.min(i + 1, ilen - (loop ? 0 : 1)) % ilen], options.tension);\n point.cp1x = controlPoints.previous.x;\n point.cp1y = controlPoints.previous.y;\n point.cp2x = controlPoints.next.x;\n point.cp2y = controlPoints.next.y;\n prev = point;\n }\n }\n if (options.capBezierPoints) {\n capBezierPoints(points, area);\n }\n}\nfunction _isDomSupported() {\n return typeof window !== 'undefined' && typeof document !== 'undefined';\n}\nfunction _getParentNode(domNode) {\n let parent = domNode.parentNode;\n if (parent && parent.toString() === '[object ShadowRoot]') {\n parent = parent.host;\n }\n return parent;\n}\nfunction parseMaxStyle(styleValue, node, parentProperty) {\n let valueInPixels;\n if (typeof styleValue === 'string') {\n valueInPixels = parseInt(styleValue, 10);\n if (styleValue.indexOf('%') !== -1) {\n valueInPixels = valueInPixels / 100 * node.parentNode[parentProperty];\n }\n } else {\n valueInPixels = styleValue;\n }\n return valueInPixels;\n}\nconst getComputedStyle = element => window.getComputedStyle(element, null);\nfunction getStyle(el, property) {\n return getComputedStyle(el).getPropertyValue(property);\n}\nconst positions = ['top', 'right', 'bottom', 'left'];\nfunction getPositionedStyle(styles, style, suffix) {\n const result = {};\n suffix = suffix ? '-' + suffix : '';\n for (let i = 0; i < 4; i++) {\n const pos = positions[i];\n result[pos] = parseFloat(styles[style + '-' + pos + suffix]) || 0;\n }\n result.width = result.left + result.right;\n result.height = result.top + result.bottom;\n return result;\n}\nconst useOffsetPos = (x, y, target) => (x > 0 || y > 0) && (!target || !target.shadowRoot);\nfunction getCanvasPosition(e, canvas) {\n const touches = e.touches;\n const source = touches && touches.length ? touches[0] : e;\n const offsetX = source.offsetX,\n offsetY = source.offsetY;\n let box = false;\n let x, y;\n if (useOffsetPos(offsetX, offsetY, e.target)) {\n x = offsetX;\n y = offsetY;\n } else {\n const rect = canvas.getBoundingClientRect();\n x = source.clientX - rect.left;\n y = source.clientY - rect.top;\n box = true;\n }\n return {\n x,\n y,\n box\n };\n}\nfunction getRelativePosition(evt, chart) {\n if ('native' in evt) {\n return evt;\n }\n const canvas = chart.canvas,\n currentDevicePixelRatio = chart.currentDevicePixelRatio;\n const style = getComputedStyle(canvas);\n const borderBox = style.boxSizing === 'border-box';\n const paddings = getPositionedStyle(style, 'padding');\n const borders = getPositionedStyle(style, 'border', 'width');\n const _getCanvasPosition = getCanvasPosition(evt, canvas),\n x = _getCanvasPosition.x,\n y = _getCanvasPosition.y,\n box = _getCanvasPosition.box;\n const xOffset = paddings.left + (box && borders.left);\n const yOffset = paddings.top + (box && borders.top);\n let width = chart.width,\n height = chart.height;\n if (borderBox) {\n width -= paddings.width + borders.width;\n height -= paddings.height + borders.height;\n }\n return {\n x: Math.round((x - xOffset) / width * canvas.width / currentDevicePixelRatio),\n y: Math.round((y - yOffset) / height * canvas.height / currentDevicePixelRatio)\n };\n}\nfunction getContainerSize(canvas, width, height) {\n let maxWidth, maxHeight;\n if (width === undefined || height === undefined) {\n const container = _getParentNode(canvas);\n if (!container) {\n width = canvas.clientWidth;\n height = canvas.clientHeight;\n } else {\n const rect = container.getBoundingClientRect();\n const containerStyle = getComputedStyle(container);\n const containerBorder = getPositionedStyle(containerStyle, 'border', 'width');\n const containerPadding = getPositionedStyle(containerStyle, 'padding');\n width = rect.width - containerPadding.width - containerBorder.width;\n height = rect.height - containerPadding.height - containerBorder.height;\n maxWidth = parseMaxStyle(containerStyle.maxWidth, container, 'clientWidth');\n maxHeight = parseMaxStyle(containerStyle.maxHeight, container, 'clientHeight');\n }\n }\n return {\n width,\n height,\n maxWidth: maxWidth || INFINITY,\n maxHeight: maxHeight || INFINITY\n };\n}\nconst round1 = v => Math.round(v * 10) / 10;\nfunction getMaximumSize(canvas, bbWidth, bbHeight, aspectRatio) {\n const style = getComputedStyle(canvas);\n const margins = getPositionedStyle(style, 'margin');\n const maxWidth = parseMaxStyle(style.maxWidth, canvas, 'clientWidth') || INFINITY;\n const maxHeight = parseMaxStyle(style.maxHeight, canvas, 'clientHeight') || INFINITY;\n const containerSize = getContainerSize(canvas, bbWidth, bbHeight);\n let width = containerSize.width,\n height = containerSize.height;\n if (style.boxSizing === 'content-box') {\n const borders = getPositionedStyle(style, 'border', 'width');\n const paddings = getPositionedStyle(style, 'padding');\n width -= paddings.width + borders.width;\n height -= paddings.height + borders.height;\n }\n width = Math.max(0, width - margins.width);\n height = Math.max(0, aspectRatio ? Math.floor(width / aspectRatio) : height - margins.height);\n width = round1(Math.min(width, maxWidth, containerSize.maxWidth));\n height = round1(Math.min(height, maxHeight, containerSize.maxHeight));\n if (width && !height) {\n height = round1(width / 2);\n }\n return {\n width,\n height\n };\n}\nfunction retinaScale(chart, forceRatio, forceStyle) {\n const pixelRatio = forceRatio || 1;\n const deviceHeight = Math.floor(chart.height * pixelRatio);\n const deviceWidth = Math.floor(chart.width * pixelRatio);\n chart.height = deviceHeight / pixelRatio;\n chart.width = deviceWidth / pixelRatio;\n const canvas = chart.canvas;\n if (canvas.style && (forceStyle || !canvas.style.height && !canvas.style.width)) {\n canvas.style.height = `${chart.height}px`;\n canvas.style.width = `${chart.width}px`;\n }\n if (chart.currentDevicePixelRatio !== pixelRatio || canvas.height !== deviceHeight || canvas.width !== deviceWidth) {\n chart.currentDevicePixelRatio = pixelRatio;\n canvas.height = deviceHeight;\n canvas.width = deviceWidth;\n chart.ctx.setTransform(pixelRatio, 0, 0, pixelRatio, 0, 0);\n return true;\n }\n return false;\n}\nconst supportsEventListenerOptions = function () {\n let passiveSupported = false;\n try {\n const options = {\n get passive() {\n passiveSupported = true;\n return false;\n }\n };\n window.addEventListener('test', null, options);\n window.removeEventListener('test', null, options);\n } catch (e) {}\n return passiveSupported;\n}();\nfunction readUsedSize(element, property) {\n const value = getStyle(element, property);\n const matches = value && value.match(/^(\\d+)(\\.\\d+)?px$/);\n return matches ? +matches[1] : undefined;\n}\nfunction _pointInLine(p1, p2, t, mode) {\n return {\n x: p1.x + t * (p2.x - p1.x),\n y: p1.y + t * (p2.y - p1.y)\n };\n}\nfunction _steppedInterpolation(p1, p2, t, mode) {\n return {\n x: p1.x + t * (p2.x - p1.x),\n y: mode === 'middle' ? t < 0.5 ? p1.y : p2.y : mode === 'after' ? t < 1 ? p1.y : p2.y : t > 0 ? p2.y : p1.y\n };\n}\nfunction _bezierInterpolation(p1, p2, t, mode) {\n const cp1 = {\n x: p1.cp2x,\n y: p1.cp2y\n };\n const cp2 = {\n x: p2.cp1x,\n y: p2.cp1y\n };\n const a = _pointInLine(p1, cp1, t);\n const b = _pointInLine(cp1, cp2, t);\n const c = _pointInLine(cp2, p2, t);\n const d = _pointInLine(a, b, t);\n const e = _pointInLine(b, c, t);\n return _pointInLine(d, e, t);\n}\nconst intlCache = new Map();\nfunction getNumberFormat(locale, options) {\n options = options || {};\n const cacheKey = locale + JSON.stringify(options);\n let formatter = intlCache.get(cacheKey);\n if (!formatter) {\n formatter = new Intl.NumberFormat(locale, options);\n intlCache.set(cacheKey, formatter);\n }\n return formatter;\n}\nfunction formatNumber(num, locale, options) {\n return getNumberFormat(locale, options).format(num);\n}\nconst getRightToLeftAdapter = function (rectX, width) {\n return {\n x(x) {\n return rectX + rectX + width - x;\n },\n setWidth(w) {\n width = w;\n },\n textAlign(align) {\n if (align === 'center') {\n return align;\n }\n return align === 'right' ? 'left' : 'right';\n },\n xPlus(x, value) {\n return x - value;\n },\n leftForLtr(x, itemWidth) {\n return x - itemWidth;\n }\n };\n};\nconst getLeftToRightAdapter = function () {\n return {\n x(x) {\n return x;\n },\n setWidth(w) {},\n textAlign(align) {\n return align;\n },\n xPlus(x, value) {\n return x + value;\n },\n leftForLtr(x, _itemWidth) {\n return x;\n }\n };\n};\nfunction getRtlAdapter(rtl, rectX, width) {\n return rtl ? getRightToLeftAdapter(rectX, width) : getLeftToRightAdapter();\n}\nfunction overrideTextDirection(ctx, direction) {\n let style, original;\n if (direction === 'ltr' || direction === 'rtl') {\n style = ctx.canvas.style;\n original = [style.getPropertyValue('direction'), style.getPropertyPriority('direction')];\n style.setProperty('direction', direction, 'important');\n ctx.prevTextDirection = original;\n }\n}\nfunction restoreTextDirection(ctx, original) {\n if (original !== undefined) {\n delete ctx.prevTextDirection;\n ctx.canvas.style.setProperty('direction', original[0], original[1]);\n }\n}\nfunction propertyFn(property) {\n if (property === 'angle') {\n return {\n between: _angleBetween,\n compare: _angleDiff,\n normalize: _normalizeAngle\n };\n }\n return {\n between: _isBetween,\n compare: (a, b) => a - b,\n normalize: x => x\n };\n}\nfunction normalizeSegment(_ref) {\n let start = _ref.start,\n end = _ref.end,\n count = _ref.count,\n loop = _ref.loop,\n style = _ref.style;\n return {\n start: start % count,\n end: end % count,\n loop: loop && (end - start + 1) % count === 0,\n style\n };\n}\nfunction getSegment(segment, points, bounds) {\n const property = bounds.property,\n startBound = bounds.start,\n endBound = bounds.end;\n const _propertyFn = propertyFn(property),\n between = _propertyFn.between,\n normalize = _propertyFn.normalize;\n const count = points.length;\n let start = segment.start,\n end = segment.end,\n loop = segment.loop;\n let i, ilen;\n if (loop) {\n start += count;\n end += count;\n for (i = 0, ilen = count; i < ilen; ++i) {\n if (!between(normalize(points[start % count][property]), startBound, endBound)) {\n break;\n }\n start--;\n end--;\n }\n start %= count;\n end %= count;\n }\n if (end < start) {\n end += count;\n }\n return {\n start,\n end,\n loop,\n style: segment.style\n };\n}\nfunction _boundSegment(segment, points, bounds) {\n if (!bounds) {\n return [segment];\n }\n const property = bounds.property,\n startBound = bounds.start,\n endBound = bounds.end;\n const count = points.length;\n const _propertyFn2 = propertyFn(property),\n compare = _propertyFn2.compare,\n between = _propertyFn2.between,\n normalize = _propertyFn2.normalize;\n const _getSegment = getSegment(segment, points, bounds),\n start = _getSegment.start,\n end = _getSegment.end,\n loop = _getSegment.loop,\n style = _getSegment.style;\n const result = [];\n let inside = false;\n let subStart = null;\n let value, point, prevValue;\n const startIsBefore = () => between(startBound, prevValue, value) && compare(startBound, prevValue) !== 0;\n const endIsBefore = () => compare(endBound, value) === 0 || between(endBound, prevValue, value);\n const shouldStart = () => inside || startIsBefore();\n const shouldStop = () => !inside || endIsBefore();\n for (let i = start, prev = start; i <= end; ++i) {\n point = points[i % count];\n if (point.skip) {\n continue;\n }\n value = normalize(point[property]);\n if (value === prevValue) {\n continue;\n }\n inside = between(value, startBound, endBound);\n if (subStart === null && shouldStart()) {\n subStart = compare(value, startBound) === 0 ? i : prev;\n }\n if (subStart !== null && shouldStop()) {\n result.push(normalizeSegment({\n start: subStart,\n end: i,\n loop,\n count,\n style\n }));\n subStart = null;\n }\n prev = i;\n prevValue = value;\n }\n if (subStart !== null) {\n result.push(normalizeSegment({\n start: subStart,\n end,\n loop,\n count,\n style\n }));\n }\n return result;\n}\nfunction _boundSegments(line, bounds) {\n const result = [];\n const segments = line.segments;\n for (let i = 0; i < segments.length; i++) {\n const sub = _boundSegment(segments[i], line.points, bounds);\n if (sub.length) {\n result.push(...sub);\n }\n }\n return result;\n}\nfunction findStartAndEnd(points, count, loop, spanGaps) {\n let start = 0;\n let end = count - 1;\n if (loop && !spanGaps) {\n while (start < count && !points[start].skip) {\n start++;\n }\n }\n while (start < count && points[start].skip) {\n start++;\n }\n start %= count;\n if (loop) {\n end += start;\n }\n while (end > start && points[end % count].skip) {\n end--;\n }\n end %= count;\n return {\n start,\n end\n };\n}\nfunction solidSegments(points, start, max, loop) {\n const count = points.length;\n const result = [];\n let last = start;\n let prev = points[start];\n let end;\n for (end = start + 1; end <= max; ++end) {\n const cur = points[end % count];\n if (cur.skip || cur.stop) {\n if (!prev.skip) {\n loop = false;\n result.push({\n start: start % count,\n end: (end - 1) % count,\n loop\n });\n start = last = cur.stop ? end : null;\n }\n } else {\n last = end;\n if (prev.skip) {\n start = end;\n }\n }\n prev = cur;\n }\n if (last !== null) {\n result.push({\n start: start % count,\n end: last % count,\n loop\n });\n }\n return result;\n}\nfunction _computeSegments(line, segmentOptions) {\n const points = line.points;\n const spanGaps = line.options.spanGaps;\n const count = points.length;\n if (!count) {\n return [];\n }\n const loop = !!line._loop;\n const _findStartAndEnd = findStartAndEnd(points, count, loop, spanGaps),\n start = _findStartAndEnd.start,\n end = _findStartAndEnd.end;\n if (spanGaps === true) {\n return splitByStyles(line, [{\n start,\n end,\n loop\n }], points, segmentOptions);\n }\n const max = end < start ? end + count : end;\n const completeLoop = !!line._fullLoop && start === 0 && end === count - 1;\n return splitByStyles(line, solidSegments(points, start, max, completeLoop), points, segmentOptions);\n}\nfunction splitByStyles(line, segments, points, segmentOptions) {\n if (!segmentOptions || !segmentOptions.setContext || !points) {\n return segments;\n }\n return doSplitByStyles(line, segments, points, segmentOptions);\n}\nfunction doSplitByStyles(line, segments, points, segmentOptions) {\n const chartContext = line._chart.getContext();\n const baseStyle = readStyle(line.options);\n const datasetIndex = line._datasetIndex,\n spanGaps = line.options.spanGaps;\n const count = points.length;\n const result = [];\n let prevStyle = baseStyle;\n let start = segments[0].start;\n let i = start;\n function addStyle(s, e, l, st) {\n const dir = spanGaps ? -1 : 1;\n if (s === e) {\n return;\n }\n s += count;\n while (points[s % count].skip) {\n s -= dir;\n }\n while (points[e % count].skip) {\n e += dir;\n }\n if (s % count !== e % count) {\n result.push({\n start: s % count,\n end: e % count,\n loop: l,\n style: st\n });\n prevStyle = st;\n start = e % count;\n }\n }\n for (const segment of segments) {\n start = spanGaps ? start : segment.start;\n let prev = points[start % count];\n let style;\n for (i = start + 1; i <= segment.end; i++) {\n const pt = points[i % count];\n style = readStyle(segmentOptions.setContext(createContext(chartContext, {\n type: 'segment',\n p0: prev,\n p1: pt,\n p0DataIndex: (i - 1) % count,\n p1DataIndex: i % count,\n datasetIndex\n })));\n if (styleChanged(style, prevStyle)) {\n addStyle(start, i - 1, segment.loop, prevStyle);\n }\n prev = pt;\n prevStyle = style;\n }\n if (start < i - 1) {\n addStyle(start, i - 1, segment.loop, prevStyle);\n }\n }\n return result;\n}\nfunction readStyle(options) {\n return {\n backgroundColor: options.backgroundColor,\n borderCapStyle: options.borderCapStyle,\n borderDash: options.borderDash,\n borderDashOffset: options.borderDashOffset,\n borderJoinStyle: options.borderJoinStyle,\n borderWidth: options.borderWidth,\n borderColor: options.borderColor\n };\n}\nfunction styleChanged(style, prevStyle) {\n return prevStyle && JSON.stringify(style) !== JSON.stringify(prevStyle);\n}\nexport { _isPointInArea as $, _factorize as A, finiteOrDefault as B, callback as C, _addGrace as D, _limitValue as E, toDegrees as F, _measureText as G, HALF_PI as H, _int16Range as I, _alignPixel as J, toPadding as K, clipArea as L, renderText as M, unclipArea as N, toFont as O, PI as P, each as Q, _toLeftRightCenter as R, _alignStartEnd as S, TAU as T, overrides as U, merge as V, _capitalize as W, getRelativePosition as X, _rlookupByKey as Y, _lookupByKey as Z, _arrayUnique as _, resolve as a, toLineHeight as a$, getAngleFromPoint as a0, getMaximumSize as a1, _getParentNode as a2, readUsedSize as a3, throttled as a4, supportsEventListenerOptions as a5, _isDomSupported as a6, descriptors as a7, isFunction as a8, _attachContext as a9, getRtlAdapter as aA, overrideTextDirection as aB, _textX as aC, restoreTextDirection as aD, drawPointLegend as aE, noop as aF, distanceBetweenPoints as aG, _setMinAndMaxByKey as aH, niceNum as aI, almostWhole as aJ, almostEquals as aK, _decimalPlaces as aL, _longestText as aM, _filterBetween as aN, _lookup as aO, isPatternOrGradient as aP, getHoverColor as aQ, clone$1 as aR, _merger as aS, _mergerIf as aT, _deprecated as aU, _splitKey as aV, toFontString as aW, splineCurve as aX, splineCurveMonotone as aY, getStyle as aZ, fontString as a_, _createResolver as aa, _descriptors as ab, mergeIf as ac, uid as ad, debounce as ae, retinaScale as af, clearCanvas as ag, setsEqual as ah, _elementsEqual as ai, _isClickEvent as aj, _isBetween as ak, _readValueToProps as al, _updateBezierControlPoints as am, _computeSegments as an, _boundSegments as ao, _steppedInterpolation as ap, _bezierInterpolation as aq, _pointInLine as ar, _steppedLineTo as as, _bezierCurveTo as at, drawPoint as au, addRoundedRectPath as av, toTRBL as aw, toTRBLCorners as ax, _boundSegment as ay, _normalizeAngle as az, isArray as b, PITAU as b0, INFINITY as b1, RAD_PER_DEG as b2, QUARTER_PI as b3, TWO_THIRDS_PI as b4, _angleDiff as b5, color as c, defaults as d, effects as e, resolveObjectKey as f, isNumberFinite as g, createContext as h, isObject as i, defined as j, isNullOrUndef as k, listenArrayEvents as l, toPercentage as m, toDimension as n, formatNumber as o, _angleBetween as p, _getStartAndCountOfVisiblePoints as q, requestAnimFrame as r, sign as s, toRadians as t, unlistenArrayEvents as u, valueOrDefault as v, _scaleRangesChanged as w, isNumber as x, _parseObjectDataRadialScale as y, log10 as z };","function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); enumerableOnly && (symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; })), keys.push.apply(keys, symbols); } return keys; }\nfunction _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = null != arguments[i] ? arguments[i] : {}; i % 2 ? ownKeys(Object(source), !0).forEach(function (key) { _defineProperty(target, key, source[key]); }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } return target; }\nfunction _defineProperty(obj, key, value) { key = _toPropertyKey(key); if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }\nfunction _toPropertyKey(arg) { var key = _toPrimitive(arg, \"string\"); return typeof key === \"symbol\" ? key : String(key); }\nfunction _toPrimitive(input, hint) { if (typeof input !== \"object\" || input === null) return input; var prim = input[Symbol.toPrimitive]; if (prim !== undefined) { var res = prim.call(input, hint || \"default\"); if (typeof res !== \"object\") return res; throw new TypeError(\"@@toPrimitive must return a primitive value.\"); } return (hint === \"string\" ? String : Number)(input); }\nfunction _slicedToArray(arr, i) { return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest(); }\nfunction _nonIterableRest() { throw new TypeError(\"Invalid attempt to destructure non-iterable instance.\\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.\"); }\nfunction _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === \"string\") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === \"Object\" && o.constructor) n = o.constructor.name; if (n === \"Map\" || n === \"Set\") return Array.from(o); if (n === \"Arguments\" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); }\nfunction _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) arr2[i] = arr[i]; return arr2; }\nfunction _iterableToArrayLimit(arr, i) { var _i = null == arr ? null : \"undefined\" != typeof Symbol && arr[Symbol.iterator] || arr[\"@@iterator\"]; if (null != _i) { var _s, _e, _x, _r, _arr = [], _n = !0, _d = !1; try { if (_x = (_i = _i.call(arr)).next, 0 === i) { if (Object(_i) !== _i) return; _n = !1; } else for (; !(_n = (_s = _x.call(_i)).done) && (_arr.push(_s.value), _arr.length !== i); _n = !0); } catch (err) { _d = !0, _e = err; } finally { try { if (!_n && null != _i.return && (_r = _i.return(), Object(_r) !== _r)) return; } finally { if (_d) throw _e; } } return _arr; } }\nfunction _arrayWithHoles(arr) { if (Array.isArray(arr)) return arr; }\n/*!\n * Chart.js v3.9.1\n * https://www.chartjs.org\n * (c) 2022 Chart.js Contributors\n * Released under the MIT License\n */\nimport { r as requestAnimFrame, a as resolve, e as effects, c as color, d as defaults, i as isObject, b as isArray, v as valueOrDefault, u as unlistenArrayEvents, l as listenArrayEvents, f as resolveObjectKey, g as isNumberFinite, h as createContext, j as defined, s as sign, k as isNullOrUndef, _ as _arrayUnique, t as toRadians, m as toPercentage, n as toDimension, T as TAU, o as formatNumber, p as _angleBetween, H as HALF_PI, P as PI, q as _getStartAndCountOfVisiblePoints, w as _scaleRangesChanged, x as isNumber, y as _parseObjectDataRadialScale, z as log10, A as _factorize, B as finiteOrDefault, C as callback, D as _addGrace, E as _limitValue, F as toDegrees, G as _measureText, I as _int16Range, J as _alignPixel, K as toPadding, L as clipArea, M as renderText, N as unclipArea, O as toFont, Q as each, R as _toLeftRightCenter, S as _alignStartEnd, U as overrides, V as merge, W as _capitalize, X as getRelativePosition, Y as _rlookupByKey, Z as _lookupByKey, $ as _isPointInArea, a0 as getAngleFromPoint, a1 as getMaximumSize, a2 as _getParentNode, a3 as readUsedSize, a4 as throttled, a5 as supportsEventListenerOptions, a6 as _isDomSupported, a7 as descriptors, a8 as isFunction, a9 as _attachContext, aa as _createResolver, ab as _descriptors, ac as mergeIf, ad as uid, ae as debounce, af as retinaScale, ag as clearCanvas, ah as setsEqual, ai as _elementsEqual, aj as _isClickEvent, ak as _isBetween, al as _readValueToProps, am as _updateBezierControlPoints, an as _computeSegments, ao as _boundSegments, ap as _steppedInterpolation, aq as _bezierInterpolation, ar as _pointInLine, as as _steppedLineTo, at as _bezierCurveTo, au as drawPoint, av as addRoundedRectPath, aw as toTRBL, ax as toTRBLCorners, ay as _boundSegment, az as _normalizeAngle, aA as getRtlAdapter, aB as overrideTextDirection, aC as _textX, aD as restoreTextDirection, aE as drawPointLegend, aF as noop, aG as distanceBetweenPoints, aH as _setMinAndMaxByKey, aI as niceNum, aJ as almostWhole, aK as almostEquals, aL as _decimalPlaces, aM as _longestText, aN as _filterBetween, aO as _lookup } from './chunks/helpers.segment.mjs';\nexport { d as defaults } from './chunks/helpers.segment.mjs';\nclass Animator {\n constructor() {\n this._request = null;\n this._charts = new Map();\n this._running = false;\n this._lastDate = undefined;\n }\n _notify(chart, anims, date, type) {\n const callbacks = anims.listeners[type];\n const numSteps = anims.duration;\n callbacks.forEach(fn => fn({\n chart,\n initial: anims.initial,\n numSteps,\n currentStep: Math.min(date - anims.start, numSteps)\n }));\n }\n _refresh() {\n if (this._request) {\n return;\n }\n this._running = true;\n this._request = requestAnimFrame.call(window, () => {\n this._update();\n this._request = null;\n if (this._running) {\n this._refresh();\n }\n });\n }\n _update() {\n let date = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : Date.now();\n let remaining = 0;\n this._charts.forEach((anims, chart) => {\n if (!anims.running || !anims.items.length) {\n return;\n }\n const items = anims.items;\n let i = items.length - 1;\n let draw = false;\n let item;\n for (; i >= 0; --i) {\n item = items[i];\n if (item._active) {\n if (item._total > anims.duration) {\n anims.duration = item._total;\n }\n item.tick(date);\n draw = true;\n } else {\n items[i] = items[items.length - 1];\n items.pop();\n }\n }\n if (draw) {\n chart.draw();\n this._notify(chart, anims, date, 'progress');\n }\n if (!items.length) {\n anims.running = false;\n this._notify(chart, anims, date, 'complete');\n anims.initial = false;\n }\n remaining += items.length;\n });\n this._lastDate = date;\n if (remaining === 0) {\n this._running = false;\n }\n }\n _getAnims(chart) {\n const charts = this._charts;\n let anims = charts.get(chart);\n if (!anims) {\n anims = {\n running: false,\n initial: true,\n items: [],\n listeners: {\n complete: [],\n progress: []\n }\n };\n charts.set(chart, anims);\n }\n return anims;\n }\n listen(chart, event, cb) {\n this._getAnims(chart).listeners[event].push(cb);\n }\n add(chart, items) {\n if (!items || !items.length) {\n return;\n }\n this._getAnims(chart).items.push(...items);\n }\n has(chart) {\n return this._getAnims(chart).items.length > 0;\n }\n start(chart) {\n const anims = this._charts.get(chart);\n if (!anims) {\n return;\n }\n anims.running = true;\n anims.start = Date.now();\n anims.duration = anims.items.reduce((acc, cur) => Math.max(acc, cur._duration), 0);\n this._refresh();\n }\n running(chart) {\n if (!this._running) {\n return false;\n }\n const anims = this._charts.get(chart);\n if (!anims || !anims.running || !anims.items.length) {\n return false;\n }\n return true;\n }\n stop(chart) {\n const anims = this._charts.get(chart);\n if (!anims || !anims.items.length) {\n return;\n }\n const items = anims.items;\n let i = items.length - 1;\n for (; i >= 0; --i) {\n items[i].cancel();\n }\n anims.items = [];\n this._notify(chart, anims, Date.now(), 'complete');\n }\n remove(chart) {\n return this._charts.delete(chart);\n }\n}\nvar animator = new Animator();\nconst transparent = 'transparent';\nconst interpolators = {\n boolean(from, to, factor) {\n return factor > 0.5 ? to : from;\n },\n color(from, to, factor) {\n const c0 = color(from || transparent);\n const c1 = c0.valid && color(to || transparent);\n return c1 && c1.valid ? c1.mix(c0, factor).hexString() : to;\n },\n number(from, to, factor) {\n return from + (to - from) * factor;\n }\n};\nclass Animation {\n constructor(cfg, target, prop, to) {\n const currentValue = target[prop];\n to = resolve([cfg.to, to, currentValue, cfg.from]);\n const from = resolve([cfg.from, currentValue, to]);\n this._active = true;\n this._fn = cfg.fn || interpolators[cfg.type || typeof from];\n this._easing = effects[cfg.easing] || effects.linear;\n this._start = Math.floor(Date.now() + (cfg.delay || 0));\n this._duration = this._total = Math.floor(cfg.duration);\n this._loop = !!cfg.loop;\n this._target = target;\n this._prop = prop;\n this._from = from;\n this._to = to;\n this._promises = undefined;\n }\n active() {\n return this._active;\n }\n update(cfg, to, date) {\n if (this._active) {\n this._notify(false);\n const currentValue = this._target[this._prop];\n const elapsed = date - this._start;\n const remain = this._duration - elapsed;\n this._start = date;\n this._duration = Math.floor(Math.max(remain, cfg.duration));\n this._total += elapsed;\n this._loop = !!cfg.loop;\n this._to = resolve([cfg.to, to, currentValue, cfg.from]);\n this._from = resolve([cfg.from, currentValue, to]);\n }\n }\n cancel() {\n if (this._active) {\n this.tick(Date.now());\n this._active = false;\n this._notify(false);\n }\n }\n tick(date) {\n const elapsed = date - this._start;\n const duration = this._duration;\n const prop = this._prop;\n const from = this._from;\n const loop = this._loop;\n const to = this._to;\n let factor;\n this._active = from !== to && (loop || elapsed < duration);\n if (!this._active) {\n this._target[prop] = to;\n this._notify(true);\n return;\n }\n if (elapsed < 0) {\n this._target[prop] = from;\n return;\n }\n factor = elapsed / duration % 2;\n factor = loop && factor > 1 ? 2 - factor : factor;\n factor = this._easing(Math.min(1, Math.max(0, factor)));\n this._target[prop] = this._fn(from, to, factor);\n }\n wait() {\n const promises = this._promises || (this._promises = []);\n return new Promise((res, rej) => {\n promises.push({\n res,\n rej\n });\n });\n }\n _notify(resolved) {\n const method = resolved ? 'res' : 'rej';\n const promises = this._promises || [];\n for (let i = 0; i < promises.length; i++) {\n promises[i][method]();\n }\n }\n}\nconst numbers = ['x', 'y', 'borderWidth', 'radius', 'tension'];\nconst colors = ['color', 'borderColor', 'backgroundColor'];\ndefaults.set('animation', {\n delay: undefined,\n duration: 1000,\n easing: 'easeOutQuart',\n fn: undefined,\n from: undefined,\n loop: undefined,\n to: undefined,\n type: undefined\n});\nconst animationOptions = Object.keys(defaults.animation);\ndefaults.describe('animation', {\n _fallback: false,\n _indexable: false,\n _scriptable: name => name !== 'onProgress' && name !== 'onComplete' && name !== 'fn'\n});\ndefaults.set('animations', {\n colors: {\n type: 'color',\n properties: colors\n },\n numbers: {\n type: 'number',\n properties: numbers\n }\n});\ndefaults.describe('animations', {\n _fallback: 'animation'\n});\ndefaults.set('transitions', {\n active: {\n animation: {\n duration: 400\n }\n },\n resize: {\n animation: {\n duration: 0\n }\n },\n show: {\n animations: {\n colors: {\n from: 'transparent'\n },\n visible: {\n type: 'boolean',\n duration: 0\n }\n }\n },\n hide: {\n animations: {\n colors: {\n to: 'transparent'\n },\n visible: {\n type: 'boolean',\n easing: 'linear',\n fn: v => v | 0\n }\n }\n }\n});\nclass Animations {\n constructor(chart, config) {\n this._chart = chart;\n this._properties = new Map();\n this.configure(config);\n }\n configure(config) {\n if (!isObject(config)) {\n return;\n }\n const animatedProps = this._properties;\n Object.getOwnPropertyNames(config).forEach(key => {\n const cfg = config[key];\n if (!isObject(cfg)) {\n return;\n }\n const resolved = {};\n for (const option of animationOptions) {\n resolved[option] = cfg[option];\n }\n (isArray(cfg.properties) && cfg.properties || [key]).forEach(prop => {\n if (prop === key || !animatedProps.has(prop)) {\n animatedProps.set(prop, resolved);\n }\n });\n });\n }\n _animateOptions(target, values) {\n const newOptions = values.options;\n const options = resolveTargetOptions(target, newOptions);\n if (!options) {\n return [];\n }\n const animations = this._createAnimations(options, newOptions);\n if (newOptions.$shared) {\n awaitAll(target.options.$animations, newOptions).then(() => {\n target.options = newOptions;\n }, () => {});\n }\n return animations;\n }\n _createAnimations(target, values) {\n const animatedProps = this._properties;\n const animations = [];\n const running = target.$animations || (target.$animations = {});\n const props = Object.keys(values);\n const date = Date.now();\n let i;\n for (i = props.length - 1; i >= 0; --i) {\n const prop = props[i];\n if (prop.charAt(0) === '$') {\n continue;\n }\n if (prop === 'options') {\n animations.push(...this._animateOptions(target, values));\n continue;\n }\n const value = values[prop];\n let animation = running[prop];\n const cfg = animatedProps.get(prop);\n if (animation) {\n if (cfg && animation.active()) {\n animation.update(cfg, value, date);\n continue;\n } else {\n animation.cancel();\n }\n }\n if (!cfg || !cfg.duration) {\n target[prop] = value;\n continue;\n }\n running[prop] = animation = new Animation(cfg, target, prop, value);\n animations.push(animation);\n }\n return animations;\n }\n update(target, values) {\n if (this._properties.size === 0) {\n Object.assign(target, values);\n return;\n }\n const animations = this._createAnimations(target, values);\n if (animations.length) {\n animator.add(this._chart, animations);\n return true;\n }\n }\n}\nfunction awaitAll(animations, properties) {\n const running = [];\n const keys = Object.keys(properties);\n for (let i = 0; i < keys.length; i++) {\n const anim = animations[keys[i]];\n if (anim && anim.active()) {\n running.push(anim.wait());\n }\n }\n return Promise.all(running);\n}\nfunction resolveTargetOptions(target, newOptions) {\n if (!newOptions) {\n return;\n }\n let options = target.options;\n if (!options) {\n target.options = newOptions;\n return;\n }\n if (options.$shared) {\n target.options = options = Object.assign({}, options, {\n $shared: false,\n $animations: {}\n });\n }\n return options;\n}\nfunction scaleClip(scale, allowedOverflow) {\n const opts = scale && scale.options || {};\n const reverse = opts.reverse;\n const min = opts.min === undefined ? allowedOverflow : 0;\n const max = opts.max === undefined ? allowedOverflow : 0;\n return {\n start: reverse ? max : min,\n end: reverse ? min : max\n };\n}\nfunction defaultClip(xScale, yScale, allowedOverflow) {\n if (allowedOverflow === false) {\n return false;\n }\n const x = scaleClip(xScale, allowedOverflow);\n const y = scaleClip(yScale, allowedOverflow);\n return {\n top: y.end,\n right: x.end,\n bottom: y.start,\n left: x.start\n };\n}\nfunction toClip(value) {\n let t, r, b, l;\n if (isObject(value)) {\n t = value.top;\n r = value.right;\n b = value.bottom;\n l = value.left;\n } else {\n t = r = b = l = value;\n }\n return {\n top: t,\n right: r,\n bottom: b,\n left: l,\n disabled: value === false\n };\n}\nfunction getSortedDatasetIndices(chart, filterVisible) {\n const keys = [];\n const metasets = chart._getSortedDatasetMetas(filterVisible);\n let i, ilen;\n for (i = 0, ilen = metasets.length; i < ilen; ++i) {\n keys.push(metasets[i].index);\n }\n return keys;\n}\nfunction applyStack(stack, value, dsIndex) {\n let options = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : {};\n const keys = stack.keys;\n const singleMode = options.mode === 'single';\n let i, ilen, datasetIndex, otherValue;\n if (value === null) {\n return;\n }\n for (i = 0, ilen = keys.length; i < ilen; ++i) {\n datasetIndex = +keys[i];\n if (datasetIndex === dsIndex) {\n if (options.all) {\n continue;\n }\n break;\n }\n otherValue = stack.values[datasetIndex];\n if (isNumberFinite(otherValue) && (singleMode || value === 0 || sign(value) === sign(otherValue))) {\n value += otherValue;\n }\n }\n return value;\n}\nfunction convertObjectDataToArray(data) {\n const keys = Object.keys(data);\n const adata = new Array(keys.length);\n let i, ilen, key;\n for (i = 0, ilen = keys.length; i < ilen; ++i) {\n key = keys[i];\n adata[i] = {\n x: key,\n y: data[key]\n };\n }\n return adata;\n}\nfunction isStacked(scale, meta) {\n const stacked = scale && scale.options.stacked;\n return stacked || stacked === undefined && meta.stack !== undefined;\n}\nfunction getStackKey(indexScale, valueScale, meta) {\n return `${indexScale.id}.${valueScale.id}.${meta.stack || meta.type}`;\n}\nfunction getUserBounds(scale) {\n const _scale$getUserBounds = scale.getUserBounds(),\n min = _scale$getUserBounds.min,\n max = _scale$getUserBounds.max,\n minDefined = _scale$getUserBounds.minDefined,\n maxDefined = _scale$getUserBounds.maxDefined;\n return {\n min: minDefined ? min : Number.NEGATIVE_INFINITY,\n max: maxDefined ? max : Number.POSITIVE_INFINITY\n };\n}\nfunction getOrCreateStack(stacks, stackKey, indexValue) {\n const subStack = stacks[stackKey] || (stacks[stackKey] = {});\n return subStack[indexValue] || (subStack[indexValue] = {});\n}\nfunction getLastIndexInStack(stack, vScale, positive, type) {\n for (const meta of vScale.getMatchingVisibleMetas(type).reverse()) {\n const value = stack[meta.index];\n if (positive && value > 0 || !positive && value < 0) {\n return meta.index;\n }\n }\n return null;\n}\nfunction updateStacks(controller, parsed) {\n const chart = controller.chart,\n meta = controller._cachedMeta;\n const stacks = chart._stacks || (chart._stacks = {});\n const iScale = meta.iScale,\n vScale = meta.vScale,\n datasetIndex = meta.index;\n const iAxis = iScale.axis;\n const vAxis = vScale.axis;\n const key = getStackKey(iScale, vScale, meta);\n const ilen = parsed.length;\n let stack;\n for (let i = 0; i < ilen; ++i) {\n const item = parsed[i];\n const index = item[iAxis],\n value = item[vAxis];\n const itemStacks = item._stacks || (item._stacks = {});\n stack = itemStacks[vAxis] = getOrCreateStack(stacks, key, index);\n stack[datasetIndex] = value;\n stack._top = getLastIndexInStack(stack, vScale, true, meta.type);\n stack._bottom = getLastIndexInStack(stack, vScale, false, meta.type);\n }\n}\nfunction getFirstScaleId(chart, axis) {\n const scales = chart.scales;\n return Object.keys(scales).filter(key => scales[key].axis === axis).shift();\n}\nfunction createDatasetContext(parent, index) {\n return createContext(parent, {\n active: false,\n dataset: undefined,\n datasetIndex: index,\n index,\n mode: 'default',\n type: 'dataset'\n });\n}\nfunction createDataContext(parent, index, element) {\n return createContext(parent, {\n active: false,\n dataIndex: index,\n parsed: undefined,\n raw: undefined,\n element,\n index,\n mode: 'default',\n type: 'data'\n });\n}\nfunction clearStacks(meta, items) {\n const datasetIndex = meta.controller.index;\n const axis = meta.vScale && meta.vScale.axis;\n if (!axis) {\n return;\n }\n items = items || meta._parsed;\n for (const parsed of items) {\n const stacks = parsed._stacks;\n if (!stacks || stacks[axis] === undefined || stacks[axis][datasetIndex] === undefined) {\n return;\n }\n delete stacks[axis][datasetIndex];\n }\n}\nconst isDirectUpdateMode = mode => mode === 'reset' || mode === 'none';\nconst cloneIfNotShared = (cached, shared) => shared ? cached : Object.assign({}, cached);\nconst createStack = (canStack, meta, chart) => canStack && !meta.hidden && meta._stacked && {\n keys: getSortedDatasetIndices(chart, true),\n values: null\n};\nclass DatasetController {\n constructor(chart, datasetIndex) {\n this.chart = chart;\n this._ctx = chart.ctx;\n this.index = datasetIndex;\n this._cachedDataOpts = {};\n this._cachedMeta = this.getMeta();\n this._type = this._cachedMeta.type;\n this.options = undefined;\n this._parsing = false;\n this._data = undefined;\n this._objectData = undefined;\n this._sharedOptions = undefined;\n this._drawStart = undefined;\n this._drawCount = undefined;\n this.enableOptionSharing = false;\n this.supportsDecimation = false;\n this.$context = undefined;\n this._syncList = [];\n this.initialize();\n }\n initialize() {\n const meta = this._cachedMeta;\n this.configure();\n this.linkScales();\n meta._stacked = isStacked(meta.vScale, meta);\n this.addElements();\n }\n updateIndex(datasetIndex) {\n if (this.index !== datasetIndex) {\n clearStacks(this._cachedMeta);\n }\n this.index = datasetIndex;\n }\n linkScales() {\n const chart = this.chart;\n const meta = this._cachedMeta;\n const dataset = this.getDataset();\n const chooseId = (axis, x, y, r) => axis === 'x' ? x : axis === 'r' ? r : y;\n const xid = meta.xAxisID = valueOrDefault(dataset.xAxisID, getFirstScaleId(chart, 'x'));\n const yid = meta.yAxisID = valueOrDefault(dataset.yAxisID, getFirstScaleId(chart, 'y'));\n const rid = meta.rAxisID = valueOrDefault(dataset.rAxisID, getFirstScaleId(chart, 'r'));\n const indexAxis = meta.indexAxis;\n const iid = meta.iAxisID = chooseId(indexAxis, xid, yid, rid);\n const vid = meta.vAxisID = chooseId(indexAxis, yid, xid, rid);\n meta.xScale = this.getScaleForId(xid);\n meta.yScale = this.getScaleForId(yid);\n meta.rScale = this.getScaleForId(rid);\n meta.iScale = this.getScaleForId(iid);\n meta.vScale = this.getScaleForId(vid);\n }\n getDataset() {\n return this.chart.data.datasets[this.index];\n }\n getMeta() {\n return this.chart.getDatasetMeta(this.index);\n }\n getScaleForId(scaleID) {\n return this.chart.scales[scaleID];\n }\n _getOtherScale(scale) {\n const meta = this._cachedMeta;\n return scale === meta.iScale ? meta.vScale : meta.iScale;\n }\n reset() {\n this._update('reset');\n }\n _destroy() {\n const meta = this._cachedMeta;\n if (this._data) {\n unlistenArrayEvents(this._data, this);\n }\n if (meta._stacked) {\n clearStacks(meta);\n }\n }\n _dataCheck() {\n const dataset = this.getDataset();\n const data = dataset.data || (dataset.data = []);\n const _data = this._data;\n if (isObject(data)) {\n this._data = convertObjectDataToArray(data);\n } else if (_data !== data) {\n if (_data) {\n unlistenArrayEvents(_data, this);\n const meta = this._cachedMeta;\n clearStacks(meta);\n meta._parsed = [];\n }\n if (data && Object.isExtensible(data)) {\n listenArrayEvents(data, this);\n }\n this._syncList = [];\n this._data = data;\n }\n }\n addElements() {\n const meta = this._cachedMeta;\n this._dataCheck();\n if (this.datasetElementType) {\n meta.dataset = new this.datasetElementType();\n }\n }\n buildOrUpdateElements(resetNewElements) {\n const meta = this._cachedMeta;\n const dataset = this.getDataset();\n let stackChanged = false;\n this._dataCheck();\n const oldStacked = meta._stacked;\n meta._stacked = isStacked(meta.vScale, meta);\n if (meta.stack !== dataset.stack) {\n stackChanged = true;\n clearStacks(meta);\n meta.stack = dataset.stack;\n }\n this._resyncElements(resetNewElements);\n if (stackChanged || oldStacked !== meta._stacked) {\n updateStacks(this, meta._parsed);\n }\n }\n configure() {\n const config = this.chart.config;\n const scopeKeys = config.datasetScopeKeys(this._type);\n const scopes = config.getOptionScopes(this.getDataset(), scopeKeys, true);\n this.options = config.createResolver(scopes, this.getContext());\n this._parsing = this.options.parsing;\n this._cachedDataOpts = {};\n }\n parse(start, count) {\n const meta = this._cachedMeta,\n data = this._data;\n const iScale = meta.iScale,\n _stacked = meta._stacked;\n const iAxis = iScale.axis;\n let sorted = start === 0 && count === data.length ? true : meta._sorted;\n let prev = start > 0 && meta._parsed[start - 1];\n let i, cur, parsed;\n if (this._parsing === false) {\n meta._parsed = data;\n meta._sorted = true;\n parsed = data;\n } else {\n if (isArray(data[start])) {\n parsed = this.parseArrayData(meta, data, start, count);\n } else if (isObject(data[start])) {\n parsed = this.parseObjectData(meta, data, start, count);\n } else {\n parsed = this.parsePrimitiveData(meta, data, start, count);\n }\n const isNotInOrderComparedToPrev = () => cur[iAxis] === null || prev && cur[iAxis] < prev[iAxis];\n for (i = 0; i < count; ++i) {\n meta._parsed[i + start] = cur = parsed[i];\n if (sorted) {\n if (isNotInOrderComparedToPrev()) {\n sorted = false;\n }\n prev = cur;\n }\n }\n meta._sorted = sorted;\n }\n if (_stacked) {\n updateStacks(this, parsed);\n }\n }\n parsePrimitiveData(meta, data, start, count) {\n const iScale = meta.iScale,\n vScale = meta.vScale;\n const iAxis = iScale.axis;\n const vAxis = vScale.axis;\n const labels = iScale.getLabels();\n const singleScale = iScale === vScale;\n const parsed = new Array(count);\n let i, ilen, index;\n for (i = 0, ilen = count; i < ilen; ++i) {\n index = i + start;\n parsed[i] = {\n [iAxis]: singleScale || iScale.parse(labels[index], index),\n [vAxis]: vScale.parse(data[index], index)\n };\n }\n return parsed;\n }\n parseArrayData(meta, data, start, count) {\n const xScale = meta.xScale,\n yScale = meta.yScale;\n const parsed = new Array(count);\n let i, ilen, index, item;\n for (i = 0, ilen = count; i < ilen; ++i) {\n index = i + start;\n item = data[index];\n parsed[i] = {\n x: xScale.parse(item[0], index),\n y: yScale.parse(item[1], index)\n };\n }\n return parsed;\n }\n parseObjectData(meta, data, start, count) {\n const xScale = meta.xScale,\n yScale = meta.yScale;\n const _this$_parsing = this._parsing,\n _this$_parsing$xAxisK = _this$_parsing.xAxisKey,\n xAxisKey = _this$_parsing$xAxisK === void 0 ? 'x' : _this$_parsing$xAxisK,\n _this$_parsing$yAxisK = _this$_parsing.yAxisKey,\n yAxisKey = _this$_parsing$yAxisK === void 0 ? 'y' : _this$_parsing$yAxisK;\n const parsed = new Array(count);\n let i, ilen, index, item;\n for (i = 0, ilen = count; i < ilen; ++i) {\n index = i + start;\n item = data[index];\n parsed[i] = {\n x: xScale.parse(resolveObjectKey(item, xAxisKey), index),\n y: yScale.parse(resolveObjectKey(item, yAxisKey), index)\n };\n }\n return parsed;\n }\n getParsed(index) {\n return this._cachedMeta._parsed[index];\n }\n getDataElement(index) {\n return this._cachedMeta.data[index];\n }\n applyStack(scale, parsed, mode) {\n const chart = this.chart;\n const meta = this._cachedMeta;\n const value = parsed[scale.axis];\n const stack = {\n keys: getSortedDatasetIndices(chart, true),\n values: parsed._stacks[scale.axis]\n };\n return applyStack(stack, value, meta.index, {\n mode\n });\n }\n updateRangeFromParsed(range, scale, parsed, stack) {\n const parsedValue = parsed[scale.axis];\n let value = parsedValue === null ? NaN : parsedValue;\n const values = stack && parsed._stacks[scale.axis];\n if (stack && values) {\n stack.values = values;\n value = applyStack(stack, parsedValue, this._cachedMeta.index);\n }\n range.min = Math.min(range.min, value);\n range.max = Math.max(range.max, value);\n }\n getMinMax(scale, canStack) {\n const meta = this._cachedMeta;\n const _parsed = meta._parsed;\n const sorted = meta._sorted && scale === meta.iScale;\n const ilen = _parsed.length;\n const otherScale = this._getOtherScale(scale);\n const stack = createStack(canStack, meta, this.chart);\n const range = {\n min: Number.POSITIVE_INFINITY,\n max: Number.NEGATIVE_INFINITY\n };\n const _getUserBounds = getUserBounds(otherScale),\n otherMin = _getUserBounds.min,\n otherMax = _getUserBounds.max;\n let i, parsed;\n function _skip() {\n parsed = _parsed[i];\n const otherValue = parsed[otherScale.axis];\n return !isNumberFinite(parsed[scale.axis]) || otherMin > otherValue || otherMax < otherValue;\n }\n for (i = 0; i < ilen; ++i) {\n if (_skip()) {\n continue;\n }\n this.updateRangeFromParsed(range, scale, parsed, stack);\n if (sorted) {\n break;\n }\n }\n if (sorted) {\n for (i = ilen - 1; i >= 0; --i) {\n if (_skip()) {\n continue;\n }\n this.updateRangeFromParsed(range, scale, parsed, stack);\n break;\n }\n }\n return range;\n }\n getAllParsedValues(scale) {\n const parsed = this._cachedMeta._parsed;\n const values = [];\n let i, ilen, value;\n for (i = 0, ilen = parsed.length; i < ilen; ++i) {\n value = parsed[i][scale.axis];\n if (isNumberFinite(value)) {\n values.push(value);\n }\n }\n return values;\n }\n getMaxOverflow() {\n return false;\n }\n getLabelAndValue(index) {\n const meta = this._cachedMeta;\n const iScale = meta.iScale;\n const vScale = meta.vScale;\n const parsed = this.getParsed(index);\n return {\n label: iScale ? '' + iScale.getLabelForValue(parsed[iScale.axis]) : '',\n value: vScale ? '' + vScale.getLabelForValue(parsed[vScale.axis]) : ''\n };\n }\n _update(mode) {\n const meta = this._cachedMeta;\n this.update(mode || 'default');\n meta._clip = toClip(valueOrDefault(this.options.clip, defaultClip(meta.xScale, meta.yScale, this.getMaxOverflow())));\n }\n update(mode) {}\n draw() {\n const ctx = this._ctx;\n const chart = this.chart;\n const meta = this._cachedMeta;\n const elements = meta.data || [];\n const area = chart.chartArea;\n const active = [];\n const start = this._drawStart || 0;\n const count = this._drawCount || elements.length - start;\n const drawActiveElementsOnTop = this.options.drawActiveElementsOnTop;\n let i;\n if (meta.dataset) {\n meta.dataset.draw(ctx, area, start, count);\n }\n for (i = start; i < start + count; ++i) {\n const element = elements[i];\n if (element.hidden) {\n continue;\n }\n if (element.active && drawActiveElementsOnTop) {\n active.push(element);\n } else {\n element.draw(ctx, area);\n }\n }\n for (i = 0; i < active.length; ++i) {\n active[i].draw(ctx, area);\n }\n }\n getStyle(index, active) {\n const mode = active ? 'active' : 'default';\n return index === undefined && this._cachedMeta.dataset ? this.resolveDatasetElementOptions(mode) : this.resolveDataElementOptions(index || 0, mode);\n }\n getContext(index, active, mode) {\n const dataset = this.getDataset();\n let context;\n if (index >= 0 && index < this._cachedMeta.data.length) {\n const element = this._cachedMeta.data[index];\n context = element.$context || (element.$context = createDataContext(this.getContext(), index, element));\n context.parsed = this.getParsed(index);\n context.raw = dataset.data[index];\n context.index = context.dataIndex = index;\n } else {\n context = this.$context || (this.$context = createDatasetContext(this.chart.getContext(), this.index));\n context.dataset = dataset;\n context.index = context.datasetIndex = this.index;\n }\n context.active = !!active;\n context.mode = mode;\n return context;\n }\n resolveDatasetElementOptions(mode) {\n return this._resolveElementOptions(this.datasetElementType.id, mode);\n }\n resolveDataElementOptions(index, mode) {\n return this._resolveElementOptions(this.dataElementType.id, mode, index);\n }\n _resolveElementOptions(elementType) {\n let mode = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'default';\n let index = arguments.length > 2 ? arguments[2] : undefined;\n const active = mode === 'active';\n const cache = this._cachedDataOpts;\n const cacheKey = elementType + '-' + mode;\n const cached = cache[cacheKey];\n const sharing = this.enableOptionSharing && defined(index);\n if (cached) {\n return cloneIfNotShared(cached, sharing);\n }\n const config = this.chart.config;\n const scopeKeys = config.datasetElementScopeKeys(this._type, elementType);\n const prefixes = active ? [`${elementType}Hover`, 'hover', elementType, ''] : [elementType, ''];\n const scopes = config.getOptionScopes(this.getDataset(), scopeKeys);\n const names = Object.keys(defaults.elements[elementType]);\n const context = () => this.getContext(index, active);\n const values = config.resolveNamedOptions(scopes, names, context, prefixes);\n if (values.$shared) {\n values.$shared = sharing;\n cache[cacheKey] = Object.freeze(cloneIfNotShared(values, sharing));\n }\n return values;\n }\n _resolveAnimations(index, transition, active) {\n const chart = this.chart;\n const cache = this._cachedDataOpts;\n const cacheKey = `animation-${transition}`;\n const cached = cache[cacheKey];\n if (cached) {\n return cached;\n }\n let options;\n if (chart.options.animation !== false) {\n const config = this.chart.config;\n const scopeKeys = config.datasetAnimationScopeKeys(this._type, transition);\n const scopes = config.getOptionScopes(this.getDataset(), scopeKeys);\n options = config.createResolver(scopes, this.getContext(index, active, transition));\n }\n const animations = new Animations(chart, options && options.animations);\n if (options && options._cacheable) {\n cache[cacheKey] = Object.freeze(animations);\n }\n return animations;\n }\n getSharedOptions(options) {\n if (!options.$shared) {\n return;\n }\n return this._sharedOptions || (this._sharedOptions = Object.assign({}, options));\n }\n includeOptions(mode, sharedOptions) {\n return !sharedOptions || isDirectUpdateMode(mode) || this.chart._animationsDisabled;\n }\n _getSharedOptions(start, mode) {\n const firstOpts = this.resolveDataElementOptions(start, mode);\n const previouslySharedOptions = this._sharedOptions;\n const sharedOptions = this.getSharedOptions(firstOpts);\n const includeOptions = this.includeOptions(mode, sharedOptions) || sharedOptions !== previouslySharedOptions;\n this.updateSharedOptions(sharedOptions, mode, firstOpts);\n return {\n sharedOptions,\n includeOptions\n };\n }\n updateElement(element, index, properties, mode) {\n if (isDirectUpdateMode(mode)) {\n Object.assign(element, properties);\n } else {\n this._resolveAnimations(index, mode).update(element, properties);\n }\n }\n updateSharedOptions(sharedOptions, mode, newOptions) {\n if (sharedOptions && !isDirectUpdateMode(mode)) {\n this._resolveAnimations(undefined, mode).update(sharedOptions, newOptions);\n }\n }\n _setStyle(element, index, mode, active) {\n element.active = active;\n const options = this.getStyle(index, active);\n this._resolveAnimations(index, mode, active).update(element, {\n options: !active && this.getSharedOptions(options) || options\n });\n }\n removeHoverStyle(element, datasetIndex, index) {\n this._setStyle(element, index, 'active', false);\n }\n setHoverStyle(element, datasetIndex, index) {\n this._setStyle(element, index, 'active', true);\n }\n _removeDatasetHoverStyle() {\n const element = this._cachedMeta.dataset;\n if (element) {\n this._setStyle(element, undefined, 'active', false);\n }\n }\n _setDatasetHoverStyle() {\n const element = this._cachedMeta.dataset;\n if (element) {\n this._setStyle(element, undefined, 'active', true);\n }\n }\n _resyncElements(resetNewElements) {\n const data = this._data;\n const elements = this._cachedMeta.data;\n for (const _ref of this._syncList) {\n var _ref2 = _slicedToArray(_ref, 3);\n const method = _ref2[0];\n const arg1 = _ref2[1];\n const arg2 = _ref2[2];\n this[method](arg1, arg2);\n }\n this._syncList = [];\n const numMeta = elements.length;\n const numData = data.length;\n const count = Math.min(numData, numMeta);\n if (count) {\n this.parse(0, count);\n }\n if (numData > numMeta) {\n this._insertElements(numMeta, numData - numMeta, resetNewElements);\n } else if (numData < numMeta) {\n this._removeElements(numData, numMeta - numData);\n }\n }\n _insertElements(start, count) {\n let resetNewElements = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : true;\n const meta = this._cachedMeta;\n const data = meta.data;\n const end = start + count;\n let i;\n const move = arr => {\n arr.length += count;\n for (i = arr.length - 1; i >= end; i--) {\n arr[i] = arr[i - count];\n }\n };\n move(data);\n for (i = start; i < end; ++i) {\n data[i] = new this.dataElementType();\n }\n if (this._parsing) {\n move(meta._parsed);\n }\n this.parse(start, count);\n if (resetNewElements) {\n this.updateElements(data, start, count, 'reset');\n }\n }\n updateElements(element, start, count, mode) {}\n _removeElements(start, count) {\n const meta = this._cachedMeta;\n if (this._parsing) {\n const removed = meta._parsed.splice(start, count);\n if (meta._stacked) {\n clearStacks(meta, removed);\n }\n }\n meta.data.splice(start, count);\n }\n _sync(args) {\n if (this._parsing) {\n this._syncList.push(args);\n } else {\n const _args2 = _slicedToArray(args, 3),\n method = _args2[0],\n arg1 = _args2[1],\n arg2 = _args2[2];\n this[method](arg1, arg2);\n }\n this.chart._dataChanges.push([this.index, ...args]);\n }\n _onDataPush() {\n const count = arguments.length;\n this._sync(['_insertElements', this.getDataset().data.length - count, count]);\n }\n _onDataPop() {\n this._sync(['_removeElements', this._cachedMeta.data.length - 1, 1]);\n }\n _onDataShift() {\n this._sync(['_removeElements', 0, 1]);\n }\n _onDataSplice(start, count) {\n if (count) {\n this._sync(['_removeElements', start, count]);\n }\n const newCount = arguments.length - 2;\n if (newCount) {\n this._sync(['_insertElements', start, newCount]);\n }\n }\n _onDataUnshift() {\n this._sync(['_insertElements', 0, arguments.length]);\n }\n}\nDatasetController.defaults = {};\nDatasetController.prototype.datasetElementType = null;\nDatasetController.prototype.dataElementType = null;\nfunction getAllScaleValues(scale, type) {\n if (!scale._cache.$bar) {\n const visibleMetas = scale.getMatchingVisibleMetas(type);\n let values = [];\n for (let i = 0, ilen = visibleMetas.length; i < ilen; i++) {\n values = values.concat(visibleMetas[i].controller.getAllParsedValues(scale));\n }\n scale._cache.$bar = _arrayUnique(values.sort((a, b) => a - b));\n }\n return scale._cache.$bar;\n}\nfunction computeMinSampleSize(meta) {\n const scale = meta.iScale;\n const values = getAllScaleValues(scale, meta.type);\n let min = scale._length;\n let i, ilen, curr, prev;\n const updateMinAndPrev = () => {\n if (curr === 32767 || curr === -32768) {\n return;\n }\n if (defined(prev)) {\n min = Math.min(min, Math.abs(curr - prev) || min);\n }\n prev = curr;\n };\n for (i = 0, ilen = values.length; i < ilen; ++i) {\n curr = scale.getPixelForValue(values[i]);\n updateMinAndPrev();\n }\n prev = undefined;\n for (i = 0, ilen = scale.ticks.length; i < ilen; ++i) {\n curr = scale.getPixelForTick(i);\n updateMinAndPrev();\n }\n return min;\n}\nfunction computeFitCategoryTraits(index, ruler, options, stackCount) {\n const thickness = options.barThickness;\n let size, ratio;\n if (isNullOrUndef(thickness)) {\n size = ruler.min * options.categoryPercentage;\n ratio = options.barPercentage;\n } else {\n size = thickness * stackCount;\n ratio = 1;\n }\n return {\n chunk: size / stackCount,\n ratio,\n start: ruler.pixels[index] - size / 2\n };\n}\nfunction computeFlexCategoryTraits(index, ruler, options, stackCount) {\n const pixels = ruler.pixels;\n const curr = pixels[index];\n let prev = index > 0 ? pixels[index - 1] : null;\n let next = index < pixels.length - 1 ? pixels[index + 1] : null;\n const percent = options.categoryPercentage;\n if (prev === null) {\n prev = curr - (next === null ? ruler.end - ruler.start : next - curr);\n }\n if (next === null) {\n next = curr + curr - prev;\n }\n const start = curr - (curr - Math.min(prev, next)) / 2 * percent;\n const size = Math.abs(next - prev) / 2 * percent;\n return {\n chunk: size / stackCount,\n ratio: options.barPercentage,\n start\n };\n}\nfunction parseFloatBar(entry, item, vScale, i) {\n const startValue = vScale.parse(entry[0], i);\n const endValue = vScale.parse(entry[1], i);\n const min = Math.min(startValue, endValue);\n const max = Math.max(startValue, endValue);\n let barStart = min;\n let barEnd = max;\n if (Math.abs(min) > Math.abs(max)) {\n barStart = max;\n barEnd = min;\n }\n item[vScale.axis] = barEnd;\n item._custom = {\n barStart,\n barEnd,\n start: startValue,\n end: endValue,\n min,\n max\n };\n}\nfunction parseValue(entry, item, vScale, i) {\n if (isArray(entry)) {\n parseFloatBar(entry, item, vScale, i);\n } else {\n item[vScale.axis] = vScale.parse(entry, i);\n }\n return item;\n}\nfunction parseArrayOrPrimitive(meta, data, start, count) {\n const iScale = meta.iScale;\n const vScale = meta.vScale;\n const labels = iScale.getLabels();\n const singleScale = iScale === vScale;\n const parsed = [];\n let i, ilen, item, entry;\n for (i = start, ilen = start + count; i < ilen; ++i) {\n entry = data[i];\n item = {};\n item[iScale.axis] = singleScale || iScale.parse(labels[i], i);\n parsed.push(parseValue(entry, item, vScale, i));\n }\n return parsed;\n}\nfunction isFloatBar(custom) {\n return custom && custom.barStart !== undefined && custom.barEnd !== undefined;\n}\nfunction barSign(size, vScale, actualBase) {\n if (size !== 0) {\n return sign(size);\n }\n return (vScale.isHorizontal() ? 1 : -1) * (vScale.min >= actualBase ? 1 : -1);\n}\nfunction borderProps(properties) {\n let reverse, start, end, top, bottom;\n if (properties.horizontal) {\n reverse = properties.base > properties.x;\n start = 'left';\n end = 'right';\n } else {\n reverse = properties.base < properties.y;\n start = 'bottom';\n end = 'top';\n }\n if (reverse) {\n top = 'end';\n bottom = 'start';\n } else {\n top = 'start';\n bottom = 'end';\n }\n return {\n start,\n end,\n reverse,\n top,\n bottom\n };\n}\nfunction setBorderSkipped(properties, options, stack, index) {\n let edge = options.borderSkipped;\n const res = {};\n if (!edge) {\n properties.borderSkipped = res;\n return;\n }\n if (edge === true) {\n properties.borderSkipped = {\n top: true,\n right: true,\n bottom: true,\n left: true\n };\n return;\n }\n const _borderProps = borderProps(properties),\n start = _borderProps.start,\n end = _borderProps.end,\n reverse = _borderProps.reverse,\n top = _borderProps.top,\n bottom = _borderProps.bottom;\n if (edge === 'middle' && stack) {\n properties.enableBorderRadius = true;\n if ((stack._top || 0) === index) {\n edge = top;\n } else if ((stack._bottom || 0) === index) {\n edge = bottom;\n } else {\n res[parseEdge(bottom, start, end, reverse)] = true;\n edge = top;\n }\n }\n res[parseEdge(edge, start, end, reverse)] = true;\n properties.borderSkipped = res;\n}\nfunction parseEdge(edge, a, b, reverse) {\n if (reverse) {\n edge = swap(edge, a, b);\n edge = startEnd(edge, b, a);\n } else {\n edge = startEnd(edge, a, b);\n }\n return edge;\n}\nfunction swap(orig, v1, v2) {\n return orig === v1 ? v2 : orig === v2 ? v1 : orig;\n}\nfunction startEnd(v, start, end) {\n return v === 'start' ? start : v === 'end' ? end : v;\n}\nfunction setInflateAmount(properties, _ref3, ratio) {\n let inflateAmount = _ref3.inflateAmount;\n properties.inflateAmount = inflateAmount === 'auto' ? ratio === 1 ? 0.33 : 0 : inflateAmount;\n}\nclass BarController extends DatasetController {\n parsePrimitiveData(meta, data, start, count) {\n return parseArrayOrPrimitive(meta, data, start, count);\n }\n parseArrayData(meta, data, start, count) {\n return parseArrayOrPrimitive(meta, data, start, count);\n }\n parseObjectData(meta, data, start, count) {\n const iScale = meta.iScale,\n vScale = meta.vScale;\n const _this$_parsing2 = this._parsing,\n _this$_parsing2$xAxis = _this$_parsing2.xAxisKey,\n xAxisKey = _this$_parsing2$xAxis === void 0 ? 'x' : _this$_parsing2$xAxis,\n _this$_parsing2$yAxis = _this$_parsing2.yAxisKey,\n yAxisKey = _this$_parsing2$yAxis === void 0 ? 'y' : _this$_parsing2$yAxis;\n const iAxisKey = iScale.axis === 'x' ? xAxisKey : yAxisKey;\n const vAxisKey = vScale.axis === 'x' ? xAxisKey : yAxisKey;\n const parsed = [];\n let i, ilen, item, obj;\n for (i = start, ilen = start + count; i < ilen; ++i) {\n obj = data[i];\n item = {};\n item[iScale.axis] = iScale.parse(resolveObjectKey(obj, iAxisKey), i);\n parsed.push(parseValue(resolveObjectKey(obj, vAxisKey), item, vScale, i));\n }\n return parsed;\n }\n updateRangeFromParsed(range, scale, parsed, stack) {\n super.updateRangeFromParsed(range, scale, parsed, stack);\n const custom = parsed._custom;\n if (custom && scale === this._cachedMeta.vScale) {\n range.min = Math.min(range.min, custom.min);\n range.max = Math.max(range.max, custom.max);\n }\n }\n getMaxOverflow() {\n return 0;\n }\n getLabelAndValue(index) {\n const meta = this._cachedMeta;\n const iScale = meta.iScale,\n vScale = meta.vScale;\n const parsed = this.getParsed(index);\n const custom = parsed._custom;\n const value = isFloatBar(custom) ? '[' + custom.start + ', ' + custom.end + ']' : '' + vScale.getLabelForValue(parsed[vScale.axis]);\n return {\n label: '' + iScale.getLabelForValue(parsed[iScale.axis]),\n value\n };\n }\n initialize() {\n this.enableOptionSharing = true;\n super.initialize();\n const meta = this._cachedMeta;\n meta.stack = this.getDataset().stack;\n }\n update(mode) {\n const meta = this._cachedMeta;\n this.updateElements(meta.data, 0, meta.data.length, mode);\n }\n updateElements(bars, start, count, mode) {\n const reset = mode === 'reset';\n const index = this.index,\n vScale = this._cachedMeta.vScale;\n const base = vScale.getBasePixel();\n const horizontal = vScale.isHorizontal();\n const ruler = this._getRuler();\n const _this$_getSharedOptio = this._getSharedOptions(start, mode),\n sharedOptions = _this$_getSharedOptio.sharedOptions,\n includeOptions = _this$_getSharedOptio.includeOptions;\n for (let i = start; i < start + count; i++) {\n const parsed = this.getParsed(i);\n const vpixels = reset || isNullOrUndef(parsed[vScale.axis]) ? {\n base,\n head: base\n } : this._calculateBarValuePixels(i);\n const ipixels = this._calculateBarIndexPixels(i, ruler);\n const stack = (parsed._stacks || {})[vScale.axis];\n const properties = {\n horizontal,\n base: vpixels.base,\n enableBorderRadius: !stack || isFloatBar(parsed._custom) || index === stack._top || index === stack._bottom,\n x: horizontal ? vpixels.head : ipixels.center,\n y: horizontal ? ipixels.center : vpixels.head,\n height: horizontal ? ipixels.size : Math.abs(vpixels.size),\n width: horizontal ? Math.abs(vpixels.size) : ipixels.size\n };\n if (includeOptions) {\n properties.options = sharedOptions || this.resolveDataElementOptions(i, bars[i].active ? 'active' : mode);\n }\n const options = properties.options || bars[i].options;\n setBorderSkipped(properties, options, stack, index);\n setInflateAmount(properties, options, ruler.ratio);\n this.updateElement(bars[i], i, properties, mode);\n }\n }\n _getStacks(last, dataIndex) {\n const iScale = this._cachedMeta.iScale;\n const metasets = iScale.getMatchingVisibleMetas(this._type).filter(meta => meta.controller.options.grouped);\n const stacked = iScale.options.stacked;\n const stacks = [];\n const skipNull = meta => {\n const parsed = meta.controller.getParsed(dataIndex);\n const val = parsed && parsed[meta.vScale.axis];\n if (isNullOrUndef(val) || isNaN(val)) {\n return true;\n }\n };\n for (const meta of metasets) {\n if (dataIndex !== undefined && skipNull(meta)) {\n continue;\n }\n if (stacked === false || stacks.indexOf(meta.stack) === -1 || stacked === undefined && meta.stack === undefined) {\n stacks.push(meta.stack);\n }\n if (meta.index === last) {\n break;\n }\n }\n if (!stacks.length) {\n stacks.push(undefined);\n }\n return stacks;\n }\n _getStackCount(index) {\n return this._getStacks(undefined, index).length;\n }\n _getStackIndex(datasetIndex, name, dataIndex) {\n const stacks = this._getStacks(datasetIndex, dataIndex);\n const index = name !== undefined ? stacks.indexOf(name) : -1;\n return index === -1 ? stacks.length - 1 : index;\n }\n _getRuler() {\n const opts = this.options;\n const meta = this._cachedMeta;\n const iScale = meta.iScale;\n const pixels = [];\n let i, ilen;\n for (i = 0, ilen = meta.data.length; i < ilen; ++i) {\n pixels.push(iScale.getPixelForValue(this.getParsed(i)[iScale.axis], i));\n }\n const barThickness = opts.barThickness;\n const min = barThickness || computeMinSampleSize(meta);\n return {\n min,\n pixels,\n start: iScale._startPixel,\n end: iScale._endPixel,\n stackCount: this._getStackCount(),\n scale: iScale,\n grouped: opts.grouped,\n ratio: barThickness ? 1 : opts.categoryPercentage * opts.barPercentage\n };\n }\n _calculateBarValuePixels(index) {\n const _this$_cachedMeta = this._cachedMeta,\n vScale = _this$_cachedMeta.vScale,\n _stacked = _this$_cachedMeta._stacked,\n _this$options = this.options,\n baseValue = _this$options.base,\n minBarLength = _this$options.minBarLength;\n const actualBase = baseValue || 0;\n const parsed = this.getParsed(index);\n const custom = parsed._custom;\n const floating = isFloatBar(custom);\n let value = parsed[vScale.axis];\n let start = 0;\n let length = _stacked ? this.applyStack(vScale, parsed, _stacked) : value;\n let head, size;\n if (length !== value) {\n start = length - value;\n length = value;\n }\n if (floating) {\n value = custom.barStart;\n length = custom.barEnd - custom.barStart;\n if (value !== 0 && sign(value) !== sign(custom.barEnd)) {\n start = 0;\n }\n start += value;\n }\n const startValue = !isNullOrUndef(baseValue) && !floating ? baseValue : start;\n let base = vScale.getPixelForValue(startValue);\n if (this.chart.getDataVisibility(index)) {\n head = vScale.getPixelForValue(start + length);\n } else {\n head = base;\n }\n size = head - base;\n if (Math.abs(size) < minBarLength) {\n size = barSign(size, vScale, actualBase) * minBarLength;\n if (value === actualBase) {\n base -= size / 2;\n }\n const startPixel = vScale.getPixelForDecimal(0);\n const endPixel = vScale.getPixelForDecimal(1);\n const min = Math.min(startPixel, endPixel);\n const max = Math.max(startPixel, endPixel);\n base = Math.max(Math.min(base, max), min);\n head = base + size;\n }\n if (base === vScale.getPixelForValue(actualBase)) {\n const halfGrid = sign(size) * vScale.getLineWidthForValue(actualBase) / 2;\n base += halfGrid;\n size -= halfGrid;\n }\n return {\n size,\n base,\n head,\n center: head + size / 2\n };\n }\n _calculateBarIndexPixels(index, ruler) {\n const scale = ruler.scale;\n const options = this.options;\n const skipNull = options.skipNull;\n const maxBarThickness = valueOrDefault(options.maxBarThickness, Infinity);\n let center, size;\n if (ruler.grouped) {\n const stackCount = skipNull ? this._getStackCount(index) : ruler.stackCount;\n const range = options.barThickness === 'flex' ? computeFlexCategoryTraits(index, ruler, options, stackCount) : computeFitCategoryTraits(index, ruler, options, stackCount);\n const stackIndex = this._getStackIndex(this.index, this._cachedMeta.stack, skipNull ? index : undefined);\n center = range.start + range.chunk * stackIndex + range.chunk / 2;\n size = Math.min(maxBarThickness, range.chunk * range.ratio);\n } else {\n center = scale.getPixelForValue(this.getParsed(index)[scale.axis], index);\n size = Math.min(maxBarThickness, ruler.min * ruler.ratio);\n }\n return {\n base: center - size / 2,\n head: center + size / 2,\n center,\n size\n };\n }\n draw() {\n const meta = this._cachedMeta;\n const vScale = meta.vScale;\n const rects = meta.data;\n const ilen = rects.length;\n let i = 0;\n for (; i < ilen; ++i) {\n if (this.getParsed(i)[vScale.axis] !== null) {\n rects[i].draw(this._ctx);\n }\n }\n }\n}\nBarController.id = 'bar';\nBarController.defaults = {\n datasetElementType: false,\n dataElementType: 'bar',\n categoryPercentage: 0.8,\n barPercentage: 0.9,\n grouped: true,\n animations: {\n numbers: {\n type: 'number',\n properties: ['x', 'y', 'base', 'width', 'height']\n }\n }\n};\nBarController.overrides = {\n scales: {\n _index_: {\n type: 'category',\n offset: true,\n grid: {\n offset: true\n }\n },\n _value_: {\n type: 'linear',\n beginAtZero: true\n }\n }\n};\nclass BubbleController extends DatasetController {\n initialize() {\n this.enableOptionSharing = true;\n super.initialize();\n }\n parsePrimitiveData(meta, data, start, count) {\n const parsed = super.parsePrimitiveData(meta, data, start, count);\n for (let i = 0; i < parsed.length; i++) {\n parsed[i]._custom = this.resolveDataElementOptions(i + start).radius;\n }\n return parsed;\n }\n parseArrayData(meta, data, start, count) {\n const parsed = super.parseArrayData(meta, data, start, count);\n for (let i = 0; i < parsed.length; i++) {\n const item = data[start + i];\n parsed[i]._custom = valueOrDefault(item[2], this.resolveDataElementOptions(i + start).radius);\n }\n return parsed;\n }\n parseObjectData(meta, data, start, count) {\n const parsed = super.parseObjectData(meta, data, start, count);\n for (let i = 0; i < parsed.length; i++) {\n const item = data[start + i];\n parsed[i]._custom = valueOrDefault(item && item.r && +item.r, this.resolveDataElementOptions(i + start).radius);\n }\n return parsed;\n }\n getMaxOverflow() {\n const data = this._cachedMeta.data;\n let max = 0;\n for (let i = data.length - 1; i >= 0; --i) {\n max = Math.max(max, data[i].size(this.resolveDataElementOptions(i)) / 2);\n }\n return max > 0 && max;\n }\n getLabelAndValue(index) {\n const meta = this._cachedMeta;\n const xScale = meta.xScale,\n yScale = meta.yScale;\n const parsed = this.getParsed(index);\n const x = xScale.getLabelForValue(parsed.x);\n const y = yScale.getLabelForValue(parsed.y);\n const r = parsed._custom;\n return {\n label: meta.label,\n value: '(' + x + ', ' + y + (r ? ', ' + r : '') + ')'\n };\n }\n update(mode) {\n const points = this._cachedMeta.data;\n this.updateElements(points, 0, points.length, mode);\n }\n updateElements(points, start, count, mode) {\n const reset = mode === 'reset';\n const _this$_cachedMeta2 = this._cachedMeta,\n iScale = _this$_cachedMeta2.iScale,\n vScale = _this$_cachedMeta2.vScale;\n const _this$_getSharedOptio2 = this._getSharedOptions(start, mode),\n sharedOptions = _this$_getSharedOptio2.sharedOptions,\n includeOptions = _this$_getSharedOptio2.includeOptions;\n const iAxis = iScale.axis;\n const vAxis = vScale.axis;\n for (let i = start; i < start + count; i++) {\n const point = points[i];\n const parsed = !reset && this.getParsed(i);\n const properties = {};\n const iPixel = properties[iAxis] = reset ? iScale.getPixelForDecimal(0.5) : iScale.getPixelForValue(parsed[iAxis]);\n const vPixel = properties[vAxis] = reset ? vScale.getBasePixel() : vScale.getPixelForValue(parsed[vAxis]);\n properties.skip = isNaN(iPixel) || isNaN(vPixel);\n if (includeOptions) {\n properties.options = sharedOptions || this.resolveDataElementOptions(i, point.active ? 'active' : mode);\n if (reset) {\n properties.options.radius = 0;\n }\n }\n this.updateElement(point, i, properties, mode);\n }\n }\n resolveDataElementOptions(index, mode) {\n const parsed = this.getParsed(index);\n let values = super.resolveDataElementOptions(index, mode);\n if (values.$shared) {\n values = Object.assign({}, values, {\n $shared: false\n });\n }\n const radius = values.radius;\n if (mode !== 'active') {\n values.radius = 0;\n }\n values.radius += valueOrDefault(parsed && parsed._custom, radius);\n return values;\n }\n}\nBubbleController.id = 'bubble';\nBubbleController.defaults = {\n datasetElementType: false,\n dataElementType: 'point',\n animations: {\n numbers: {\n type: 'number',\n properties: ['x', 'y', 'borderWidth', 'radius']\n }\n }\n};\nBubbleController.overrides = {\n scales: {\n x: {\n type: 'linear'\n },\n y: {\n type: 'linear'\n }\n },\n plugins: {\n tooltip: {\n callbacks: {\n title() {\n return '';\n }\n }\n }\n }\n};\nfunction getRatioAndOffset(rotation, circumference, cutout) {\n let ratioX = 1;\n let ratioY = 1;\n let offsetX = 0;\n let offsetY = 0;\n if (circumference < TAU) {\n const startAngle = rotation;\n const endAngle = startAngle + circumference;\n const startX = Math.cos(startAngle);\n const startY = Math.sin(startAngle);\n const endX = Math.cos(endAngle);\n const endY = Math.sin(endAngle);\n const calcMax = (angle, a, b) => _angleBetween(angle, startAngle, endAngle, true) ? 1 : Math.max(a, a * cutout, b, b * cutout);\n const calcMin = (angle, a, b) => _angleBetween(angle, startAngle, endAngle, true) ? -1 : Math.min(a, a * cutout, b, b * cutout);\n const maxX = calcMax(0, startX, endX);\n const maxY = calcMax(HALF_PI, startY, endY);\n const minX = calcMin(PI, startX, endX);\n const minY = calcMin(PI + HALF_PI, startY, endY);\n ratioX = (maxX - minX) / 2;\n ratioY = (maxY - minY) / 2;\n offsetX = -(maxX + minX) / 2;\n offsetY = -(maxY + minY) / 2;\n }\n return {\n ratioX,\n ratioY,\n offsetX,\n offsetY\n };\n}\nclass DoughnutController extends DatasetController {\n constructor(chart, datasetIndex) {\n super(chart, datasetIndex);\n this.enableOptionSharing = true;\n this.innerRadius = undefined;\n this.outerRadius = undefined;\n this.offsetX = undefined;\n this.offsetY = undefined;\n }\n linkScales() {}\n parse(start, count) {\n const data = this.getDataset().data;\n const meta = this._cachedMeta;\n if (this._parsing === false) {\n meta._parsed = data;\n } else {\n let getter = i => +data[i];\n if (isObject(data[start])) {\n const _this$_parsing$key = this._parsing.key,\n key = _this$_parsing$key === void 0 ? 'value' : _this$_parsing$key;\n getter = i => +resolveObjectKey(data[i], key);\n }\n let i, ilen;\n for (i = start, ilen = start + count; i < ilen; ++i) {\n meta._parsed[i] = getter(i);\n }\n }\n }\n _getRotation() {\n return toRadians(this.options.rotation - 90);\n }\n _getCircumference() {\n return toRadians(this.options.circumference);\n }\n _getRotationExtents() {\n let min = TAU;\n let max = -TAU;\n for (let i = 0; i < this.chart.data.datasets.length; ++i) {\n if (this.chart.isDatasetVisible(i)) {\n const controller = this.chart.getDatasetMeta(i).controller;\n const rotation = controller._getRotation();\n const circumference = controller._getCircumference();\n min = Math.min(min, rotation);\n max = Math.max(max, rotation + circumference);\n }\n }\n return {\n rotation: min,\n circumference: max - min\n };\n }\n update(mode) {\n const chart = this.chart;\n const chartArea = chart.chartArea;\n const meta = this._cachedMeta;\n const arcs = meta.data;\n const spacing = this.getMaxBorderWidth() + this.getMaxOffset(arcs) + this.options.spacing;\n const maxSize = Math.max((Math.min(chartArea.width, chartArea.height) - spacing) / 2, 0);\n const cutout = Math.min(toPercentage(this.options.cutout, maxSize), 1);\n const chartWeight = this._getRingWeight(this.index);\n const _this$_getRotationExt = this._getRotationExtents(),\n circumference = _this$_getRotationExt.circumference,\n rotation = _this$_getRotationExt.rotation;\n const _getRatioAndOffset = getRatioAndOffset(rotation, circumference, cutout),\n ratioX = _getRatioAndOffset.ratioX,\n ratioY = _getRatioAndOffset.ratioY,\n offsetX = _getRatioAndOffset.offsetX,\n offsetY = _getRatioAndOffset.offsetY;\n const maxWidth = (chartArea.width - spacing) / ratioX;\n const maxHeight = (chartArea.height - spacing) / ratioY;\n const maxRadius = Math.max(Math.min(maxWidth, maxHeight) / 2, 0);\n const outerRadius = toDimension(this.options.radius, maxRadius);\n const innerRadius = Math.max(outerRadius * cutout, 0);\n const radiusLength = (outerRadius - innerRadius) / this._getVisibleDatasetWeightTotal();\n this.offsetX = offsetX * outerRadius;\n this.offsetY = offsetY * outerRadius;\n meta.total = this.calculateTotal();\n this.outerRadius = outerRadius - radiusLength * this._getRingWeightOffset(this.index);\n this.innerRadius = Math.max(this.outerRadius - radiusLength * chartWeight, 0);\n this.updateElements(arcs, 0, arcs.length, mode);\n }\n _circumference(i, reset) {\n const opts = this.options;\n const meta = this._cachedMeta;\n const circumference = this._getCircumference();\n if (reset && opts.animation.animateRotate || !this.chart.getDataVisibility(i) || meta._parsed[i] === null || meta.data[i].hidden) {\n return 0;\n }\n return this.calculateCircumference(meta._parsed[i] * circumference / TAU);\n }\n updateElements(arcs, start, count, mode) {\n const reset = mode === 'reset';\n const chart = this.chart;\n const chartArea = chart.chartArea;\n const opts = chart.options;\n const animationOpts = opts.animation;\n const centerX = (chartArea.left + chartArea.right) / 2;\n const centerY = (chartArea.top + chartArea.bottom) / 2;\n const animateScale = reset && animationOpts.animateScale;\n const innerRadius = animateScale ? 0 : this.innerRadius;\n const outerRadius = animateScale ? 0 : this.outerRadius;\n const _this$_getSharedOptio3 = this._getSharedOptions(start, mode),\n sharedOptions = _this$_getSharedOptio3.sharedOptions,\n includeOptions = _this$_getSharedOptio3.includeOptions;\n let startAngle = this._getRotation();\n let i;\n for (i = 0; i < start; ++i) {\n startAngle += this._circumference(i, reset);\n }\n for (i = start; i < start + count; ++i) {\n const circumference = this._circumference(i, reset);\n const arc = arcs[i];\n const properties = {\n x: centerX + this.offsetX,\n y: centerY + this.offsetY,\n startAngle,\n endAngle: startAngle + circumference,\n circumference,\n outerRadius,\n innerRadius\n };\n if (includeOptions) {\n properties.options = sharedOptions || this.resolveDataElementOptions(i, arc.active ? 'active' : mode);\n }\n startAngle += circumference;\n this.updateElement(arc, i, properties, mode);\n }\n }\n calculateTotal() {\n const meta = this._cachedMeta;\n const metaData = meta.data;\n let total = 0;\n let i;\n for (i = 0; i < metaData.length; i++) {\n const value = meta._parsed[i];\n if (value !== null && !isNaN(value) && this.chart.getDataVisibility(i) && !metaData[i].hidden) {\n total += Math.abs(value);\n }\n }\n return total;\n }\n calculateCircumference(value) {\n const total = this._cachedMeta.total;\n if (total > 0 && !isNaN(value)) {\n return TAU * (Math.abs(value) / total);\n }\n return 0;\n }\n getLabelAndValue(index) {\n const meta = this._cachedMeta;\n const chart = this.chart;\n const labels = chart.data.labels || [];\n const value = formatNumber(meta._parsed[index], chart.options.locale);\n return {\n label: labels[index] || '',\n value\n };\n }\n getMaxBorderWidth(arcs) {\n let max = 0;\n const chart = this.chart;\n let i, ilen, meta, controller, options;\n if (!arcs) {\n for (i = 0, ilen = chart.data.datasets.length; i < ilen; ++i) {\n if (chart.isDatasetVisible(i)) {\n meta = chart.getDatasetMeta(i);\n arcs = meta.data;\n controller = meta.controller;\n break;\n }\n }\n }\n if (!arcs) {\n return 0;\n }\n for (i = 0, ilen = arcs.length; i < ilen; ++i) {\n options = controller.resolveDataElementOptions(i);\n if (options.borderAlign !== 'inner') {\n max = Math.max(max, options.borderWidth || 0, options.hoverBorderWidth || 0);\n }\n }\n return max;\n }\n getMaxOffset(arcs) {\n let max = 0;\n for (let i = 0, ilen = arcs.length; i < ilen; ++i) {\n const options = this.resolveDataElementOptions(i);\n max = Math.max(max, options.offset || 0, options.hoverOffset || 0);\n }\n return max;\n }\n _getRingWeightOffset(datasetIndex) {\n let ringWeightOffset = 0;\n for (let i = 0; i < datasetIndex; ++i) {\n if (this.chart.isDatasetVisible(i)) {\n ringWeightOffset += this._getRingWeight(i);\n }\n }\n return ringWeightOffset;\n }\n _getRingWeight(datasetIndex) {\n return Math.max(valueOrDefault(this.chart.data.datasets[datasetIndex].weight, 1), 0);\n }\n _getVisibleDatasetWeightTotal() {\n return this._getRingWeightOffset(this.chart.data.datasets.length) || 1;\n }\n}\nDoughnutController.id = 'doughnut';\nDoughnutController.defaults = {\n datasetElementType: false,\n dataElementType: 'arc',\n animation: {\n animateRotate: true,\n animateScale: false\n },\n animations: {\n numbers: {\n type: 'number',\n properties: ['circumference', 'endAngle', 'innerRadius', 'outerRadius', 'startAngle', 'x', 'y', 'offset', 'borderWidth', 'spacing']\n }\n },\n cutout: '50%',\n rotation: 0,\n circumference: 360,\n radius: '100%',\n spacing: 0,\n indexAxis: 'r'\n};\nDoughnutController.descriptors = {\n _scriptable: name => name !== 'spacing',\n _indexable: name => name !== 'spacing'\n};\nDoughnutController.overrides = {\n aspectRatio: 1,\n plugins: {\n legend: {\n labels: {\n generateLabels(chart) {\n const data = chart.data;\n if (data.labels.length && data.datasets.length) {\n const pointStyle = chart.legend.options.labels.pointStyle;\n return data.labels.map((label, i) => {\n const meta = chart.getDatasetMeta(0);\n const style = meta.controller.getStyle(i);\n return {\n text: label,\n fillStyle: style.backgroundColor,\n strokeStyle: style.borderColor,\n lineWidth: style.borderWidth,\n pointStyle: pointStyle,\n hidden: !chart.getDataVisibility(i),\n index: i\n };\n });\n }\n return [];\n }\n },\n onClick(e, legendItem, legend) {\n legend.chart.toggleDataVisibility(legendItem.index);\n legend.chart.update();\n }\n },\n tooltip: {\n callbacks: {\n title() {\n return '';\n },\n label(tooltipItem) {\n let dataLabel = tooltipItem.label;\n const value = ': ' + tooltipItem.formattedValue;\n if (isArray(dataLabel)) {\n dataLabel = dataLabel.slice();\n dataLabel[0] += value;\n } else {\n dataLabel += value;\n }\n return dataLabel;\n }\n }\n }\n }\n};\nclass LineController extends DatasetController {\n initialize() {\n this.enableOptionSharing = true;\n this.supportsDecimation = true;\n super.initialize();\n }\n update(mode) {\n const meta = this._cachedMeta;\n const line = meta.dataset,\n _meta$data = meta.data,\n points = _meta$data === void 0 ? [] : _meta$data,\n _dataset = meta._dataset;\n const animationsDisabled = this.chart._animationsDisabled;\n let _getStartAndCountOfVi = _getStartAndCountOfVisiblePoints(meta, points, animationsDisabled),\n start = _getStartAndCountOfVi.start,\n count = _getStartAndCountOfVi.count;\n this._drawStart = start;\n this._drawCount = count;\n if (_scaleRangesChanged(meta)) {\n start = 0;\n count = points.length;\n }\n line._chart = this.chart;\n line._datasetIndex = this.index;\n line._decimated = !!_dataset._decimated;\n line.points = points;\n const options = this.resolveDatasetElementOptions(mode);\n if (!this.options.showLine) {\n options.borderWidth = 0;\n }\n options.segment = this.options.segment;\n this.updateElement(line, undefined, {\n animated: !animationsDisabled,\n options\n }, mode);\n this.updateElements(points, start, count, mode);\n }\n updateElements(points, start, count, mode) {\n const reset = mode === 'reset';\n const _this$_cachedMeta3 = this._cachedMeta,\n iScale = _this$_cachedMeta3.iScale,\n vScale = _this$_cachedMeta3.vScale,\n _stacked = _this$_cachedMeta3._stacked,\n _dataset = _this$_cachedMeta3._dataset;\n const _this$_getSharedOptio4 = this._getSharedOptions(start, mode),\n sharedOptions = _this$_getSharedOptio4.sharedOptions,\n includeOptions = _this$_getSharedOptio4.includeOptions;\n const iAxis = iScale.axis;\n const vAxis = vScale.axis;\n const _this$options2 = this.options,\n spanGaps = _this$options2.spanGaps,\n segment = _this$options2.segment;\n const maxGapLength = isNumber(spanGaps) ? spanGaps : Number.POSITIVE_INFINITY;\n const directUpdate = this.chart._animationsDisabled || reset || mode === 'none';\n let prevParsed = start > 0 && this.getParsed(start - 1);\n for (let i = start; i < start + count; ++i) {\n const point = points[i];\n const parsed = this.getParsed(i);\n const properties = directUpdate ? point : {};\n const nullData = isNullOrUndef(parsed[vAxis]);\n const iPixel = properties[iAxis] = iScale.getPixelForValue(parsed[iAxis], i);\n const vPixel = properties[vAxis] = reset || nullData ? vScale.getBasePixel() : vScale.getPixelForValue(_stacked ? this.applyStack(vScale, parsed, _stacked) : parsed[vAxis], i);\n properties.skip = isNaN(iPixel) || isNaN(vPixel) || nullData;\n properties.stop = i > 0 && Math.abs(parsed[iAxis] - prevParsed[iAxis]) > maxGapLength;\n if (segment) {\n properties.parsed = parsed;\n properties.raw = _dataset.data[i];\n }\n if (includeOptions) {\n properties.options = sharedOptions || this.resolveDataElementOptions(i, point.active ? 'active' : mode);\n }\n if (!directUpdate) {\n this.updateElement(point, i, properties, mode);\n }\n prevParsed = parsed;\n }\n }\n getMaxOverflow() {\n const meta = this._cachedMeta;\n const dataset = meta.dataset;\n const border = dataset.options && dataset.options.borderWidth || 0;\n const data = meta.data || [];\n if (!data.length) {\n return border;\n }\n const firstPoint = data[0].size(this.resolveDataElementOptions(0));\n const lastPoint = data[data.length - 1].size(this.resolveDataElementOptions(data.length - 1));\n return Math.max(border, firstPoint, lastPoint) / 2;\n }\n draw() {\n const meta = this._cachedMeta;\n meta.dataset.updateControlPoints(this.chart.chartArea, meta.iScale.axis);\n super.draw();\n }\n}\nLineController.id = 'line';\nLineController.defaults = {\n datasetElementType: 'line',\n dataElementType: 'point',\n showLine: true,\n spanGaps: false\n};\nLineController.overrides = {\n scales: {\n _index_: {\n type: 'category'\n },\n _value_: {\n type: 'linear'\n }\n }\n};\nclass PolarAreaController extends DatasetController {\n constructor(chart, datasetIndex) {\n super(chart, datasetIndex);\n this.innerRadius = undefined;\n this.outerRadius = undefined;\n }\n getLabelAndValue(index) {\n const meta = this._cachedMeta;\n const chart = this.chart;\n const labels = chart.data.labels || [];\n const value = formatNumber(meta._parsed[index].r, chart.options.locale);\n return {\n label: labels[index] || '',\n value\n };\n }\n parseObjectData(meta, data, start, count) {\n return _parseObjectDataRadialScale.bind(this)(meta, data, start, count);\n }\n update(mode) {\n const arcs = this._cachedMeta.data;\n this._updateRadius();\n this.updateElements(arcs, 0, arcs.length, mode);\n }\n getMinMax() {\n const meta = this._cachedMeta;\n const range = {\n min: Number.POSITIVE_INFINITY,\n max: Number.NEGATIVE_INFINITY\n };\n meta.data.forEach((element, index) => {\n const parsed = this.getParsed(index).r;\n if (!isNaN(parsed) && this.chart.getDataVisibility(index)) {\n if (parsed < range.min) {\n range.min = parsed;\n }\n if (parsed > range.max) {\n range.max = parsed;\n }\n }\n });\n return range;\n }\n _updateRadius() {\n const chart = this.chart;\n const chartArea = chart.chartArea;\n const opts = chart.options;\n const minSize = Math.min(chartArea.right - chartArea.left, chartArea.bottom - chartArea.top);\n const outerRadius = Math.max(minSize / 2, 0);\n const innerRadius = Math.max(opts.cutoutPercentage ? outerRadius / 100 * opts.cutoutPercentage : 1, 0);\n const radiusLength = (outerRadius - innerRadius) / chart.getVisibleDatasetCount();\n this.outerRadius = outerRadius - radiusLength * this.index;\n this.innerRadius = this.outerRadius - radiusLength;\n }\n updateElements(arcs, start, count, mode) {\n const reset = mode === 'reset';\n const chart = this.chart;\n const opts = chart.options;\n const animationOpts = opts.animation;\n const scale = this._cachedMeta.rScale;\n const centerX = scale.xCenter;\n const centerY = scale.yCenter;\n const datasetStartAngle = scale.getIndexAngle(0) - 0.5 * PI;\n let angle = datasetStartAngle;\n let i;\n const defaultAngle = 360 / this.countVisibleElements();\n for (i = 0; i < start; ++i) {\n angle += this._computeAngle(i, mode, defaultAngle);\n }\n for (i = start; i < start + count; i++) {\n const arc = arcs[i];\n let startAngle = angle;\n let endAngle = angle + this._computeAngle(i, mode, defaultAngle);\n let outerRadius = chart.getDataVisibility(i) ? scale.getDistanceFromCenterForValue(this.getParsed(i).r) : 0;\n angle = endAngle;\n if (reset) {\n if (animationOpts.animateScale) {\n outerRadius = 0;\n }\n if (animationOpts.animateRotate) {\n startAngle = endAngle = datasetStartAngle;\n }\n }\n const properties = {\n x: centerX,\n y: centerY,\n innerRadius: 0,\n outerRadius,\n startAngle,\n endAngle,\n options: this.resolveDataElementOptions(i, arc.active ? 'active' : mode)\n };\n this.updateElement(arc, i, properties, mode);\n }\n }\n countVisibleElements() {\n const meta = this._cachedMeta;\n let count = 0;\n meta.data.forEach((element, index) => {\n if (!isNaN(this.getParsed(index).r) && this.chart.getDataVisibility(index)) {\n count++;\n }\n });\n return count;\n }\n _computeAngle(index, mode, defaultAngle) {\n return this.chart.getDataVisibility(index) ? toRadians(this.resolveDataElementOptions(index, mode).angle || defaultAngle) : 0;\n }\n}\nPolarAreaController.id = 'polarArea';\nPolarAreaController.defaults = {\n dataElementType: 'arc',\n animation: {\n animateRotate: true,\n animateScale: true\n },\n animations: {\n numbers: {\n type: 'number',\n properties: ['x', 'y', 'startAngle', 'endAngle', 'innerRadius', 'outerRadius']\n }\n },\n indexAxis: 'r',\n startAngle: 0\n};\nPolarAreaController.overrides = {\n aspectRatio: 1,\n plugins: {\n legend: {\n labels: {\n generateLabels(chart) {\n const data = chart.data;\n if (data.labels.length && data.datasets.length) {\n const pointStyle = chart.legend.options.labels.pointStyle;\n return data.labels.map((label, i) => {\n const meta = chart.getDatasetMeta(0);\n const style = meta.controller.getStyle(i);\n return {\n text: label,\n fillStyle: style.backgroundColor,\n strokeStyle: style.borderColor,\n lineWidth: style.borderWidth,\n pointStyle: pointStyle,\n hidden: !chart.getDataVisibility(i),\n index: i\n };\n });\n }\n return [];\n }\n },\n onClick(e, legendItem, legend) {\n legend.chart.toggleDataVisibility(legendItem.index);\n legend.chart.update();\n }\n },\n tooltip: {\n callbacks: {\n title() {\n return '';\n },\n label(context) {\n return context.chart.data.labels[context.dataIndex] + ': ' + context.formattedValue;\n }\n }\n }\n },\n scales: {\n r: {\n type: 'radialLinear',\n angleLines: {\n display: false\n },\n beginAtZero: true,\n grid: {\n circular: true\n },\n pointLabels: {\n display: false\n },\n startAngle: 0\n }\n }\n};\nclass PieController extends DoughnutController {}\nPieController.id = 'pie';\nPieController.defaults = {\n cutout: 0,\n rotation: 0,\n circumference: 360,\n radius: '100%'\n};\nclass RadarController extends DatasetController {\n getLabelAndValue(index) {\n const vScale = this._cachedMeta.vScale;\n const parsed = this.getParsed(index);\n return {\n label: vScale.getLabels()[index],\n value: '' + vScale.getLabelForValue(parsed[vScale.axis])\n };\n }\n parseObjectData(meta, data, start, count) {\n return _parseObjectDataRadialScale.bind(this)(meta, data, start, count);\n }\n update(mode) {\n const meta = this._cachedMeta;\n const line = meta.dataset;\n const points = meta.data || [];\n const labels = meta.iScale.getLabels();\n line.points = points;\n if (mode !== 'resize') {\n const options = this.resolveDatasetElementOptions(mode);\n if (!this.options.showLine) {\n options.borderWidth = 0;\n }\n const properties = {\n _loop: true,\n _fullLoop: labels.length === points.length,\n options\n };\n this.updateElement(line, undefined, properties, mode);\n }\n this.updateElements(points, 0, points.length, mode);\n }\n updateElements(points, start, count, mode) {\n const scale = this._cachedMeta.rScale;\n const reset = mode === 'reset';\n for (let i = start; i < start + count; i++) {\n const point = points[i];\n const options = this.resolveDataElementOptions(i, point.active ? 'active' : mode);\n const pointPosition = scale.getPointPositionForValue(i, this.getParsed(i).r);\n const x = reset ? scale.xCenter : pointPosition.x;\n const y = reset ? scale.yCenter : pointPosition.y;\n const properties = {\n x,\n y,\n angle: pointPosition.angle,\n skip: isNaN(x) || isNaN(y),\n options\n };\n this.updateElement(point, i, properties, mode);\n }\n }\n}\nRadarController.id = 'radar';\nRadarController.defaults = {\n datasetElementType: 'line',\n dataElementType: 'point',\n indexAxis: 'r',\n showLine: true,\n elements: {\n line: {\n fill: 'start'\n }\n }\n};\nRadarController.overrides = {\n aspectRatio: 1,\n scales: {\n r: {\n type: 'radialLinear'\n }\n }\n};\nclass Element {\n constructor() {\n this.x = undefined;\n this.y = undefined;\n this.active = false;\n this.options = undefined;\n this.$animations = undefined;\n }\n tooltipPosition(useFinalPosition) {\n const _this$getProps = this.getProps(['x', 'y'], useFinalPosition),\n x = _this$getProps.x,\n y = _this$getProps.y;\n return {\n x,\n y\n };\n }\n hasValue() {\n return isNumber(this.x) && isNumber(this.y);\n }\n getProps(props, final) {\n const anims = this.$animations;\n if (!final || !anims) {\n return this;\n }\n const ret = {};\n props.forEach(prop => {\n ret[prop] = anims[prop] && anims[prop].active() ? anims[prop]._to : this[prop];\n });\n return ret;\n }\n}\nElement.defaults = {};\nElement.defaultRoutes = undefined;\nconst formatters = {\n values(value) {\n return isArray(value) ? value : '' + value;\n },\n numeric(tickValue, index, ticks) {\n if (tickValue === 0) {\n return '0';\n }\n const locale = this.chart.options.locale;\n let notation;\n let delta = tickValue;\n if (ticks.length > 1) {\n const maxTick = Math.max(Math.abs(ticks[0].value), Math.abs(ticks[ticks.length - 1].value));\n if (maxTick < 1e-4 || maxTick > 1e+15) {\n notation = 'scientific';\n }\n delta = calculateDelta(tickValue, ticks);\n }\n const logDelta = log10(Math.abs(delta));\n const numDecimal = Math.max(Math.min(-1 * Math.floor(logDelta), 20), 0);\n const options = {\n notation,\n minimumFractionDigits: numDecimal,\n maximumFractionDigits: numDecimal\n };\n Object.assign(options, this.options.ticks.format);\n return formatNumber(tickValue, locale, options);\n },\n logarithmic(tickValue, index, ticks) {\n if (tickValue === 0) {\n return '0';\n }\n const remain = tickValue / Math.pow(10, Math.floor(log10(tickValue)));\n if (remain === 1 || remain === 2 || remain === 5) {\n return formatters.numeric.call(this, tickValue, index, ticks);\n }\n return '';\n }\n};\nfunction calculateDelta(tickValue, ticks) {\n let delta = ticks.length > 3 ? ticks[2].value - ticks[1].value : ticks[1].value - ticks[0].value;\n if (Math.abs(delta) >= 1 && tickValue !== Math.floor(tickValue)) {\n delta = tickValue - Math.floor(tickValue);\n }\n return delta;\n}\nvar Ticks = {\n formatters\n};\ndefaults.set('scale', {\n display: true,\n offset: false,\n reverse: false,\n beginAtZero: false,\n bounds: 'ticks',\n grace: 0,\n grid: {\n display: true,\n lineWidth: 1,\n drawBorder: true,\n drawOnChartArea: true,\n drawTicks: true,\n tickLength: 8,\n tickWidth: (_ctx, options) => options.lineWidth,\n tickColor: (_ctx, options) => options.color,\n offset: false,\n borderDash: [],\n borderDashOffset: 0.0,\n borderWidth: 1\n },\n title: {\n display: false,\n text: '',\n padding: {\n top: 4,\n bottom: 4\n }\n },\n ticks: {\n minRotation: 0,\n maxRotation: 50,\n mirror: false,\n textStrokeWidth: 0,\n textStrokeColor: '',\n padding: 3,\n display: true,\n autoSkip: true,\n autoSkipPadding: 3,\n labelOffset: 0,\n callback: Ticks.formatters.values,\n minor: {},\n major: {},\n align: 'center',\n crossAlign: 'near',\n showLabelBackdrop: false,\n backdropColor: 'rgba(255, 255, 255, 0.75)',\n backdropPadding: 2\n }\n});\ndefaults.route('scale.ticks', 'color', '', 'color');\ndefaults.route('scale.grid', 'color', '', 'borderColor');\ndefaults.route('scale.grid', 'borderColor', '', 'borderColor');\ndefaults.route('scale.title', 'color', '', 'color');\ndefaults.describe('scale', {\n _fallback: false,\n _scriptable: name => !name.startsWith('before') && !name.startsWith('after') && name !== 'callback' && name !== 'parser',\n _indexable: name => name !== 'borderDash' && name !== 'tickBorderDash'\n});\ndefaults.describe('scales', {\n _fallback: 'scale'\n});\ndefaults.describe('scale.ticks', {\n _scriptable: name => name !== 'backdropPadding' && name !== 'callback',\n _indexable: name => name !== 'backdropPadding'\n});\nfunction autoSkip(scale, ticks) {\n const tickOpts = scale.options.ticks;\n const ticksLimit = tickOpts.maxTicksLimit || determineMaxTicks(scale);\n const majorIndices = tickOpts.major.enabled ? getMajorIndices(ticks) : [];\n const numMajorIndices = majorIndices.length;\n const first = majorIndices[0];\n const last = majorIndices[numMajorIndices - 1];\n const newTicks = [];\n if (numMajorIndices > ticksLimit) {\n skipMajors(ticks, newTicks, majorIndices, numMajorIndices / ticksLimit);\n return newTicks;\n }\n const spacing = calculateSpacing(majorIndices, ticks, ticksLimit);\n if (numMajorIndices > 0) {\n let i, ilen;\n const avgMajorSpacing = numMajorIndices > 1 ? Math.round((last - first) / (numMajorIndices - 1)) : null;\n skip(ticks, newTicks, spacing, isNullOrUndef(avgMajorSpacing) ? 0 : first - avgMajorSpacing, first);\n for (i = 0, ilen = numMajorIndices - 1; i < ilen; i++) {\n skip(ticks, newTicks, spacing, majorIndices[i], majorIndices[i + 1]);\n }\n skip(ticks, newTicks, spacing, last, isNullOrUndef(avgMajorSpacing) ? ticks.length : last + avgMajorSpacing);\n return newTicks;\n }\n skip(ticks, newTicks, spacing);\n return newTicks;\n}\nfunction determineMaxTicks(scale) {\n const offset = scale.options.offset;\n const tickLength = scale._tickSize();\n const maxScale = scale._length / tickLength + (offset ? 0 : 1);\n const maxChart = scale._maxLength / tickLength;\n return Math.floor(Math.min(maxScale, maxChart));\n}\nfunction calculateSpacing(majorIndices, ticks, ticksLimit) {\n const evenMajorSpacing = getEvenSpacing(majorIndices);\n const spacing = ticks.length / ticksLimit;\n if (!evenMajorSpacing) {\n return Math.max(spacing, 1);\n }\n const factors = _factorize(evenMajorSpacing);\n for (let i = 0, ilen = factors.length - 1; i < ilen; i++) {\n const factor = factors[i];\n if (factor > spacing) {\n return factor;\n }\n }\n return Math.max(spacing, 1);\n}\nfunction getMajorIndices(ticks) {\n const result = [];\n let i, ilen;\n for (i = 0, ilen = ticks.length; i < ilen; i++) {\n if (ticks[i].major) {\n result.push(i);\n }\n }\n return result;\n}\nfunction skipMajors(ticks, newTicks, majorIndices, spacing) {\n let count = 0;\n let next = majorIndices[0];\n let i;\n spacing = Math.ceil(spacing);\n for (i = 0; i < ticks.length; i++) {\n if (i === next) {\n newTicks.push(ticks[i]);\n count++;\n next = majorIndices[count * spacing];\n }\n }\n}\nfunction skip(ticks, newTicks, spacing, majorStart, majorEnd) {\n const start = valueOrDefault(majorStart, 0);\n const end = Math.min(valueOrDefault(majorEnd, ticks.length), ticks.length);\n let count = 0;\n let length, i, next;\n spacing = Math.ceil(spacing);\n if (majorEnd) {\n length = majorEnd - majorStart;\n spacing = length / Math.floor(length / spacing);\n }\n next = start;\n while (next < 0) {\n count++;\n next = Math.round(start + count * spacing);\n }\n for (i = Math.max(start, 0); i < end; i++) {\n if (i === next) {\n newTicks.push(ticks[i]);\n count++;\n next = Math.round(start + count * spacing);\n }\n }\n}\nfunction getEvenSpacing(arr) {\n const len = arr.length;\n let i, diff;\n if (len < 2) {\n return false;\n }\n for (diff = arr[0], i = 1; i < len; ++i) {\n if (arr[i] - arr[i - 1] !== diff) {\n return false;\n }\n }\n return diff;\n}\nconst reverseAlign = align => align === 'left' ? 'right' : align === 'right' ? 'left' : align;\nconst offsetFromEdge = (scale, edge, offset) => edge === 'top' || edge === 'left' ? scale[edge] + offset : scale[edge] - offset;\nfunction sample(arr, numItems) {\n const result = [];\n const increment = arr.length / numItems;\n const len = arr.length;\n let i = 0;\n for (; i < len; i += increment) {\n result.push(arr[Math.floor(i)]);\n }\n return result;\n}\nfunction getPixelForGridLine(scale, index, offsetGridLines) {\n const length = scale.ticks.length;\n const validIndex = Math.min(index, length - 1);\n const start = scale._startPixel;\n const end = scale._endPixel;\n const epsilon = 1e-6;\n let lineValue = scale.getPixelForTick(validIndex);\n let offset;\n if (offsetGridLines) {\n if (length === 1) {\n offset = Math.max(lineValue - start, end - lineValue);\n } else if (index === 0) {\n offset = (scale.getPixelForTick(1) - lineValue) / 2;\n } else {\n offset = (lineValue - scale.getPixelForTick(validIndex - 1)) / 2;\n }\n lineValue += validIndex < index ? offset : -offset;\n if (lineValue < start - epsilon || lineValue > end + epsilon) {\n return;\n }\n }\n return lineValue;\n}\nfunction garbageCollect(caches, length) {\n each(caches, cache => {\n const gc = cache.gc;\n const gcLen = gc.length / 2;\n let i;\n if (gcLen > length) {\n for (i = 0; i < gcLen; ++i) {\n delete cache.data[gc[i]];\n }\n gc.splice(0, gcLen);\n }\n });\n}\nfunction getTickMarkLength(options) {\n return options.drawTicks ? options.tickLength : 0;\n}\nfunction getTitleHeight(options, fallback) {\n if (!options.display) {\n return 0;\n }\n const font = toFont(options.font, fallback);\n const padding = toPadding(options.padding);\n const lines = isArray(options.text) ? options.text.length : 1;\n return lines * font.lineHeight + padding.height;\n}\nfunction createScaleContext(parent, scale) {\n return createContext(parent, {\n scale,\n type: 'scale'\n });\n}\nfunction createTickContext(parent, index, tick) {\n return createContext(parent, {\n tick,\n index,\n type: 'tick'\n });\n}\nfunction titleAlign(align, position, reverse) {\n let ret = _toLeftRightCenter(align);\n if (reverse && position !== 'right' || !reverse && position === 'right') {\n ret = reverseAlign(ret);\n }\n return ret;\n}\nfunction titleArgs(scale, offset, position, align) {\n const top = scale.top,\n left = scale.left,\n bottom = scale.bottom,\n right = scale.right,\n chart = scale.chart;\n const chartArea = chart.chartArea,\n scales = chart.scales;\n let rotation = 0;\n let maxWidth, titleX, titleY;\n const height = bottom - top;\n const width = right - left;\n if (scale.isHorizontal()) {\n titleX = _alignStartEnd(align, left, right);\n if (isObject(position)) {\n const positionAxisID = Object.keys(position)[0];\n const value = position[positionAxisID];\n titleY = scales[positionAxisID].getPixelForValue(value) + height - offset;\n } else if (position === 'center') {\n titleY = (chartArea.bottom + chartArea.top) / 2 + height - offset;\n } else {\n titleY = offsetFromEdge(scale, position, offset);\n }\n maxWidth = right - left;\n } else {\n if (isObject(position)) {\n const positionAxisID = Object.keys(position)[0];\n const value = position[positionAxisID];\n titleX = scales[positionAxisID].getPixelForValue(value) - width + offset;\n } else if (position === 'center') {\n titleX = (chartArea.left + chartArea.right) / 2 - width + offset;\n } else {\n titleX = offsetFromEdge(scale, position, offset);\n }\n titleY = _alignStartEnd(align, bottom, top);\n rotation = position === 'left' ? -HALF_PI : HALF_PI;\n }\n return {\n titleX,\n titleY,\n maxWidth,\n rotation\n };\n}\nclass Scale extends Element {\n constructor(cfg) {\n super();\n this.id = cfg.id;\n this.type = cfg.type;\n this.options = undefined;\n this.ctx = cfg.ctx;\n this.chart = cfg.chart;\n this.top = undefined;\n this.bottom = undefined;\n this.left = undefined;\n this.right = undefined;\n this.width = undefined;\n this.height = undefined;\n this._margins = {\n left: 0,\n right: 0,\n top: 0,\n bottom: 0\n };\n this.maxWidth = undefined;\n this.maxHeight = undefined;\n this.paddingTop = undefined;\n this.paddingBottom = undefined;\n this.paddingLeft = undefined;\n this.paddingRight = undefined;\n this.axis = undefined;\n this.labelRotation = undefined;\n this.min = undefined;\n this.max = undefined;\n this._range = undefined;\n this.ticks = [];\n this._gridLineItems = null;\n this._labelItems = null;\n this._labelSizes = null;\n this._length = 0;\n this._maxLength = 0;\n this._longestTextCache = {};\n this._startPixel = undefined;\n this._endPixel = undefined;\n this._reversePixels = false;\n this._userMax = undefined;\n this._userMin = undefined;\n this._suggestedMax = undefined;\n this._suggestedMin = undefined;\n this._ticksLength = 0;\n this._borderValue = 0;\n this._cache = {};\n this._dataLimitsCached = false;\n this.$context = undefined;\n }\n init(options) {\n this.options = options.setContext(this.getContext());\n this.axis = options.axis;\n this._userMin = this.parse(options.min);\n this._userMax = this.parse(options.max);\n this._suggestedMin = this.parse(options.suggestedMin);\n this._suggestedMax = this.parse(options.suggestedMax);\n }\n parse(raw, index) {\n return raw;\n }\n getUserBounds() {\n let _userMin = this._userMin,\n _userMax = this._userMax,\n _suggestedMin = this._suggestedMin,\n _suggestedMax = this._suggestedMax;\n _userMin = finiteOrDefault(_userMin, Number.POSITIVE_INFINITY);\n _userMax = finiteOrDefault(_userMax, Number.NEGATIVE_INFINITY);\n _suggestedMin = finiteOrDefault(_suggestedMin, Number.POSITIVE_INFINITY);\n _suggestedMax = finiteOrDefault(_suggestedMax, Number.NEGATIVE_INFINITY);\n return {\n min: finiteOrDefault(_userMin, _suggestedMin),\n max: finiteOrDefault(_userMax, _suggestedMax),\n minDefined: isNumberFinite(_userMin),\n maxDefined: isNumberFinite(_userMax)\n };\n }\n getMinMax(canStack) {\n let _this$getUserBounds = this.getUserBounds(),\n min = _this$getUserBounds.min,\n max = _this$getUserBounds.max,\n minDefined = _this$getUserBounds.minDefined,\n maxDefined = _this$getUserBounds.maxDefined;\n let range;\n if (minDefined && maxDefined) {\n return {\n min,\n max\n };\n }\n const metas = this.getMatchingVisibleMetas();\n for (let i = 0, ilen = metas.length; i < ilen; ++i) {\n range = metas[i].controller.getMinMax(this, canStack);\n if (!minDefined) {\n min = Math.min(min, range.min);\n }\n if (!maxDefined) {\n max = Math.max(max, range.max);\n }\n }\n min = maxDefined && min > max ? max : min;\n max = minDefined && min > max ? min : max;\n return {\n min: finiteOrDefault(min, finiteOrDefault(max, min)),\n max: finiteOrDefault(max, finiteOrDefault(min, max))\n };\n }\n getPadding() {\n return {\n left: this.paddingLeft || 0,\n top: this.paddingTop || 0,\n right: this.paddingRight || 0,\n bottom: this.paddingBottom || 0\n };\n }\n getTicks() {\n return this.ticks;\n }\n getLabels() {\n const data = this.chart.data;\n return this.options.labels || (this.isHorizontal() ? data.xLabels : data.yLabels) || data.labels || [];\n }\n beforeLayout() {\n this._cache = {};\n this._dataLimitsCached = false;\n }\n beforeUpdate() {\n callback(this.options.beforeUpdate, [this]);\n }\n update(maxWidth, maxHeight, margins) {\n const _this$options3 = this.options,\n beginAtZero = _this$options3.beginAtZero,\n grace = _this$options3.grace,\n tickOpts = _this$options3.ticks;\n const sampleSize = tickOpts.sampleSize;\n this.beforeUpdate();\n this.maxWidth = maxWidth;\n this.maxHeight = maxHeight;\n this._margins = margins = Object.assign({\n left: 0,\n right: 0,\n top: 0,\n bottom: 0\n }, margins);\n this.ticks = null;\n this._labelSizes = null;\n this._gridLineItems = null;\n this._labelItems = null;\n this.beforeSetDimensions();\n this.setDimensions();\n this.afterSetDimensions();\n this._maxLength = this.isHorizontal() ? this.width + margins.left + margins.right : this.height + margins.top + margins.bottom;\n if (!this._dataLimitsCached) {\n this.beforeDataLimits();\n this.determineDataLimits();\n this.afterDataLimits();\n this._range = _addGrace(this, grace, beginAtZero);\n this._dataLimitsCached = true;\n }\n this.beforeBuildTicks();\n this.ticks = this.buildTicks() || [];\n this.afterBuildTicks();\n const samplingEnabled = sampleSize < this.ticks.length;\n this._convertTicksToLabels(samplingEnabled ? sample(this.ticks, sampleSize) : this.ticks);\n this.configure();\n this.beforeCalculateLabelRotation();\n this.calculateLabelRotation();\n this.afterCalculateLabelRotation();\n if (tickOpts.display && (tickOpts.autoSkip || tickOpts.source === 'auto')) {\n this.ticks = autoSkip(this, this.ticks);\n this._labelSizes = null;\n this.afterAutoSkip();\n }\n if (samplingEnabled) {\n this._convertTicksToLabels(this.ticks);\n }\n this.beforeFit();\n this.fit();\n this.afterFit();\n this.afterUpdate();\n }\n configure() {\n let reversePixels = this.options.reverse;\n let startPixel, endPixel;\n if (this.isHorizontal()) {\n startPixel = this.left;\n endPixel = this.right;\n } else {\n startPixel = this.top;\n endPixel = this.bottom;\n reversePixels = !reversePixels;\n }\n this._startPixel = startPixel;\n this._endPixel = endPixel;\n this._reversePixels = reversePixels;\n this._length = endPixel - startPixel;\n this._alignToPixels = this.options.alignToPixels;\n }\n afterUpdate() {\n callback(this.options.afterUpdate, [this]);\n }\n beforeSetDimensions() {\n callback(this.options.beforeSetDimensions, [this]);\n }\n setDimensions() {\n if (this.isHorizontal()) {\n this.width = this.maxWidth;\n this.left = 0;\n this.right = this.width;\n } else {\n this.height = this.maxHeight;\n this.top = 0;\n this.bottom = this.height;\n }\n this.paddingLeft = 0;\n this.paddingTop = 0;\n this.paddingRight = 0;\n this.paddingBottom = 0;\n }\n afterSetDimensions() {\n callback(this.options.afterSetDimensions, [this]);\n }\n _callHooks(name) {\n this.chart.notifyPlugins(name, this.getContext());\n callback(this.options[name], [this]);\n }\n beforeDataLimits() {\n this._callHooks('beforeDataLimits');\n }\n determineDataLimits() {}\n afterDataLimits() {\n this._callHooks('afterDataLimits');\n }\n beforeBuildTicks() {\n this._callHooks('beforeBuildTicks');\n }\n buildTicks() {\n return [];\n }\n afterBuildTicks() {\n this._callHooks('afterBuildTicks');\n }\n beforeTickToLabelConversion() {\n callback(this.options.beforeTickToLabelConversion, [this]);\n }\n generateTickLabels(ticks) {\n const tickOpts = this.options.ticks;\n let i, ilen, tick;\n for (i = 0, ilen = ticks.length; i < ilen; i++) {\n tick = ticks[i];\n tick.label = callback(tickOpts.callback, [tick.value, i, ticks], this);\n }\n }\n afterTickToLabelConversion() {\n callback(this.options.afterTickToLabelConversion, [this]);\n }\n beforeCalculateLabelRotation() {\n callback(this.options.beforeCalculateLabelRotation, [this]);\n }\n calculateLabelRotation() {\n const options = this.options;\n const tickOpts = options.ticks;\n const numTicks = this.ticks.length;\n const minRotation = tickOpts.minRotation || 0;\n const maxRotation = tickOpts.maxRotation;\n let labelRotation = minRotation;\n let tickWidth, maxHeight, maxLabelDiagonal;\n if (!this._isVisible() || !tickOpts.display || minRotation >= maxRotation || numTicks <= 1 || !this.isHorizontal()) {\n this.labelRotation = minRotation;\n return;\n }\n const labelSizes = this._getLabelSizes();\n const maxLabelWidth = labelSizes.widest.width;\n const maxLabelHeight = labelSizes.highest.height;\n const maxWidth = _limitValue(this.chart.width - maxLabelWidth, 0, this.maxWidth);\n tickWidth = options.offset ? this.maxWidth / numTicks : maxWidth / (numTicks - 1);\n if (maxLabelWidth + 6 > tickWidth) {\n tickWidth = maxWidth / (numTicks - (options.offset ? 0.5 : 1));\n maxHeight = this.maxHeight - getTickMarkLength(options.grid) - tickOpts.padding - getTitleHeight(options.title, this.chart.options.font);\n maxLabelDiagonal = Math.sqrt(maxLabelWidth * maxLabelWidth + maxLabelHeight * maxLabelHeight);\n labelRotation = toDegrees(Math.min(Math.asin(_limitValue((labelSizes.highest.height + 6) / tickWidth, -1, 1)), Math.asin(_limitValue(maxHeight / maxLabelDiagonal, -1, 1)) - Math.asin(_limitValue(maxLabelHeight / maxLabelDiagonal, -1, 1))));\n labelRotation = Math.max(minRotation, Math.min(maxRotation, labelRotation));\n }\n this.labelRotation = labelRotation;\n }\n afterCalculateLabelRotation() {\n callback(this.options.afterCalculateLabelRotation, [this]);\n }\n afterAutoSkip() {}\n beforeFit() {\n callback(this.options.beforeFit, [this]);\n }\n fit() {\n const minSize = {\n width: 0,\n height: 0\n };\n const chart = this.chart,\n _this$options4 = this.options,\n tickOpts = _this$options4.ticks,\n titleOpts = _this$options4.title,\n gridOpts = _this$options4.grid;\n const display = this._isVisible();\n const isHorizontal = this.isHorizontal();\n if (display) {\n const titleHeight = getTitleHeight(titleOpts, chart.options.font);\n if (isHorizontal) {\n minSize.width = this.maxWidth;\n minSize.height = getTickMarkLength(gridOpts) + titleHeight;\n } else {\n minSize.height = this.maxHeight;\n minSize.width = getTickMarkLength(gridOpts) + titleHeight;\n }\n if (tickOpts.display && this.ticks.length) {\n const _this$_getLabelSizes = this._getLabelSizes(),\n first = _this$_getLabelSizes.first,\n last = _this$_getLabelSizes.last,\n widest = _this$_getLabelSizes.widest,\n highest = _this$_getLabelSizes.highest;\n const tickPadding = tickOpts.padding * 2;\n const angleRadians = toRadians(this.labelRotation);\n const cos = Math.cos(angleRadians);\n const sin = Math.sin(angleRadians);\n if (isHorizontal) {\n const labelHeight = tickOpts.mirror ? 0 : sin * widest.width + cos * highest.height;\n minSize.height = Math.min(this.maxHeight, minSize.height + labelHeight + tickPadding);\n } else {\n const labelWidth = tickOpts.mirror ? 0 : cos * widest.width + sin * highest.height;\n minSize.width = Math.min(this.maxWidth, minSize.width + labelWidth + tickPadding);\n }\n this._calculatePadding(first, last, sin, cos);\n }\n }\n this._handleMargins();\n if (isHorizontal) {\n this.width = this._length = chart.width - this._margins.left - this._margins.right;\n this.height = minSize.height;\n } else {\n this.width = minSize.width;\n this.height = this._length = chart.height - this._margins.top - this._margins.bottom;\n }\n }\n _calculatePadding(first, last, sin, cos) {\n const _this$options5 = this.options,\n _this$options5$ticks = _this$options5.ticks,\n align = _this$options5$ticks.align,\n padding = _this$options5$ticks.padding,\n position = _this$options5.position;\n const isRotated = this.labelRotation !== 0;\n const labelsBelowTicks = position !== 'top' && this.axis === 'x';\n if (this.isHorizontal()) {\n const offsetLeft = this.getPixelForTick(0) - this.left;\n const offsetRight = this.right - this.getPixelForTick(this.ticks.length - 1);\n let paddingLeft = 0;\n let paddingRight = 0;\n if (isRotated) {\n if (labelsBelowTicks) {\n paddingLeft = cos * first.width;\n paddingRight = sin * last.height;\n } else {\n paddingLeft = sin * first.height;\n paddingRight = cos * last.width;\n }\n } else if (align === 'start') {\n paddingRight = last.width;\n } else if (align === 'end') {\n paddingLeft = first.width;\n } else if (align !== 'inner') {\n paddingLeft = first.width / 2;\n paddingRight = last.width / 2;\n }\n this.paddingLeft = Math.max((paddingLeft - offsetLeft + padding) * this.width / (this.width - offsetLeft), 0);\n this.paddingRight = Math.max((paddingRight - offsetRight + padding) * this.width / (this.width - offsetRight), 0);\n } else {\n let paddingTop = last.height / 2;\n let paddingBottom = first.height / 2;\n if (align === 'start') {\n paddingTop = 0;\n paddingBottom = first.height;\n } else if (align === 'end') {\n paddingTop = last.height;\n paddingBottom = 0;\n }\n this.paddingTop = paddingTop + padding;\n this.paddingBottom = paddingBottom + padding;\n }\n }\n _handleMargins() {\n if (this._margins) {\n this._margins.left = Math.max(this.paddingLeft, this._margins.left);\n this._margins.top = Math.max(this.paddingTop, this._margins.top);\n this._margins.right = Math.max(this.paddingRight, this._margins.right);\n this._margins.bottom = Math.max(this.paddingBottom, this._margins.bottom);\n }\n }\n afterFit() {\n callback(this.options.afterFit, [this]);\n }\n isHorizontal() {\n const _this$options6 = this.options,\n axis = _this$options6.axis,\n position = _this$options6.position;\n return position === 'top' || position === 'bottom' || axis === 'x';\n }\n isFullSize() {\n return this.options.fullSize;\n }\n _convertTicksToLabels(ticks) {\n this.beforeTickToLabelConversion();\n this.generateTickLabels(ticks);\n let i, ilen;\n for (i = 0, ilen = ticks.length; i < ilen; i++) {\n if (isNullOrUndef(ticks[i].label)) {\n ticks.splice(i, 1);\n ilen--;\n i--;\n }\n }\n this.afterTickToLabelConversion();\n }\n _getLabelSizes() {\n let labelSizes = this._labelSizes;\n if (!labelSizes) {\n const sampleSize = this.options.ticks.sampleSize;\n let ticks = this.ticks;\n if (sampleSize < ticks.length) {\n ticks = sample(ticks, sampleSize);\n }\n this._labelSizes = labelSizes = this._computeLabelSizes(ticks, ticks.length);\n }\n return labelSizes;\n }\n _computeLabelSizes(ticks, length) {\n const ctx = this.ctx,\n caches = this._longestTextCache;\n const widths = [];\n const heights = [];\n let widestLabelSize = 0;\n let highestLabelSize = 0;\n let i, j, jlen, label, tickFont, fontString, cache, lineHeight, width, height, nestedLabel;\n for (i = 0; i < length; ++i) {\n label = ticks[i].label;\n tickFont = this._resolveTickFontOptions(i);\n ctx.font = fontString = tickFont.string;\n cache = caches[fontString] = caches[fontString] || {\n data: {},\n gc: []\n };\n lineHeight = tickFont.lineHeight;\n width = height = 0;\n if (!isNullOrUndef(label) && !isArray(label)) {\n width = _measureText(ctx, cache.data, cache.gc, width, label);\n height = lineHeight;\n } else if (isArray(label)) {\n for (j = 0, jlen = label.length; j < jlen; ++j) {\n nestedLabel = label[j];\n if (!isNullOrUndef(nestedLabel) && !isArray(nestedLabel)) {\n width = _measureText(ctx, cache.data, cache.gc, width, nestedLabel);\n height += lineHeight;\n }\n }\n }\n widths.push(width);\n heights.push(height);\n widestLabelSize = Math.max(width, widestLabelSize);\n highestLabelSize = Math.max(height, highestLabelSize);\n }\n garbageCollect(caches, length);\n const widest = widths.indexOf(widestLabelSize);\n const highest = heights.indexOf(highestLabelSize);\n const valueAt = idx => ({\n width: widths[idx] || 0,\n height: heights[idx] || 0\n });\n return {\n first: valueAt(0),\n last: valueAt(length - 1),\n widest: valueAt(widest),\n highest: valueAt(highest),\n widths,\n heights\n };\n }\n getLabelForValue(value) {\n return value;\n }\n getPixelForValue(value, index) {\n return NaN;\n }\n getValueForPixel(pixel) {}\n getPixelForTick(index) {\n const ticks = this.ticks;\n if (index < 0 || index > ticks.length - 1) {\n return null;\n }\n return this.getPixelForValue(ticks[index].value);\n }\n getPixelForDecimal(decimal) {\n if (this._reversePixels) {\n decimal = 1 - decimal;\n }\n const pixel = this._startPixel + decimal * this._length;\n return _int16Range(this._alignToPixels ? _alignPixel(this.chart, pixel, 0) : pixel);\n }\n getDecimalForPixel(pixel) {\n const decimal = (pixel - this._startPixel) / this._length;\n return this._reversePixels ? 1 - decimal : decimal;\n }\n getBasePixel() {\n return this.getPixelForValue(this.getBaseValue());\n }\n getBaseValue() {\n const min = this.min,\n max = this.max;\n return min < 0 && max < 0 ? max : min > 0 && max > 0 ? min : 0;\n }\n getContext(index) {\n const ticks = this.ticks || [];\n if (index >= 0 && index < ticks.length) {\n const tick = ticks[index];\n return tick.$context || (tick.$context = createTickContext(this.getContext(), index, tick));\n }\n return this.$context || (this.$context = createScaleContext(this.chart.getContext(), this));\n }\n _tickSize() {\n const optionTicks = this.options.ticks;\n const rot = toRadians(this.labelRotation);\n const cos = Math.abs(Math.cos(rot));\n const sin = Math.abs(Math.sin(rot));\n const labelSizes = this._getLabelSizes();\n const padding = optionTicks.autoSkipPadding || 0;\n const w = labelSizes ? labelSizes.widest.width + padding : 0;\n const h = labelSizes ? labelSizes.highest.height + padding : 0;\n return this.isHorizontal() ? h * cos > w * sin ? w / cos : h / sin : h * sin < w * cos ? h / cos : w / sin;\n }\n _isVisible() {\n const display = this.options.display;\n if (display !== 'auto') {\n return !!display;\n }\n return this.getMatchingVisibleMetas().length > 0;\n }\n _computeGridLineItems(chartArea) {\n const axis = this.axis;\n const chart = this.chart;\n const options = this.options;\n const grid = options.grid,\n position = options.position;\n const offset = grid.offset;\n const isHorizontal = this.isHorizontal();\n const ticks = this.ticks;\n const ticksLength = ticks.length + (offset ? 1 : 0);\n const tl = getTickMarkLength(grid);\n const items = [];\n const borderOpts = grid.setContext(this.getContext());\n const axisWidth = borderOpts.drawBorder ? borderOpts.borderWidth : 0;\n const axisHalfWidth = axisWidth / 2;\n const alignBorderValue = function (pixel) {\n return _alignPixel(chart, pixel, axisWidth);\n };\n let borderValue, i, lineValue, alignedLineValue;\n let tx1, ty1, tx2, ty2, x1, y1, x2, y2;\n if (position === 'top') {\n borderValue = alignBorderValue(this.bottom);\n ty1 = this.bottom - tl;\n ty2 = borderValue - axisHalfWidth;\n y1 = alignBorderValue(chartArea.top) + axisHalfWidth;\n y2 = chartArea.bottom;\n } else if (position === 'bottom') {\n borderValue = alignBorderValue(this.top);\n y1 = chartArea.top;\n y2 = alignBorderValue(chartArea.bottom) - axisHalfWidth;\n ty1 = borderValue + axisHalfWidth;\n ty2 = this.top + tl;\n } else if (position === 'left') {\n borderValue = alignBorderValue(this.right);\n tx1 = this.right - tl;\n tx2 = borderValue - axisHalfWidth;\n x1 = alignBorderValue(chartArea.left) + axisHalfWidth;\n x2 = chartArea.right;\n } else if (position === 'right') {\n borderValue = alignBorderValue(this.left);\n x1 = chartArea.left;\n x2 = alignBorderValue(chartArea.right) - axisHalfWidth;\n tx1 = borderValue + axisHalfWidth;\n tx2 = this.left + tl;\n } else if (axis === 'x') {\n if (position === 'center') {\n borderValue = alignBorderValue((chartArea.top + chartArea.bottom) / 2 + 0.5);\n } else if (isObject(position)) {\n const positionAxisID = Object.keys(position)[0];\n const value = position[positionAxisID];\n borderValue = alignBorderValue(this.chart.scales[positionAxisID].getPixelForValue(value));\n }\n y1 = chartArea.top;\n y2 = chartArea.bottom;\n ty1 = borderValue + axisHalfWidth;\n ty2 = ty1 + tl;\n } else if (axis === 'y') {\n if (position === 'center') {\n borderValue = alignBorderValue((chartArea.left + chartArea.right) / 2);\n } else if (isObject(position)) {\n const positionAxisID = Object.keys(position)[0];\n const value = position[positionAxisID];\n borderValue = alignBorderValue(this.chart.scales[positionAxisID].getPixelForValue(value));\n }\n tx1 = borderValue - axisHalfWidth;\n tx2 = tx1 - tl;\n x1 = chartArea.left;\n x2 = chartArea.right;\n }\n const limit = valueOrDefault(options.ticks.maxTicksLimit, ticksLength);\n const step = Math.max(1, Math.ceil(ticksLength / limit));\n for (i = 0; i < ticksLength; i += step) {\n const optsAtIndex = grid.setContext(this.getContext(i));\n const lineWidth = optsAtIndex.lineWidth;\n const lineColor = optsAtIndex.color;\n const borderDash = optsAtIndex.borderDash || [];\n const borderDashOffset = optsAtIndex.borderDashOffset;\n const tickWidth = optsAtIndex.tickWidth;\n const tickColor = optsAtIndex.tickColor;\n const tickBorderDash = optsAtIndex.tickBorderDash || [];\n const tickBorderDashOffset = optsAtIndex.tickBorderDashOffset;\n lineValue = getPixelForGridLine(this, i, offset);\n if (lineValue === undefined) {\n continue;\n }\n alignedLineValue = _alignPixel(chart, lineValue, lineWidth);\n if (isHorizontal) {\n tx1 = tx2 = x1 = x2 = alignedLineValue;\n } else {\n ty1 = ty2 = y1 = y2 = alignedLineValue;\n }\n items.push({\n tx1,\n ty1,\n tx2,\n ty2,\n x1,\n y1,\n x2,\n y2,\n width: lineWidth,\n color: lineColor,\n borderDash,\n borderDashOffset,\n tickWidth,\n tickColor,\n tickBorderDash,\n tickBorderDashOffset\n });\n }\n this._ticksLength = ticksLength;\n this._borderValue = borderValue;\n return items;\n }\n _computeLabelItems(chartArea) {\n const axis = this.axis;\n const options = this.options;\n const position = options.position,\n optionTicks = options.ticks;\n const isHorizontal = this.isHorizontal();\n const ticks = this.ticks;\n const align = optionTicks.align,\n crossAlign = optionTicks.crossAlign,\n padding = optionTicks.padding,\n mirror = optionTicks.mirror;\n const tl = getTickMarkLength(options.grid);\n const tickAndPadding = tl + padding;\n const hTickAndPadding = mirror ? -padding : tickAndPadding;\n const rotation = -toRadians(this.labelRotation);\n const items = [];\n let i, ilen, tick, label, x, y, textAlign, pixel, font, lineHeight, lineCount, textOffset;\n let textBaseline = 'middle';\n if (position === 'top') {\n y = this.bottom - hTickAndPadding;\n textAlign = this._getXAxisLabelAlignment();\n } else if (position === 'bottom') {\n y = this.top + hTickAndPadding;\n textAlign = this._getXAxisLabelAlignment();\n } else if (position === 'left') {\n const ret = this._getYAxisLabelAlignment(tl);\n textAlign = ret.textAlign;\n x = ret.x;\n } else if (position === 'right') {\n const ret = this._getYAxisLabelAlignment(tl);\n textAlign = ret.textAlign;\n x = ret.x;\n } else if (axis === 'x') {\n if (position === 'center') {\n y = (chartArea.top + chartArea.bottom) / 2 + tickAndPadding;\n } else if (isObject(position)) {\n const positionAxisID = Object.keys(position)[0];\n const value = position[positionAxisID];\n y = this.chart.scales[positionAxisID].getPixelForValue(value) + tickAndPadding;\n }\n textAlign = this._getXAxisLabelAlignment();\n } else if (axis === 'y') {\n if (position === 'center') {\n x = (chartArea.left + chartArea.right) / 2 - tickAndPadding;\n } else if (isObject(position)) {\n const positionAxisID = Object.keys(position)[0];\n const value = position[positionAxisID];\n x = this.chart.scales[positionAxisID].getPixelForValue(value);\n }\n textAlign = this._getYAxisLabelAlignment(tl).textAlign;\n }\n if (axis === 'y') {\n if (align === 'start') {\n textBaseline = 'top';\n } else if (align === 'end') {\n textBaseline = 'bottom';\n }\n }\n const labelSizes = this._getLabelSizes();\n for (i = 0, ilen = ticks.length; i < ilen; ++i) {\n tick = ticks[i];\n label = tick.label;\n const optsAtIndex = optionTicks.setContext(this.getContext(i));\n pixel = this.getPixelForTick(i) + optionTicks.labelOffset;\n font = this._resolveTickFontOptions(i);\n lineHeight = font.lineHeight;\n lineCount = isArray(label) ? label.length : 1;\n const halfCount = lineCount / 2;\n const color = optsAtIndex.color;\n const strokeColor = optsAtIndex.textStrokeColor;\n const strokeWidth = optsAtIndex.textStrokeWidth;\n let tickTextAlign = textAlign;\n if (isHorizontal) {\n x = pixel;\n if (textAlign === 'inner') {\n if (i === ilen - 1) {\n tickTextAlign = !this.options.reverse ? 'right' : 'left';\n } else if (i === 0) {\n tickTextAlign = !this.options.reverse ? 'left' : 'right';\n } else {\n tickTextAlign = 'center';\n }\n }\n if (position === 'top') {\n if (crossAlign === 'near' || rotation !== 0) {\n textOffset = -lineCount * lineHeight + lineHeight / 2;\n } else if (crossAlign === 'center') {\n textOffset = -labelSizes.highest.height / 2 - halfCount * lineHeight + lineHeight;\n } else {\n textOffset = -labelSizes.highest.height + lineHeight / 2;\n }\n } else {\n if (crossAlign === 'near' || rotation !== 0) {\n textOffset = lineHeight / 2;\n } else if (crossAlign === 'center') {\n textOffset = labelSizes.highest.height / 2 - halfCount * lineHeight;\n } else {\n textOffset = labelSizes.highest.height - lineCount * lineHeight;\n }\n }\n if (mirror) {\n textOffset *= -1;\n }\n } else {\n y = pixel;\n textOffset = (1 - lineCount) * lineHeight / 2;\n }\n let backdrop;\n if (optsAtIndex.showLabelBackdrop) {\n const labelPadding = toPadding(optsAtIndex.backdropPadding);\n const height = labelSizes.heights[i];\n const width = labelSizes.widths[i];\n let top = y + textOffset - labelPadding.top;\n let left = x - labelPadding.left;\n switch (textBaseline) {\n case 'middle':\n top -= height / 2;\n break;\n case 'bottom':\n top -= height;\n break;\n }\n switch (textAlign) {\n case 'center':\n left -= width / 2;\n break;\n case 'right':\n left -= width;\n break;\n }\n backdrop = {\n left,\n top,\n width: width + labelPadding.width,\n height: height + labelPadding.height,\n color: optsAtIndex.backdropColor\n };\n }\n items.push({\n rotation,\n label,\n font,\n color,\n strokeColor,\n strokeWidth,\n textOffset,\n textAlign: tickTextAlign,\n textBaseline,\n translation: [x, y],\n backdrop\n });\n }\n return items;\n }\n _getXAxisLabelAlignment() {\n const _this$options7 = this.options,\n position = _this$options7.position,\n ticks = _this$options7.ticks;\n const rotation = -toRadians(this.labelRotation);\n if (rotation) {\n return position === 'top' ? 'left' : 'right';\n }\n let align = 'center';\n if (ticks.align === 'start') {\n align = 'left';\n } else if (ticks.align === 'end') {\n align = 'right';\n } else if (ticks.align === 'inner') {\n align = 'inner';\n }\n return align;\n }\n _getYAxisLabelAlignment(tl) {\n const _this$options8 = this.options,\n position = _this$options8.position,\n _this$options8$ticks = _this$options8.ticks,\n crossAlign = _this$options8$ticks.crossAlign,\n mirror = _this$options8$ticks.mirror,\n padding = _this$options8$ticks.padding;\n const labelSizes = this._getLabelSizes();\n const tickAndPadding = tl + padding;\n const widest = labelSizes.widest.width;\n let textAlign;\n let x;\n if (position === 'left') {\n if (mirror) {\n x = this.right + padding;\n if (crossAlign === 'near') {\n textAlign = 'left';\n } else if (crossAlign === 'center') {\n textAlign = 'center';\n x += widest / 2;\n } else {\n textAlign = 'right';\n x += widest;\n }\n } else {\n x = this.right - tickAndPadding;\n if (crossAlign === 'near') {\n textAlign = 'right';\n } else if (crossAlign === 'center') {\n textAlign = 'center';\n x -= widest / 2;\n } else {\n textAlign = 'left';\n x = this.left;\n }\n }\n } else if (position === 'right') {\n if (mirror) {\n x = this.left + padding;\n if (crossAlign === 'near') {\n textAlign = 'right';\n } else if (crossAlign === 'center') {\n textAlign = 'center';\n x -= widest / 2;\n } else {\n textAlign = 'left';\n x -= widest;\n }\n } else {\n x = this.left + tickAndPadding;\n if (crossAlign === 'near') {\n textAlign = 'left';\n } else if (crossAlign === 'center') {\n textAlign = 'center';\n x += widest / 2;\n } else {\n textAlign = 'right';\n x = this.right;\n }\n }\n } else {\n textAlign = 'right';\n }\n return {\n textAlign,\n x\n };\n }\n _computeLabelArea() {\n if (this.options.ticks.mirror) {\n return;\n }\n const chart = this.chart;\n const position = this.options.position;\n if (position === 'left' || position === 'right') {\n return {\n top: 0,\n left: this.left,\n bottom: chart.height,\n right: this.right\n };\n }\n if (position === 'top' || position === 'bottom') {\n return {\n top: this.top,\n left: 0,\n bottom: this.bottom,\n right: chart.width\n };\n }\n }\n drawBackground() {\n const ctx = this.ctx,\n backgroundColor = this.options.backgroundColor,\n left = this.left,\n top = this.top,\n width = this.width,\n height = this.height;\n if (backgroundColor) {\n ctx.save();\n ctx.fillStyle = backgroundColor;\n ctx.fillRect(left, top, width, height);\n ctx.restore();\n }\n }\n getLineWidthForValue(value) {\n const grid = this.options.grid;\n if (!this._isVisible() || !grid.display) {\n return 0;\n }\n const ticks = this.ticks;\n const index = ticks.findIndex(t => t.value === value);\n if (index >= 0) {\n const opts = grid.setContext(this.getContext(index));\n return opts.lineWidth;\n }\n return 0;\n }\n drawGrid(chartArea) {\n const grid = this.options.grid;\n const ctx = this.ctx;\n const items = this._gridLineItems || (this._gridLineItems = this._computeGridLineItems(chartArea));\n let i, ilen;\n const drawLine = (p1, p2, style) => {\n if (!style.width || !style.color) {\n return;\n }\n ctx.save();\n ctx.lineWidth = style.width;\n ctx.strokeStyle = style.color;\n ctx.setLineDash(style.borderDash || []);\n ctx.lineDashOffset = style.borderDashOffset;\n ctx.beginPath();\n ctx.moveTo(p1.x, p1.y);\n ctx.lineTo(p2.x, p2.y);\n ctx.stroke();\n ctx.restore();\n };\n if (grid.display) {\n for (i = 0, ilen = items.length; i < ilen; ++i) {\n const item = items[i];\n if (grid.drawOnChartArea) {\n drawLine({\n x: item.x1,\n y: item.y1\n }, {\n x: item.x2,\n y: item.y2\n }, item);\n }\n if (grid.drawTicks) {\n drawLine({\n x: item.tx1,\n y: item.ty1\n }, {\n x: item.tx2,\n y: item.ty2\n }, {\n color: item.tickColor,\n width: item.tickWidth,\n borderDash: item.tickBorderDash,\n borderDashOffset: item.tickBorderDashOffset\n });\n }\n }\n }\n }\n drawBorder() {\n const chart = this.chart,\n ctx = this.ctx,\n grid = this.options.grid;\n const borderOpts = grid.setContext(this.getContext());\n const axisWidth = grid.drawBorder ? borderOpts.borderWidth : 0;\n if (!axisWidth) {\n return;\n }\n const lastLineWidth = grid.setContext(this.getContext(0)).lineWidth;\n const borderValue = this._borderValue;\n let x1, x2, y1, y2;\n if (this.isHorizontal()) {\n x1 = _alignPixel(chart, this.left, axisWidth) - axisWidth / 2;\n x2 = _alignPixel(chart, this.right, lastLineWidth) + lastLineWidth / 2;\n y1 = y2 = borderValue;\n } else {\n y1 = _alignPixel(chart, this.top, axisWidth) - axisWidth / 2;\n y2 = _alignPixel(chart, this.bottom, lastLineWidth) + lastLineWidth / 2;\n x1 = x2 = borderValue;\n }\n ctx.save();\n ctx.lineWidth = borderOpts.borderWidth;\n ctx.strokeStyle = borderOpts.borderColor;\n ctx.beginPath();\n ctx.moveTo(x1, y1);\n ctx.lineTo(x2, y2);\n ctx.stroke();\n ctx.restore();\n }\n drawLabels(chartArea) {\n const optionTicks = this.options.ticks;\n if (!optionTicks.display) {\n return;\n }\n const ctx = this.ctx;\n const area = this._computeLabelArea();\n if (area) {\n clipArea(ctx, area);\n }\n const items = this._labelItems || (this._labelItems = this._computeLabelItems(chartArea));\n let i, ilen;\n for (i = 0, ilen = items.length; i < ilen; ++i) {\n const item = items[i];\n const tickFont = item.font;\n const label = item.label;\n if (item.backdrop) {\n ctx.fillStyle = item.backdrop.color;\n ctx.fillRect(item.backdrop.left, item.backdrop.top, item.backdrop.width, item.backdrop.height);\n }\n let y = item.textOffset;\n renderText(ctx, label, 0, y, tickFont, item);\n }\n if (area) {\n unclipArea(ctx);\n }\n }\n drawTitle() {\n const ctx = this.ctx,\n _this$options9 = this.options,\n position = _this$options9.position,\n title = _this$options9.title,\n reverse = _this$options9.reverse;\n if (!title.display) {\n return;\n }\n const font = toFont(title.font);\n const padding = toPadding(title.padding);\n const align = title.align;\n let offset = font.lineHeight / 2;\n if (position === 'bottom' || position === 'center' || isObject(position)) {\n offset += padding.bottom;\n if (isArray(title.text)) {\n offset += font.lineHeight * (title.text.length - 1);\n }\n } else {\n offset += padding.top;\n }\n const _titleArgs = titleArgs(this, offset, position, align),\n titleX = _titleArgs.titleX,\n titleY = _titleArgs.titleY,\n maxWidth = _titleArgs.maxWidth,\n rotation = _titleArgs.rotation;\n renderText(ctx, title.text, 0, 0, font, {\n color: title.color,\n maxWidth,\n rotation,\n textAlign: titleAlign(align, position, reverse),\n textBaseline: 'middle',\n translation: [titleX, titleY]\n });\n }\n draw(chartArea) {\n if (!this._isVisible()) {\n return;\n }\n this.drawBackground();\n this.drawGrid(chartArea);\n this.drawBorder();\n this.drawTitle();\n this.drawLabels(chartArea);\n }\n _layers() {\n const opts = this.options;\n const tz = opts.ticks && opts.ticks.z || 0;\n const gz = valueOrDefault(opts.grid && opts.grid.z, -1);\n if (!this._isVisible() || this.draw !== Scale.prototype.draw) {\n return [{\n z: tz,\n draw: chartArea => {\n this.draw(chartArea);\n }\n }];\n }\n return [{\n z: gz,\n draw: chartArea => {\n this.drawBackground();\n this.drawGrid(chartArea);\n this.drawTitle();\n }\n }, {\n z: gz + 1,\n draw: () => {\n this.drawBorder();\n }\n }, {\n z: tz,\n draw: chartArea => {\n this.drawLabels(chartArea);\n }\n }];\n }\n getMatchingVisibleMetas(type) {\n const metas = this.chart.getSortedVisibleDatasetMetas();\n const axisID = this.axis + 'AxisID';\n const result = [];\n let i, ilen;\n for (i = 0, ilen = metas.length; i < ilen; ++i) {\n const meta = metas[i];\n if (meta[axisID] === this.id && (!type || meta.type === type)) {\n result.push(meta);\n }\n }\n return result;\n }\n _resolveTickFontOptions(index) {\n const opts = this.options.ticks.setContext(this.getContext(index));\n return toFont(opts.font);\n }\n _maxDigits() {\n const fontSize = this._resolveTickFontOptions(0).lineHeight;\n return (this.isHorizontal() ? this.width : this.height) / fontSize;\n }\n}\nclass TypedRegistry {\n constructor(type, scope, override) {\n this.type = type;\n this.scope = scope;\n this.override = override;\n this.items = Object.create(null);\n }\n isForType(type) {\n return Object.prototype.isPrototypeOf.call(this.type.prototype, type.prototype);\n }\n register(item) {\n const proto = Object.getPrototypeOf(item);\n let parentScope;\n if (isIChartComponent(proto)) {\n parentScope = this.register(proto);\n }\n const items = this.items;\n const id = item.id;\n const scope = this.scope + '.' + id;\n if (!id) {\n throw new Error('class does not have id: ' + item);\n }\n if (id in items) {\n return scope;\n }\n items[id] = item;\n registerDefaults(item, scope, parentScope);\n if (this.override) {\n defaults.override(item.id, item.overrides);\n }\n return scope;\n }\n get(id) {\n return this.items[id];\n }\n unregister(item) {\n const items = this.items;\n const id = item.id;\n const scope = this.scope;\n if (id in items) {\n delete items[id];\n }\n if (scope && id in defaults[scope]) {\n delete defaults[scope][id];\n if (this.override) {\n delete overrides[id];\n }\n }\n }\n}\nfunction registerDefaults(item, scope, parentScope) {\n const itemDefaults = merge(Object.create(null), [parentScope ? defaults.get(parentScope) : {}, defaults.get(scope), item.defaults]);\n defaults.set(scope, itemDefaults);\n if (item.defaultRoutes) {\n routeDefaults(scope, item.defaultRoutes);\n }\n if (item.descriptors) {\n defaults.describe(scope, item.descriptors);\n }\n}\nfunction routeDefaults(scope, routes) {\n Object.keys(routes).forEach(property => {\n const propertyParts = property.split('.');\n const sourceName = propertyParts.pop();\n const sourceScope = [scope].concat(propertyParts).join('.');\n const parts = routes[property].split('.');\n const targetName = parts.pop();\n const targetScope = parts.join('.');\n defaults.route(sourceScope, sourceName, targetScope, targetName);\n });\n}\nfunction isIChartComponent(proto) {\n return 'id' in proto && 'defaults' in proto;\n}\nclass Registry {\n constructor() {\n this.controllers = new TypedRegistry(DatasetController, 'datasets', true);\n this.elements = new TypedRegistry(Element, 'elements');\n this.plugins = new TypedRegistry(Object, 'plugins');\n this.scales = new TypedRegistry(Scale, 'scales');\n this._typedRegistries = [this.controllers, this.scales, this.elements];\n }\n add() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n this._each('register', args);\n }\n remove() {\n for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {\n args[_key2] = arguments[_key2];\n }\n this._each('unregister', args);\n }\n addControllers() {\n for (var _len3 = arguments.length, args = new Array(_len3), _key3 = 0; _key3 < _len3; _key3++) {\n args[_key3] = arguments[_key3];\n }\n this._each('register', args, this.controllers);\n }\n addElements() {\n for (var _len4 = arguments.length, args = new Array(_len4), _key4 = 0; _key4 < _len4; _key4++) {\n args[_key4] = arguments[_key4];\n }\n this._each('register', args, this.elements);\n }\n addPlugins() {\n for (var _len5 = arguments.length, args = new Array(_len5), _key5 = 0; _key5 < _len5; _key5++) {\n args[_key5] = arguments[_key5];\n }\n this._each('register', args, this.plugins);\n }\n addScales() {\n for (var _len6 = arguments.length, args = new Array(_len6), _key6 = 0; _key6 < _len6; _key6++) {\n args[_key6] = arguments[_key6];\n }\n this._each('register', args, this.scales);\n }\n getController(id) {\n return this._get(id, this.controllers, 'controller');\n }\n getElement(id) {\n return this._get(id, this.elements, 'element');\n }\n getPlugin(id) {\n return this._get(id, this.plugins, 'plugin');\n }\n getScale(id) {\n return this._get(id, this.scales, 'scale');\n }\n removeControllers() {\n for (var _len7 = arguments.length, args = new Array(_len7), _key7 = 0; _key7 < _len7; _key7++) {\n args[_key7] = arguments[_key7];\n }\n this._each('unregister', args, this.controllers);\n }\n removeElements() {\n for (var _len8 = arguments.length, args = new Array(_len8), _key8 = 0; _key8 < _len8; _key8++) {\n args[_key8] = arguments[_key8];\n }\n this._each('unregister', args, this.elements);\n }\n removePlugins() {\n for (var _len9 = arguments.length, args = new Array(_len9), _key9 = 0; _key9 < _len9; _key9++) {\n args[_key9] = arguments[_key9];\n }\n this._each('unregister', args, this.plugins);\n }\n removeScales() {\n for (var _len10 = arguments.length, args = new Array(_len10), _key10 = 0; _key10 < _len10; _key10++) {\n args[_key10] = arguments[_key10];\n }\n this._each('unregister', args, this.scales);\n }\n _each(method, args, typedRegistry) {\n [...args].forEach(arg => {\n const reg = typedRegistry || this._getRegistryForType(arg);\n if (typedRegistry || reg.isForType(arg) || reg === this.plugins && arg.id) {\n this._exec(method, reg, arg);\n } else {\n each(arg, item => {\n const itemReg = typedRegistry || this._getRegistryForType(item);\n this._exec(method, itemReg, item);\n });\n }\n });\n }\n _exec(method, registry, component) {\n const camelMethod = _capitalize(method);\n callback(component['before' + camelMethod], [], component);\n registry[method](component);\n callback(component['after' + camelMethod], [], component);\n }\n _getRegistryForType(type) {\n for (let i = 0; i < this._typedRegistries.length; i++) {\n const reg = this._typedRegistries[i];\n if (reg.isForType(type)) {\n return reg;\n }\n }\n return this.plugins;\n }\n _get(id, typedRegistry, type) {\n const item = typedRegistry.get(id);\n if (item === undefined) {\n throw new Error('\"' + id + '\" is not a registered ' + type + '.');\n }\n return item;\n }\n}\nvar registry = new Registry();\nclass ScatterController extends DatasetController {\n update(mode) {\n const meta = this._cachedMeta;\n const _meta$data2 = meta.data,\n points = _meta$data2 === void 0 ? [] : _meta$data2;\n const animationsDisabled = this.chart._animationsDisabled;\n let _getStartAndCountOfVi2 = _getStartAndCountOfVisiblePoints(meta, points, animationsDisabled),\n start = _getStartAndCountOfVi2.start,\n count = _getStartAndCountOfVi2.count;\n this._drawStart = start;\n this._drawCount = count;\n if (_scaleRangesChanged(meta)) {\n start = 0;\n count = points.length;\n }\n if (this.options.showLine) {\n const line = meta.dataset,\n _dataset = meta._dataset;\n line._chart = this.chart;\n line._datasetIndex = this.index;\n line._decimated = !!_dataset._decimated;\n line.points = points;\n const options = this.resolveDatasetElementOptions(mode);\n options.segment = this.options.segment;\n this.updateElement(line, undefined, {\n animated: !animationsDisabled,\n options\n }, mode);\n }\n this.updateElements(points, start, count, mode);\n }\n addElements() {\n const showLine = this.options.showLine;\n if (!this.datasetElementType && showLine) {\n this.datasetElementType = registry.getElement('line');\n }\n super.addElements();\n }\n updateElements(points, start, count, mode) {\n const reset = mode === 'reset';\n const _this$_cachedMeta4 = this._cachedMeta,\n iScale = _this$_cachedMeta4.iScale,\n vScale = _this$_cachedMeta4.vScale,\n _stacked = _this$_cachedMeta4._stacked,\n _dataset = _this$_cachedMeta4._dataset;\n const firstOpts = this.resolveDataElementOptions(start, mode);\n const sharedOptions = this.getSharedOptions(firstOpts);\n const includeOptions = this.includeOptions(mode, sharedOptions);\n const iAxis = iScale.axis;\n const vAxis = vScale.axis;\n const _this$options10 = this.options,\n spanGaps = _this$options10.spanGaps,\n segment = _this$options10.segment;\n const maxGapLength = isNumber(spanGaps) ? spanGaps : Number.POSITIVE_INFINITY;\n const directUpdate = this.chart._animationsDisabled || reset || mode === 'none';\n let prevParsed = start > 0 && this.getParsed(start - 1);\n for (let i = start; i < start + count; ++i) {\n const point = points[i];\n const parsed = this.getParsed(i);\n const properties = directUpdate ? point : {};\n const nullData = isNullOrUndef(parsed[vAxis]);\n const iPixel = properties[iAxis] = iScale.getPixelForValue(parsed[iAxis], i);\n const vPixel = properties[vAxis] = reset || nullData ? vScale.getBasePixel() : vScale.getPixelForValue(_stacked ? this.applyStack(vScale, parsed, _stacked) : parsed[vAxis], i);\n properties.skip = isNaN(iPixel) || isNaN(vPixel) || nullData;\n properties.stop = i > 0 && Math.abs(parsed[iAxis] - prevParsed[iAxis]) > maxGapLength;\n if (segment) {\n properties.parsed = parsed;\n properties.raw = _dataset.data[i];\n }\n if (includeOptions) {\n properties.options = sharedOptions || this.resolveDataElementOptions(i, point.active ? 'active' : mode);\n }\n if (!directUpdate) {\n this.updateElement(point, i, properties, mode);\n }\n prevParsed = parsed;\n }\n this.updateSharedOptions(sharedOptions, mode, firstOpts);\n }\n getMaxOverflow() {\n const meta = this._cachedMeta;\n const data = meta.data || [];\n if (!this.options.showLine) {\n let max = 0;\n for (let i = data.length - 1; i >= 0; --i) {\n max = Math.max(max, data[i].size(this.resolveDataElementOptions(i)) / 2);\n }\n return max > 0 && max;\n }\n const dataset = meta.dataset;\n const border = dataset.options && dataset.options.borderWidth || 0;\n if (!data.length) {\n return border;\n }\n const firstPoint = data[0].size(this.resolveDataElementOptions(0));\n const lastPoint = data[data.length - 1].size(this.resolveDataElementOptions(data.length - 1));\n return Math.max(border, firstPoint, lastPoint) / 2;\n }\n}\nScatterController.id = 'scatter';\nScatterController.defaults = {\n datasetElementType: false,\n dataElementType: 'point',\n showLine: false,\n fill: false\n};\nScatterController.overrides = {\n interaction: {\n mode: 'point'\n },\n plugins: {\n tooltip: {\n callbacks: {\n title() {\n return '';\n },\n label(item) {\n return '(' + item.label + ', ' + item.formattedValue + ')';\n }\n }\n }\n },\n scales: {\n x: {\n type: 'linear'\n },\n y: {\n type: 'linear'\n }\n }\n};\nvar controllers = /*#__PURE__*/Object.freeze({\n __proto__: null,\n BarController: BarController,\n BubbleController: BubbleController,\n DoughnutController: DoughnutController,\n LineController: LineController,\n PolarAreaController: PolarAreaController,\n PieController: PieController,\n RadarController: RadarController,\n ScatterController: ScatterController\n});\nfunction abstract() {\n throw new Error('This method is not implemented: Check that a complete date adapter is provided.');\n}\nclass DateAdapter {\n constructor(options) {\n this.options = options || {};\n }\n init(chartOptions) {}\n formats() {\n return abstract();\n }\n parse(value, format) {\n return abstract();\n }\n format(timestamp, format) {\n return abstract();\n }\n add(timestamp, amount, unit) {\n return abstract();\n }\n diff(a, b, unit) {\n return abstract();\n }\n startOf(timestamp, unit, weekday) {\n return abstract();\n }\n endOf(timestamp, unit) {\n return abstract();\n }\n}\nDateAdapter.override = function (members) {\n Object.assign(DateAdapter.prototype, members);\n};\nvar adapters = {\n _date: DateAdapter\n};\nfunction binarySearch(metaset, axis, value, intersect) {\n const controller = metaset.controller,\n data = metaset.data,\n _sorted = metaset._sorted;\n const iScale = controller._cachedMeta.iScale;\n if (iScale && axis === iScale.axis && axis !== 'r' && _sorted && data.length) {\n const lookupMethod = iScale._reversePixels ? _rlookupByKey : _lookupByKey;\n if (!intersect) {\n return lookupMethod(data, axis, value);\n } else if (controller._sharedOptions) {\n const el = data[0];\n const range = typeof el.getRange === 'function' && el.getRange(axis);\n if (range) {\n const start = lookupMethod(data, axis, value - range);\n const end = lookupMethod(data, axis, value + range);\n return {\n lo: start.lo,\n hi: end.hi\n };\n }\n }\n }\n return {\n lo: 0,\n hi: data.length - 1\n };\n}\nfunction evaluateInteractionItems(chart, axis, position, handler, intersect) {\n const metasets = chart.getSortedVisibleDatasetMetas();\n const value = position[axis];\n for (let i = 0, ilen = metasets.length; i < ilen; ++i) {\n const _metasets$i = metasets[i],\n index = _metasets$i.index,\n data = _metasets$i.data;\n const _binarySearch = binarySearch(metasets[i], axis, value, intersect),\n lo = _binarySearch.lo,\n hi = _binarySearch.hi;\n for (let j = lo; j <= hi; ++j) {\n const element = data[j];\n if (!element.skip) {\n handler(element, index, j);\n }\n }\n }\n}\nfunction getDistanceMetricForAxis(axis) {\n const useX = axis.indexOf('x') !== -1;\n const useY = axis.indexOf('y') !== -1;\n return function (pt1, pt2) {\n const deltaX = useX ? Math.abs(pt1.x - pt2.x) : 0;\n const deltaY = useY ? Math.abs(pt1.y - pt2.y) : 0;\n return Math.sqrt(Math.pow(deltaX, 2) + Math.pow(deltaY, 2));\n };\n}\nfunction getIntersectItems(chart, position, axis, useFinalPosition, includeInvisible) {\n const items = [];\n if (!includeInvisible && !chart.isPointInArea(position)) {\n return items;\n }\n const evaluationFunc = function (element, datasetIndex, index) {\n if (!includeInvisible && !_isPointInArea(element, chart.chartArea, 0)) {\n return;\n }\n if (element.inRange(position.x, position.y, useFinalPosition)) {\n items.push({\n element,\n datasetIndex,\n index\n });\n }\n };\n evaluateInteractionItems(chart, axis, position, evaluationFunc, true);\n return items;\n}\nfunction getNearestRadialItems(chart, position, axis, useFinalPosition) {\n let items = [];\n function evaluationFunc(element, datasetIndex, index) {\n const _element$getProps = element.getProps(['startAngle', 'endAngle'], useFinalPosition),\n startAngle = _element$getProps.startAngle,\n endAngle = _element$getProps.endAngle;\n const _getAngleFromPoint = getAngleFromPoint(element, {\n x: position.x,\n y: position.y\n }),\n angle = _getAngleFromPoint.angle;\n if (_angleBetween(angle, startAngle, endAngle)) {\n items.push({\n element,\n datasetIndex,\n index\n });\n }\n }\n evaluateInteractionItems(chart, axis, position, evaluationFunc);\n return items;\n}\nfunction getNearestCartesianItems(chart, position, axis, intersect, useFinalPosition, includeInvisible) {\n let items = [];\n const distanceMetric = getDistanceMetricForAxis(axis);\n let minDistance = Number.POSITIVE_INFINITY;\n function evaluationFunc(element, datasetIndex, index) {\n const inRange = element.inRange(position.x, position.y, useFinalPosition);\n if (intersect && !inRange) {\n return;\n }\n const center = element.getCenterPoint(useFinalPosition);\n const pointInArea = !!includeInvisible || chart.isPointInArea(center);\n if (!pointInArea && !inRange) {\n return;\n }\n const distance = distanceMetric(position, center);\n if (distance < minDistance) {\n items = [{\n element,\n datasetIndex,\n index\n }];\n minDistance = distance;\n } else if (distance === minDistance) {\n items.push({\n element,\n datasetIndex,\n index\n });\n }\n }\n evaluateInteractionItems(chart, axis, position, evaluationFunc);\n return items;\n}\nfunction getNearestItems(chart, position, axis, intersect, useFinalPosition, includeInvisible) {\n if (!includeInvisible && !chart.isPointInArea(position)) {\n return [];\n }\n return axis === 'r' && !intersect ? getNearestRadialItems(chart, position, axis, useFinalPosition) : getNearestCartesianItems(chart, position, axis, intersect, useFinalPosition, includeInvisible);\n}\nfunction getAxisItems(chart, position, axis, intersect, useFinalPosition) {\n const items = [];\n const rangeMethod = axis === 'x' ? 'inXRange' : 'inYRange';\n let intersectsItem = false;\n evaluateInteractionItems(chart, axis, position, (element, datasetIndex, index) => {\n if (element[rangeMethod](position[axis], useFinalPosition)) {\n items.push({\n element,\n datasetIndex,\n index\n });\n intersectsItem = intersectsItem || element.inRange(position.x, position.y, useFinalPosition);\n }\n });\n if (intersect && !intersectsItem) {\n return [];\n }\n return items;\n}\nvar Interaction = {\n evaluateInteractionItems,\n modes: {\n index(chart, e, options, useFinalPosition) {\n const position = getRelativePosition(e, chart);\n const axis = options.axis || 'x';\n const includeInvisible = options.includeInvisible || false;\n const items = options.intersect ? getIntersectItems(chart, position, axis, useFinalPosition, includeInvisible) : getNearestItems(chart, position, axis, false, useFinalPosition, includeInvisible);\n const elements = [];\n if (!items.length) {\n return [];\n }\n chart.getSortedVisibleDatasetMetas().forEach(meta => {\n const index = items[0].index;\n const element = meta.data[index];\n if (element && !element.skip) {\n elements.push({\n element,\n datasetIndex: meta.index,\n index\n });\n }\n });\n return elements;\n },\n dataset(chart, e, options, useFinalPosition) {\n const position = getRelativePosition(e, chart);\n const axis = options.axis || 'xy';\n const includeInvisible = options.includeInvisible || false;\n let items = options.intersect ? getIntersectItems(chart, position, axis, useFinalPosition, includeInvisible) : getNearestItems(chart, position, axis, false, useFinalPosition, includeInvisible);\n if (items.length > 0) {\n const datasetIndex = items[0].datasetIndex;\n const data = chart.getDatasetMeta(datasetIndex).data;\n items = [];\n for (let i = 0; i < data.length; ++i) {\n items.push({\n element: data[i],\n datasetIndex,\n index: i\n });\n }\n }\n return items;\n },\n point(chart, e, options, useFinalPosition) {\n const position = getRelativePosition(e, chart);\n const axis = options.axis || 'xy';\n const includeInvisible = options.includeInvisible || false;\n return getIntersectItems(chart, position, axis, useFinalPosition, includeInvisible);\n },\n nearest(chart, e, options, useFinalPosition) {\n const position = getRelativePosition(e, chart);\n const axis = options.axis || 'xy';\n const includeInvisible = options.includeInvisible || false;\n return getNearestItems(chart, position, axis, options.intersect, useFinalPosition, includeInvisible);\n },\n x(chart, e, options, useFinalPosition) {\n const position = getRelativePosition(e, chart);\n return getAxisItems(chart, position, 'x', options.intersect, useFinalPosition);\n },\n y(chart, e, options, useFinalPosition) {\n const position = getRelativePosition(e, chart);\n return getAxisItems(chart, position, 'y', options.intersect, useFinalPosition);\n }\n }\n};\nconst STATIC_POSITIONS = ['left', 'top', 'right', 'bottom'];\nfunction filterByPosition(array, position) {\n return array.filter(v => v.pos === position);\n}\nfunction filterDynamicPositionByAxis(array, axis) {\n return array.filter(v => STATIC_POSITIONS.indexOf(v.pos) === -1 && v.box.axis === axis);\n}\nfunction sortByWeight(array, reverse) {\n return array.sort((a, b) => {\n const v0 = reverse ? b : a;\n const v1 = reverse ? a : b;\n return v0.weight === v1.weight ? v0.index - v1.index : v0.weight - v1.weight;\n });\n}\nfunction wrapBoxes(boxes) {\n const layoutBoxes = [];\n let i, ilen, box, pos, stack, stackWeight;\n for (i = 0, ilen = (boxes || []).length; i < ilen; ++i) {\n box = boxes[i];\n var _box = box;\n pos = _box.position;\n var _box$options = _box.options;\n stack = _box$options.stack;\n var _box$options$stackWei = _box$options.stackWeight;\n stackWeight = _box$options$stackWei === void 0 ? 1 : _box$options$stackWei;\n layoutBoxes.push({\n index: i,\n box,\n pos,\n horizontal: box.isHorizontal(),\n weight: box.weight,\n stack: stack && pos + stack,\n stackWeight\n });\n }\n return layoutBoxes;\n}\nfunction buildStacks(layouts) {\n const stacks = {};\n for (const wrap of layouts) {\n const stack = wrap.stack,\n pos = wrap.pos,\n stackWeight = wrap.stackWeight;\n if (!stack || !STATIC_POSITIONS.includes(pos)) {\n continue;\n }\n const _stack = stacks[stack] || (stacks[stack] = {\n count: 0,\n placed: 0,\n weight: 0,\n size: 0\n });\n _stack.count++;\n _stack.weight += stackWeight;\n }\n return stacks;\n}\nfunction setLayoutDims(layouts, params) {\n const stacks = buildStacks(layouts);\n const vBoxMaxWidth = params.vBoxMaxWidth,\n hBoxMaxHeight = params.hBoxMaxHeight;\n let i, ilen, layout;\n for (i = 0, ilen = layouts.length; i < ilen; ++i) {\n layout = layouts[i];\n const fullSize = layout.box.fullSize;\n const stack = stacks[layout.stack];\n const factor = stack && layout.stackWeight / stack.weight;\n if (layout.horizontal) {\n layout.width = factor ? factor * vBoxMaxWidth : fullSize && params.availableWidth;\n layout.height = hBoxMaxHeight;\n } else {\n layout.width = vBoxMaxWidth;\n layout.height = factor ? factor * hBoxMaxHeight : fullSize && params.availableHeight;\n }\n }\n return stacks;\n}\nfunction buildLayoutBoxes(boxes) {\n const layoutBoxes = wrapBoxes(boxes);\n const fullSize = sortByWeight(layoutBoxes.filter(wrap => wrap.box.fullSize), true);\n const left = sortByWeight(filterByPosition(layoutBoxes, 'left'), true);\n const right = sortByWeight(filterByPosition(layoutBoxes, 'right'));\n const top = sortByWeight(filterByPosition(layoutBoxes, 'top'), true);\n const bottom = sortByWeight(filterByPosition(layoutBoxes, 'bottom'));\n const centerHorizontal = filterDynamicPositionByAxis(layoutBoxes, 'x');\n const centerVertical = filterDynamicPositionByAxis(layoutBoxes, 'y');\n return {\n fullSize,\n leftAndTop: left.concat(top),\n rightAndBottom: right.concat(centerVertical).concat(bottom).concat(centerHorizontal),\n chartArea: filterByPosition(layoutBoxes, 'chartArea'),\n vertical: left.concat(right).concat(centerVertical),\n horizontal: top.concat(bottom).concat(centerHorizontal)\n };\n}\nfunction getCombinedMax(maxPadding, chartArea, a, b) {\n return Math.max(maxPadding[a], chartArea[a]) + Math.max(maxPadding[b], chartArea[b]);\n}\nfunction updateMaxPadding(maxPadding, boxPadding) {\n maxPadding.top = Math.max(maxPadding.top, boxPadding.top);\n maxPadding.left = Math.max(maxPadding.left, boxPadding.left);\n maxPadding.bottom = Math.max(maxPadding.bottom, boxPadding.bottom);\n maxPadding.right = Math.max(maxPadding.right, boxPadding.right);\n}\nfunction updateDims(chartArea, params, layout, stacks) {\n const pos = layout.pos,\n box = layout.box;\n const maxPadding = chartArea.maxPadding;\n if (!isObject(pos)) {\n if (layout.size) {\n chartArea[pos] -= layout.size;\n }\n const stack = stacks[layout.stack] || {\n size: 0,\n count: 1\n };\n stack.size = Math.max(stack.size, layout.horizontal ? box.height : box.width);\n layout.size = stack.size / stack.count;\n chartArea[pos] += layout.size;\n }\n if (box.getPadding) {\n updateMaxPadding(maxPadding, box.getPadding());\n }\n const newWidth = Math.max(0, params.outerWidth - getCombinedMax(maxPadding, chartArea, 'left', 'right'));\n const newHeight = Math.max(0, params.outerHeight - getCombinedMax(maxPadding, chartArea, 'top', 'bottom'));\n const widthChanged = newWidth !== chartArea.w;\n const heightChanged = newHeight !== chartArea.h;\n chartArea.w = newWidth;\n chartArea.h = newHeight;\n return layout.horizontal ? {\n same: widthChanged,\n other: heightChanged\n } : {\n same: heightChanged,\n other: widthChanged\n };\n}\nfunction handleMaxPadding(chartArea) {\n const maxPadding = chartArea.maxPadding;\n function updatePos(pos) {\n const change = Math.max(maxPadding[pos] - chartArea[pos], 0);\n chartArea[pos] += change;\n return change;\n }\n chartArea.y += updatePos('top');\n chartArea.x += updatePos('left');\n updatePos('right');\n updatePos('bottom');\n}\nfunction getMargins(horizontal, chartArea) {\n const maxPadding = chartArea.maxPadding;\n function marginForPositions(positions) {\n const margin = {\n left: 0,\n top: 0,\n right: 0,\n bottom: 0\n };\n positions.forEach(pos => {\n margin[pos] = Math.max(chartArea[pos], maxPadding[pos]);\n });\n return margin;\n }\n return horizontal ? marginForPositions(['left', 'right']) : marginForPositions(['top', 'bottom']);\n}\nfunction fitBoxes(boxes, chartArea, params, stacks) {\n const refitBoxes = [];\n let i, ilen, layout, box, refit, changed;\n for (i = 0, ilen = boxes.length, refit = 0; i < ilen; ++i) {\n layout = boxes[i];\n box = layout.box;\n box.update(layout.width || chartArea.w, layout.height || chartArea.h, getMargins(layout.horizontal, chartArea));\n const _updateDims = updateDims(chartArea, params, layout, stacks),\n same = _updateDims.same,\n other = _updateDims.other;\n refit |= same && refitBoxes.length;\n changed = changed || other;\n if (!box.fullSize) {\n refitBoxes.push(layout);\n }\n }\n return refit && fitBoxes(refitBoxes, chartArea, params, stacks) || changed;\n}\nfunction setBoxDims(box, left, top, width, height) {\n box.top = top;\n box.left = left;\n box.right = left + width;\n box.bottom = top + height;\n box.width = width;\n box.height = height;\n}\nfunction placeBoxes(boxes, chartArea, params, stacks) {\n const userPadding = params.padding;\n let x = chartArea.x,\n y = chartArea.y;\n for (const layout of boxes) {\n const box = layout.box;\n const stack = stacks[layout.stack] || {\n count: 1,\n placed: 0,\n weight: 1\n };\n const weight = layout.stackWeight / stack.weight || 1;\n if (layout.horizontal) {\n const width = chartArea.w * weight;\n const height = stack.size || box.height;\n if (defined(stack.start)) {\n y = stack.start;\n }\n if (box.fullSize) {\n setBoxDims(box, userPadding.left, y, params.outerWidth - userPadding.right - userPadding.left, height);\n } else {\n setBoxDims(box, chartArea.left + stack.placed, y, width, height);\n }\n stack.start = y;\n stack.placed += width;\n y = box.bottom;\n } else {\n const height = chartArea.h * weight;\n const width = stack.size || box.width;\n if (defined(stack.start)) {\n x = stack.start;\n }\n if (box.fullSize) {\n setBoxDims(box, x, userPadding.top, width, params.outerHeight - userPadding.bottom - userPadding.top);\n } else {\n setBoxDims(box, x, chartArea.top + stack.placed, width, height);\n }\n stack.start = x;\n stack.placed += height;\n x = box.right;\n }\n }\n chartArea.x = x;\n chartArea.y = y;\n}\ndefaults.set('layout', {\n autoPadding: true,\n padding: {\n top: 0,\n right: 0,\n bottom: 0,\n left: 0\n }\n});\nvar layouts = {\n addBox(chart, item) {\n if (!chart.boxes) {\n chart.boxes = [];\n }\n item.fullSize = item.fullSize || false;\n item.position = item.position || 'top';\n item.weight = item.weight || 0;\n item._layers = item._layers || function () {\n return [{\n z: 0,\n draw(chartArea) {\n item.draw(chartArea);\n }\n }];\n };\n chart.boxes.push(item);\n },\n removeBox(chart, layoutItem) {\n const index = chart.boxes ? chart.boxes.indexOf(layoutItem) : -1;\n if (index !== -1) {\n chart.boxes.splice(index, 1);\n }\n },\n configure(chart, item, options) {\n item.fullSize = options.fullSize;\n item.position = options.position;\n item.weight = options.weight;\n },\n update(chart, width, height, minPadding) {\n if (!chart) {\n return;\n }\n const padding = toPadding(chart.options.layout.padding);\n const availableWidth = Math.max(width - padding.width, 0);\n const availableHeight = Math.max(height - padding.height, 0);\n const boxes = buildLayoutBoxes(chart.boxes);\n const verticalBoxes = boxes.vertical;\n const horizontalBoxes = boxes.horizontal;\n each(chart.boxes, box => {\n if (typeof box.beforeLayout === 'function') {\n box.beforeLayout();\n }\n });\n const visibleVerticalBoxCount = verticalBoxes.reduce((total, wrap) => wrap.box.options && wrap.box.options.display === false ? total : total + 1, 0) || 1;\n const params = Object.freeze({\n outerWidth: width,\n outerHeight: height,\n padding,\n availableWidth,\n availableHeight,\n vBoxMaxWidth: availableWidth / 2 / visibleVerticalBoxCount,\n hBoxMaxHeight: availableHeight / 2\n });\n const maxPadding = Object.assign({}, padding);\n updateMaxPadding(maxPadding, toPadding(minPadding));\n const chartArea = Object.assign({\n maxPadding,\n w: availableWidth,\n h: availableHeight,\n x: padding.left,\n y: padding.top\n }, padding);\n const stacks = setLayoutDims(verticalBoxes.concat(horizontalBoxes), params);\n fitBoxes(boxes.fullSize, chartArea, params, stacks);\n fitBoxes(verticalBoxes, chartArea, params, stacks);\n if (fitBoxes(horizontalBoxes, chartArea, params, stacks)) {\n fitBoxes(verticalBoxes, chartArea, params, stacks);\n }\n handleMaxPadding(chartArea);\n placeBoxes(boxes.leftAndTop, chartArea, params, stacks);\n chartArea.x += chartArea.w;\n chartArea.y += chartArea.h;\n placeBoxes(boxes.rightAndBottom, chartArea, params, stacks);\n chart.chartArea = {\n left: chartArea.left,\n top: chartArea.top,\n right: chartArea.left + chartArea.w,\n bottom: chartArea.top + chartArea.h,\n height: chartArea.h,\n width: chartArea.w\n };\n each(boxes.chartArea, layout => {\n const box = layout.box;\n Object.assign(box, chart.chartArea);\n box.update(chartArea.w, chartArea.h, {\n left: 0,\n top: 0,\n right: 0,\n bottom: 0\n });\n });\n }\n};\nclass BasePlatform {\n acquireContext(canvas, aspectRatio) {}\n releaseContext(context) {\n return false;\n }\n addEventListener(chart, type, listener) {}\n removeEventListener(chart, type, listener) {}\n getDevicePixelRatio() {\n return 1;\n }\n getMaximumSize(element, width, height, aspectRatio) {\n width = Math.max(0, width || element.width);\n height = height || element.height;\n return {\n width,\n height: Math.max(0, aspectRatio ? Math.floor(width / aspectRatio) : height)\n };\n }\n isAttached(canvas) {\n return true;\n }\n updateConfig(config) {}\n}\nclass BasicPlatform extends BasePlatform {\n acquireContext(item) {\n return item && item.getContext && item.getContext('2d') || null;\n }\n updateConfig(config) {\n config.options.animation = false;\n }\n}\nconst EXPANDO_KEY = '$chartjs';\nconst EVENT_TYPES = {\n touchstart: 'mousedown',\n touchmove: 'mousemove',\n touchend: 'mouseup',\n pointerenter: 'mouseenter',\n pointerdown: 'mousedown',\n pointermove: 'mousemove',\n pointerup: 'mouseup',\n pointerleave: 'mouseout',\n pointerout: 'mouseout'\n};\nconst isNullOrEmpty = value => value === null || value === '';\nfunction initCanvas(canvas, aspectRatio) {\n const style = canvas.style;\n const renderHeight = canvas.getAttribute('height');\n const renderWidth = canvas.getAttribute('width');\n canvas[EXPANDO_KEY] = {\n initial: {\n height: renderHeight,\n width: renderWidth,\n style: {\n display: style.display,\n height: style.height,\n width: style.width\n }\n }\n };\n style.display = style.display || 'block';\n style.boxSizing = style.boxSizing || 'border-box';\n if (isNullOrEmpty(renderWidth)) {\n const displayWidth = readUsedSize(canvas, 'width');\n if (displayWidth !== undefined) {\n canvas.width = displayWidth;\n }\n }\n if (isNullOrEmpty(renderHeight)) {\n if (canvas.style.height === '') {\n canvas.height = canvas.width / (aspectRatio || 2);\n } else {\n const displayHeight = readUsedSize(canvas, 'height');\n if (displayHeight !== undefined) {\n canvas.height = displayHeight;\n }\n }\n }\n return canvas;\n}\nconst eventListenerOptions = supportsEventListenerOptions ? {\n passive: true\n} : false;\nfunction addListener(node, type, listener) {\n node.addEventListener(type, listener, eventListenerOptions);\n}\nfunction removeListener(chart, type, listener) {\n chart.canvas.removeEventListener(type, listener, eventListenerOptions);\n}\nfunction fromNativeEvent(event, chart) {\n const type = EVENT_TYPES[event.type] || event.type;\n const _getRelativePosition = getRelativePosition(event, chart),\n x = _getRelativePosition.x,\n y = _getRelativePosition.y;\n return {\n type,\n chart,\n native: event,\n x: x !== undefined ? x : null,\n y: y !== undefined ? y : null\n };\n}\nfunction nodeListContains(nodeList, canvas) {\n for (const node of nodeList) {\n if (node === canvas || node.contains(canvas)) {\n return true;\n }\n }\n}\nfunction createAttachObserver(chart, type, listener) {\n const canvas = chart.canvas;\n const observer = new MutationObserver(entries => {\n let trigger = false;\n for (const entry of entries) {\n trigger = trigger || nodeListContains(entry.addedNodes, canvas);\n trigger = trigger && !nodeListContains(entry.removedNodes, canvas);\n }\n if (trigger) {\n listener();\n }\n });\n observer.observe(document, {\n childList: true,\n subtree: true\n });\n return observer;\n}\nfunction createDetachObserver(chart, type, listener) {\n const canvas = chart.canvas;\n const observer = new MutationObserver(entries => {\n let trigger = false;\n for (const entry of entries) {\n trigger = trigger || nodeListContains(entry.removedNodes, canvas);\n trigger = trigger && !nodeListContains(entry.addedNodes, canvas);\n }\n if (trigger) {\n listener();\n }\n });\n observer.observe(document, {\n childList: true,\n subtree: true\n });\n return observer;\n}\nconst drpListeningCharts = new Map();\nlet oldDevicePixelRatio = 0;\nfunction onWindowResize() {\n const dpr = window.devicePixelRatio;\n if (dpr === oldDevicePixelRatio) {\n return;\n }\n oldDevicePixelRatio = dpr;\n drpListeningCharts.forEach((resize, chart) => {\n if (chart.currentDevicePixelRatio !== dpr) {\n resize();\n }\n });\n}\nfunction listenDevicePixelRatioChanges(chart, resize) {\n if (!drpListeningCharts.size) {\n window.addEventListener('resize', onWindowResize);\n }\n drpListeningCharts.set(chart, resize);\n}\nfunction unlistenDevicePixelRatioChanges(chart) {\n drpListeningCharts.delete(chart);\n if (!drpListeningCharts.size) {\n window.removeEventListener('resize', onWindowResize);\n }\n}\nfunction createResizeObserver(chart, type, listener) {\n const canvas = chart.canvas;\n const container = canvas && _getParentNode(canvas);\n if (!container) {\n return;\n }\n const resize = throttled((width, height) => {\n const w = container.clientWidth;\n listener(width, height);\n if (w < container.clientWidth) {\n listener();\n }\n }, window);\n const observer = new ResizeObserver(entries => {\n const entry = entries[0];\n const width = entry.contentRect.width;\n const height = entry.contentRect.height;\n if (width === 0 && height === 0) {\n return;\n }\n resize(width, height);\n });\n observer.observe(container);\n listenDevicePixelRatioChanges(chart, resize);\n return observer;\n}\nfunction releaseObserver(chart, type, observer) {\n if (observer) {\n observer.disconnect();\n }\n if (type === 'resize') {\n unlistenDevicePixelRatioChanges(chart);\n }\n}\nfunction createProxyAndListen(chart, type, listener) {\n const canvas = chart.canvas;\n const proxy = throttled(event => {\n if (chart.ctx !== null) {\n listener(fromNativeEvent(event, chart));\n }\n }, chart, args => {\n const event = args[0];\n return [event, event.offsetX, event.offsetY];\n });\n addListener(canvas, type, proxy);\n return proxy;\n}\nclass DomPlatform extends BasePlatform {\n acquireContext(canvas, aspectRatio) {\n const context = canvas && canvas.getContext && canvas.getContext('2d');\n if (context && context.canvas === canvas) {\n initCanvas(canvas, aspectRatio);\n return context;\n }\n return null;\n }\n releaseContext(context) {\n const canvas = context.canvas;\n if (!canvas[EXPANDO_KEY]) {\n return false;\n }\n const initial = canvas[EXPANDO_KEY].initial;\n ['height', 'width'].forEach(prop => {\n const value = initial[prop];\n if (isNullOrUndef(value)) {\n canvas.removeAttribute(prop);\n } else {\n canvas.setAttribute(prop, value);\n }\n });\n const style = initial.style || {};\n Object.keys(style).forEach(key => {\n canvas.style[key] = style[key];\n });\n canvas.width = canvas.width;\n delete canvas[EXPANDO_KEY];\n return true;\n }\n addEventListener(chart, type, listener) {\n this.removeEventListener(chart, type);\n const proxies = chart.$proxies || (chart.$proxies = {});\n const handlers = {\n attach: createAttachObserver,\n detach: createDetachObserver,\n resize: createResizeObserver\n };\n const handler = handlers[type] || createProxyAndListen;\n proxies[type] = handler(chart, type, listener);\n }\n removeEventListener(chart, type) {\n const proxies = chart.$proxies || (chart.$proxies = {});\n const proxy = proxies[type];\n if (!proxy) {\n return;\n }\n const handlers = {\n attach: releaseObserver,\n detach: releaseObserver,\n resize: releaseObserver\n };\n const handler = handlers[type] || removeListener;\n handler(chart, type, proxy);\n proxies[type] = undefined;\n }\n getDevicePixelRatio() {\n return window.devicePixelRatio;\n }\n getMaximumSize(canvas, width, height, aspectRatio) {\n return getMaximumSize(canvas, width, height, aspectRatio);\n }\n isAttached(canvas) {\n const container = _getParentNode(canvas);\n return !!(container && container.isConnected);\n }\n}\nfunction _detectPlatform(canvas) {\n if (!_isDomSupported() || typeof OffscreenCanvas !== 'undefined' && canvas instanceof OffscreenCanvas) {\n return BasicPlatform;\n }\n return DomPlatform;\n}\nclass PluginService {\n constructor() {\n this._init = [];\n }\n notify(chart, hook, args, filter) {\n if (hook === 'beforeInit') {\n this._init = this._createDescriptors(chart, true);\n this._notify(this._init, chart, 'install');\n }\n const descriptors = filter ? this._descriptors(chart).filter(filter) : this._descriptors(chart);\n const result = this._notify(descriptors, chart, hook, args);\n if (hook === 'afterDestroy') {\n this._notify(descriptors, chart, 'stop');\n this._notify(this._init, chart, 'uninstall');\n }\n return result;\n }\n _notify(descriptors, chart, hook, args) {\n args = args || {};\n for (const descriptor of descriptors) {\n const plugin = descriptor.plugin;\n const method = plugin[hook];\n const params = [chart, args, descriptor.options];\n if (callback(method, params, plugin) === false && args.cancelable) {\n return false;\n }\n }\n return true;\n }\n invalidate() {\n if (!isNullOrUndef(this._cache)) {\n this._oldCache = this._cache;\n this._cache = undefined;\n }\n }\n _descriptors(chart) {\n if (this._cache) {\n return this._cache;\n }\n const descriptors = this._cache = this._createDescriptors(chart);\n this._notifyStateChanges(chart);\n return descriptors;\n }\n _createDescriptors(chart, all) {\n const config = chart && chart.config;\n const options = valueOrDefault(config.options && config.options.plugins, {});\n const plugins = allPlugins(config);\n return options === false && !all ? [] : createDescriptors(chart, plugins, options, all);\n }\n _notifyStateChanges(chart) {\n const previousDescriptors = this._oldCache || [];\n const descriptors = this._cache;\n const diff = (a, b) => a.filter(x => !b.some(y => x.plugin.id === y.plugin.id));\n this._notify(diff(previousDescriptors, descriptors), chart, 'stop');\n this._notify(diff(descriptors, previousDescriptors), chart, 'start');\n }\n}\nfunction allPlugins(config) {\n const localIds = {};\n const plugins = [];\n const keys = Object.keys(registry.plugins.items);\n for (let i = 0; i < keys.length; i++) {\n plugins.push(registry.getPlugin(keys[i]));\n }\n const local = config.plugins || [];\n for (let i = 0; i < local.length; i++) {\n const plugin = local[i];\n if (plugins.indexOf(plugin) === -1) {\n plugins.push(plugin);\n localIds[plugin.id] = true;\n }\n }\n return {\n plugins,\n localIds\n };\n}\nfunction getOpts(options, all) {\n if (!all && options === false) {\n return null;\n }\n if (options === true) {\n return {};\n }\n return options;\n}\nfunction createDescriptors(chart, _ref4, options, all) {\n let plugins = _ref4.plugins,\n localIds = _ref4.localIds;\n const result = [];\n const context = chart.getContext();\n for (const plugin of plugins) {\n const id = plugin.id;\n const opts = getOpts(options[id], all);\n if (opts === null) {\n continue;\n }\n result.push({\n plugin,\n options: pluginOpts(chart.config, {\n plugin,\n local: localIds[id]\n }, opts, context)\n });\n }\n return result;\n}\nfunction pluginOpts(config, _ref5, opts, context) {\n let plugin = _ref5.plugin,\n local = _ref5.local;\n const keys = config.pluginScopeKeys(plugin);\n const scopes = config.getOptionScopes(opts, keys);\n if (local && plugin.defaults) {\n scopes.push(plugin.defaults);\n }\n return config.createResolver(scopes, context, [''], {\n scriptable: false,\n indexable: false,\n allKeys: true\n });\n}\nfunction getIndexAxis(type, options) {\n const datasetDefaults = defaults.datasets[type] || {};\n const datasetOptions = (options.datasets || {})[type] || {};\n return datasetOptions.indexAxis || options.indexAxis || datasetDefaults.indexAxis || 'x';\n}\nfunction getAxisFromDefaultScaleID(id, indexAxis) {\n let axis = id;\n if (id === '_index_') {\n axis = indexAxis;\n } else if (id === '_value_') {\n axis = indexAxis === 'x' ? 'y' : 'x';\n }\n return axis;\n}\nfunction getDefaultScaleIDFromAxis(axis, indexAxis) {\n return axis === indexAxis ? '_index_' : '_value_';\n}\nfunction axisFromPosition(position) {\n if (position === 'top' || position === 'bottom') {\n return 'x';\n }\n if (position === 'left' || position === 'right') {\n return 'y';\n }\n}\nfunction determineAxis(id, scaleOptions) {\n if (id === 'x' || id === 'y') {\n return id;\n }\n return scaleOptions.axis || axisFromPosition(scaleOptions.position) || id.charAt(0).toLowerCase();\n}\nfunction mergeScaleConfig(config, options) {\n const chartDefaults = overrides[config.type] || {\n scales: {}\n };\n const configScales = options.scales || {};\n const chartIndexAxis = getIndexAxis(config.type, options);\n const firstIDs = Object.create(null);\n const scales = Object.create(null);\n Object.keys(configScales).forEach(id => {\n const scaleConf = configScales[id];\n if (!isObject(scaleConf)) {\n return console.error(`Invalid scale configuration for scale: ${id}`);\n }\n if (scaleConf._proxy) {\n return console.warn(`Ignoring resolver passed as options for scale: ${id}`);\n }\n const axis = determineAxis(id, scaleConf);\n const defaultId = getDefaultScaleIDFromAxis(axis, chartIndexAxis);\n const defaultScaleOptions = chartDefaults.scales || {};\n firstIDs[axis] = firstIDs[axis] || id;\n scales[id] = mergeIf(Object.create(null), [{\n axis\n }, scaleConf, defaultScaleOptions[axis], defaultScaleOptions[defaultId]]);\n });\n config.data.datasets.forEach(dataset => {\n const type = dataset.type || config.type;\n const indexAxis = dataset.indexAxis || getIndexAxis(type, options);\n const datasetDefaults = overrides[type] || {};\n const defaultScaleOptions = datasetDefaults.scales || {};\n Object.keys(defaultScaleOptions).forEach(defaultID => {\n const axis = getAxisFromDefaultScaleID(defaultID, indexAxis);\n const id = dataset[axis + 'AxisID'] || firstIDs[axis] || axis;\n scales[id] = scales[id] || Object.create(null);\n mergeIf(scales[id], [{\n axis\n }, configScales[id], defaultScaleOptions[defaultID]]);\n });\n });\n Object.keys(scales).forEach(key => {\n const scale = scales[key];\n mergeIf(scale, [defaults.scales[scale.type], defaults.scale]);\n });\n return scales;\n}\nfunction initOptions(config) {\n const options = config.options || (config.options = {});\n options.plugins = valueOrDefault(options.plugins, {});\n options.scales = mergeScaleConfig(config, options);\n}\nfunction initData(data) {\n data = data || {};\n data.datasets = data.datasets || [];\n data.labels = data.labels || [];\n return data;\n}\nfunction initConfig(config) {\n config = config || {};\n config.data = initData(config.data);\n initOptions(config);\n return config;\n}\nconst keyCache = new Map();\nconst keysCached = new Set();\nfunction cachedKeys(cacheKey, generate) {\n let keys = keyCache.get(cacheKey);\n if (!keys) {\n keys = generate();\n keyCache.set(cacheKey, keys);\n keysCached.add(keys);\n }\n return keys;\n}\nconst addIfFound = (set, obj, key) => {\n const opts = resolveObjectKey(obj, key);\n if (opts !== undefined) {\n set.add(opts);\n }\n};\nclass Config {\n constructor(config) {\n this._config = initConfig(config);\n this._scopeCache = new Map();\n this._resolverCache = new Map();\n }\n get platform() {\n return this._config.platform;\n }\n get type() {\n return this._config.type;\n }\n set type(type) {\n this._config.type = type;\n }\n get data() {\n return this._config.data;\n }\n set data(data) {\n this._config.data = initData(data);\n }\n get options() {\n return this._config.options;\n }\n set options(options) {\n this._config.options = options;\n }\n get plugins() {\n return this._config.plugins;\n }\n update() {\n const config = this._config;\n this.clearCache();\n initOptions(config);\n }\n clearCache() {\n this._scopeCache.clear();\n this._resolverCache.clear();\n }\n datasetScopeKeys(datasetType) {\n return cachedKeys(datasetType, () => [[`datasets.${datasetType}`, '']]);\n }\n datasetAnimationScopeKeys(datasetType, transition) {\n return cachedKeys(`${datasetType}.transition.${transition}`, () => [[`datasets.${datasetType}.transitions.${transition}`, `transitions.${transition}`], [`datasets.${datasetType}`, '']]);\n }\n datasetElementScopeKeys(datasetType, elementType) {\n return cachedKeys(`${datasetType}-${elementType}`, () => [[`datasets.${datasetType}.elements.${elementType}`, `datasets.${datasetType}`, `elements.${elementType}`, '']]);\n }\n pluginScopeKeys(plugin) {\n const id = plugin.id;\n const type = this.type;\n return cachedKeys(`${type}-plugin-${id}`, () => [[`plugins.${id}`, ...(plugin.additionalOptionScopes || [])]]);\n }\n _cachedScopes(mainScope, resetCache) {\n const _scopeCache = this._scopeCache;\n let cache = _scopeCache.get(mainScope);\n if (!cache || resetCache) {\n cache = new Map();\n _scopeCache.set(mainScope, cache);\n }\n return cache;\n }\n getOptionScopes(mainScope, keyLists, resetCache) {\n const options = this.options,\n type = this.type;\n const cache = this._cachedScopes(mainScope, resetCache);\n const cached = cache.get(keyLists);\n if (cached) {\n return cached;\n }\n const scopes = new Set();\n keyLists.forEach(keys => {\n if (mainScope) {\n scopes.add(mainScope);\n keys.forEach(key => addIfFound(scopes, mainScope, key));\n }\n keys.forEach(key => addIfFound(scopes, options, key));\n keys.forEach(key => addIfFound(scopes, overrides[type] || {}, key));\n keys.forEach(key => addIfFound(scopes, defaults, key));\n keys.forEach(key => addIfFound(scopes, descriptors, key));\n });\n const array = Array.from(scopes);\n if (array.length === 0) {\n array.push(Object.create(null));\n }\n if (keysCached.has(keyLists)) {\n cache.set(keyLists, array);\n }\n return array;\n }\n chartOptionScopes() {\n const options = this.options,\n type = this.type;\n return [options, overrides[type] || {}, defaults.datasets[type] || {}, {\n type\n }, defaults, descriptors];\n }\n resolveNamedOptions(scopes, names, context) {\n let prefixes = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : [''];\n const result = {\n $shared: true\n };\n const _getResolver = getResolver(this._resolverCache, scopes, prefixes),\n resolver = _getResolver.resolver,\n subPrefixes = _getResolver.subPrefixes;\n let options = resolver;\n if (needContext(resolver, names)) {\n result.$shared = false;\n context = isFunction(context) ? context() : context;\n const subResolver = this.createResolver(scopes, context, subPrefixes);\n options = _attachContext(resolver, context, subResolver);\n }\n for (const prop of names) {\n result[prop] = options[prop];\n }\n return result;\n }\n createResolver(scopes, context) {\n let prefixes = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : [''];\n let descriptorDefaults = arguments.length > 3 ? arguments[3] : undefined;\n const _getResolver2 = getResolver(this._resolverCache, scopes, prefixes),\n resolver = _getResolver2.resolver;\n return isObject(context) ? _attachContext(resolver, context, undefined, descriptorDefaults) : resolver;\n }\n}\nfunction getResolver(resolverCache, scopes, prefixes) {\n let cache = resolverCache.get(scopes);\n if (!cache) {\n cache = new Map();\n resolverCache.set(scopes, cache);\n }\n const cacheKey = prefixes.join();\n let cached = cache.get(cacheKey);\n if (!cached) {\n const resolver = _createResolver(scopes, prefixes);\n cached = {\n resolver,\n subPrefixes: prefixes.filter(p => !p.toLowerCase().includes('hover'))\n };\n cache.set(cacheKey, cached);\n }\n return cached;\n}\nconst hasFunction = value => isObject(value) && Object.getOwnPropertyNames(value).reduce((acc, key) => acc || isFunction(value[key]), false);\nfunction needContext(proxy, names) {\n const _descriptors2 = _descriptors(proxy),\n isScriptable = _descriptors2.isScriptable,\n isIndexable = _descriptors2.isIndexable;\n for (const prop of names) {\n const scriptable = isScriptable(prop);\n const indexable = isIndexable(prop);\n const value = (indexable || scriptable) && proxy[prop];\n if (scriptable && (isFunction(value) || hasFunction(value)) || indexable && isArray(value)) {\n return true;\n }\n }\n return false;\n}\nvar version = \"3.9.1\";\nconst KNOWN_POSITIONS = ['top', 'bottom', 'left', 'right', 'chartArea'];\nfunction positionIsHorizontal(position, axis) {\n return position === 'top' || position === 'bottom' || KNOWN_POSITIONS.indexOf(position) === -1 && axis === 'x';\n}\nfunction compare2Level(l1, l2) {\n return function (a, b) {\n return a[l1] === b[l1] ? a[l2] - b[l2] : a[l1] - b[l1];\n };\n}\nfunction onAnimationsComplete(context) {\n const chart = context.chart;\n const animationOptions = chart.options.animation;\n chart.notifyPlugins('afterRender');\n callback(animationOptions && animationOptions.onComplete, [context], chart);\n}\nfunction onAnimationProgress(context) {\n const chart = context.chart;\n const animationOptions = chart.options.animation;\n callback(animationOptions && animationOptions.onProgress, [context], chart);\n}\nfunction getCanvas(item) {\n if (_isDomSupported() && typeof item === 'string') {\n item = document.getElementById(item);\n } else if (item && item.length) {\n item = item[0];\n }\n if (item && item.canvas) {\n item = item.canvas;\n }\n return item;\n}\nconst instances = {};\nconst getChart = key => {\n const canvas = getCanvas(key);\n return Object.values(instances).filter(c => c.canvas === canvas).pop();\n};\nfunction moveNumericKeys(obj, start, move) {\n const keys = Object.keys(obj);\n for (const key of keys) {\n const intKey = +key;\n if (intKey >= start) {\n const value = obj[key];\n delete obj[key];\n if (move > 0 || intKey > start) {\n obj[intKey + move] = value;\n }\n }\n }\n}\nfunction determineLastEvent(e, lastEvent, inChartArea, isClick) {\n if (!inChartArea || e.type === 'mouseout') {\n return null;\n }\n if (isClick) {\n return lastEvent;\n }\n return e;\n}\nclass Chart {\n constructor(item, userConfig) {\n const config = this.config = new Config(userConfig);\n const initialCanvas = getCanvas(item);\n const existingChart = getChart(initialCanvas);\n if (existingChart) {\n throw new Error('Canvas is already in use. Chart with ID \\'' + existingChart.id + '\\'' + ' must be destroyed before the canvas with ID \\'' + existingChart.canvas.id + '\\' can be reused.');\n }\n const options = config.createResolver(config.chartOptionScopes(), this.getContext());\n this.platform = new (config.platform || _detectPlatform(initialCanvas))();\n this.platform.updateConfig(config);\n const context = this.platform.acquireContext(initialCanvas, options.aspectRatio);\n const canvas = context && context.canvas;\n const height = canvas && canvas.height;\n const width = canvas && canvas.width;\n this.id = uid();\n this.ctx = context;\n this.canvas = canvas;\n this.width = width;\n this.height = height;\n this._options = options;\n this._aspectRatio = this.aspectRatio;\n this._layers = [];\n this._metasets = [];\n this._stacks = undefined;\n this.boxes = [];\n this.currentDevicePixelRatio = undefined;\n this.chartArea = undefined;\n this._active = [];\n this._lastEvent = undefined;\n this._listeners = {};\n this._responsiveListeners = undefined;\n this._sortedMetasets = [];\n this.scales = {};\n this._plugins = new PluginService();\n this.$proxies = {};\n this._hiddenIndices = {};\n this.attached = false;\n this._animationsDisabled = undefined;\n this.$context = undefined;\n this._doResize = debounce(mode => this.update(mode), options.resizeDelay || 0);\n this._dataChanges = [];\n instances[this.id] = this;\n if (!context || !canvas) {\n console.error(\"Failed to create chart: can't acquire context from the given item\");\n return;\n }\n animator.listen(this, 'complete', onAnimationsComplete);\n animator.listen(this, 'progress', onAnimationProgress);\n this._initialize();\n if (this.attached) {\n this.update();\n }\n }\n get aspectRatio() {\n const _this$options11 = this.options,\n aspectRatio = _this$options11.aspectRatio,\n maintainAspectRatio = _this$options11.maintainAspectRatio,\n width = this.width,\n height = this.height,\n _aspectRatio = this._aspectRatio;\n if (!isNullOrUndef(aspectRatio)) {\n return aspectRatio;\n }\n if (maintainAspectRatio && _aspectRatio) {\n return _aspectRatio;\n }\n return height ? width / height : null;\n }\n get data() {\n return this.config.data;\n }\n set data(data) {\n this.config.data = data;\n }\n get options() {\n return this._options;\n }\n set options(options) {\n this.config.options = options;\n }\n _initialize() {\n this.notifyPlugins('beforeInit');\n if (this.options.responsive) {\n this.resize();\n } else {\n retinaScale(this, this.options.devicePixelRatio);\n }\n this.bindEvents();\n this.notifyPlugins('afterInit');\n return this;\n }\n clear() {\n clearCanvas(this.canvas, this.ctx);\n return this;\n }\n stop() {\n animator.stop(this);\n return this;\n }\n resize(width, height) {\n if (!animator.running(this)) {\n this._resize(width, height);\n } else {\n this._resizeBeforeDraw = {\n width,\n height\n };\n }\n }\n _resize(width, height) {\n const options = this.options;\n const canvas = this.canvas;\n const aspectRatio = options.maintainAspectRatio && this.aspectRatio;\n const newSize = this.platform.getMaximumSize(canvas, width, height, aspectRatio);\n const newRatio = options.devicePixelRatio || this.platform.getDevicePixelRatio();\n const mode = this.width ? 'resize' : 'attach';\n this.width = newSize.width;\n this.height = newSize.height;\n this._aspectRatio = this.aspectRatio;\n if (!retinaScale(this, newRatio, true)) {\n return;\n }\n this.notifyPlugins('resize', {\n size: newSize\n });\n callback(options.onResize, [this, newSize], this);\n if (this.attached) {\n if (this._doResize(mode)) {\n this.render();\n }\n }\n }\n ensureScalesHaveIDs() {\n const options = this.options;\n const scalesOptions = options.scales || {};\n each(scalesOptions, (axisOptions, axisID) => {\n axisOptions.id = axisID;\n });\n }\n buildOrUpdateScales() {\n const options = this.options;\n const scaleOpts = options.scales;\n const scales = this.scales;\n const updated = Object.keys(scales).reduce((obj, id) => {\n obj[id] = false;\n return obj;\n }, {});\n let items = [];\n if (scaleOpts) {\n items = items.concat(Object.keys(scaleOpts).map(id => {\n const scaleOptions = scaleOpts[id];\n const axis = determineAxis(id, scaleOptions);\n const isRadial = axis === 'r';\n const isHorizontal = axis === 'x';\n return {\n options: scaleOptions,\n dposition: isRadial ? 'chartArea' : isHorizontal ? 'bottom' : 'left',\n dtype: isRadial ? 'radialLinear' : isHorizontal ? 'category' : 'linear'\n };\n }));\n }\n each(items, item => {\n const scaleOptions = item.options;\n const id = scaleOptions.id;\n const axis = determineAxis(id, scaleOptions);\n const scaleType = valueOrDefault(scaleOptions.type, item.dtype);\n if (scaleOptions.position === undefined || positionIsHorizontal(scaleOptions.position, axis) !== positionIsHorizontal(item.dposition)) {\n scaleOptions.position = item.dposition;\n }\n updated[id] = true;\n let scale = null;\n if (id in scales && scales[id].type === scaleType) {\n scale = scales[id];\n } else {\n const scaleClass = registry.getScale(scaleType);\n scale = new scaleClass({\n id,\n type: scaleType,\n ctx: this.ctx,\n chart: this\n });\n scales[scale.id] = scale;\n }\n scale.init(scaleOptions, options);\n });\n each(updated, (hasUpdated, id) => {\n if (!hasUpdated) {\n delete scales[id];\n }\n });\n each(scales, scale => {\n layouts.configure(this, scale, scale.options);\n layouts.addBox(this, scale);\n });\n }\n _updateMetasets() {\n const metasets = this._metasets;\n const numData = this.data.datasets.length;\n const numMeta = metasets.length;\n metasets.sort((a, b) => a.index - b.index);\n if (numMeta > numData) {\n for (let i = numData; i < numMeta; ++i) {\n this._destroyDatasetMeta(i);\n }\n metasets.splice(numData, numMeta - numData);\n }\n this._sortedMetasets = metasets.slice(0).sort(compare2Level('order', 'index'));\n }\n _removeUnreferencedMetasets() {\n const metasets = this._metasets,\n datasets = this.data.datasets;\n if (metasets.length > datasets.length) {\n delete this._stacks;\n }\n metasets.forEach((meta, index) => {\n if (datasets.filter(x => x === meta._dataset).length === 0) {\n this._destroyDatasetMeta(index);\n }\n });\n }\n buildOrUpdateControllers() {\n const newControllers = [];\n const datasets = this.data.datasets;\n let i, ilen;\n this._removeUnreferencedMetasets();\n for (i = 0, ilen = datasets.length; i < ilen; i++) {\n const dataset = datasets[i];\n let meta = this.getDatasetMeta(i);\n const type = dataset.type || this.config.type;\n if (meta.type && meta.type !== type) {\n this._destroyDatasetMeta(i);\n meta = this.getDatasetMeta(i);\n }\n meta.type = type;\n meta.indexAxis = dataset.indexAxis || getIndexAxis(type, this.options);\n meta.order = dataset.order || 0;\n meta.index = i;\n meta.label = '' + dataset.label;\n meta.visible = this.isDatasetVisible(i);\n if (meta.controller) {\n meta.controller.updateIndex(i);\n meta.controller.linkScales();\n } else {\n const ControllerClass = registry.getController(type);\n const _defaults$datasets$ty = defaults.datasets[type],\n datasetElementType = _defaults$datasets$ty.datasetElementType,\n dataElementType = _defaults$datasets$ty.dataElementType;\n Object.assign(ControllerClass.prototype, {\n dataElementType: registry.getElement(dataElementType),\n datasetElementType: datasetElementType && registry.getElement(datasetElementType)\n });\n meta.controller = new ControllerClass(this, i);\n newControllers.push(meta.controller);\n }\n }\n this._updateMetasets();\n return newControllers;\n }\n _resetElements() {\n each(this.data.datasets, (dataset, datasetIndex) => {\n this.getDatasetMeta(datasetIndex).controller.reset();\n }, this);\n }\n reset() {\n this._resetElements();\n this.notifyPlugins('reset');\n }\n update(mode) {\n const config = this.config;\n config.update();\n const options = this._options = config.createResolver(config.chartOptionScopes(), this.getContext());\n const animsDisabled = this._animationsDisabled = !options.animation;\n this._updateScales();\n this._checkEventBindings();\n this._updateHiddenIndices();\n this._plugins.invalidate();\n if (this.notifyPlugins('beforeUpdate', {\n mode,\n cancelable: true\n }) === false) {\n return;\n }\n const newControllers = this.buildOrUpdateControllers();\n this.notifyPlugins('beforeElementsUpdate');\n let minPadding = 0;\n for (let i = 0, ilen = this.data.datasets.length; i < ilen; i++) {\n const _this$getDatasetMeta = this.getDatasetMeta(i),\n controller = _this$getDatasetMeta.controller;\n const reset = !animsDisabled && newControllers.indexOf(controller) === -1;\n controller.buildOrUpdateElements(reset);\n minPadding = Math.max(+controller.getMaxOverflow(), minPadding);\n }\n minPadding = this._minPadding = options.layout.autoPadding ? minPadding : 0;\n this._updateLayout(minPadding);\n if (!animsDisabled) {\n each(newControllers, controller => {\n controller.reset();\n });\n }\n this._updateDatasets(mode);\n this.notifyPlugins('afterUpdate', {\n mode\n });\n this._layers.sort(compare2Level('z', '_idx'));\n const _active = this._active,\n _lastEvent = this._lastEvent;\n if (_lastEvent) {\n this._eventHandler(_lastEvent, true);\n } else if (_active.length) {\n this._updateHoverStyles(_active, _active, true);\n }\n this.render();\n }\n _updateScales() {\n each(this.scales, scale => {\n layouts.removeBox(this, scale);\n });\n this.ensureScalesHaveIDs();\n this.buildOrUpdateScales();\n }\n _checkEventBindings() {\n const options = this.options;\n const existingEvents = new Set(Object.keys(this._listeners));\n const newEvents = new Set(options.events);\n if (!setsEqual(existingEvents, newEvents) || !!this._responsiveListeners !== options.responsive) {\n this.unbindEvents();\n this.bindEvents();\n }\n }\n _updateHiddenIndices() {\n const _hiddenIndices = this._hiddenIndices;\n const changes = this._getUniformDataChanges() || [];\n for (const _ref6 of changes) {\n const method = _ref6.method;\n const start = _ref6.start;\n const count = _ref6.count;\n const move = method === '_removeElements' ? -count : count;\n moveNumericKeys(_hiddenIndices, start, move);\n }\n }\n _getUniformDataChanges() {\n const _dataChanges = this._dataChanges;\n if (!_dataChanges || !_dataChanges.length) {\n return;\n }\n this._dataChanges = [];\n const datasetCount = this.data.datasets.length;\n const makeSet = idx => new Set(_dataChanges.filter(c => c[0] === idx).map((c, i) => i + ',' + c.splice(1).join(',')));\n const changeSet = makeSet(0);\n for (let i = 1; i < datasetCount; i++) {\n if (!setsEqual(changeSet, makeSet(i))) {\n return;\n }\n }\n return Array.from(changeSet).map(c => c.split(',')).map(a => ({\n method: a[1],\n start: +a[2],\n count: +a[3]\n }));\n }\n _updateLayout(minPadding) {\n if (this.notifyPlugins('beforeLayout', {\n cancelable: true\n }) === false) {\n return;\n }\n layouts.update(this, this.width, this.height, minPadding);\n const area = this.chartArea;\n const noArea = area.width <= 0 || area.height <= 0;\n this._layers = [];\n each(this.boxes, box => {\n if (noArea && box.position === 'chartArea') {\n return;\n }\n if (box.configure) {\n box.configure();\n }\n this._layers.push(...box._layers());\n }, this);\n this._layers.forEach((item, index) => {\n item._idx = index;\n });\n this.notifyPlugins('afterLayout');\n }\n _updateDatasets(mode) {\n if (this.notifyPlugins('beforeDatasetsUpdate', {\n mode,\n cancelable: true\n }) === false) {\n return;\n }\n for (let i = 0, ilen = this.data.datasets.length; i < ilen; ++i) {\n this.getDatasetMeta(i).controller.configure();\n }\n for (let i = 0, ilen = this.data.datasets.length; i < ilen; ++i) {\n this._updateDataset(i, isFunction(mode) ? mode({\n datasetIndex: i\n }) : mode);\n }\n this.notifyPlugins('afterDatasetsUpdate', {\n mode\n });\n }\n _updateDataset(index, mode) {\n const meta = this.getDatasetMeta(index);\n const args = {\n meta,\n index,\n mode,\n cancelable: true\n };\n if (this.notifyPlugins('beforeDatasetUpdate', args) === false) {\n return;\n }\n meta.controller._update(mode);\n args.cancelable = false;\n this.notifyPlugins('afterDatasetUpdate', args);\n }\n render() {\n if (this.notifyPlugins('beforeRender', {\n cancelable: true\n }) === false) {\n return;\n }\n if (animator.has(this)) {\n if (this.attached && !animator.running(this)) {\n animator.start(this);\n }\n } else {\n this.draw();\n onAnimationsComplete({\n chart: this\n });\n }\n }\n draw() {\n let i;\n if (this._resizeBeforeDraw) {\n const _this$_resizeBeforeDr = this._resizeBeforeDraw,\n width = _this$_resizeBeforeDr.width,\n height = _this$_resizeBeforeDr.height;\n this._resize(width, height);\n this._resizeBeforeDraw = null;\n }\n this.clear();\n if (this.width <= 0 || this.height <= 0) {\n return;\n }\n if (this.notifyPlugins('beforeDraw', {\n cancelable: true\n }) === false) {\n return;\n }\n const layers = this._layers;\n for (i = 0; i < layers.length && layers[i].z <= 0; ++i) {\n layers[i].draw(this.chartArea);\n }\n this._drawDatasets();\n for (; i < layers.length; ++i) {\n layers[i].draw(this.chartArea);\n }\n this.notifyPlugins('afterDraw');\n }\n _getSortedDatasetMetas(filterVisible) {\n const metasets = this._sortedMetasets;\n const result = [];\n let i, ilen;\n for (i = 0, ilen = metasets.length; i < ilen; ++i) {\n const meta = metasets[i];\n if (!filterVisible || meta.visible) {\n result.push(meta);\n }\n }\n return result;\n }\n getSortedVisibleDatasetMetas() {\n return this._getSortedDatasetMetas(true);\n }\n _drawDatasets() {\n if (this.notifyPlugins('beforeDatasetsDraw', {\n cancelable: true\n }) === false) {\n return;\n }\n const metasets = this.getSortedVisibleDatasetMetas();\n for (let i = metasets.length - 1; i >= 0; --i) {\n this._drawDataset(metasets[i]);\n }\n this.notifyPlugins('afterDatasetsDraw');\n }\n _drawDataset(meta) {\n const ctx = this.ctx;\n const clip = meta._clip;\n const useClip = !clip.disabled;\n const area = this.chartArea;\n const args = {\n meta,\n index: meta.index,\n cancelable: true\n };\n if (this.notifyPlugins('beforeDatasetDraw', args) === false) {\n return;\n }\n if (useClip) {\n clipArea(ctx, {\n left: clip.left === false ? 0 : area.left - clip.left,\n right: clip.right === false ? this.width : area.right + clip.right,\n top: clip.top === false ? 0 : area.top - clip.top,\n bottom: clip.bottom === false ? this.height : area.bottom + clip.bottom\n });\n }\n meta.controller.draw();\n if (useClip) {\n unclipArea(ctx);\n }\n args.cancelable = false;\n this.notifyPlugins('afterDatasetDraw', args);\n }\n isPointInArea(point) {\n return _isPointInArea(point, this.chartArea, this._minPadding);\n }\n getElementsAtEventForMode(e, mode, options, useFinalPosition) {\n const method = Interaction.modes[mode];\n if (typeof method === 'function') {\n return method(this, e, options, useFinalPosition);\n }\n return [];\n }\n getDatasetMeta(datasetIndex) {\n const dataset = this.data.datasets[datasetIndex];\n const metasets = this._metasets;\n let meta = metasets.filter(x => x && x._dataset === dataset).pop();\n if (!meta) {\n meta = {\n type: null,\n data: [],\n dataset: null,\n controller: null,\n hidden: null,\n xAxisID: null,\n yAxisID: null,\n order: dataset && dataset.order || 0,\n index: datasetIndex,\n _dataset: dataset,\n _parsed: [],\n _sorted: false\n };\n metasets.push(meta);\n }\n return meta;\n }\n getContext() {\n return this.$context || (this.$context = createContext(null, {\n chart: this,\n type: 'chart'\n }));\n }\n getVisibleDatasetCount() {\n return this.getSortedVisibleDatasetMetas().length;\n }\n isDatasetVisible(datasetIndex) {\n const dataset = this.data.datasets[datasetIndex];\n if (!dataset) {\n return false;\n }\n const meta = this.getDatasetMeta(datasetIndex);\n return typeof meta.hidden === 'boolean' ? !meta.hidden : !dataset.hidden;\n }\n setDatasetVisibility(datasetIndex, visible) {\n const meta = this.getDatasetMeta(datasetIndex);\n meta.hidden = !visible;\n }\n toggleDataVisibility(index) {\n this._hiddenIndices[index] = !this._hiddenIndices[index];\n }\n getDataVisibility(index) {\n return !this._hiddenIndices[index];\n }\n _updateVisibility(datasetIndex, dataIndex, visible) {\n const mode = visible ? 'show' : 'hide';\n const meta = this.getDatasetMeta(datasetIndex);\n const anims = meta.controller._resolveAnimations(undefined, mode);\n if (defined(dataIndex)) {\n meta.data[dataIndex].hidden = !visible;\n this.update();\n } else {\n this.setDatasetVisibility(datasetIndex, visible);\n anims.update(meta, {\n visible\n });\n this.update(ctx => ctx.datasetIndex === datasetIndex ? mode : undefined);\n }\n }\n hide(datasetIndex, dataIndex) {\n this._updateVisibility(datasetIndex, dataIndex, false);\n }\n show(datasetIndex, dataIndex) {\n this._updateVisibility(datasetIndex, dataIndex, true);\n }\n _destroyDatasetMeta(datasetIndex) {\n const meta = this._metasets[datasetIndex];\n if (meta && meta.controller) {\n meta.controller._destroy();\n }\n delete this._metasets[datasetIndex];\n }\n _stop() {\n let i, ilen;\n this.stop();\n animator.remove(this);\n for (i = 0, ilen = this.data.datasets.length; i < ilen; ++i) {\n this._destroyDatasetMeta(i);\n }\n }\n destroy() {\n this.notifyPlugins('beforeDestroy');\n const canvas = this.canvas,\n ctx = this.ctx;\n this._stop();\n this.config.clearCache();\n if (canvas) {\n this.unbindEvents();\n clearCanvas(canvas, ctx);\n this.platform.releaseContext(ctx);\n this.canvas = null;\n this.ctx = null;\n }\n this.notifyPlugins('destroy');\n delete instances[this.id];\n this.notifyPlugins('afterDestroy');\n }\n toBase64Image() {\n return this.canvas.toDataURL(...arguments);\n }\n bindEvents() {\n this.bindUserEvents();\n if (this.options.responsive) {\n this.bindResponsiveEvents();\n } else {\n this.attached = true;\n }\n }\n bindUserEvents() {\n const listeners = this._listeners;\n const platform = this.platform;\n const _add = (type, listener) => {\n platform.addEventListener(this, type, listener);\n listeners[type] = listener;\n };\n const listener = (e, x, y) => {\n e.offsetX = x;\n e.offsetY = y;\n this._eventHandler(e);\n };\n each(this.options.events, type => _add(type, listener));\n }\n bindResponsiveEvents() {\n if (!this._responsiveListeners) {\n this._responsiveListeners = {};\n }\n const listeners = this._responsiveListeners;\n const platform = this.platform;\n const _add = (type, listener) => {\n platform.addEventListener(this, type, listener);\n listeners[type] = listener;\n };\n const _remove = (type, listener) => {\n if (listeners[type]) {\n platform.removeEventListener(this, type, listener);\n delete listeners[type];\n }\n };\n const listener = (width, height) => {\n if (this.canvas) {\n this.resize(width, height);\n }\n };\n let detached;\n const attached = () => {\n _remove('attach', attached);\n this.attached = true;\n this.resize();\n _add('resize', listener);\n _add('detach', detached);\n };\n detached = () => {\n this.attached = false;\n _remove('resize', listener);\n this._stop();\n this._resize(0, 0);\n _add('attach', attached);\n };\n if (platform.isAttached(this.canvas)) {\n attached();\n } else {\n detached();\n }\n }\n unbindEvents() {\n each(this._listeners, (listener, type) => {\n this.platform.removeEventListener(this, type, listener);\n });\n this._listeners = {};\n each(this._responsiveListeners, (listener, type) => {\n this.platform.removeEventListener(this, type, listener);\n });\n this._responsiveListeners = undefined;\n }\n updateHoverStyle(items, mode, enabled) {\n const prefix = enabled ? 'set' : 'remove';\n let meta, item, i, ilen;\n if (mode === 'dataset') {\n meta = this.getDatasetMeta(items[0].datasetIndex);\n meta.controller['_' + prefix + 'DatasetHoverStyle']();\n }\n for (i = 0, ilen = items.length; i < ilen; ++i) {\n item = items[i];\n const controller = item && this.getDatasetMeta(item.datasetIndex).controller;\n if (controller) {\n controller[prefix + 'HoverStyle'](item.element, item.datasetIndex, item.index);\n }\n }\n }\n getActiveElements() {\n return this._active || [];\n }\n setActiveElements(activeElements) {\n const lastActive = this._active || [];\n const active = activeElements.map(_ref7 => {\n let datasetIndex = _ref7.datasetIndex,\n index = _ref7.index;\n const meta = this.getDatasetMeta(datasetIndex);\n if (!meta) {\n throw new Error('No dataset found at index ' + datasetIndex);\n }\n return {\n datasetIndex,\n element: meta.data[index],\n index\n };\n });\n const changed = !_elementsEqual(active, lastActive);\n if (changed) {\n this._active = active;\n this._lastEvent = null;\n this._updateHoverStyles(active, lastActive);\n }\n }\n notifyPlugins(hook, args, filter) {\n return this._plugins.notify(this, hook, args, filter);\n }\n _updateHoverStyles(active, lastActive, replay) {\n const hoverOptions = this.options.hover;\n const diff = (a, b) => a.filter(x => !b.some(y => x.datasetIndex === y.datasetIndex && x.index === y.index));\n const deactivated = diff(lastActive, active);\n const activated = replay ? active : diff(active, lastActive);\n if (deactivated.length) {\n this.updateHoverStyle(deactivated, hoverOptions.mode, false);\n }\n if (activated.length && hoverOptions.mode) {\n this.updateHoverStyle(activated, hoverOptions.mode, true);\n }\n }\n _eventHandler(e, replay) {\n const args = {\n event: e,\n replay,\n cancelable: true,\n inChartArea: this.isPointInArea(e)\n };\n const eventFilter = plugin => (plugin.options.events || this.options.events).includes(e.native.type);\n if (this.notifyPlugins('beforeEvent', args, eventFilter) === false) {\n return;\n }\n const changed = this._handleEvent(e, replay, args.inChartArea);\n args.cancelable = false;\n this.notifyPlugins('afterEvent', args, eventFilter);\n if (changed || args.changed) {\n this.render();\n }\n return this;\n }\n _handleEvent(e, replay, inChartArea) {\n const _this$_active = this._active,\n lastActive = _this$_active === void 0 ? [] : _this$_active,\n options = this.options;\n const useFinalPosition = replay;\n const active = this._getActiveElements(e, lastActive, inChartArea, useFinalPosition);\n const isClick = _isClickEvent(e);\n const lastEvent = determineLastEvent(e, this._lastEvent, inChartArea, isClick);\n if (inChartArea) {\n this._lastEvent = null;\n callback(options.onHover, [e, active, this], this);\n if (isClick) {\n callback(options.onClick, [e, active, this], this);\n }\n }\n const changed = !_elementsEqual(active, lastActive);\n if (changed || replay) {\n this._active = active;\n this._updateHoverStyles(active, lastActive, replay);\n }\n this._lastEvent = lastEvent;\n return changed;\n }\n _getActiveElements(e, lastActive, inChartArea, useFinalPosition) {\n if (e.type === 'mouseout') {\n return [];\n }\n if (!inChartArea) {\n return lastActive;\n }\n const hoverOptions = this.options.hover;\n return this.getElementsAtEventForMode(e, hoverOptions.mode, hoverOptions, useFinalPosition);\n }\n}\nconst invalidatePlugins = () => each(Chart.instances, chart => chart._plugins.invalidate());\nconst enumerable = true;\nObject.defineProperties(Chart, {\n defaults: {\n enumerable,\n value: defaults\n },\n instances: {\n enumerable,\n value: instances\n },\n overrides: {\n enumerable,\n value: overrides\n },\n registry: {\n enumerable,\n value: registry\n },\n version: {\n enumerable,\n value: version\n },\n getChart: {\n enumerable,\n value: getChart\n },\n register: {\n enumerable,\n value: function () {\n registry.add(...arguments);\n invalidatePlugins();\n }\n },\n unregister: {\n enumerable,\n value: function () {\n registry.remove(...arguments);\n invalidatePlugins();\n }\n }\n});\nfunction clipArc(ctx, element, endAngle) {\n const startAngle = element.startAngle,\n pixelMargin = element.pixelMargin,\n x = element.x,\n y = element.y,\n outerRadius = element.outerRadius,\n innerRadius = element.innerRadius;\n let angleMargin = pixelMargin / outerRadius;\n ctx.beginPath();\n ctx.arc(x, y, outerRadius, startAngle - angleMargin, endAngle + angleMargin);\n if (innerRadius > pixelMargin) {\n angleMargin = pixelMargin / innerRadius;\n ctx.arc(x, y, innerRadius, endAngle + angleMargin, startAngle - angleMargin, true);\n } else {\n ctx.arc(x, y, pixelMargin, endAngle + HALF_PI, startAngle - HALF_PI);\n }\n ctx.closePath();\n ctx.clip();\n}\nfunction toRadiusCorners(value) {\n return _readValueToProps(value, ['outerStart', 'outerEnd', 'innerStart', 'innerEnd']);\n}\nfunction parseBorderRadius$1(arc, innerRadius, outerRadius, angleDelta) {\n const o = toRadiusCorners(arc.options.borderRadius);\n const halfThickness = (outerRadius - innerRadius) / 2;\n const innerLimit = Math.min(halfThickness, angleDelta * innerRadius / 2);\n const computeOuterLimit = val => {\n const outerArcLimit = (outerRadius - Math.min(halfThickness, val)) * angleDelta / 2;\n return _limitValue(val, 0, Math.min(halfThickness, outerArcLimit));\n };\n return {\n outerStart: computeOuterLimit(o.outerStart),\n outerEnd: computeOuterLimit(o.outerEnd),\n innerStart: _limitValue(o.innerStart, 0, innerLimit),\n innerEnd: _limitValue(o.innerEnd, 0, innerLimit)\n };\n}\nfunction rThetaToXY(r, theta, x, y) {\n return {\n x: x + r * Math.cos(theta),\n y: y + r * Math.sin(theta)\n };\n}\nfunction pathArc(ctx, element, offset, spacing, end, circular) {\n const x = element.x,\n y = element.y,\n start = element.startAngle,\n pixelMargin = element.pixelMargin,\n innerR = element.innerRadius;\n const outerRadius = Math.max(element.outerRadius + spacing + offset - pixelMargin, 0);\n const innerRadius = innerR > 0 ? innerR + spacing + offset + pixelMargin : 0;\n let spacingOffset = 0;\n const alpha = end - start;\n if (spacing) {\n const noSpacingInnerRadius = innerR > 0 ? innerR - spacing : 0;\n const noSpacingOuterRadius = outerRadius > 0 ? outerRadius - spacing : 0;\n const avNogSpacingRadius = (noSpacingInnerRadius + noSpacingOuterRadius) / 2;\n const adjustedAngle = avNogSpacingRadius !== 0 ? alpha * avNogSpacingRadius / (avNogSpacingRadius + spacing) : alpha;\n spacingOffset = (alpha - adjustedAngle) / 2;\n }\n const beta = Math.max(0.001, alpha * outerRadius - offset / PI) / outerRadius;\n const angleOffset = (alpha - beta) / 2;\n const startAngle = start + angleOffset + spacingOffset;\n const endAngle = end - angleOffset - spacingOffset;\n const _parseBorderRadius$ = parseBorderRadius$1(element, innerRadius, outerRadius, endAngle - startAngle),\n outerStart = _parseBorderRadius$.outerStart,\n outerEnd = _parseBorderRadius$.outerEnd,\n innerStart = _parseBorderRadius$.innerStart,\n innerEnd = _parseBorderRadius$.innerEnd;\n const outerStartAdjustedRadius = outerRadius - outerStart;\n const outerEndAdjustedRadius = outerRadius - outerEnd;\n const outerStartAdjustedAngle = startAngle + outerStart / outerStartAdjustedRadius;\n const outerEndAdjustedAngle = endAngle - outerEnd / outerEndAdjustedRadius;\n const innerStartAdjustedRadius = innerRadius + innerStart;\n const innerEndAdjustedRadius = innerRadius + innerEnd;\n const innerStartAdjustedAngle = startAngle + innerStart / innerStartAdjustedRadius;\n const innerEndAdjustedAngle = endAngle - innerEnd / innerEndAdjustedRadius;\n ctx.beginPath();\n if (circular) {\n ctx.arc(x, y, outerRadius, outerStartAdjustedAngle, outerEndAdjustedAngle);\n if (outerEnd > 0) {\n const pCenter = rThetaToXY(outerEndAdjustedRadius, outerEndAdjustedAngle, x, y);\n ctx.arc(pCenter.x, pCenter.y, outerEnd, outerEndAdjustedAngle, endAngle + HALF_PI);\n }\n const p4 = rThetaToXY(innerEndAdjustedRadius, endAngle, x, y);\n ctx.lineTo(p4.x, p4.y);\n if (innerEnd > 0) {\n const pCenter = rThetaToXY(innerEndAdjustedRadius, innerEndAdjustedAngle, x, y);\n ctx.arc(pCenter.x, pCenter.y, innerEnd, endAngle + HALF_PI, innerEndAdjustedAngle + Math.PI);\n }\n ctx.arc(x, y, innerRadius, endAngle - innerEnd / innerRadius, startAngle + innerStart / innerRadius, true);\n if (innerStart > 0) {\n const pCenter = rThetaToXY(innerStartAdjustedRadius, innerStartAdjustedAngle, x, y);\n ctx.arc(pCenter.x, pCenter.y, innerStart, innerStartAdjustedAngle + Math.PI, startAngle - HALF_PI);\n }\n const p8 = rThetaToXY(outerStartAdjustedRadius, startAngle, x, y);\n ctx.lineTo(p8.x, p8.y);\n if (outerStart > 0) {\n const pCenter = rThetaToXY(outerStartAdjustedRadius, outerStartAdjustedAngle, x, y);\n ctx.arc(pCenter.x, pCenter.y, outerStart, startAngle - HALF_PI, outerStartAdjustedAngle);\n }\n } else {\n ctx.moveTo(x, y);\n const outerStartX = Math.cos(outerStartAdjustedAngle) * outerRadius + x;\n const outerStartY = Math.sin(outerStartAdjustedAngle) * outerRadius + y;\n ctx.lineTo(outerStartX, outerStartY);\n const outerEndX = Math.cos(outerEndAdjustedAngle) * outerRadius + x;\n const outerEndY = Math.sin(outerEndAdjustedAngle) * outerRadius + y;\n ctx.lineTo(outerEndX, outerEndY);\n }\n ctx.closePath();\n}\nfunction drawArc(ctx, element, offset, spacing, circular) {\n const fullCircles = element.fullCircles,\n startAngle = element.startAngle,\n circumference = element.circumference;\n let endAngle = element.endAngle;\n if (fullCircles) {\n pathArc(ctx, element, offset, spacing, startAngle + TAU, circular);\n for (let i = 0; i < fullCircles; ++i) {\n ctx.fill();\n }\n if (!isNaN(circumference)) {\n endAngle = startAngle + circumference % TAU;\n if (circumference % TAU === 0) {\n endAngle += TAU;\n }\n }\n }\n pathArc(ctx, element, offset, spacing, endAngle, circular);\n ctx.fill();\n return endAngle;\n}\nfunction drawFullCircleBorders(ctx, element, inner) {\n const x = element.x,\n y = element.y,\n startAngle = element.startAngle,\n pixelMargin = element.pixelMargin,\n fullCircles = element.fullCircles;\n const outerRadius = Math.max(element.outerRadius - pixelMargin, 0);\n const innerRadius = element.innerRadius + pixelMargin;\n let i;\n if (inner) {\n clipArc(ctx, element, startAngle + TAU);\n }\n ctx.beginPath();\n ctx.arc(x, y, innerRadius, startAngle + TAU, startAngle, true);\n for (i = 0; i < fullCircles; ++i) {\n ctx.stroke();\n }\n ctx.beginPath();\n ctx.arc(x, y, outerRadius, startAngle, startAngle + TAU);\n for (i = 0; i < fullCircles; ++i) {\n ctx.stroke();\n }\n}\nfunction drawBorder(ctx, element, offset, spacing, endAngle, circular) {\n const options = element.options;\n const borderWidth = options.borderWidth,\n borderJoinStyle = options.borderJoinStyle;\n const inner = options.borderAlign === 'inner';\n if (!borderWidth) {\n return;\n }\n if (inner) {\n ctx.lineWidth = borderWidth * 2;\n ctx.lineJoin = borderJoinStyle || 'round';\n } else {\n ctx.lineWidth = borderWidth;\n ctx.lineJoin = borderJoinStyle || 'bevel';\n }\n if (element.fullCircles) {\n drawFullCircleBorders(ctx, element, inner);\n }\n if (inner) {\n clipArc(ctx, element, endAngle);\n }\n pathArc(ctx, element, offset, spacing, endAngle, circular);\n ctx.stroke();\n}\nclass ArcElement extends Element {\n constructor(cfg) {\n super();\n this.options = undefined;\n this.circumference = undefined;\n this.startAngle = undefined;\n this.endAngle = undefined;\n this.innerRadius = undefined;\n this.outerRadius = undefined;\n this.pixelMargin = 0;\n this.fullCircles = 0;\n if (cfg) {\n Object.assign(this, cfg);\n }\n }\n inRange(chartX, chartY, useFinalPosition) {\n const point = this.getProps(['x', 'y'], useFinalPosition);\n const _getAngleFromPoint2 = getAngleFromPoint(point, {\n x: chartX,\n y: chartY\n }),\n angle = _getAngleFromPoint2.angle,\n distance = _getAngleFromPoint2.distance;\n const _this$getProps2 = this.getProps(['startAngle', 'endAngle', 'innerRadius', 'outerRadius', 'circumference'], useFinalPosition),\n startAngle = _this$getProps2.startAngle,\n endAngle = _this$getProps2.endAngle,\n innerRadius = _this$getProps2.innerRadius,\n outerRadius = _this$getProps2.outerRadius,\n circumference = _this$getProps2.circumference;\n const rAdjust = this.options.spacing / 2;\n const _circumference = valueOrDefault(circumference, endAngle - startAngle);\n const betweenAngles = _circumference >= TAU || _angleBetween(angle, startAngle, endAngle);\n const withinRadius = _isBetween(distance, innerRadius + rAdjust, outerRadius + rAdjust);\n return betweenAngles && withinRadius;\n }\n getCenterPoint(useFinalPosition) {\n const _this$getProps3 = this.getProps(['x', 'y', 'startAngle', 'endAngle', 'innerRadius', 'outerRadius', 'circumference'], useFinalPosition),\n x = _this$getProps3.x,\n y = _this$getProps3.y,\n startAngle = _this$getProps3.startAngle,\n endAngle = _this$getProps3.endAngle,\n innerRadius = _this$getProps3.innerRadius,\n outerRadius = _this$getProps3.outerRadius;\n const _this$options12 = this.options,\n offset = _this$options12.offset,\n spacing = _this$options12.spacing;\n const halfAngle = (startAngle + endAngle) / 2;\n const halfRadius = (innerRadius + outerRadius + spacing + offset) / 2;\n return {\n x: x + Math.cos(halfAngle) * halfRadius,\n y: y + Math.sin(halfAngle) * halfRadius\n };\n }\n tooltipPosition(useFinalPosition) {\n return this.getCenterPoint(useFinalPosition);\n }\n draw(ctx) {\n const options = this.options,\n circumference = this.circumference;\n const offset = (options.offset || 0) / 2;\n const spacing = (options.spacing || 0) / 2;\n const circular = options.circular;\n this.pixelMargin = options.borderAlign === 'inner' ? 0.33 : 0;\n this.fullCircles = circumference > TAU ? Math.floor(circumference / TAU) : 0;\n if (circumference === 0 || this.innerRadius < 0 || this.outerRadius < 0) {\n return;\n }\n ctx.save();\n let radiusOffset = 0;\n if (offset) {\n radiusOffset = offset / 2;\n const halfAngle = (this.startAngle + this.endAngle) / 2;\n ctx.translate(Math.cos(halfAngle) * radiusOffset, Math.sin(halfAngle) * radiusOffset);\n if (this.circumference >= PI) {\n radiusOffset = offset;\n }\n }\n ctx.fillStyle = options.backgroundColor;\n ctx.strokeStyle = options.borderColor;\n const endAngle = drawArc(ctx, this, radiusOffset, spacing, circular);\n drawBorder(ctx, this, radiusOffset, spacing, endAngle, circular);\n ctx.restore();\n }\n}\nArcElement.id = 'arc';\nArcElement.defaults = {\n borderAlign: 'center',\n borderColor: '#fff',\n borderJoinStyle: undefined,\n borderRadius: 0,\n borderWidth: 2,\n offset: 0,\n spacing: 0,\n angle: undefined,\n circular: true\n};\nArcElement.defaultRoutes = {\n backgroundColor: 'backgroundColor'\n};\nfunction setStyle(ctx, options) {\n let style = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : options;\n ctx.lineCap = valueOrDefault(style.borderCapStyle, options.borderCapStyle);\n ctx.setLineDash(valueOrDefault(style.borderDash, options.borderDash));\n ctx.lineDashOffset = valueOrDefault(style.borderDashOffset, options.borderDashOffset);\n ctx.lineJoin = valueOrDefault(style.borderJoinStyle, options.borderJoinStyle);\n ctx.lineWidth = valueOrDefault(style.borderWidth, options.borderWidth);\n ctx.strokeStyle = valueOrDefault(style.borderColor, options.borderColor);\n}\nfunction lineTo(ctx, previous, target) {\n ctx.lineTo(target.x, target.y);\n}\nfunction getLineMethod(options) {\n if (options.stepped) {\n return _steppedLineTo;\n }\n if (options.tension || options.cubicInterpolationMode === 'monotone') {\n return _bezierCurveTo;\n }\n return lineTo;\n}\nfunction pathVars(points, segment) {\n let params = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};\n const count = points.length;\n const _params$start = params.start,\n paramsStart = _params$start === void 0 ? 0 : _params$start,\n _params$end = params.end,\n paramsEnd = _params$end === void 0 ? count - 1 : _params$end;\n const segmentStart = segment.start,\n segmentEnd = segment.end;\n const start = Math.max(paramsStart, segmentStart);\n const end = Math.min(paramsEnd, segmentEnd);\n const outside = paramsStart < segmentStart && paramsEnd < segmentStart || paramsStart > segmentEnd && paramsEnd > segmentEnd;\n return {\n count,\n start,\n loop: segment.loop,\n ilen: end < start && !outside ? count + end - start : end - start\n };\n}\nfunction pathSegment(ctx, line, segment, params) {\n const points = line.points,\n options = line.options;\n const _pathVars = pathVars(points, segment, params),\n count = _pathVars.count,\n start = _pathVars.start,\n loop = _pathVars.loop,\n ilen = _pathVars.ilen;\n const lineMethod = getLineMethod(options);\n let _ref8 = params || {},\n _ref8$move = _ref8.move,\n move = _ref8$move === void 0 ? true : _ref8$move,\n reverse = _ref8.reverse;\n let i, point, prev;\n for (i = 0; i <= ilen; ++i) {\n point = points[(start + (reverse ? ilen - i : i)) % count];\n if (point.skip) {\n continue;\n } else if (move) {\n ctx.moveTo(point.x, point.y);\n move = false;\n } else {\n lineMethod(ctx, prev, point, reverse, options.stepped);\n }\n prev = point;\n }\n if (loop) {\n point = points[(start + (reverse ? ilen : 0)) % count];\n lineMethod(ctx, prev, point, reverse, options.stepped);\n }\n return !!loop;\n}\nfunction fastPathSegment(ctx, line, segment, params) {\n const points = line.points;\n const _pathVars2 = pathVars(points, segment, params),\n count = _pathVars2.count,\n start = _pathVars2.start,\n ilen = _pathVars2.ilen;\n const _ref9 = params || {},\n _ref9$move = _ref9.move,\n move = _ref9$move === void 0 ? true : _ref9$move,\n reverse = _ref9.reverse;\n let avgX = 0;\n let countX = 0;\n let i, point, prevX, minY, maxY, lastY;\n const pointIndex = index => (start + (reverse ? ilen - index : index)) % count;\n const drawX = () => {\n if (minY !== maxY) {\n ctx.lineTo(avgX, maxY);\n ctx.lineTo(avgX, minY);\n ctx.lineTo(avgX, lastY);\n }\n };\n if (move) {\n point = points[pointIndex(0)];\n ctx.moveTo(point.x, point.y);\n }\n for (i = 0; i <= ilen; ++i) {\n point = points[pointIndex(i)];\n if (point.skip) {\n continue;\n }\n const x = point.x;\n const y = point.y;\n const truncX = x | 0;\n if (truncX === prevX) {\n if (y < minY) {\n minY = y;\n } else if (y > maxY) {\n maxY = y;\n }\n avgX = (countX * avgX + x) / ++countX;\n } else {\n drawX();\n ctx.lineTo(x, y);\n prevX = truncX;\n countX = 0;\n minY = maxY = y;\n }\n lastY = y;\n }\n drawX();\n}\nfunction _getSegmentMethod(line) {\n const opts = line.options;\n const borderDash = opts.borderDash && opts.borderDash.length;\n const useFastPath = !line._decimated && !line._loop && !opts.tension && opts.cubicInterpolationMode !== 'monotone' && !opts.stepped && !borderDash;\n return useFastPath ? fastPathSegment : pathSegment;\n}\nfunction _getInterpolationMethod(options) {\n if (options.stepped) {\n return _steppedInterpolation;\n }\n if (options.tension || options.cubicInterpolationMode === 'monotone') {\n return _bezierInterpolation;\n }\n return _pointInLine;\n}\nfunction strokePathWithCache(ctx, line, start, count) {\n let path = line._path;\n if (!path) {\n path = line._path = new Path2D();\n if (line.path(path, start, count)) {\n path.closePath();\n }\n }\n setStyle(ctx, line.options);\n ctx.stroke(path);\n}\nfunction strokePathDirect(ctx, line, start, count) {\n const segments = line.segments,\n options = line.options;\n const segmentMethod = _getSegmentMethod(line);\n for (const segment of segments) {\n setStyle(ctx, options, segment.style);\n ctx.beginPath();\n if (segmentMethod(ctx, line, segment, {\n start,\n end: start + count - 1\n })) {\n ctx.closePath();\n }\n ctx.stroke();\n }\n}\nconst usePath2D = typeof Path2D === 'function';\nfunction draw(ctx, line, start, count) {\n if (usePath2D && !line.options.segment) {\n strokePathWithCache(ctx, line, start, count);\n } else {\n strokePathDirect(ctx, line, start, count);\n }\n}\nclass LineElement extends Element {\n constructor(cfg) {\n super();\n this.animated = true;\n this.options = undefined;\n this._chart = undefined;\n this._loop = undefined;\n this._fullLoop = undefined;\n this._path = undefined;\n this._points = undefined;\n this._segments = undefined;\n this._decimated = false;\n this._pointsUpdated = false;\n this._datasetIndex = undefined;\n if (cfg) {\n Object.assign(this, cfg);\n }\n }\n updateControlPoints(chartArea, indexAxis) {\n const options = this.options;\n if ((options.tension || options.cubicInterpolationMode === 'monotone') && !options.stepped && !this._pointsUpdated) {\n const loop = options.spanGaps ? this._loop : this._fullLoop;\n _updateBezierControlPoints(this._points, options, chartArea, loop, indexAxis);\n this._pointsUpdated = true;\n }\n }\n set points(points) {\n this._points = points;\n delete this._segments;\n delete this._path;\n this._pointsUpdated = false;\n }\n get points() {\n return this._points;\n }\n get segments() {\n return this._segments || (this._segments = _computeSegments(this, this.options.segment));\n }\n first() {\n const segments = this.segments;\n const points = this.points;\n return segments.length && points[segments[0].start];\n }\n last() {\n const segments = this.segments;\n const points = this.points;\n const count = segments.length;\n return count && points[segments[count - 1].end];\n }\n interpolate(point, property) {\n const options = this.options;\n const value = point[property];\n const points = this.points;\n const segments = _boundSegments(this, {\n property,\n start: value,\n end: value\n });\n if (!segments.length) {\n return;\n }\n const result = [];\n const _interpolate = _getInterpolationMethod(options);\n let i, ilen;\n for (i = 0, ilen = segments.length; i < ilen; ++i) {\n const _segments$i = segments[i],\n start = _segments$i.start,\n end = _segments$i.end;\n const p1 = points[start];\n const p2 = points[end];\n if (p1 === p2) {\n result.push(p1);\n continue;\n }\n const t = Math.abs((value - p1[property]) / (p2[property] - p1[property]));\n const interpolated = _interpolate(p1, p2, t, options.stepped);\n interpolated[property] = point[property];\n result.push(interpolated);\n }\n return result.length === 1 ? result[0] : result;\n }\n pathSegment(ctx, segment, params) {\n const segmentMethod = _getSegmentMethod(this);\n return segmentMethod(ctx, this, segment, params);\n }\n path(ctx, start, count) {\n const segments = this.segments;\n const segmentMethod = _getSegmentMethod(this);\n let loop = this._loop;\n start = start || 0;\n count = count || this.points.length - start;\n for (const segment of segments) {\n loop &= segmentMethod(ctx, this, segment, {\n start,\n end: start + count - 1\n });\n }\n return !!loop;\n }\n draw(ctx, chartArea, start, count) {\n const options = this.options || {};\n const points = this.points || [];\n if (points.length && options.borderWidth) {\n ctx.save();\n draw(ctx, this, start, count);\n ctx.restore();\n }\n if (this.animated) {\n this._pointsUpdated = false;\n this._path = undefined;\n }\n }\n}\nLineElement.id = 'line';\nLineElement.defaults = {\n borderCapStyle: 'butt',\n borderDash: [],\n borderDashOffset: 0,\n borderJoinStyle: 'miter',\n borderWidth: 3,\n capBezierPoints: true,\n cubicInterpolationMode: 'default',\n fill: false,\n spanGaps: false,\n stepped: false,\n tension: 0\n};\nLineElement.defaultRoutes = {\n backgroundColor: 'backgroundColor',\n borderColor: 'borderColor'\n};\nLineElement.descriptors = {\n _scriptable: true,\n _indexable: name => name !== 'borderDash' && name !== 'fill'\n};\nfunction inRange$1(el, pos, axis, useFinalPosition) {\n const options = el.options;\n const _el$getProps = el.getProps([axis], useFinalPosition),\n value = _el$getProps[axis];\n return Math.abs(pos - value) < options.radius + options.hitRadius;\n}\nclass PointElement extends Element {\n constructor(cfg) {\n super();\n this.options = undefined;\n this.parsed = undefined;\n this.skip = undefined;\n this.stop = undefined;\n if (cfg) {\n Object.assign(this, cfg);\n }\n }\n inRange(mouseX, mouseY, useFinalPosition) {\n const options = this.options;\n const _this$getProps4 = this.getProps(['x', 'y'], useFinalPosition),\n x = _this$getProps4.x,\n y = _this$getProps4.y;\n return Math.pow(mouseX - x, 2) + Math.pow(mouseY - y, 2) < Math.pow(options.hitRadius + options.radius, 2);\n }\n inXRange(mouseX, useFinalPosition) {\n return inRange$1(this, mouseX, 'x', useFinalPosition);\n }\n inYRange(mouseY, useFinalPosition) {\n return inRange$1(this, mouseY, 'y', useFinalPosition);\n }\n getCenterPoint(useFinalPosition) {\n const _this$getProps5 = this.getProps(['x', 'y'], useFinalPosition),\n x = _this$getProps5.x,\n y = _this$getProps5.y;\n return {\n x,\n y\n };\n }\n size(options) {\n options = options || this.options || {};\n let radius = options.radius || 0;\n radius = Math.max(radius, radius && options.hoverRadius || 0);\n const borderWidth = radius && options.borderWidth || 0;\n return (radius + borderWidth) * 2;\n }\n draw(ctx, area) {\n const options = this.options;\n if (this.skip || options.radius < 0.1 || !_isPointInArea(this, area, this.size(options) / 2)) {\n return;\n }\n ctx.strokeStyle = options.borderColor;\n ctx.lineWidth = options.borderWidth;\n ctx.fillStyle = options.backgroundColor;\n drawPoint(ctx, options, this.x, this.y);\n }\n getRange() {\n const options = this.options || {};\n return options.radius + options.hitRadius;\n }\n}\nPointElement.id = 'point';\nPointElement.defaults = {\n borderWidth: 1,\n hitRadius: 1,\n hoverBorderWidth: 1,\n hoverRadius: 4,\n pointStyle: 'circle',\n radius: 3,\n rotation: 0\n};\nPointElement.defaultRoutes = {\n backgroundColor: 'backgroundColor',\n borderColor: 'borderColor'\n};\nfunction getBarBounds(bar, useFinalPosition) {\n const _bar$getProps = bar.getProps(['x', 'y', 'base', 'width', 'height'], useFinalPosition),\n x = _bar$getProps.x,\n y = _bar$getProps.y,\n base = _bar$getProps.base,\n width = _bar$getProps.width,\n height = _bar$getProps.height;\n let left, right, top, bottom, half;\n if (bar.horizontal) {\n half = height / 2;\n left = Math.min(x, base);\n right = Math.max(x, base);\n top = y - half;\n bottom = y + half;\n } else {\n half = width / 2;\n left = x - half;\n right = x + half;\n top = Math.min(y, base);\n bottom = Math.max(y, base);\n }\n return {\n left,\n top,\n right,\n bottom\n };\n}\nfunction skipOrLimit(skip, value, min, max) {\n return skip ? 0 : _limitValue(value, min, max);\n}\nfunction parseBorderWidth(bar, maxW, maxH) {\n const value = bar.options.borderWidth;\n const skip = bar.borderSkipped;\n const o = toTRBL(value);\n return {\n t: skipOrLimit(skip.top, o.top, 0, maxH),\n r: skipOrLimit(skip.right, o.right, 0, maxW),\n b: skipOrLimit(skip.bottom, o.bottom, 0, maxH),\n l: skipOrLimit(skip.left, o.left, 0, maxW)\n };\n}\nfunction parseBorderRadius(bar, maxW, maxH) {\n const _bar$getProps2 = bar.getProps(['enableBorderRadius']),\n enableBorderRadius = _bar$getProps2.enableBorderRadius;\n const value = bar.options.borderRadius;\n const o = toTRBLCorners(value);\n const maxR = Math.min(maxW, maxH);\n const skip = bar.borderSkipped;\n const enableBorder = enableBorderRadius || isObject(value);\n return {\n topLeft: skipOrLimit(!enableBorder || skip.top || skip.left, o.topLeft, 0, maxR),\n topRight: skipOrLimit(!enableBorder || skip.top || skip.right, o.topRight, 0, maxR),\n bottomLeft: skipOrLimit(!enableBorder || skip.bottom || skip.left, o.bottomLeft, 0, maxR),\n bottomRight: skipOrLimit(!enableBorder || skip.bottom || skip.right, o.bottomRight, 0, maxR)\n };\n}\nfunction boundingRects(bar) {\n const bounds = getBarBounds(bar);\n const width = bounds.right - bounds.left;\n const height = bounds.bottom - bounds.top;\n const border = parseBorderWidth(bar, width / 2, height / 2);\n const radius = parseBorderRadius(bar, width / 2, height / 2);\n return {\n outer: {\n x: bounds.left,\n y: bounds.top,\n w: width,\n h: height,\n radius\n },\n inner: {\n x: bounds.left + border.l,\n y: bounds.top + border.t,\n w: width - border.l - border.r,\n h: height - border.t - border.b,\n radius: {\n topLeft: Math.max(0, radius.topLeft - Math.max(border.t, border.l)),\n topRight: Math.max(0, radius.topRight - Math.max(border.t, border.r)),\n bottomLeft: Math.max(0, radius.bottomLeft - Math.max(border.b, border.l)),\n bottomRight: Math.max(0, radius.bottomRight - Math.max(border.b, border.r))\n }\n }\n };\n}\nfunction inRange(bar, x, y, useFinalPosition) {\n const skipX = x === null;\n const skipY = y === null;\n const skipBoth = skipX && skipY;\n const bounds = bar && !skipBoth && getBarBounds(bar, useFinalPosition);\n return bounds && (skipX || _isBetween(x, bounds.left, bounds.right)) && (skipY || _isBetween(y, bounds.top, bounds.bottom));\n}\nfunction hasRadius(radius) {\n return radius.topLeft || radius.topRight || radius.bottomLeft || radius.bottomRight;\n}\nfunction addNormalRectPath(ctx, rect) {\n ctx.rect(rect.x, rect.y, rect.w, rect.h);\n}\nfunction inflateRect(rect, amount) {\n let refRect = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};\n const x = rect.x !== refRect.x ? -amount : 0;\n const y = rect.y !== refRect.y ? -amount : 0;\n const w = (rect.x + rect.w !== refRect.x + refRect.w ? amount : 0) - x;\n const h = (rect.y + rect.h !== refRect.y + refRect.h ? amount : 0) - y;\n return {\n x: rect.x + x,\n y: rect.y + y,\n w: rect.w + w,\n h: rect.h + h,\n radius: rect.radius\n };\n}\nclass BarElement extends Element {\n constructor(cfg) {\n super();\n this.options = undefined;\n this.horizontal = undefined;\n this.base = undefined;\n this.width = undefined;\n this.height = undefined;\n this.inflateAmount = undefined;\n if (cfg) {\n Object.assign(this, cfg);\n }\n }\n draw(ctx) {\n const inflateAmount = this.inflateAmount,\n _this$options13 = this.options,\n borderColor = _this$options13.borderColor,\n backgroundColor = _this$options13.backgroundColor;\n const _boundingRects = boundingRects(this),\n inner = _boundingRects.inner,\n outer = _boundingRects.outer;\n const addRectPath = hasRadius(outer.radius) ? addRoundedRectPath : addNormalRectPath;\n ctx.save();\n if (outer.w !== inner.w || outer.h !== inner.h) {\n ctx.beginPath();\n addRectPath(ctx, inflateRect(outer, inflateAmount, inner));\n ctx.clip();\n addRectPath(ctx, inflateRect(inner, -inflateAmount, outer));\n ctx.fillStyle = borderColor;\n ctx.fill('evenodd');\n }\n ctx.beginPath();\n addRectPath(ctx, inflateRect(inner, inflateAmount));\n ctx.fillStyle = backgroundColor;\n ctx.fill();\n ctx.restore();\n }\n inRange(mouseX, mouseY, useFinalPosition) {\n return inRange(this, mouseX, mouseY, useFinalPosition);\n }\n inXRange(mouseX, useFinalPosition) {\n return inRange(this, mouseX, null, useFinalPosition);\n }\n inYRange(mouseY, useFinalPosition) {\n return inRange(this, null, mouseY, useFinalPosition);\n }\n getCenterPoint(useFinalPosition) {\n const _this$getProps6 = this.getProps(['x', 'y', 'base', 'horizontal'], useFinalPosition),\n x = _this$getProps6.x,\n y = _this$getProps6.y,\n base = _this$getProps6.base,\n horizontal = _this$getProps6.horizontal;\n return {\n x: horizontal ? (x + base) / 2 : x,\n y: horizontal ? y : (y + base) / 2\n };\n }\n getRange(axis) {\n return axis === 'x' ? this.width / 2 : this.height / 2;\n }\n}\nBarElement.id = 'bar';\nBarElement.defaults = {\n borderSkipped: 'start',\n borderWidth: 0,\n borderRadius: 0,\n inflateAmount: 'auto',\n pointStyle: undefined\n};\nBarElement.defaultRoutes = {\n backgroundColor: 'backgroundColor',\n borderColor: 'borderColor'\n};\nvar elements = /*#__PURE__*/Object.freeze({\n __proto__: null,\n ArcElement: ArcElement,\n LineElement: LineElement,\n PointElement: PointElement,\n BarElement: BarElement\n});\nfunction lttbDecimation(data, start, count, availableWidth, options) {\n const samples = options.samples || availableWidth;\n if (samples >= count) {\n return data.slice(start, start + count);\n }\n const decimated = [];\n const bucketWidth = (count - 2) / (samples - 2);\n let sampledIndex = 0;\n const endIndex = start + count - 1;\n let a = start;\n let i, maxAreaPoint, maxArea, area, nextA;\n decimated[sampledIndex++] = data[a];\n for (i = 0; i < samples - 2; i++) {\n let avgX = 0;\n let avgY = 0;\n let j;\n const avgRangeStart = Math.floor((i + 1) * bucketWidth) + 1 + start;\n const avgRangeEnd = Math.min(Math.floor((i + 2) * bucketWidth) + 1, count) + start;\n const avgRangeLength = avgRangeEnd - avgRangeStart;\n for (j = avgRangeStart; j < avgRangeEnd; j++) {\n avgX += data[j].x;\n avgY += data[j].y;\n }\n avgX /= avgRangeLength;\n avgY /= avgRangeLength;\n const rangeOffs = Math.floor(i * bucketWidth) + 1 + start;\n const rangeTo = Math.min(Math.floor((i + 1) * bucketWidth) + 1, count) + start;\n const _data$a = data[a],\n pointAx = _data$a.x,\n pointAy = _data$a.y;\n maxArea = area = -1;\n for (j = rangeOffs; j < rangeTo; j++) {\n area = 0.5 * Math.abs((pointAx - avgX) * (data[j].y - pointAy) - (pointAx - data[j].x) * (avgY - pointAy));\n if (area > maxArea) {\n maxArea = area;\n maxAreaPoint = data[j];\n nextA = j;\n }\n }\n decimated[sampledIndex++] = maxAreaPoint;\n a = nextA;\n }\n decimated[sampledIndex++] = data[endIndex];\n return decimated;\n}\nfunction minMaxDecimation(data, start, count, availableWidth) {\n let avgX = 0;\n let countX = 0;\n let i, point, x, y, prevX, minIndex, maxIndex, startIndex, minY, maxY;\n const decimated = [];\n const endIndex = start + count - 1;\n const xMin = data[start].x;\n const xMax = data[endIndex].x;\n const dx = xMax - xMin;\n for (i = start; i < start + count; ++i) {\n point = data[i];\n x = (point.x - xMin) / dx * availableWidth;\n y = point.y;\n const truncX = x | 0;\n if (truncX === prevX) {\n if (y < minY) {\n minY = y;\n minIndex = i;\n } else if (y > maxY) {\n maxY = y;\n maxIndex = i;\n }\n avgX = (countX * avgX + point.x) / ++countX;\n } else {\n const lastIndex = i - 1;\n if (!isNullOrUndef(minIndex) && !isNullOrUndef(maxIndex)) {\n const intermediateIndex1 = Math.min(minIndex, maxIndex);\n const intermediateIndex2 = Math.max(minIndex, maxIndex);\n if (intermediateIndex1 !== startIndex && intermediateIndex1 !== lastIndex) {\n decimated.push(_objectSpread(_objectSpread({}, data[intermediateIndex1]), {}, {\n x: avgX\n }));\n }\n if (intermediateIndex2 !== startIndex && intermediateIndex2 !== lastIndex) {\n decimated.push(_objectSpread(_objectSpread({}, data[intermediateIndex2]), {}, {\n x: avgX\n }));\n }\n }\n if (i > 0 && lastIndex !== startIndex) {\n decimated.push(data[lastIndex]);\n }\n decimated.push(point);\n prevX = truncX;\n countX = 0;\n minY = maxY = y;\n minIndex = maxIndex = startIndex = i;\n }\n }\n return decimated;\n}\nfunction cleanDecimatedDataset(dataset) {\n if (dataset._decimated) {\n const data = dataset._data;\n delete dataset._decimated;\n delete dataset._data;\n Object.defineProperty(dataset, 'data', {\n value: data\n });\n }\n}\nfunction cleanDecimatedData(chart) {\n chart.data.datasets.forEach(dataset => {\n cleanDecimatedDataset(dataset);\n });\n}\nfunction getStartAndCountOfVisiblePointsSimplified(meta, points) {\n const pointCount = points.length;\n let start = 0;\n let count;\n const iScale = meta.iScale;\n const _iScale$getUserBounds = iScale.getUserBounds(),\n min = _iScale$getUserBounds.min,\n max = _iScale$getUserBounds.max,\n minDefined = _iScale$getUserBounds.minDefined,\n maxDefined = _iScale$getUserBounds.maxDefined;\n if (minDefined) {\n start = _limitValue(_lookupByKey(points, iScale.axis, min).lo, 0, pointCount - 1);\n }\n if (maxDefined) {\n count = _limitValue(_lookupByKey(points, iScale.axis, max).hi + 1, start, pointCount) - start;\n } else {\n count = pointCount - start;\n }\n return {\n start,\n count\n };\n}\nvar plugin_decimation = {\n id: 'decimation',\n defaults: {\n algorithm: 'min-max',\n enabled: false\n },\n beforeElementsUpdate: (chart, args, options) => {\n if (!options.enabled) {\n cleanDecimatedData(chart);\n return;\n }\n const availableWidth = chart.width;\n chart.data.datasets.forEach((dataset, datasetIndex) => {\n const _data = dataset._data,\n indexAxis = dataset.indexAxis;\n const meta = chart.getDatasetMeta(datasetIndex);\n const data = _data || dataset.data;\n if (resolve([indexAxis, chart.options.indexAxis]) === 'y') {\n return;\n }\n if (!meta.controller.supportsDecimation) {\n return;\n }\n const xAxis = chart.scales[meta.xAxisID];\n if (xAxis.type !== 'linear' && xAxis.type !== 'time') {\n return;\n }\n if (chart.options.parsing) {\n return;\n }\n let _getStartAndCountOfVi3 = getStartAndCountOfVisiblePointsSimplified(meta, data),\n start = _getStartAndCountOfVi3.start,\n count = _getStartAndCountOfVi3.count;\n const threshold = options.threshold || 4 * availableWidth;\n if (count <= threshold) {\n cleanDecimatedDataset(dataset);\n return;\n }\n if (isNullOrUndef(_data)) {\n dataset._data = data;\n delete dataset.data;\n Object.defineProperty(dataset, 'data', {\n configurable: true,\n enumerable: true,\n get: function () {\n return this._decimated;\n },\n set: function (d) {\n this._data = d;\n }\n });\n }\n let decimated;\n switch (options.algorithm) {\n case 'lttb':\n decimated = lttbDecimation(data, start, count, availableWidth, options);\n break;\n case 'min-max':\n decimated = minMaxDecimation(data, start, count, availableWidth);\n break;\n default:\n throw new Error(`Unsupported decimation algorithm '${options.algorithm}'`);\n }\n dataset._decimated = decimated;\n });\n },\n destroy(chart) {\n cleanDecimatedData(chart);\n }\n};\nfunction _segments(line, target, property) {\n const segments = line.segments;\n const points = line.points;\n const tpoints = target.points;\n const parts = [];\n for (const segment of segments) {\n let start = segment.start,\n end = segment.end;\n end = _findSegmentEnd(start, end, points);\n const bounds = _getBounds(property, points[start], points[end], segment.loop);\n if (!target.segments) {\n parts.push({\n source: segment,\n target: bounds,\n start: points[start],\n end: points[end]\n });\n continue;\n }\n const targetSegments = _boundSegments(target, bounds);\n for (const tgt of targetSegments) {\n const subBounds = _getBounds(property, tpoints[tgt.start], tpoints[tgt.end], tgt.loop);\n const fillSources = _boundSegment(segment, points, subBounds);\n for (const fillSource of fillSources) {\n parts.push({\n source: fillSource,\n target: tgt,\n start: {\n [property]: _getEdge(bounds, subBounds, 'start', Math.max)\n },\n end: {\n [property]: _getEdge(bounds, subBounds, 'end', Math.min)\n }\n });\n }\n }\n }\n return parts;\n}\nfunction _getBounds(property, first, last, loop) {\n if (loop) {\n return;\n }\n let start = first[property];\n let end = last[property];\n if (property === 'angle') {\n start = _normalizeAngle(start);\n end = _normalizeAngle(end);\n }\n return {\n property,\n start,\n end\n };\n}\nfunction _pointsFromSegments(boundary, line) {\n const _ref10 = boundary || {},\n _ref10$x = _ref10.x,\n x = _ref10$x === void 0 ? null : _ref10$x,\n _ref10$y = _ref10.y,\n y = _ref10$y === void 0 ? null : _ref10$y;\n const linePoints = line.points;\n const points = [];\n line.segments.forEach(_ref11 => {\n let start = _ref11.start,\n end = _ref11.end;\n end = _findSegmentEnd(start, end, linePoints);\n const first = linePoints[start];\n const last = linePoints[end];\n if (y !== null) {\n points.push({\n x: first.x,\n y\n });\n points.push({\n x: last.x,\n y\n });\n } else if (x !== null) {\n points.push({\n x,\n y: first.y\n });\n points.push({\n x,\n y: last.y\n });\n }\n });\n return points;\n}\nfunction _findSegmentEnd(start, end, points) {\n for (; end > start; end--) {\n const point = points[end];\n if (!isNaN(point.x) && !isNaN(point.y)) {\n break;\n }\n }\n return end;\n}\nfunction _getEdge(a, b, prop, fn) {\n if (a && b) {\n return fn(a[prop], b[prop]);\n }\n return a ? a[prop] : b ? b[prop] : 0;\n}\nfunction _createBoundaryLine(boundary, line) {\n let points = [];\n let _loop = false;\n if (isArray(boundary)) {\n _loop = true;\n points = boundary;\n } else {\n points = _pointsFromSegments(boundary, line);\n }\n return points.length ? new LineElement({\n points,\n options: {\n tension: 0\n },\n _loop,\n _fullLoop: _loop\n }) : null;\n}\nfunction _shouldApplyFill(source) {\n return source && source.fill !== false;\n}\nfunction _resolveTarget(sources, index, propagate) {\n const source = sources[index];\n let fill = source.fill;\n const visited = [index];\n let target;\n if (!propagate) {\n return fill;\n }\n while (fill !== false && visited.indexOf(fill) === -1) {\n if (!isNumberFinite(fill)) {\n return fill;\n }\n target = sources[fill];\n if (!target) {\n return false;\n }\n if (target.visible) {\n return fill;\n }\n visited.push(fill);\n fill = target.fill;\n }\n return false;\n}\nfunction _decodeFill(line, index, count) {\n const fill = parseFillOption(line);\n if (isObject(fill)) {\n return isNaN(fill.value) ? false : fill;\n }\n let target = parseFloat(fill);\n if (isNumberFinite(target) && Math.floor(target) === target) {\n return decodeTargetIndex(fill[0], index, target, count);\n }\n return ['origin', 'start', 'end', 'stack', 'shape'].indexOf(fill) >= 0 && fill;\n}\nfunction decodeTargetIndex(firstCh, index, target, count) {\n if (firstCh === '-' || firstCh === '+') {\n target = index + target;\n }\n if (target === index || target < 0 || target >= count) {\n return false;\n }\n return target;\n}\nfunction _getTargetPixel(fill, scale) {\n let pixel = null;\n if (fill === 'start') {\n pixel = scale.bottom;\n } else if (fill === 'end') {\n pixel = scale.top;\n } else if (isObject(fill)) {\n pixel = scale.getPixelForValue(fill.value);\n } else if (scale.getBasePixel) {\n pixel = scale.getBasePixel();\n }\n return pixel;\n}\nfunction _getTargetValue(fill, scale, startValue) {\n let value;\n if (fill === 'start') {\n value = startValue;\n } else if (fill === 'end') {\n value = scale.options.reverse ? scale.min : scale.max;\n } else if (isObject(fill)) {\n value = fill.value;\n } else {\n value = scale.getBaseValue();\n }\n return value;\n}\nfunction parseFillOption(line) {\n const options = line.options;\n const fillOption = options.fill;\n let fill = valueOrDefault(fillOption && fillOption.target, fillOption);\n if (fill === undefined) {\n fill = !!options.backgroundColor;\n }\n if (fill === false || fill === null) {\n return false;\n }\n if (fill === true) {\n return 'origin';\n }\n return fill;\n}\nfunction _buildStackLine(source) {\n const scale = source.scale,\n index = source.index,\n line = source.line;\n const points = [];\n const segments = line.segments;\n const sourcePoints = line.points;\n const linesBelow = getLinesBelow(scale, index);\n linesBelow.push(_createBoundaryLine({\n x: null,\n y: scale.bottom\n }, line));\n for (let i = 0; i < segments.length; i++) {\n const segment = segments[i];\n for (let j = segment.start; j <= segment.end; j++) {\n addPointsBelow(points, sourcePoints[j], linesBelow);\n }\n }\n return new LineElement({\n points,\n options: {}\n });\n}\nfunction getLinesBelow(scale, index) {\n const below = [];\n const metas = scale.getMatchingVisibleMetas('line');\n for (let i = 0; i < metas.length; i++) {\n const meta = metas[i];\n if (meta.index === index) {\n break;\n }\n if (!meta.hidden) {\n below.unshift(meta.dataset);\n }\n }\n return below;\n}\nfunction addPointsBelow(points, sourcePoint, linesBelow) {\n const postponed = [];\n for (let j = 0; j < linesBelow.length; j++) {\n const line = linesBelow[j];\n const _findPoint = findPoint(line, sourcePoint, 'x'),\n first = _findPoint.first,\n last = _findPoint.last,\n point = _findPoint.point;\n if (!point || first && last) {\n continue;\n }\n if (first) {\n postponed.unshift(point);\n } else {\n points.push(point);\n if (!last) {\n break;\n }\n }\n }\n points.push(...postponed);\n}\nfunction findPoint(line, sourcePoint, property) {\n const point = line.interpolate(sourcePoint, property);\n if (!point) {\n return {};\n }\n const pointValue = point[property];\n const segments = line.segments;\n const linePoints = line.points;\n let first = false;\n let last = false;\n for (let i = 0; i < segments.length; i++) {\n const segment = segments[i];\n const firstValue = linePoints[segment.start][property];\n const lastValue = linePoints[segment.end][property];\n if (_isBetween(pointValue, firstValue, lastValue)) {\n first = pointValue === firstValue;\n last = pointValue === lastValue;\n break;\n }\n }\n return {\n first,\n last,\n point\n };\n}\nclass simpleArc {\n constructor(opts) {\n this.x = opts.x;\n this.y = opts.y;\n this.radius = opts.radius;\n }\n pathSegment(ctx, bounds, opts) {\n const x = this.x,\n y = this.y,\n radius = this.radius;\n bounds = bounds || {\n start: 0,\n end: TAU\n };\n ctx.arc(x, y, radius, bounds.end, bounds.start, true);\n return !opts.bounds;\n }\n interpolate(point) {\n const x = this.x,\n y = this.y,\n radius = this.radius;\n const angle = point.angle;\n return {\n x: x + Math.cos(angle) * radius,\n y: y + Math.sin(angle) * radius,\n angle\n };\n }\n}\nfunction _getTarget(source) {\n const chart = source.chart,\n fill = source.fill,\n line = source.line;\n if (isNumberFinite(fill)) {\n return getLineByIndex(chart, fill);\n }\n if (fill === 'stack') {\n return _buildStackLine(source);\n }\n if (fill === 'shape') {\n return true;\n }\n const boundary = computeBoundary(source);\n if (boundary instanceof simpleArc) {\n return boundary;\n }\n return _createBoundaryLine(boundary, line);\n}\nfunction getLineByIndex(chart, index) {\n const meta = chart.getDatasetMeta(index);\n const visible = meta && chart.isDatasetVisible(index);\n return visible ? meta.dataset : null;\n}\nfunction computeBoundary(source) {\n const scale = source.scale || {};\n if (scale.getPointPositionForValue) {\n return computeCircularBoundary(source);\n }\n return computeLinearBoundary(source);\n}\nfunction computeLinearBoundary(source) {\n const _source$scale = source.scale,\n scale = _source$scale === void 0 ? {} : _source$scale,\n fill = source.fill;\n const pixel = _getTargetPixel(fill, scale);\n if (isNumberFinite(pixel)) {\n const horizontal = scale.isHorizontal();\n return {\n x: horizontal ? pixel : null,\n y: horizontal ? null : pixel\n };\n }\n return null;\n}\nfunction computeCircularBoundary(source) {\n const scale = source.scale,\n fill = source.fill;\n const options = scale.options;\n const length = scale.getLabels().length;\n const start = options.reverse ? scale.max : scale.min;\n const value = _getTargetValue(fill, scale, start);\n const target = [];\n if (options.grid.circular) {\n const center = scale.getPointPositionForValue(0, start);\n return new simpleArc({\n x: center.x,\n y: center.y,\n radius: scale.getDistanceFromCenterForValue(value)\n });\n }\n for (let i = 0; i < length; ++i) {\n target.push(scale.getPointPositionForValue(i, value));\n }\n return target;\n}\nfunction _drawfill(ctx, source, area) {\n const target = _getTarget(source);\n const line = source.line,\n scale = source.scale,\n axis = source.axis;\n const lineOpts = line.options;\n const fillOption = lineOpts.fill;\n const color = lineOpts.backgroundColor;\n const _ref12 = fillOption || {},\n _ref12$above = _ref12.above,\n above = _ref12$above === void 0 ? color : _ref12$above,\n _ref12$below = _ref12.below,\n below = _ref12$below === void 0 ? color : _ref12$below;\n if (target && line.points.length) {\n clipArea(ctx, area);\n doFill(ctx, {\n line,\n target,\n above,\n below,\n area,\n scale,\n axis\n });\n unclipArea(ctx);\n }\n}\nfunction doFill(ctx, cfg) {\n const line = cfg.line,\n target = cfg.target,\n above = cfg.above,\n below = cfg.below,\n area = cfg.area,\n scale = cfg.scale;\n const property = line._loop ? 'angle' : cfg.axis;\n ctx.save();\n if (property === 'x' && below !== above) {\n clipVertical(ctx, target, area.top);\n fill(ctx, {\n line,\n target,\n color: above,\n scale,\n property\n });\n ctx.restore();\n ctx.save();\n clipVertical(ctx, target, area.bottom);\n }\n fill(ctx, {\n line,\n target,\n color: below,\n scale,\n property\n });\n ctx.restore();\n}\nfunction clipVertical(ctx, target, clipY) {\n const segments = target.segments,\n points = target.points;\n let first = true;\n let lineLoop = false;\n ctx.beginPath();\n for (const segment of segments) {\n const start = segment.start,\n end = segment.end;\n const firstPoint = points[start];\n const lastPoint = points[_findSegmentEnd(start, end, points)];\n if (first) {\n ctx.moveTo(firstPoint.x, firstPoint.y);\n first = false;\n } else {\n ctx.lineTo(firstPoint.x, clipY);\n ctx.lineTo(firstPoint.x, firstPoint.y);\n }\n lineLoop = !!target.pathSegment(ctx, segment, {\n move: lineLoop\n });\n if (lineLoop) {\n ctx.closePath();\n } else {\n ctx.lineTo(lastPoint.x, clipY);\n }\n }\n ctx.lineTo(target.first().x, clipY);\n ctx.closePath();\n ctx.clip();\n}\nfunction fill(ctx, cfg) {\n const line = cfg.line,\n target = cfg.target,\n property = cfg.property,\n color = cfg.color,\n scale = cfg.scale;\n const segments = _segments(line, target, property);\n for (const _ref13 of segments) {\n const src = _ref13.source;\n const tgt = _ref13.target;\n const start = _ref13.start;\n const end = _ref13.end;\n const _src$style = src.style,\n _src$style2 = _src$style === void 0 ? {} : _src$style,\n _src$style2$backgroun = _src$style2.backgroundColor,\n backgroundColor = _src$style2$backgroun === void 0 ? color : _src$style2$backgroun;\n const notShape = target !== true;\n ctx.save();\n ctx.fillStyle = backgroundColor;\n clipBounds(ctx, scale, notShape && _getBounds(property, start, end));\n ctx.beginPath();\n const lineLoop = !!line.pathSegment(ctx, src);\n let loop;\n if (notShape) {\n if (lineLoop) {\n ctx.closePath();\n } else {\n interpolatedLineTo(ctx, target, end, property);\n }\n const targetLoop = !!target.pathSegment(ctx, tgt, {\n move: lineLoop,\n reverse: true\n });\n loop = lineLoop && targetLoop;\n if (!loop) {\n interpolatedLineTo(ctx, target, start, property);\n }\n }\n ctx.closePath();\n ctx.fill(loop ? 'evenodd' : 'nonzero');\n ctx.restore();\n }\n}\nfunction clipBounds(ctx, scale, bounds) {\n const _scale$chart$chartAre = scale.chart.chartArea,\n top = _scale$chart$chartAre.top,\n bottom = _scale$chart$chartAre.bottom;\n const _ref14 = bounds || {},\n property = _ref14.property,\n start = _ref14.start,\n end = _ref14.end;\n if (property === 'x') {\n ctx.beginPath();\n ctx.rect(start, top, end - start, bottom - top);\n ctx.clip();\n }\n}\nfunction interpolatedLineTo(ctx, target, point, property) {\n const interpolatedPoint = target.interpolate(point, property);\n if (interpolatedPoint) {\n ctx.lineTo(interpolatedPoint.x, interpolatedPoint.y);\n }\n}\nvar index = {\n id: 'filler',\n afterDatasetsUpdate(chart, _args, options) {\n const count = (chart.data.datasets || []).length;\n const sources = [];\n let meta, i, line, source;\n for (i = 0; i < count; ++i) {\n meta = chart.getDatasetMeta(i);\n line = meta.dataset;\n source = null;\n if (line && line.options && line instanceof LineElement) {\n source = {\n visible: chart.isDatasetVisible(i),\n index: i,\n fill: _decodeFill(line, i, count),\n chart,\n axis: meta.controller.options.indexAxis,\n scale: meta.vScale,\n line\n };\n }\n meta.$filler = source;\n sources.push(source);\n }\n for (i = 0; i < count; ++i) {\n source = sources[i];\n if (!source || source.fill === false) {\n continue;\n }\n source.fill = _resolveTarget(sources, i, options.propagate);\n }\n },\n beforeDraw(chart, _args, options) {\n const draw = options.drawTime === 'beforeDraw';\n const metasets = chart.getSortedVisibleDatasetMetas();\n const area = chart.chartArea;\n for (let i = metasets.length - 1; i >= 0; --i) {\n const source = metasets[i].$filler;\n if (!source) {\n continue;\n }\n source.line.updateControlPoints(area, source.axis);\n if (draw && source.fill) {\n _drawfill(chart.ctx, source, area);\n }\n }\n },\n beforeDatasetsDraw(chart, _args, options) {\n if (options.drawTime !== 'beforeDatasetsDraw') {\n return;\n }\n const metasets = chart.getSortedVisibleDatasetMetas();\n for (let i = metasets.length - 1; i >= 0; --i) {\n const source = metasets[i].$filler;\n if (_shouldApplyFill(source)) {\n _drawfill(chart.ctx, source, chart.chartArea);\n }\n }\n },\n beforeDatasetDraw(chart, args, options) {\n const source = args.meta.$filler;\n if (!_shouldApplyFill(source) || options.drawTime !== 'beforeDatasetDraw') {\n return;\n }\n _drawfill(chart.ctx, source, chart.chartArea);\n },\n defaults: {\n propagate: true,\n drawTime: 'beforeDatasetDraw'\n }\n};\nconst getBoxSize = (labelOpts, fontSize) => {\n let _labelOpts$boxHeight = labelOpts.boxHeight,\n boxHeight = _labelOpts$boxHeight === void 0 ? fontSize : _labelOpts$boxHeight,\n _labelOpts$boxWidth = labelOpts.boxWidth,\n boxWidth = _labelOpts$boxWidth === void 0 ? fontSize : _labelOpts$boxWidth;\n if (labelOpts.usePointStyle) {\n boxHeight = Math.min(boxHeight, fontSize);\n boxWidth = labelOpts.pointStyleWidth || Math.min(boxWidth, fontSize);\n }\n return {\n boxWidth,\n boxHeight,\n itemHeight: Math.max(fontSize, boxHeight)\n };\n};\nconst itemsEqual = (a, b) => a !== null && b !== null && a.datasetIndex === b.datasetIndex && a.index === b.index;\nclass Legend extends Element {\n constructor(config) {\n super();\n this._added = false;\n this.legendHitBoxes = [];\n this._hoveredItem = null;\n this.doughnutMode = false;\n this.chart = config.chart;\n this.options = config.options;\n this.ctx = config.ctx;\n this.legendItems = undefined;\n this.columnSizes = undefined;\n this.lineWidths = undefined;\n this.maxHeight = undefined;\n this.maxWidth = undefined;\n this.top = undefined;\n this.bottom = undefined;\n this.left = undefined;\n this.right = undefined;\n this.height = undefined;\n this.width = undefined;\n this._margins = undefined;\n this.position = undefined;\n this.weight = undefined;\n this.fullSize = undefined;\n }\n update(maxWidth, maxHeight, margins) {\n this.maxWidth = maxWidth;\n this.maxHeight = maxHeight;\n this._margins = margins;\n this.setDimensions();\n this.buildLabels();\n this.fit();\n }\n setDimensions() {\n if (this.isHorizontal()) {\n this.width = this.maxWidth;\n this.left = this._margins.left;\n this.right = this.width;\n } else {\n this.height = this.maxHeight;\n this.top = this._margins.top;\n this.bottom = this.height;\n }\n }\n buildLabels() {\n const labelOpts = this.options.labels || {};\n let legendItems = callback(labelOpts.generateLabels, [this.chart], this) || [];\n if (labelOpts.filter) {\n legendItems = legendItems.filter(item => labelOpts.filter(item, this.chart.data));\n }\n if (labelOpts.sort) {\n legendItems = legendItems.sort((a, b) => labelOpts.sort(a, b, this.chart.data));\n }\n if (this.options.reverse) {\n legendItems.reverse();\n }\n this.legendItems = legendItems;\n }\n fit() {\n const options = this.options,\n ctx = this.ctx;\n if (!options.display) {\n this.width = this.height = 0;\n return;\n }\n const labelOpts = options.labels;\n const labelFont = toFont(labelOpts.font);\n const fontSize = labelFont.size;\n const titleHeight = this._computeTitleHeight();\n const _getBoxSize = getBoxSize(labelOpts, fontSize),\n boxWidth = _getBoxSize.boxWidth,\n itemHeight = _getBoxSize.itemHeight;\n let width, height;\n ctx.font = labelFont.string;\n if (this.isHorizontal()) {\n width = this.maxWidth;\n height = this._fitRows(titleHeight, fontSize, boxWidth, itemHeight) + 10;\n } else {\n height = this.maxHeight;\n width = this._fitCols(titleHeight, fontSize, boxWidth, itemHeight) + 10;\n }\n this.width = Math.min(width, options.maxWidth || this.maxWidth);\n this.height = Math.min(height, options.maxHeight || this.maxHeight);\n }\n _fitRows(titleHeight, fontSize, boxWidth, itemHeight) {\n const ctx = this.ctx,\n maxWidth = this.maxWidth,\n padding = this.options.labels.padding;\n const hitboxes = this.legendHitBoxes = [];\n const lineWidths = this.lineWidths = [0];\n const lineHeight = itemHeight + padding;\n let totalHeight = titleHeight;\n ctx.textAlign = 'left';\n ctx.textBaseline = 'middle';\n let row = -1;\n let top = -lineHeight;\n this.legendItems.forEach((legendItem, i) => {\n const itemWidth = boxWidth + fontSize / 2 + ctx.measureText(legendItem.text).width;\n if (i === 0 || lineWidths[lineWidths.length - 1] + itemWidth + 2 * padding > maxWidth) {\n totalHeight += lineHeight;\n lineWidths[lineWidths.length - (i > 0 ? 0 : 1)] = 0;\n top += lineHeight;\n row++;\n }\n hitboxes[i] = {\n left: 0,\n top,\n row,\n width: itemWidth,\n height: itemHeight\n };\n lineWidths[lineWidths.length - 1] += itemWidth + padding;\n });\n return totalHeight;\n }\n _fitCols(titleHeight, fontSize, boxWidth, itemHeight) {\n const ctx = this.ctx,\n maxHeight = this.maxHeight,\n padding = this.options.labels.padding;\n const hitboxes = this.legendHitBoxes = [];\n const columnSizes = this.columnSizes = [];\n const heightLimit = maxHeight - titleHeight;\n let totalWidth = padding;\n let currentColWidth = 0;\n let currentColHeight = 0;\n let left = 0;\n let col = 0;\n this.legendItems.forEach((legendItem, i) => {\n const itemWidth = boxWidth + fontSize / 2 + ctx.measureText(legendItem.text).width;\n if (i > 0 && currentColHeight + itemHeight + 2 * padding > heightLimit) {\n totalWidth += currentColWidth + padding;\n columnSizes.push({\n width: currentColWidth,\n height: currentColHeight\n });\n left += currentColWidth + padding;\n col++;\n currentColWidth = currentColHeight = 0;\n }\n hitboxes[i] = {\n left,\n top: currentColHeight,\n col,\n width: itemWidth,\n height: itemHeight\n };\n currentColWidth = Math.max(currentColWidth, itemWidth);\n currentColHeight += itemHeight + padding;\n });\n totalWidth += currentColWidth;\n columnSizes.push({\n width: currentColWidth,\n height: currentColHeight\n });\n return totalWidth;\n }\n adjustHitBoxes() {\n if (!this.options.display) {\n return;\n }\n const titleHeight = this._computeTitleHeight();\n const hitboxes = this.legendHitBoxes,\n _this$options14 = this.options,\n align = _this$options14.align,\n padding = _this$options14.labels.padding,\n rtl = _this$options14.rtl;\n const rtlHelper = getRtlAdapter(rtl, this.left, this.width);\n if (this.isHorizontal()) {\n let row = 0;\n let left = _alignStartEnd(align, this.left + padding, this.right - this.lineWidths[row]);\n for (const hitbox of hitboxes) {\n if (row !== hitbox.row) {\n row = hitbox.row;\n left = _alignStartEnd(align, this.left + padding, this.right - this.lineWidths[row]);\n }\n hitbox.top += this.top + titleHeight + padding;\n hitbox.left = rtlHelper.leftForLtr(rtlHelper.x(left), hitbox.width);\n left += hitbox.width + padding;\n }\n } else {\n let col = 0;\n let top = _alignStartEnd(align, this.top + titleHeight + padding, this.bottom - this.columnSizes[col].height);\n for (const hitbox of hitboxes) {\n if (hitbox.col !== col) {\n col = hitbox.col;\n top = _alignStartEnd(align, this.top + titleHeight + padding, this.bottom - this.columnSizes[col].height);\n }\n hitbox.top = top;\n hitbox.left += this.left + padding;\n hitbox.left = rtlHelper.leftForLtr(rtlHelper.x(hitbox.left), hitbox.width);\n top += hitbox.height + padding;\n }\n }\n }\n isHorizontal() {\n return this.options.position === 'top' || this.options.position === 'bottom';\n }\n draw() {\n if (this.options.display) {\n const ctx = this.ctx;\n clipArea(ctx, this);\n this._draw();\n unclipArea(ctx);\n }\n }\n _draw() {\n const opts = this.options,\n columnSizes = this.columnSizes,\n lineWidths = this.lineWidths,\n ctx = this.ctx;\n const align = opts.align,\n labelOpts = opts.labels;\n const defaultColor = defaults.color;\n const rtlHelper = getRtlAdapter(opts.rtl, this.left, this.width);\n const labelFont = toFont(labelOpts.font);\n const fontColor = labelOpts.color,\n padding = labelOpts.padding;\n const fontSize = labelFont.size;\n const halfFontSize = fontSize / 2;\n let cursor;\n this.drawTitle();\n ctx.textAlign = rtlHelper.textAlign('left');\n ctx.textBaseline = 'middle';\n ctx.lineWidth = 0.5;\n ctx.font = labelFont.string;\n const _getBoxSize2 = getBoxSize(labelOpts, fontSize),\n boxWidth = _getBoxSize2.boxWidth,\n boxHeight = _getBoxSize2.boxHeight,\n itemHeight = _getBoxSize2.itemHeight;\n const drawLegendBox = function (x, y, legendItem) {\n if (isNaN(boxWidth) || boxWidth <= 0 || isNaN(boxHeight) || boxHeight < 0) {\n return;\n }\n ctx.save();\n const lineWidth = valueOrDefault(legendItem.lineWidth, 1);\n ctx.fillStyle = valueOrDefault(legendItem.fillStyle, defaultColor);\n ctx.lineCap = valueOrDefault(legendItem.lineCap, 'butt');\n ctx.lineDashOffset = valueOrDefault(legendItem.lineDashOffset, 0);\n ctx.lineJoin = valueOrDefault(legendItem.lineJoin, 'miter');\n ctx.lineWidth = lineWidth;\n ctx.strokeStyle = valueOrDefault(legendItem.strokeStyle, defaultColor);\n ctx.setLineDash(valueOrDefault(legendItem.lineDash, []));\n if (labelOpts.usePointStyle) {\n const drawOptions = {\n radius: boxHeight * Math.SQRT2 / 2,\n pointStyle: legendItem.pointStyle,\n rotation: legendItem.rotation,\n borderWidth: lineWidth\n };\n const centerX = rtlHelper.xPlus(x, boxWidth / 2);\n const centerY = y + halfFontSize;\n drawPointLegend(ctx, drawOptions, centerX, centerY, labelOpts.pointStyleWidth && boxWidth);\n } else {\n const yBoxTop = y + Math.max((fontSize - boxHeight) / 2, 0);\n const xBoxLeft = rtlHelper.leftForLtr(x, boxWidth);\n const borderRadius = toTRBLCorners(legendItem.borderRadius);\n ctx.beginPath();\n if (Object.values(borderRadius).some(v => v !== 0)) {\n addRoundedRectPath(ctx, {\n x: xBoxLeft,\n y: yBoxTop,\n w: boxWidth,\n h: boxHeight,\n radius: borderRadius\n });\n } else {\n ctx.rect(xBoxLeft, yBoxTop, boxWidth, boxHeight);\n }\n ctx.fill();\n if (lineWidth !== 0) {\n ctx.stroke();\n }\n }\n ctx.restore();\n };\n const fillText = function (x, y, legendItem) {\n renderText(ctx, legendItem.text, x, y + itemHeight / 2, labelFont, {\n strikethrough: legendItem.hidden,\n textAlign: rtlHelper.textAlign(legendItem.textAlign)\n });\n };\n const isHorizontal = this.isHorizontal();\n const titleHeight = this._computeTitleHeight();\n if (isHorizontal) {\n cursor = {\n x: _alignStartEnd(align, this.left + padding, this.right - lineWidths[0]),\n y: this.top + padding + titleHeight,\n line: 0\n };\n } else {\n cursor = {\n x: this.left + padding,\n y: _alignStartEnd(align, this.top + titleHeight + padding, this.bottom - columnSizes[0].height),\n line: 0\n };\n }\n overrideTextDirection(this.ctx, opts.textDirection);\n const lineHeight = itemHeight + padding;\n this.legendItems.forEach((legendItem, i) => {\n ctx.strokeStyle = legendItem.fontColor || fontColor;\n ctx.fillStyle = legendItem.fontColor || fontColor;\n const textWidth = ctx.measureText(legendItem.text).width;\n const textAlign = rtlHelper.textAlign(legendItem.textAlign || (legendItem.textAlign = labelOpts.textAlign));\n const width = boxWidth + halfFontSize + textWidth;\n let x = cursor.x;\n let y = cursor.y;\n rtlHelper.setWidth(this.width);\n if (isHorizontal) {\n if (i > 0 && x + width + padding > this.right) {\n y = cursor.y += lineHeight;\n cursor.line++;\n x = cursor.x = _alignStartEnd(align, this.left + padding, this.right - lineWidths[cursor.line]);\n }\n } else if (i > 0 && y + lineHeight > this.bottom) {\n x = cursor.x = x + columnSizes[cursor.line].width + padding;\n cursor.line++;\n y = cursor.y = _alignStartEnd(align, this.top + titleHeight + padding, this.bottom - columnSizes[cursor.line].height);\n }\n const realX = rtlHelper.x(x);\n drawLegendBox(realX, y, legendItem);\n x = _textX(textAlign, x + boxWidth + halfFontSize, isHorizontal ? x + width : this.right, opts.rtl);\n fillText(rtlHelper.x(x), y, legendItem);\n if (isHorizontal) {\n cursor.x += width + padding;\n } else {\n cursor.y += lineHeight;\n }\n });\n restoreTextDirection(this.ctx, opts.textDirection);\n }\n drawTitle() {\n const opts = this.options;\n const titleOpts = opts.title;\n const titleFont = toFont(titleOpts.font);\n const titlePadding = toPadding(titleOpts.padding);\n if (!titleOpts.display) {\n return;\n }\n const rtlHelper = getRtlAdapter(opts.rtl, this.left, this.width);\n const ctx = this.ctx;\n const position = titleOpts.position;\n const halfFontSize = titleFont.size / 2;\n const topPaddingPlusHalfFontSize = titlePadding.top + halfFontSize;\n let y;\n let left = this.left;\n let maxWidth = this.width;\n if (this.isHorizontal()) {\n maxWidth = Math.max(...this.lineWidths);\n y = this.top + topPaddingPlusHalfFontSize;\n left = _alignStartEnd(opts.align, left, this.right - maxWidth);\n } else {\n const maxHeight = this.columnSizes.reduce((acc, size) => Math.max(acc, size.height), 0);\n y = topPaddingPlusHalfFontSize + _alignStartEnd(opts.align, this.top, this.bottom - maxHeight - opts.labels.padding - this._computeTitleHeight());\n }\n const x = _alignStartEnd(position, left, left + maxWidth);\n ctx.textAlign = rtlHelper.textAlign(_toLeftRightCenter(position));\n ctx.textBaseline = 'middle';\n ctx.strokeStyle = titleOpts.color;\n ctx.fillStyle = titleOpts.color;\n ctx.font = titleFont.string;\n renderText(ctx, titleOpts.text, x, y, titleFont);\n }\n _computeTitleHeight() {\n const titleOpts = this.options.title;\n const titleFont = toFont(titleOpts.font);\n const titlePadding = toPadding(titleOpts.padding);\n return titleOpts.display ? titleFont.lineHeight + titlePadding.height : 0;\n }\n _getLegendItemAt(x, y) {\n let i, hitBox, lh;\n if (_isBetween(x, this.left, this.right) && _isBetween(y, this.top, this.bottom)) {\n lh = this.legendHitBoxes;\n for (i = 0; i < lh.length; ++i) {\n hitBox = lh[i];\n if (_isBetween(x, hitBox.left, hitBox.left + hitBox.width) && _isBetween(y, hitBox.top, hitBox.top + hitBox.height)) {\n return this.legendItems[i];\n }\n }\n }\n return null;\n }\n handleEvent(e) {\n const opts = this.options;\n if (!isListened(e.type, opts)) {\n return;\n }\n const hoveredItem = this._getLegendItemAt(e.x, e.y);\n if (e.type === 'mousemove' || e.type === 'mouseout') {\n const previous = this._hoveredItem;\n const sameItem = itemsEqual(previous, hoveredItem);\n if (previous && !sameItem) {\n callback(opts.onLeave, [e, previous, this], this);\n }\n this._hoveredItem = hoveredItem;\n if (hoveredItem && !sameItem) {\n callback(opts.onHover, [e, hoveredItem, this], this);\n }\n } else if (hoveredItem) {\n callback(opts.onClick, [e, hoveredItem, this], this);\n }\n }\n}\nfunction isListened(type, opts) {\n if ((type === 'mousemove' || type === 'mouseout') && (opts.onHover || opts.onLeave)) {\n return true;\n }\n if (opts.onClick && (type === 'click' || type === 'mouseup')) {\n return true;\n }\n return false;\n}\nvar plugin_legend = {\n id: 'legend',\n _element: Legend,\n start(chart, _args, options) {\n const legend = chart.legend = new Legend({\n ctx: chart.ctx,\n options,\n chart\n });\n layouts.configure(chart, legend, options);\n layouts.addBox(chart, legend);\n },\n stop(chart) {\n layouts.removeBox(chart, chart.legend);\n delete chart.legend;\n },\n beforeUpdate(chart, _args, options) {\n const legend = chart.legend;\n layouts.configure(chart, legend, options);\n legend.options = options;\n },\n afterUpdate(chart) {\n const legend = chart.legend;\n legend.buildLabels();\n legend.adjustHitBoxes();\n },\n afterEvent(chart, args) {\n if (!args.replay) {\n chart.legend.handleEvent(args.event);\n }\n },\n defaults: {\n display: true,\n position: 'top',\n align: 'center',\n fullSize: true,\n reverse: false,\n weight: 1000,\n onClick(e, legendItem, legend) {\n const index = legendItem.datasetIndex;\n const ci = legend.chart;\n if (ci.isDatasetVisible(index)) {\n ci.hide(index);\n legendItem.hidden = true;\n } else {\n ci.show(index);\n legendItem.hidden = false;\n }\n },\n onHover: null,\n onLeave: null,\n labels: {\n color: ctx => ctx.chart.options.color,\n boxWidth: 40,\n padding: 10,\n generateLabels(chart) {\n const datasets = chart.data.datasets;\n const _chart$legend$options = chart.legend.options.labels,\n usePointStyle = _chart$legend$options.usePointStyle,\n pointStyle = _chart$legend$options.pointStyle,\n textAlign = _chart$legend$options.textAlign,\n color = _chart$legend$options.color;\n return chart._getSortedDatasetMetas().map(meta => {\n const style = meta.controller.getStyle(usePointStyle ? 0 : undefined);\n const borderWidth = toPadding(style.borderWidth);\n return {\n text: datasets[meta.index].label,\n fillStyle: style.backgroundColor,\n fontColor: color,\n hidden: !meta.visible,\n lineCap: style.borderCapStyle,\n lineDash: style.borderDash,\n lineDashOffset: style.borderDashOffset,\n lineJoin: style.borderJoinStyle,\n lineWidth: (borderWidth.width + borderWidth.height) / 4,\n strokeStyle: style.borderColor,\n pointStyle: pointStyle || style.pointStyle,\n rotation: style.rotation,\n textAlign: textAlign || style.textAlign,\n borderRadius: 0,\n datasetIndex: meta.index\n };\n }, this);\n }\n },\n title: {\n color: ctx => ctx.chart.options.color,\n display: false,\n position: 'center',\n text: ''\n }\n },\n descriptors: {\n _scriptable: name => !name.startsWith('on'),\n labels: {\n _scriptable: name => !['generateLabels', 'filter', 'sort'].includes(name)\n }\n }\n};\nclass Title extends Element {\n constructor(config) {\n super();\n this.chart = config.chart;\n this.options = config.options;\n this.ctx = config.ctx;\n this._padding = undefined;\n this.top = undefined;\n this.bottom = undefined;\n this.left = undefined;\n this.right = undefined;\n this.width = undefined;\n this.height = undefined;\n this.position = undefined;\n this.weight = undefined;\n this.fullSize = undefined;\n }\n update(maxWidth, maxHeight) {\n const opts = this.options;\n this.left = 0;\n this.top = 0;\n if (!opts.display) {\n this.width = this.height = this.right = this.bottom = 0;\n return;\n }\n this.width = this.right = maxWidth;\n this.height = this.bottom = maxHeight;\n const lineCount = isArray(opts.text) ? opts.text.length : 1;\n this._padding = toPadding(opts.padding);\n const textSize = lineCount * toFont(opts.font).lineHeight + this._padding.height;\n if (this.isHorizontal()) {\n this.height = textSize;\n } else {\n this.width = textSize;\n }\n }\n isHorizontal() {\n const pos = this.options.position;\n return pos === 'top' || pos === 'bottom';\n }\n _drawArgs(offset) {\n const top = this.top,\n left = this.left,\n bottom = this.bottom,\n right = this.right,\n options = this.options;\n const align = options.align;\n let rotation = 0;\n let maxWidth, titleX, titleY;\n if (this.isHorizontal()) {\n titleX = _alignStartEnd(align, left, right);\n titleY = top + offset;\n maxWidth = right - left;\n } else {\n if (options.position === 'left') {\n titleX = left + offset;\n titleY = _alignStartEnd(align, bottom, top);\n rotation = PI * -0.5;\n } else {\n titleX = right - offset;\n titleY = _alignStartEnd(align, top, bottom);\n rotation = PI * 0.5;\n }\n maxWidth = bottom - top;\n }\n return {\n titleX,\n titleY,\n maxWidth,\n rotation\n };\n }\n draw() {\n const ctx = this.ctx;\n const opts = this.options;\n if (!opts.display) {\n return;\n }\n const fontOpts = toFont(opts.font);\n const lineHeight = fontOpts.lineHeight;\n const offset = lineHeight / 2 + this._padding.top;\n const _this$_drawArgs = this._drawArgs(offset),\n titleX = _this$_drawArgs.titleX,\n titleY = _this$_drawArgs.titleY,\n maxWidth = _this$_drawArgs.maxWidth,\n rotation = _this$_drawArgs.rotation;\n renderText(ctx, opts.text, 0, 0, fontOpts, {\n color: opts.color,\n maxWidth,\n rotation,\n textAlign: _toLeftRightCenter(opts.align),\n textBaseline: 'middle',\n translation: [titleX, titleY]\n });\n }\n}\nfunction createTitle(chart, titleOpts) {\n const title = new Title({\n ctx: chart.ctx,\n options: titleOpts,\n chart\n });\n layouts.configure(chart, title, titleOpts);\n layouts.addBox(chart, title);\n chart.titleBlock = title;\n}\nvar plugin_title = {\n id: 'title',\n _element: Title,\n start(chart, _args, options) {\n createTitle(chart, options);\n },\n stop(chart) {\n const titleBlock = chart.titleBlock;\n layouts.removeBox(chart, titleBlock);\n delete chart.titleBlock;\n },\n beforeUpdate(chart, _args, options) {\n const title = chart.titleBlock;\n layouts.configure(chart, title, options);\n title.options = options;\n },\n defaults: {\n align: 'center',\n display: false,\n font: {\n weight: 'bold'\n },\n fullSize: true,\n padding: 10,\n position: 'top',\n text: '',\n weight: 2000\n },\n defaultRoutes: {\n color: 'color'\n },\n descriptors: {\n _scriptable: true,\n _indexable: false\n }\n};\nconst map = new WeakMap();\nvar plugin_subtitle = {\n id: 'subtitle',\n start(chart, _args, options) {\n const title = new Title({\n ctx: chart.ctx,\n options,\n chart\n });\n layouts.configure(chart, title, options);\n layouts.addBox(chart, title);\n map.set(chart, title);\n },\n stop(chart) {\n layouts.removeBox(chart, map.get(chart));\n map.delete(chart);\n },\n beforeUpdate(chart, _args, options) {\n const title = map.get(chart);\n layouts.configure(chart, title, options);\n title.options = options;\n },\n defaults: {\n align: 'center',\n display: false,\n font: {\n weight: 'normal'\n },\n fullSize: true,\n padding: 0,\n position: 'top',\n text: '',\n weight: 1500\n },\n defaultRoutes: {\n color: 'color'\n },\n descriptors: {\n _scriptable: true,\n _indexable: false\n }\n};\nconst positioners = {\n average(items) {\n if (!items.length) {\n return false;\n }\n let i, len;\n let x = 0;\n let y = 0;\n let count = 0;\n for (i = 0, len = items.length; i < len; ++i) {\n const el = items[i].element;\n if (el && el.hasValue()) {\n const pos = el.tooltipPosition();\n x += pos.x;\n y += pos.y;\n ++count;\n }\n }\n return {\n x: x / count,\n y: y / count\n };\n },\n nearest(items, eventPosition) {\n if (!items.length) {\n return false;\n }\n let x = eventPosition.x;\n let y = eventPosition.y;\n let minDistance = Number.POSITIVE_INFINITY;\n let i, len, nearestElement;\n for (i = 0, len = items.length; i < len; ++i) {\n const el = items[i].element;\n if (el && el.hasValue()) {\n const center = el.getCenterPoint();\n const d = distanceBetweenPoints(eventPosition, center);\n if (d < minDistance) {\n minDistance = d;\n nearestElement = el;\n }\n }\n }\n if (nearestElement) {\n const tp = nearestElement.tooltipPosition();\n x = tp.x;\n y = tp.y;\n }\n return {\n x,\n y\n };\n }\n};\nfunction pushOrConcat(base, toPush) {\n if (toPush) {\n if (isArray(toPush)) {\n Array.prototype.push.apply(base, toPush);\n } else {\n base.push(toPush);\n }\n }\n return base;\n}\nfunction splitNewlines(str) {\n if ((typeof str === 'string' || str instanceof String) && str.indexOf('\\n') > -1) {\n return str.split('\\n');\n }\n return str;\n}\nfunction createTooltipItem(chart, item) {\n const element = item.element,\n datasetIndex = item.datasetIndex,\n index = item.index;\n const controller = chart.getDatasetMeta(datasetIndex).controller;\n const _controller$getLabelA = controller.getLabelAndValue(index),\n label = _controller$getLabelA.label,\n value = _controller$getLabelA.value;\n return {\n chart,\n label,\n parsed: controller.getParsed(index),\n raw: chart.data.datasets[datasetIndex].data[index],\n formattedValue: value,\n dataset: controller.getDataset(),\n dataIndex: index,\n datasetIndex,\n element\n };\n}\nfunction getTooltipSize(tooltip, options) {\n const ctx = tooltip.chart.ctx;\n const body = tooltip.body,\n footer = tooltip.footer,\n title = tooltip.title;\n const boxWidth = options.boxWidth,\n boxHeight = options.boxHeight;\n const bodyFont = toFont(options.bodyFont);\n const titleFont = toFont(options.titleFont);\n const footerFont = toFont(options.footerFont);\n const titleLineCount = title.length;\n const footerLineCount = footer.length;\n const bodyLineItemCount = body.length;\n const padding = toPadding(options.padding);\n let height = padding.height;\n let width = 0;\n let combinedBodyLength = body.reduce((count, bodyItem) => count + bodyItem.before.length + bodyItem.lines.length + bodyItem.after.length, 0);\n combinedBodyLength += tooltip.beforeBody.length + tooltip.afterBody.length;\n if (titleLineCount) {\n height += titleLineCount * titleFont.lineHeight + (titleLineCount - 1) * options.titleSpacing + options.titleMarginBottom;\n }\n if (combinedBodyLength) {\n const bodyLineHeight = options.displayColors ? Math.max(boxHeight, bodyFont.lineHeight) : bodyFont.lineHeight;\n height += bodyLineItemCount * bodyLineHeight + (combinedBodyLength - bodyLineItemCount) * bodyFont.lineHeight + (combinedBodyLength - 1) * options.bodySpacing;\n }\n if (footerLineCount) {\n height += options.footerMarginTop + footerLineCount * footerFont.lineHeight + (footerLineCount - 1) * options.footerSpacing;\n }\n let widthPadding = 0;\n const maxLineWidth = function (line) {\n width = Math.max(width, ctx.measureText(line).width + widthPadding);\n };\n ctx.save();\n ctx.font = titleFont.string;\n each(tooltip.title, maxLineWidth);\n ctx.font = bodyFont.string;\n each(tooltip.beforeBody.concat(tooltip.afterBody), maxLineWidth);\n widthPadding = options.displayColors ? boxWidth + 2 + options.boxPadding : 0;\n each(body, bodyItem => {\n each(bodyItem.before, maxLineWidth);\n each(bodyItem.lines, maxLineWidth);\n each(bodyItem.after, maxLineWidth);\n });\n widthPadding = 0;\n ctx.font = footerFont.string;\n each(tooltip.footer, maxLineWidth);\n ctx.restore();\n width += padding.width;\n return {\n width,\n height\n };\n}\nfunction determineYAlign(chart, size) {\n const y = size.y,\n height = size.height;\n if (y < height / 2) {\n return 'top';\n } else if (y > chart.height - height / 2) {\n return 'bottom';\n }\n return 'center';\n}\nfunction doesNotFitWithAlign(xAlign, chart, options, size) {\n const x = size.x,\n width = size.width;\n const caret = options.caretSize + options.caretPadding;\n if (xAlign === 'left' && x + width + caret > chart.width) {\n return true;\n }\n if (xAlign === 'right' && x - width - caret < 0) {\n return true;\n }\n}\nfunction determineXAlign(chart, options, size, yAlign) {\n const x = size.x,\n width = size.width;\n const chartWidth = chart.width,\n _chart$chartArea = chart.chartArea,\n left = _chart$chartArea.left,\n right = _chart$chartArea.right;\n let xAlign = 'center';\n if (yAlign === 'center') {\n xAlign = x <= (left + right) / 2 ? 'left' : 'right';\n } else if (x <= width / 2) {\n xAlign = 'left';\n } else if (x >= chartWidth - width / 2) {\n xAlign = 'right';\n }\n if (doesNotFitWithAlign(xAlign, chart, options, size)) {\n xAlign = 'center';\n }\n return xAlign;\n}\nfunction determineAlignment(chart, options, size) {\n const yAlign = size.yAlign || options.yAlign || determineYAlign(chart, size);\n return {\n xAlign: size.xAlign || options.xAlign || determineXAlign(chart, options, size, yAlign),\n yAlign\n };\n}\nfunction alignX(size, xAlign) {\n let x = size.x,\n width = size.width;\n if (xAlign === 'right') {\n x -= width;\n } else if (xAlign === 'center') {\n x -= width / 2;\n }\n return x;\n}\nfunction alignY(size, yAlign, paddingAndSize) {\n let y = size.y,\n height = size.height;\n if (yAlign === 'top') {\n y += paddingAndSize;\n } else if (yAlign === 'bottom') {\n y -= height + paddingAndSize;\n } else {\n y -= height / 2;\n }\n return y;\n}\nfunction getBackgroundPoint(options, size, alignment, chart) {\n const caretSize = options.caretSize,\n caretPadding = options.caretPadding,\n cornerRadius = options.cornerRadius;\n const xAlign = alignment.xAlign,\n yAlign = alignment.yAlign;\n const paddingAndSize = caretSize + caretPadding;\n const _toTRBLCorners = toTRBLCorners(cornerRadius),\n topLeft = _toTRBLCorners.topLeft,\n topRight = _toTRBLCorners.topRight,\n bottomLeft = _toTRBLCorners.bottomLeft,\n bottomRight = _toTRBLCorners.bottomRight;\n let x = alignX(size, xAlign);\n const y = alignY(size, yAlign, paddingAndSize);\n if (yAlign === 'center') {\n if (xAlign === 'left') {\n x += paddingAndSize;\n } else if (xAlign === 'right') {\n x -= paddingAndSize;\n }\n } else if (xAlign === 'left') {\n x -= Math.max(topLeft, bottomLeft) + caretSize;\n } else if (xAlign === 'right') {\n x += Math.max(topRight, bottomRight) + caretSize;\n }\n return {\n x: _limitValue(x, 0, chart.width - size.width),\n y: _limitValue(y, 0, chart.height - size.height)\n };\n}\nfunction getAlignedX(tooltip, align, options) {\n const padding = toPadding(options.padding);\n return align === 'center' ? tooltip.x + tooltip.width / 2 : align === 'right' ? tooltip.x + tooltip.width - padding.right : tooltip.x + padding.left;\n}\nfunction getBeforeAfterBodyLines(callback) {\n return pushOrConcat([], splitNewlines(callback));\n}\nfunction createTooltipContext(parent, tooltip, tooltipItems) {\n return createContext(parent, {\n tooltip,\n tooltipItems,\n type: 'tooltip'\n });\n}\nfunction overrideCallbacks(callbacks, context) {\n const override = context && context.dataset && context.dataset.tooltip && context.dataset.tooltip.callbacks;\n return override ? callbacks.override(override) : callbacks;\n}\nclass Tooltip extends Element {\n constructor(config) {\n super();\n this.opacity = 0;\n this._active = [];\n this._eventPosition = undefined;\n this._size = undefined;\n this._cachedAnimations = undefined;\n this._tooltipItems = [];\n this.$animations = undefined;\n this.$context = undefined;\n this.chart = config.chart || config._chart;\n this._chart = this.chart;\n this.options = config.options;\n this.dataPoints = undefined;\n this.title = undefined;\n this.beforeBody = undefined;\n this.body = undefined;\n this.afterBody = undefined;\n this.footer = undefined;\n this.xAlign = undefined;\n this.yAlign = undefined;\n this.x = undefined;\n this.y = undefined;\n this.height = undefined;\n this.width = undefined;\n this.caretX = undefined;\n this.caretY = undefined;\n this.labelColors = undefined;\n this.labelPointStyles = undefined;\n this.labelTextColors = undefined;\n }\n initialize(options) {\n this.options = options;\n this._cachedAnimations = undefined;\n this.$context = undefined;\n }\n _resolveAnimations() {\n const cached = this._cachedAnimations;\n if (cached) {\n return cached;\n }\n const chart = this.chart;\n const options = this.options.setContext(this.getContext());\n const opts = options.enabled && chart.options.animation && options.animations;\n const animations = new Animations(this.chart, opts);\n if (opts._cacheable) {\n this._cachedAnimations = Object.freeze(animations);\n }\n return animations;\n }\n getContext() {\n return this.$context || (this.$context = createTooltipContext(this.chart.getContext(), this, this._tooltipItems));\n }\n getTitle(context, options) {\n const callbacks = options.callbacks;\n const beforeTitle = callbacks.beforeTitle.apply(this, [context]);\n const title = callbacks.title.apply(this, [context]);\n const afterTitle = callbacks.afterTitle.apply(this, [context]);\n let lines = [];\n lines = pushOrConcat(lines, splitNewlines(beforeTitle));\n lines = pushOrConcat(lines, splitNewlines(title));\n lines = pushOrConcat(lines, splitNewlines(afterTitle));\n return lines;\n }\n getBeforeBody(tooltipItems, options) {\n return getBeforeAfterBodyLines(options.callbacks.beforeBody.apply(this, [tooltipItems]));\n }\n getBody(tooltipItems, options) {\n const callbacks = options.callbacks;\n const bodyItems = [];\n each(tooltipItems, context => {\n const bodyItem = {\n before: [],\n lines: [],\n after: []\n };\n const scoped = overrideCallbacks(callbacks, context);\n pushOrConcat(bodyItem.before, splitNewlines(scoped.beforeLabel.call(this, context)));\n pushOrConcat(bodyItem.lines, scoped.label.call(this, context));\n pushOrConcat(bodyItem.after, splitNewlines(scoped.afterLabel.call(this, context)));\n bodyItems.push(bodyItem);\n });\n return bodyItems;\n }\n getAfterBody(tooltipItems, options) {\n return getBeforeAfterBodyLines(options.callbacks.afterBody.apply(this, [tooltipItems]));\n }\n getFooter(tooltipItems, options) {\n const callbacks = options.callbacks;\n const beforeFooter = callbacks.beforeFooter.apply(this, [tooltipItems]);\n const footer = callbacks.footer.apply(this, [tooltipItems]);\n const afterFooter = callbacks.afterFooter.apply(this, [tooltipItems]);\n let lines = [];\n lines = pushOrConcat(lines, splitNewlines(beforeFooter));\n lines = pushOrConcat(lines, splitNewlines(footer));\n lines = pushOrConcat(lines, splitNewlines(afterFooter));\n return lines;\n }\n _createItems(options) {\n const active = this._active;\n const data = this.chart.data;\n const labelColors = [];\n const labelPointStyles = [];\n const labelTextColors = [];\n let tooltipItems = [];\n let i, len;\n for (i = 0, len = active.length; i < len; ++i) {\n tooltipItems.push(createTooltipItem(this.chart, active[i]));\n }\n if (options.filter) {\n tooltipItems = tooltipItems.filter((element, index, array) => options.filter(element, index, array, data));\n }\n if (options.itemSort) {\n tooltipItems = tooltipItems.sort((a, b) => options.itemSort(a, b, data));\n }\n each(tooltipItems, context => {\n const scoped = overrideCallbacks(options.callbacks, context);\n labelColors.push(scoped.labelColor.call(this, context));\n labelPointStyles.push(scoped.labelPointStyle.call(this, context));\n labelTextColors.push(scoped.labelTextColor.call(this, context));\n });\n this.labelColors = labelColors;\n this.labelPointStyles = labelPointStyles;\n this.labelTextColors = labelTextColors;\n this.dataPoints = tooltipItems;\n return tooltipItems;\n }\n update(changed, replay) {\n const options = this.options.setContext(this.getContext());\n const active = this._active;\n let properties;\n let tooltipItems = [];\n if (!active.length) {\n if (this.opacity !== 0) {\n properties = {\n opacity: 0\n };\n }\n } else {\n const position = positioners[options.position].call(this, active, this._eventPosition);\n tooltipItems = this._createItems(options);\n this.title = this.getTitle(tooltipItems, options);\n this.beforeBody = this.getBeforeBody(tooltipItems, options);\n this.body = this.getBody(tooltipItems, options);\n this.afterBody = this.getAfterBody(tooltipItems, options);\n this.footer = this.getFooter(tooltipItems, options);\n const size = this._size = getTooltipSize(this, options);\n const positionAndSize = Object.assign({}, position, size);\n const alignment = determineAlignment(this.chart, options, positionAndSize);\n const backgroundPoint = getBackgroundPoint(options, positionAndSize, alignment, this.chart);\n this.xAlign = alignment.xAlign;\n this.yAlign = alignment.yAlign;\n properties = {\n opacity: 1,\n x: backgroundPoint.x,\n y: backgroundPoint.y,\n width: size.width,\n height: size.height,\n caretX: position.x,\n caretY: position.y\n };\n }\n this._tooltipItems = tooltipItems;\n this.$context = undefined;\n if (properties) {\n this._resolveAnimations().update(this, properties);\n }\n if (changed && options.external) {\n options.external.call(this, {\n chart: this.chart,\n tooltip: this,\n replay\n });\n }\n }\n drawCaret(tooltipPoint, ctx, size, options) {\n const caretPosition = this.getCaretPosition(tooltipPoint, size, options);\n ctx.lineTo(caretPosition.x1, caretPosition.y1);\n ctx.lineTo(caretPosition.x2, caretPosition.y2);\n ctx.lineTo(caretPosition.x3, caretPosition.y3);\n }\n getCaretPosition(tooltipPoint, size, options) {\n const xAlign = this.xAlign,\n yAlign = this.yAlign;\n const caretSize = options.caretSize,\n cornerRadius = options.cornerRadius;\n const _toTRBLCorners2 = toTRBLCorners(cornerRadius),\n topLeft = _toTRBLCorners2.topLeft,\n topRight = _toTRBLCorners2.topRight,\n bottomLeft = _toTRBLCorners2.bottomLeft,\n bottomRight = _toTRBLCorners2.bottomRight;\n const ptX = tooltipPoint.x,\n ptY = tooltipPoint.y;\n const width = size.width,\n height = size.height;\n let x1, x2, x3, y1, y2, y3;\n if (yAlign === 'center') {\n y2 = ptY + height / 2;\n if (xAlign === 'left') {\n x1 = ptX;\n x2 = x1 - caretSize;\n y1 = y2 + caretSize;\n y3 = y2 - caretSize;\n } else {\n x1 = ptX + width;\n x2 = x1 + caretSize;\n y1 = y2 - caretSize;\n y3 = y2 + caretSize;\n }\n x3 = x1;\n } else {\n if (xAlign === 'left') {\n x2 = ptX + Math.max(topLeft, bottomLeft) + caretSize;\n } else if (xAlign === 'right') {\n x2 = ptX + width - Math.max(topRight, bottomRight) - caretSize;\n } else {\n x2 = this.caretX;\n }\n if (yAlign === 'top') {\n y1 = ptY;\n y2 = y1 - caretSize;\n x1 = x2 - caretSize;\n x3 = x2 + caretSize;\n } else {\n y1 = ptY + height;\n y2 = y1 + caretSize;\n x1 = x2 + caretSize;\n x3 = x2 - caretSize;\n }\n y3 = y1;\n }\n return {\n x1,\n x2,\n x3,\n y1,\n y2,\n y3\n };\n }\n drawTitle(pt, ctx, options) {\n const title = this.title;\n const length = title.length;\n let titleFont, titleSpacing, i;\n if (length) {\n const rtlHelper = getRtlAdapter(options.rtl, this.x, this.width);\n pt.x = getAlignedX(this, options.titleAlign, options);\n ctx.textAlign = rtlHelper.textAlign(options.titleAlign);\n ctx.textBaseline = 'middle';\n titleFont = toFont(options.titleFont);\n titleSpacing = options.titleSpacing;\n ctx.fillStyle = options.titleColor;\n ctx.font = titleFont.string;\n for (i = 0; i < length; ++i) {\n ctx.fillText(title[i], rtlHelper.x(pt.x), pt.y + titleFont.lineHeight / 2);\n pt.y += titleFont.lineHeight + titleSpacing;\n if (i + 1 === length) {\n pt.y += options.titleMarginBottom - titleSpacing;\n }\n }\n }\n }\n _drawColorBox(ctx, pt, i, rtlHelper, options) {\n const labelColors = this.labelColors[i];\n const labelPointStyle = this.labelPointStyles[i];\n const boxHeight = options.boxHeight,\n boxWidth = options.boxWidth,\n boxPadding = options.boxPadding;\n const bodyFont = toFont(options.bodyFont);\n const colorX = getAlignedX(this, 'left', options);\n const rtlColorX = rtlHelper.x(colorX);\n const yOffSet = boxHeight < bodyFont.lineHeight ? (bodyFont.lineHeight - boxHeight) / 2 : 0;\n const colorY = pt.y + yOffSet;\n if (options.usePointStyle) {\n const drawOptions = {\n radius: Math.min(boxWidth, boxHeight) / 2,\n pointStyle: labelPointStyle.pointStyle,\n rotation: labelPointStyle.rotation,\n borderWidth: 1\n };\n const centerX = rtlHelper.leftForLtr(rtlColorX, boxWidth) + boxWidth / 2;\n const centerY = colorY + boxHeight / 2;\n ctx.strokeStyle = options.multiKeyBackground;\n ctx.fillStyle = options.multiKeyBackground;\n drawPoint(ctx, drawOptions, centerX, centerY);\n ctx.strokeStyle = labelColors.borderColor;\n ctx.fillStyle = labelColors.backgroundColor;\n drawPoint(ctx, drawOptions, centerX, centerY);\n } else {\n ctx.lineWidth = isObject(labelColors.borderWidth) ? Math.max(...Object.values(labelColors.borderWidth)) : labelColors.borderWidth || 1;\n ctx.strokeStyle = labelColors.borderColor;\n ctx.setLineDash(labelColors.borderDash || []);\n ctx.lineDashOffset = labelColors.borderDashOffset || 0;\n const outerX = rtlHelper.leftForLtr(rtlColorX, boxWidth - boxPadding);\n const innerX = rtlHelper.leftForLtr(rtlHelper.xPlus(rtlColorX, 1), boxWidth - boxPadding - 2);\n const borderRadius = toTRBLCorners(labelColors.borderRadius);\n if (Object.values(borderRadius).some(v => v !== 0)) {\n ctx.beginPath();\n ctx.fillStyle = options.multiKeyBackground;\n addRoundedRectPath(ctx, {\n x: outerX,\n y: colorY,\n w: boxWidth,\n h: boxHeight,\n radius: borderRadius\n });\n ctx.fill();\n ctx.stroke();\n ctx.fillStyle = labelColors.backgroundColor;\n ctx.beginPath();\n addRoundedRectPath(ctx, {\n x: innerX,\n y: colorY + 1,\n w: boxWidth - 2,\n h: boxHeight - 2,\n radius: borderRadius\n });\n ctx.fill();\n } else {\n ctx.fillStyle = options.multiKeyBackground;\n ctx.fillRect(outerX, colorY, boxWidth, boxHeight);\n ctx.strokeRect(outerX, colorY, boxWidth, boxHeight);\n ctx.fillStyle = labelColors.backgroundColor;\n ctx.fillRect(innerX, colorY + 1, boxWidth - 2, boxHeight - 2);\n }\n }\n ctx.fillStyle = this.labelTextColors[i];\n }\n drawBody(pt, ctx, options) {\n const body = this.body;\n const bodySpacing = options.bodySpacing,\n bodyAlign = options.bodyAlign,\n displayColors = options.displayColors,\n boxHeight = options.boxHeight,\n boxWidth = options.boxWidth,\n boxPadding = options.boxPadding;\n const bodyFont = toFont(options.bodyFont);\n let bodyLineHeight = bodyFont.lineHeight;\n let xLinePadding = 0;\n const rtlHelper = getRtlAdapter(options.rtl, this.x, this.width);\n const fillLineOfText = function (line) {\n ctx.fillText(line, rtlHelper.x(pt.x + xLinePadding), pt.y + bodyLineHeight / 2);\n pt.y += bodyLineHeight + bodySpacing;\n };\n const bodyAlignForCalculation = rtlHelper.textAlign(bodyAlign);\n let bodyItem, textColor, lines, i, j, ilen, jlen;\n ctx.textAlign = bodyAlign;\n ctx.textBaseline = 'middle';\n ctx.font = bodyFont.string;\n pt.x = getAlignedX(this, bodyAlignForCalculation, options);\n ctx.fillStyle = options.bodyColor;\n each(this.beforeBody, fillLineOfText);\n xLinePadding = displayColors && bodyAlignForCalculation !== 'right' ? bodyAlign === 'center' ? boxWidth / 2 + boxPadding : boxWidth + 2 + boxPadding : 0;\n for (i = 0, ilen = body.length; i < ilen; ++i) {\n bodyItem = body[i];\n textColor = this.labelTextColors[i];\n ctx.fillStyle = textColor;\n each(bodyItem.before, fillLineOfText);\n lines = bodyItem.lines;\n if (displayColors && lines.length) {\n this._drawColorBox(ctx, pt, i, rtlHelper, options);\n bodyLineHeight = Math.max(bodyFont.lineHeight, boxHeight);\n }\n for (j = 0, jlen = lines.length; j < jlen; ++j) {\n fillLineOfText(lines[j]);\n bodyLineHeight = bodyFont.lineHeight;\n }\n each(bodyItem.after, fillLineOfText);\n }\n xLinePadding = 0;\n bodyLineHeight = bodyFont.lineHeight;\n each(this.afterBody, fillLineOfText);\n pt.y -= bodySpacing;\n }\n drawFooter(pt, ctx, options) {\n const footer = this.footer;\n const length = footer.length;\n let footerFont, i;\n if (length) {\n const rtlHelper = getRtlAdapter(options.rtl, this.x, this.width);\n pt.x = getAlignedX(this, options.footerAlign, options);\n pt.y += options.footerMarginTop;\n ctx.textAlign = rtlHelper.textAlign(options.footerAlign);\n ctx.textBaseline = 'middle';\n footerFont = toFont(options.footerFont);\n ctx.fillStyle = options.footerColor;\n ctx.font = footerFont.string;\n for (i = 0; i < length; ++i) {\n ctx.fillText(footer[i], rtlHelper.x(pt.x), pt.y + footerFont.lineHeight / 2);\n pt.y += footerFont.lineHeight + options.footerSpacing;\n }\n }\n }\n drawBackground(pt, ctx, tooltipSize, options) {\n const xAlign = this.xAlign,\n yAlign = this.yAlign;\n const x = pt.x,\n y = pt.y;\n const width = tooltipSize.width,\n height = tooltipSize.height;\n const _toTRBLCorners3 = toTRBLCorners(options.cornerRadius),\n topLeft = _toTRBLCorners3.topLeft,\n topRight = _toTRBLCorners3.topRight,\n bottomLeft = _toTRBLCorners3.bottomLeft,\n bottomRight = _toTRBLCorners3.bottomRight;\n ctx.fillStyle = options.backgroundColor;\n ctx.strokeStyle = options.borderColor;\n ctx.lineWidth = options.borderWidth;\n ctx.beginPath();\n ctx.moveTo(x + topLeft, y);\n if (yAlign === 'top') {\n this.drawCaret(pt, ctx, tooltipSize, options);\n }\n ctx.lineTo(x + width - topRight, y);\n ctx.quadraticCurveTo(x + width, y, x + width, y + topRight);\n if (yAlign === 'center' && xAlign === 'right') {\n this.drawCaret(pt, ctx, tooltipSize, options);\n }\n ctx.lineTo(x + width, y + height - bottomRight);\n ctx.quadraticCurveTo(x + width, y + height, x + width - bottomRight, y + height);\n if (yAlign === 'bottom') {\n this.drawCaret(pt, ctx, tooltipSize, options);\n }\n ctx.lineTo(x + bottomLeft, y + height);\n ctx.quadraticCurveTo(x, y + height, x, y + height - bottomLeft);\n if (yAlign === 'center' && xAlign === 'left') {\n this.drawCaret(pt, ctx, tooltipSize, options);\n }\n ctx.lineTo(x, y + topLeft);\n ctx.quadraticCurveTo(x, y, x + topLeft, y);\n ctx.closePath();\n ctx.fill();\n if (options.borderWidth > 0) {\n ctx.stroke();\n }\n }\n _updateAnimationTarget(options) {\n const chart = this.chart;\n const anims = this.$animations;\n const animX = anims && anims.x;\n const animY = anims && anims.y;\n if (animX || animY) {\n const position = positioners[options.position].call(this, this._active, this._eventPosition);\n if (!position) {\n return;\n }\n const size = this._size = getTooltipSize(this, options);\n const positionAndSize = Object.assign({}, position, this._size);\n const alignment = determineAlignment(chart, options, positionAndSize);\n const point = getBackgroundPoint(options, positionAndSize, alignment, chart);\n if (animX._to !== point.x || animY._to !== point.y) {\n this.xAlign = alignment.xAlign;\n this.yAlign = alignment.yAlign;\n this.width = size.width;\n this.height = size.height;\n this.caretX = position.x;\n this.caretY = position.y;\n this._resolveAnimations().update(this, point);\n }\n }\n }\n _willRender() {\n return !!this.opacity;\n }\n draw(ctx) {\n const options = this.options.setContext(this.getContext());\n let opacity = this.opacity;\n if (!opacity) {\n return;\n }\n this._updateAnimationTarget(options);\n const tooltipSize = {\n width: this.width,\n height: this.height\n };\n const pt = {\n x: this.x,\n y: this.y\n };\n opacity = Math.abs(opacity) < 1e-3 ? 0 : opacity;\n const padding = toPadding(options.padding);\n const hasTooltipContent = this.title.length || this.beforeBody.length || this.body.length || this.afterBody.length || this.footer.length;\n if (options.enabled && hasTooltipContent) {\n ctx.save();\n ctx.globalAlpha = opacity;\n this.drawBackground(pt, ctx, tooltipSize, options);\n overrideTextDirection(ctx, options.textDirection);\n pt.y += padding.top;\n this.drawTitle(pt, ctx, options);\n this.drawBody(pt, ctx, options);\n this.drawFooter(pt, ctx, options);\n restoreTextDirection(ctx, options.textDirection);\n ctx.restore();\n }\n }\n getActiveElements() {\n return this._active || [];\n }\n setActiveElements(activeElements, eventPosition) {\n const lastActive = this._active;\n const active = activeElements.map(_ref15 => {\n let datasetIndex = _ref15.datasetIndex,\n index = _ref15.index;\n const meta = this.chart.getDatasetMeta(datasetIndex);\n if (!meta) {\n throw new Error('Cannot find a dataset at index ' + datasetIndex);\n }\n return {\n datasetIndex,\n element: meta.data[index],\n index\n };\n });\n const changed = !_elementsEqual(lastActive, active);\n const positionChanged = this._positionChanged(active, eventPosition);\n if (changed || positionChanged) {\n this._active = active;\n this._eventPosition = eventPosition;\n this._ignoreReplayEvents = true;\n this.update(true);\n }\n }\n handleEvent(e, replay) {\n let inChartArea = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : true;\n if (replay && this._ignoreReplayEvents) {\n return false;\n }\n this._ignoreReplayEvents = false;\n const options = this.options;\n const lastActive = this._active || [];\n const active = this._getActiveElements(e, lastActive, replay, inChartArea);\n const positionChanged = this._positionChanged(active, e);\n const changed = replay || !_elementsEqual(active, lastActive) || positionChanged;\n if (changed) {\n this._active = active;\n if (options.enabled || options.external) {\n this._eventPosition = {\n x: e.x,\n y: e.y\n };\n this.update(true, replay);\n }\n }\n return changed;\n }\n _getActiveElements(e, lastActive, replay, inChartArea) {\n const options = this.options;\n if (e.type === 'mouseout') {\n return [];\n }\n if (!inChartArea) {\n return lastActive;\n }\n const active = this.chart.getElementsAtEventForMode(e, options.mode, options, replay);\n if (options.reverse) {\n active.reverse();\n }\n return active;\n }\n _positionChanged(active, e) {\n const caretX = this.caretX,\n caretY = this.caretY,\n options = this.options;\n const position = positioners[options.position].call(this, active, e);\n return position !== false && (caretX !== position.x || caretY !== position.y);\n }\n}\nTooltip.positioners = positioners;\nvar plugin_tooltip = {\n id: 'tooltip',\n _element: Tooltip,\n positioners,\n afterInit(chart, _args, options) {\n if (options) {\n chart.tooltip = new Tooltip({\n chart,\n options\n });\n }\n },\n beforeUpdate(chart, _args, options) {\n if (chart.tooltip) {\n chart.tooltip.initialize(options);\n }\n },\n reset(chart, _args, options) {\n if (chart.tooltip) {\n chart.tooltip.initialize(options);\n }\n },\n afterDraw(chart) {\n const tooltip = chart.tooltip;\n if (tooltip && tooltip._willRender()) {\n const args = {\n tooltip\n };\n if (chart.notifyPlugins('beforeTooltipDraw', args) === false) {\n return;\n }\n tooltip.draw(chart.ctx);\n chart.notifyPlugins('afterTooltipDraw', args);\n }\n },\n afterEvent(chart, args) {\n if (chart.tooltip) {\n const useFinalPosition = args.replay;\n if (chart.tooltip.handleEvent(args.event, useFinalPosition, args.inChartArea)) {\n args.changed = true;\n }\n }\n },\n defaults: {\n enabled: true,\n external: null,\n position: 'average',\n backgroundColor: 'rgba(0,0,0,0.8)',\n titleColor: '#fff',\n titleFont: {\n weight: 'bold'\n },\n titleSpacing: 2,\n titleMarginBottom: 6,\n titleAlign: 'left',\n bodyColor: '#fff',\n bodySpacing: 2,\n bodyFont: {},\n bodyAlign: 'left',\n footerColor: '#fff',\n footerSpacing: 2,\n footerMarginTop: 6,\n footerFont: {\n weight: 'bold'\n },\n footerAlign: 'left',\n padding: 6,\n caretPadding: 2,\n caretSize: 5,\n cornerRadius: 6,\n boxHeight: (ctx, opts) => opts.bodyFont.size,\n boxWidth: (ctx, opts) => opts.bodyFont.size,\n multiKeyBackground: '#fff',\n displayColors: true,\n boxPadding: 0,\n borderColor: 'rgba(0,0,0,0)',\n borderWidth: 0,\n animation: {\n duration: 400,\n easing: 'easeOutQuart'\n },\n animations: {\n numbers: {\n type: 'number',\n properties: ['x', 'y', 'width', 'height', 'caretX', 'caretY']\n },\n opacity: {\n easing: 'linear',\n duration: 200\n }\n },\n callbacks: {\n beforeTitle: noop,\n title(tooltipItems) {\n if (tooltipItems.length > 0) {\n const item = tooltipItems[0];\n const labels = item.chart.data.labels;\n const labelCount = labels ? labels.length : 0;\n if (this && this.options && this.options.mode === 'dataset') {\n return item.dataset.label || '';\n } else if (item.label) {\n return item.label;\n } else if (labelCount > 0 && item.dataIndex < labelCount) {\n return labels[item.dataIndex];\n }\n }\n return '';\n },\n afterTitle: noop,\n beforeBody: noop,\n beforeLabel: noop,\n label(tooltipItem) {\n if (this && this.options && this.options.mode === 'dataset') {\n return tooltipItem.label + ': ' + tooltipItem.formattedValue || tooltipItem.formattedValue;\n }\n let label = tooltipItem.dataset.label || '';\n if (label) {\n label += ': ';\n }\n const value = tooltipItem.formattedValue;\n if (!isNullOrUndef(value)) {\n label += value;\n }\n return label;\n },\n labelColor(tooltipItem) {\n const meta = tooltipItem.chart.getDatasetMeta(tooltipItem.datasetIndex);\n const options = meta.controller.getStyle(tooltipItem.dataIndex);\n return {\n borderColor: options.borderColor,\n backgroundColor: options.backgroundColor,\n borderWidth: options.borderWidth,\n borderDash: options.borderDash,\n borderDashOffset: options.borderDashOffset,\n borderRadius: 0\n };\n },\n labelTextColor() {\n return this.options.bodyColor;\n },\n labelPointStyle(tooltipItem) {\n const meta = tooltipItem.chart.getDatasetMeta(tooltipItem.datasetIndex);\n const options = meta.controller.getStyle(tooltipItem.dataIndex);\n return {\n pointStyle: options.pointStyle,\n rotation: options.rotation\n };\n },\n afterLabel: noop,\n afterBody: noop,\n beforeFooter: noop,\n footer: noop,\n afterFooter: noop\n }\n },\n defaultRoutes: {\n bodyFont: 'font',\n footerFont: 'font',\n titleFont: 'font'\n },\n descriptors: {\n _scriptable: name => name !== 'filter' && name !== 'itemSort' && name !== 'external',\n _indexable: false,\n callbacks: {\n _scriptable: false,\n _indexable: false\n },\n animation: {\n _fallback: false\n },\n animations: {\n _fallback: 'animation'\n }\n },\n additionalOptionScopes: ['interaction']\n};\nvar plugins = /*#__PURE__*/Object.freeze({\n __proto__: null,\n Decimation: plugin_decimation,\n Filler: index,\n Legend: plugin_legend,\n SubTitle: plugin_subtitle,\n Title: plugin_title,\n Tooltip: plugin_tooltip\n});\nconst addIfString = (labels, raw, index, addedLabels) => {\n if (typeof raw === 'string') {\n index = labels.push(raw) - 1;\n addedLabels.unshift({\n index,\n label: raw\n });\n } else if (isNaN(raw)) {\n index = null;\n }\n return index;\n};\nfunction findOrAddLabel(labels, raw, index, addedLabels) {\n const first = labels.indexOf(raw);\n if (first === -1) {\n return addIfString(labels, raw, index, addedLabels);\n }\n const last = labels.lastIndexOf(raw);\n return first !== last ? index : first;\n}\nconst validIndex = (index, max) => index === null ? null : _limitValue(Math.round(index), 0, max);\nclass CategoryScale extends Scale {\n constructor(cfg) {\n super(cfg);\n this._startValue = undefined;\n this._valueRange = 0;\n this._addedLabels = [];\n }\n init(scaleOptions) {\n const added = this._addedLabels;\n if (added.length) {\n const labels = this.getLabels();\n for (const _ref16 of added) {\n const index = _ref16.index;\n const label = _ref16.label;\n if (labels[index] === label) {\n labels.splice(index, 1);\n }\n }\n this._addedLabels = [];\n }\n super.init(scaleOptions);\n }\n parse(raw, index) {\n if (isNullOrUndef(raw)) {\n return null;\n }\n const labels = this.getLabels();\n index = isFinite(index) && labels[index] === raw ? index : findOrAddLabel(labels, raw, valueOrDefault(index, raw), this._addedLabels);\n return validIndex(index, labels.length - 1);\n }\n determineDataLimits() {\n const _this$getUserBounds2 = this.getUserBounds(),\n minDefined = _this$getUserBounds2.minDefined,\n maxDefined = _this$getUserBounds2.maxDefined;\n let _this$getMinMax = this.getMinMax(true),\n min = _this$getMinMax.min,\n max = _this$getMinMax.max;\n if (this.options.bounds === 'ticks') {\n if (!minDefined) {\n min = 0;\n }\n if (!maxDefined) {\n max = this.getLabels().length - 1;\n }\n }\n this.min = min;\n this.max = max;\n }\n buildTicks() {\n const min = this.min;\n const max = this.max;\n const offset = this.options.offset;\n const ticks = [];\n let labels = this.getLabels();\n labels = min === 0 && max === labels.length - 1 ? labels : labels.slice(min, max + 1);\n this._valueRange = Math.max(labels.length - (offset ? 0 : 1), 1);\n this._startValue = this.min - (offset ? 0.5 : 0);\n for (let value = min; value <= max; value++) {\n ticks.push({\n value\n });\n }\n return ticks;\n }\n getLabelForValue(value) {\n const labels = this.getLabels();\n if (value >= 0 && value < labels.length) {\n return labels[value];\n }\n return value;\n }\n configure() {\n super.configure();\n if (!this.isHorizontal()) {\n this._reversePixels = !this._reversePixels;\n }\n }\n getPixelForValue(value) {\n if (typeof value !== 'number') {\n value = this.parse(value);\n }\n return value === null ? NaN : this.getPixelForDecimal((value - this._startValue) / this._valueRange);\n }\n getPixelForTick(index) {\n const ticks = this.ticks;\n if (index < 0 || index > ticks.length - 1) {\n return null;\n }\n return this.getPixelForValue(ticks[index].value);\n }\n getValueForPixel(pixel) {\n return Math.round(this._startValue + this.getDecimalForPixel(pixel) * this._valueRange);\n }\n getBasePixel() {\n return this.bottom;\n }\n}\nCategoryScale.id = 'category';\nCategoryScale.defaults = {\n ticks: {\n callback: CategoryScale.prototype.getLabelForValue\n }\n};\nfunction generateTicks$1(generationOptions, dataRange) {\n const ticks = [];\n const MIN_SPACING = 1e-14;\n const bounds = generationOptions.bounds,\n step = generationOptions.step,\n min = generationOptions.min,\n max = generationOptions.max,\n precision = generationOptions.precision,\n count = generationOptions.count,\n maxTicks = generationOptions.maxTicks,\n maxDigits = generationOptions.maxDigits,\n includeBounds = generationOptions.includeBounds;\n const unit = step || 1;\n const maxSpaces = maxTicks - 1;\n const rmin = dataRange.min,\n rmax = dataRange.max;\n const minDefined = !isNullOrUndef(min);\n const maxDefined = !isNullOrUndef(max);\n const countDefined = !isNullOrUndef(count);\n const minSpacing = (rmax - rmin) / (maxDigits + 1);\n let spacing = niceNum((rmax - rmin) / maxSpaces / unit) * unit;\n let factor, niceMin, niceMax, numSpaces;\n if (spacing < MIN_SPACING && !minDefined && !maxDefined) {\n return [{\n value: rmin\n }, {\n value: rmax\n }];\n }\n numSpaces = Math.ceil(rmax / spacing) - Math.floor(rmin / spacing);\n if (numSpaces > maxSpaces) {\n spacing = niceNum(numSpaces * spacing / maxSpaces / unit) * unit;\n }\n if (!isNullOrUndef(precision)) {\n factor = Math.pow(10, precision);\n spacing = Math.ceil(spacing * factor) / factor;\n }\n if (bounds === 'ticks') {\n niceMin = Math.floor(rmin / spacing) * spacing;\n niceMax = Math.ceil(rmax / spacing) * spacing;\n } else {\n niceMin = rmin;\n niceMax = rmax;\n }\n if (minDefined && maxDefined && step && almostWhole((max - min) / step, spacing / 1000)) {\n numSpaces = Math.round(Math.min((max - min) / spacing, maxTicks));\n spacing = (max - min) / numSpaces;\n niceMin = min;\n niceMax = max;\n } else if (countDefined) {\n niceMin = minDefined ? min : niceMin;\n niceMax = maxDefined ? max : niceMax;\n numSpaces = count - 1;\n spacing = (niceMax - niceMin) / numSpaces;\n } else {\n numSpaces = (niceMax - niceMin) / spacing;\n if (almostEquals(numSpaces, Math.round(numSpaces), spacing / 1000)) {\n numSpaces = Math.round(numSpaces);\n } else {\n numSpaces = Math.ceil(numSpaces);\n }\n }\n const decimalPlaces = Math.max(_decimalPlaces(spacing), _decimalPlaces(niceMin));\n factor = Math.pow(10, isNullOrUndef(precision) ? decimalPlaces : precision);\n niceMin = Math.round(niceMin * factor) / factor;\n niceMax = Math.round(niceMax * factor) / factor;\n let j = 0;\n if (minDefined) {\n if (includeBounds && niceMin !== min) {\n ticks.push({\n value: min\n });\n if (niceMin < min) {\n j++;\n }\n if (almostEquals(Math.round((niceMin + j * spacing) * factor) / factor, min, relativeLabelSize(min, minSpacing, generationOptions))) {\n j++;\n }\n } else if (niceMin < min) {\n j++;\n }\n }\n for (; j < numSpaces; ++j) {\n ticks.push({\n value: Math.round((niceMin + j * spacing) * factor) / factor\n });\n }\n if (maxDefined && includeBounds && niceMax !== max) {\n if (ticks.length && almostEquals(ticks[ticks.length - 1].value, max, relativeLabelSize(max, minSpacing, generationOptions))) {\n ticks[ticks.length - 1].value = max;\n } else {\n ticks.push({\n value: max\n });\n }\n } else if (!maxDefined || niceMax === max) {\n ticks.push({\n value: niceMax\n });\n }\n return ticks;\n}\nfunction relativeLabelSize(value, minSpacing, _ref17) {\n let horizontal = _ref17.horizontal,\n minRotation = _ref17.minRotation;\n const rad = toRadians(minRotation);\n const ratio = (horizontal ? Math.sin(rad) : Math.cos(rad)) || 0.001;\n const length = 0.75 * minSpacing * ('' + value).length;\n return Math.min(minSpacing / ratio, length);\n}\nclass LinearScaleBase extends Scale {\n constructor(cfg) {\n super(cfg);\n this.start = undefined;\n this.end = undefined;\n this._startValue = undefined;\n this._endValue = undefined;\n this._valueRange = 0;\n }\n parse(raw, index) {\n if (isNullOrUndef(raw)) {\n return null;\n }\n if ((typeof raw === 'number' || raw instanceof Number) && !isFinite(+raw)) {\n return null;\n }\n return +raw;\n }\n handleTickRangeOptions() {\n const beginAtZero = this.options.beginAtZero;\n const _this$getUserBounds3 = this.getUserBounds(),\n minDefined = _this$getUserBounds3.minDefined,\n maxDefined = _this$getUserBounds3.maxDefined;\n let min = this.min,\n max = this.max;\n const setMin = v => min = minDefined ? min : v;\n const setMax = v => max = maxDefined ? max : v;\n if (beginAtZero) {\n const minSign = sign(min);\n const maxSign = sign(max);\n if (minSign < 0 && maxSign < 0) {\n setMax(0);\n } else if (minSign > 0 && maxSign > 0) {\n setMin(0);\n }\n }\n if (min === max) {\n let offset = 1;\n if (max >= Number.MAX_SAFE_INTEGER || min <= Number.MIN_SAFE_INTEGER) {\n offset = Math.abs(max * 0.05);\n }\n setMax(max + offset);\n if (!beginAtZero) {\n setMin(min - offset);\n }\n }\n this.min = min;\n this.max = max;\n }\n getTickLimit() {\n const tickOpts = this.options.ticks;\n let maxTicksLimit = tickOpts.maxTicksLimit,\n stepSize = tickOpts.stepSize;\n let maxTicks;\n if (stepSize) {\n maxTicks = Math.ceil(this.max / stepSize) - Math.floor(this.min / stepSize) + 1;\n if (maxTicks > 1000) {\n console.warn(`scales.${this.id}.ticks.stepSize: ${stepSize} would result generating up to ${maxTicks} ticks. Limiting to 1000.`);\n maxTicks = 1000;\n }\n } else {\n maxTicks = this.computeTickLimit();\n maxTicksLimit = maxTicksLimit || 11;\n }\n if (maxTicksLimit) {\n maxTicks = Math.min(maxTicksLimit, maxTicks);\n }\n return maxTicks;\n }\n computeTickLimit() {\n return Number.POSITIVE_INFINITY;\n }\n buildTicks() {\n const opts = this.options;\n const tickOpts = opts.ticks;\n let maxTicks = this.getTickLimit();\n maxTicks = Math.max(2, maxTicks);\n const numericGeneratorOptions = {\n maxTicks,\n bounds: opts.bounds,\n min: opts.min,\n max: opts.max,\n precision: tickOpts.precision,\n step: tickOpts.stepSize,\n count: tickOpts.count,\n maxDigits: this._maxDigits(),\n horizontal: this.isHorizontal(),\n minRotation: tickOpts.minRotation || 0,\n includeBounds: tickOpts.includeBounds !== false\n };\n const dataRange = this._range || this;\n const ticks = generateTicks$1(numericGeneratorOptions, dataRange);\n if (opts.bounds === 'ticks') {\n _setMinAndMaxByKey(ticks, this, 'value');\n }\n if (opts.reverse) {\n ticks.reverse();\n this.start = this.max;\n this.end = this.min;\n } else {\n this.start = this.min;\n this.end = this.max;\n }\n return ticks;\n }\n configure() {\n const ticks = this.ticks;\n let start = this.min;\n let end = this.max;\n super.configure();\n if (this.options.offset && ticks.length) {\n const offset = (end - start) / Math.max(ticks.length - 1, 1) / 2;\n start -= offset;\n end += offset;\n }\n this._startValue = start;\n this._endValue = end;\n this._valueRange = end - start;\n }\n getLabelForValue(value) {\n return formatNumber(value, this.chart.options.locale, this.options.ticks.format);\n }\n}\nclass LinearScale extends LinearScaleBase {\n determineDataLimits() {\n const _this$getMinMax2 = this.getMinMax(true),\n min = _this$getMinMax2.min,\n max = _this$getMinMax2.max;\n this.min = isNumberFinite(min) ? min : 0;\n this.max = isNumberFinite(max) ? max : 1;\n this.handleTickRangeOptions();\n }\n computeTickLimit() {\n const horizontal = this.isHorizontal();\n const length = horizontal ? this.width : this.height;\n const minRotation = toRadians(this.options.ticks.minRotation);\n const ratio = (horizontal ? Math.sin(minRotation) : Math.cos(minRotation)) || 0.001;\n const tickFont = this._resolveTickFontOptions(0);\n return Math.ceil(length / Math.min(40, tickFont.lineHeight / ratio));\n }\n getPixelForValue(value) {\n return value === null ? NaN : this.getPixelForDecimal((value - this._startValue) / this._valueRange);\n }\n getValueForPixel(pixel) {\n return this._startValue + this.getDecimalForPixel(pixel) * this._valueRange;\n }\n}\nLinearScale.id = 'linear';\nLinearScale.defaults = {\n ticks: {\n callback: Ticks.formatters.numeric\n }\n};\nfunction isMajor(tickVal) {\n const remain = tickVal / Math.pow(10, Math.floor(log10(tickVal)));\n return remain === 1;\n}\nfunction generateTicks(generationOptions, dataRange) {\n const endExp = Math.floor(log10(dataRange.max));\n const endSignificand = Math.ceil(dataRange.max / Math.pow(10, endExp));\n const ticks = [];\n let tickVal = finiteOrDefault(generationOptions.min, Math.pow(10, Math.floor(log10(dataRange.min))));\n let exp = Math.floor(log10(tickVal));\n let significand = Math.floor(tickVal / Math.pow(10, exp));\n let precision = exp < 0 ? Math.pow(10, Math.abs(exp)) : 1;\n do {\n ticks.push({\n value: tickVal,\n major: isMajor(tickVal)\n });\n ++significand;\n if (significand === 10) {\n significand = 1;\n ++exp;\n precision = exp >= 0 ? 1 : precision;\n }\n tickVal = Math.round(significand * Math.pow(10, exp) * precision) / precision;\n } while (exp < endExp || exp === endExp && significand < endSignificand);\n const lastTick = finiteOrDefault(generationOptions.max, tickVal);\n ticks.push({\n value: lastTick,\n major: isMajor(tickVal)\n });\n return ticks;\n}\nclass LogarithmicScale extends Scale {\n constructor(cfg) {\n super(cfg);\n this.start = undefined;\n this.end = undefined;\n this._startValue = undefined;\n this._valueRange = 0;\n }\n parse(raw, index) {\n const value = LinearScaleBase.prototype.parse.apply(this, [raw, index]);\n if (value === 0) {\n this._zero = true;\n return undefined;\n }\n return isNumberFinite(value) && value > 0 ? value : null;\n }\n determineDataLimits() {\n const _this$getMinMax3 = this.getMinMax(true),\n min = _this$getMinMax3.min,\n max = _this$getMinMax3.max;\n this.min = isNumberFinite(min) ? Math.max(0, min) : null;\n this.max = isNumberFinite(max) ? Math.max(0, max) : null;\n if (this.options.beginAtZero) {\n this._zero = true;\n }\n this.handleTickRangeOptions();\n }\n handleTickRangeOptions() {\n const _this$getUserBounds4 = this.getUserBounds(),\n minDefined = _this$getUserBounds4.minDefined,\n maxDefined = _this$getUserBounds4.maxDefined;\n let min = this.min;\n let max = this.max;\n const setMin = v => min = minDefined ? min : v;\n const setMax = v => max = maxDefined ? max : v;\n const exp = (v, m) => Math.pow(10, Math.floor(log10(v)) + m);\n if (min === max) {\n if (min <= 0) {\n setMin(1);\n setMax(10);\n } else {\n setMin(exp(min, -1));\n setMax(exp(max, +1));\n }\n }\n if (min <= 0) {\n setMin(exp(max, -1));\n }\n if (max <= 0) {\n setMax(exp(min, +1));\n }\n if (this._zero && this.min !== this._suggestedMin && min === exp(this.min, 0)) {\n setMin(exp(min, -1));\n }\n this.min = min;\n this.max = max;\n }\n buildTicks() {\n const opts = this.options;\n const generationOptions = {\n min: this._userMin,\n max: this._userMax\n };\n const ticks = generateTicks(generationOptions, this);\n if (opts.bounds === 'ticks') {\n _setMinAndMaxByKey(ticks, this, 'value');\n }\n if (opts.reverse) {\n ticks.reverse();\n this.start = this.max;\n this.end = this.min;\n } else {\n this.start = this.min;\n this.end = this.max;\n }\n return ticks;\n }\n getLabelForValue(value) {\n return value === undefined ? '0' : formatNumber(value, this.chart.options.locale, this.options.ticks.format);\n }\n configure() {\n const start = this.min;\n super.configure();\n this._startValue = log10(start);\n this._valueRange = log10(this.max) - log10(start);\n }\n getPixelForValue(value) {\n if (value === undefined || value === 0) {\n value = this.min;\n }\n if (value === null || isNaN(value)) {\n return NaN;\n }\n return this.getPixelForDecimal(value === this.min ? 0 : (log10(value) - this._startValue) / this._valueRange);\n }\n getValueForPixel(pixel) {\n const decimal = this.getDecimalForPixel(pixel);\n return Math.pow(10, this._startValue + decimal * this._valueRange);\n }\n}\nLogarithmicScale.id = 'logarithmic';\nLogarithmicScale.defaults = {\n ticks: {\n callback: Ticks.formatters.logarithmic,\n major: {\n enabled: true\n }\n }\n};\nfunction getTickBackdropHeight(opts) {\n const tickOpts = opts.ticks;\n if (tickOpts.display && opts.display) {\n const padding = toPadding(tickOpts.backdropPadding);\n return valueOrDefault(tickOpts.font && tickOpts.font.size, defaults.font.size) + padding.height;\n }\n return 0;\n}\nfunction measureLabelSize(ctx, font, label) {\n label = isArray(label) ? label : [label];\n return {\n w: _longestText(ctx, font.string, label),\n h: label.length * font.lineHeight\n };\n}\nfunction determineLimits(angle, pos, size, min, max) {\n if (angle === min || angle === max) {\n return {\n start: pos - size / 2,\n end: pos + size / 2\n };\n } else if (angle < min || angle > max) {\n return {\n start: pos - size,\n end: pos\n };\n }\n return {\n start: pos,\n end: pos + size\n };\n}\nfunction fitWithPointLabels(scale) {\n const orig = {\n l: scale.left + scale._padding.left,\n r: scale.right - scale._padding.right,\n t: scale.top + scale._padding.top,\n b: scale.bottom - scale._padding.bottom\n };\n const limits = Object.assign({}, orig);\n const labelSizes = [];\n const padding = [];\n const valueCount = scale._pointLabels.length;\n const pointLabelOpts = scale.options.pointLabels;\n const additionalAngle = pointLabelOpts.centerPointLabels ? PI / valueCount : 0;\n for (let i = 0; i < valueCount; i++) {\n const opts = pointLabelOpts.setContext(scale.getPointLabelContext(i));\n padding[i] = opts.padding;\n const pointPosition = scale.getPointPosition(i, scale.drawingArea + padding[i], additionalAngle);\n const plFont = toFont(opts.font);\n const textSize = measureLabelSize(scale.ctx, plFont, scale._pointLabels[i]);\n labelSizes[i] = textSize;\n const angleRadians = _normalizeAngle(scale.getIndexAngle(i) + additionalAngle);\n const angle = Math.round(toDegrees(angleRadians));\n const hLimits = determineLimits(angle, pointPosition.x, textSize.w, 0, 180);\n const vLimits = determineLimits(angle, pointPosition.y, textSize.h, 90, 270);\n updateLimits(limits, orig, angleRadians, hLimits, vLimits);\n }\n scale.setCenterPoint(orig.l - limits.l, limits.r - orig.r, orig.t - limits.t, limits.b - orig.b);\n scale._pointLabelItems = buildPointLabelItems(scale, labelSizes, padding);\n}\nfunction updateLimits(limits, orig, angle, hLimits, vLimits) {\n const sin = Math.abs(Math.sin(angle));\n const cos = Math.abs(Math.cos(angle));\n let x = 0;\n let y = 0;\n if (hLimits.start < orig.l) {\n x = (orig.l - hLimits.start) / sin;\n limits.l = Math.min(limits.l, orig.l - x);\n } else if (hLimits.end > orig.r) {\n x = (hLimits.end - orig.r) / sin;\n limits.r = Math.max(limits.r, orig.r + x);\n }\n if (vLimits.start < orig.t) {\n y = (orig.t - vLimits.start) / cos;\n limits.t = Math.min(limits.t, orig.t - y);\n } else if (vLimits.end > orig.b) {\n y = (vLimits.end - orig.b) / cos;\n limits.b = Math.max(limits.b, orig.b + y);\n }\n}\nfunction buildPointLabelItems(scale, labelSizes, padding) {\n const items = [];\n const valueCount = scale._pointLabels.length;\n const opts = scale.options;\n const extra = getTickBackdropHeight(opts) / 2;\n const outerDistance = scale.drawingArea;\n const additionalAngle = opts.pointLabels.centerPointLabels ? PI / valueCount : 0;\n for (let i = 0; i < valueCount; i++) {\n const pointLabelPosition = scale.getPointPosition(i, outerDistance + extra + padding[i], additionalAngle);\n const angle = Math.round(toDegrees(_normalizeAngle(pointLabelPosition.angle + HALF_PI)));\n const size = labelSizes[i];\n const y = yForAngle(pointLabelPosition.y, size.h, angle);\n const textAlign = getTextAlignForAngle(angle);\n const left = leftForTextAlign(pointLabelPosition.x, size.w, textAlign);\n items.push({\n x: pointLabelPosition.x,\n y,\n textAlign,\n left,\n top: y,\n right: left + size.w,\n bottom: y + size.h\n });\n }\n return items;\n}\nfunction getTextAlignForAngle(angle) {\n if (angle === 0 || angle === 180) {\n return 'center';\n } else if (angle < 180) {\n return 'left';\n }\n return 'right';\n}\nfunction leftForTextAlign(x, w, align) {\n if (align === 'right') {\n x -= w;\n } else if (align === 'center') {\n x -= w / 2;\n }\n return x;\n}\nfunction yForAngle(y, h, angle) {\n if (angle === 90 || angle === 270) {\n y -= h / 2;\n } else if (angle > 270 || angle < 90) {\n y -= h;\n }\n return y;\n}\nfunction drawPointLabels(scale, labelCount) {\n const ctx = scale.ctx,\n pointLabels = scale.options.pointLabels;\n for (let i = labelCount - 1; i >= 0; i--) {\n const optsAtIndex = pointLabels.setContext(scale.getPointLabelContext(i));\n const plFont = toFont(optsAtIndex.font);\n const _scale$_pointLabelIte = scale._pointLabelItems[i],\n x = _scale$_pointLabelIte.x,\n y = _scale$_pointLabelIte.y,\n textAlign = _scale$_pointLabelIte.textAlign,\n left = _scale$_pointLabelIte.left,\n top = _scale$_pointLabelIte.top,\n right = _scale$_pointLabelIte.right,\n bottom = _scale$_pointLabelIte.bottom;\n const backdropColor = optsAtIndex.backdropColor;\n if (!isNullOrUndef(backdropColor)) {\n const borderRadius = toTRBLCorners(optsAtIndex.borderRadius);\n const padding = toPadding(optsAtIndex.backdropPadding);\n ctx.fillStyle = backdropColor;\n const backdropLeft = left - padding.left;\n const backdropTop = top - padding.top;\n const backdropWidth = right - left + padding.width;\n const backdropHeight = bottom - top + padding.height;\n if (Object.values(borderRadius).some(v => v !== 0)) {\n ctx.beginPath();\n addRoundedRectPath(ctx, {\n x: backdropLeft,\n y: backdropTop,\n w: backdropWidth,\n h: backdropHeight,\n radius: borderRadius\n });\n ctx.fill();\n } else {\n ctx.fillRect(backdropLeft, backdropTop, backdropWidth, backdropHeight);\n }\n }\n renderText(ctx, scale._pointLabels[i], x, y + plFont.lineHeight / 2, plFont, {\n color: optsAtIndex.color,\n textAlign: textAlign,\n textBaseline: 'middle'\n });\n }\n}\nfunction pathRadiusLine(scale, radius, circular, labelCount) {\n const ctx = scale.ctx;\n if (circular) {\n ctx.arc(scale.xCenter, scale.yCenter, radius, 0, TAU);\n } else {\n let pointPosition = scale.getPointPosition(0, radius);\n ctx.moveTo(pointPosition.x, pointPosition.y);\n for (let i = 1; i < labelCount; i++) {\n pointPosition = scale.getPointPosition(i, radius);\n ctx.lineTo(pointPosition.x, pointPosition.y);\n }\n }\n}\nfunction drawRadiusLine(scale, gridLineOpts, radius, labelCount) {\n const ctx = scale.ctx;\n const circular = gridLineOpts.circular;\n const color = gridLineOpts.color,\n lineWidth = gridLineOpts.lineWidth;\n if (!circular && !labelCount || !color || !lineWidth || radius < 0) {\n return;\n }\n ctx.save();\n ctx.strokeStyle = color;\n ctx.lineWidth = lineWidth;\n ctx.setLineDash(gridLineOpts.borderDash);\n ctx.lineDashOffset = gridLineOpts.borderDashOffset;\n ctx.beginPath();\n pathRadiusLine(scale, radius, circular, labelCount);\n ctx.closePath();\n ctx.stroke();\n ctx.restore();\n}\nfunction createPointLabelContext(parent, index, label) {\n return createContext(parent, {\n label,\n index,\n type: 'pointLabel'\n });\n}\nclass RadialLinearScale extends LinearScaleBase {\n constructor(cfg) {\n super(cfg);\n this.xCenter = undefined;\n this.yCenter = undefined;\n this.drawingArea = undefined;\n this._pointLabels = [];\n this._pointLabelItems = [];\n }\n setDimensions() {\n const padding = this._padding = toPadding(getTickBackdropHeight(this.options) / 2);\n const w = this.width = this.maxWidth - padding.width;\n const h = this.height = this.maxHeight - padding.height;\n this.xCenter = Math.floor(this.left + w / 2 + padding.left);\n this.yCenter = Math.floor(this.top + h / 2 + padding.top);\n this.drawingArea = Math.floor(Math.min(w, h) / 2);\n }\n determineDataLimits() {\n const _this$getMinMax4 = this.getMinMax(false),\n min = _this$getMinMax4.min,\n max = _this$getMinMax4.max;\n this.min = isNumberFinite(min) && !isNaN(min) ? min : 0;\n this.max = isNumberFinite(max) && !isNaN(max) ? max : 0;\n this.handleTickRangeOptions();\n }\n computeTickLimit() {\n return Math.ceil(this.drawingArea / getTickBackdropHeight(this.options));\n }\n generateTickLabels(ticks) {\n LinearScaleBase.prototype.generateTickLabels.call(this, ticks);\n this._pointLabels = this.getLabels().map((value, index) => {\n const label = callback(this.options.pointLabels.callback, [value, index], this);\n return label || label === 0 ? label : '';\n }).filter((v, i) => this.chart.getDataVisibility(i));\n }\n fit() {\n const opts = this.options;\n if (opts.display && opts.pointLabels.display) {\n fitWithPointLabels(this);\n } else {\n this.setCenterPoint(0, 0, 0, 0);\n }\n }\n setCenterPoint(leftMovement, rightMovement, topMovement, bottomMovement) {\n this.xCenter += Math.floor((leftMovement - rightMovement) / 2);\n this.yCenter += Math.floor((topMovement - bottomMovement) / 2);\n this.drawingArea -= Math.min(this.drawingArea / 2, Math.max(leftMovement, rightMovement, topMovement, bottomMovement));\n }\n getIndexAngle(index) {\n const angleMultiplier = TAU / (this._pointLabels.length || 1);\n const startAngle = this.options.startAngle || 0;\n return _normalizeAngle(index * angleMultiplier + toRadians(startAngle));\n }\n getDistanceFromCenterForValue(value) {\n if (isNullOrUndef(value)) {\n return NaN;\n }\n const scalingFactor = this.drawingArea / (this.max - this.min);\n if (this.options.reverse) {\n return (this.max - value) * scalingFactor;\n }\n return (value - this.min) * scalingFactor;\n }\n getValueForDistanceFromCenter(distance) {\n if (isNullOrUndef(distance)) {\n return NaN;\n }\n const scaledDistance = distance / (this.drawingArea / (this.max - this.min));\n return this.options.reverse ? this.max - scaledDistance : this.min + scaledDistance;\n }\n getPointLabelContext(index) {\n const pointLabels = this._pointLabels || [];\n if (index >= 0 && index < pointLabels.length) {\n const pointLabel = pointLabels[index];\n return createPointLabelContext(this.getContext(), index, pointLabel);\n }\n }\n getPointPosition(index, distanceFromCenter) {\n let additionalAngle = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 0;\n const angle = this.getIndexAngle(index) - HALF_PI + additionalAngle;\n return {\n x: Math.cos(angle) * distanceFromCenter + this.xCenter,\n y: Math.sin(angle) * distanceFromCenter + this.yCenter,\n angle\n };\n }\n getPointPositionForValue(index, value) {\n return this.getPointPosition(index, this.getDistanceFromCenterForValue(value));\n }\n getBasePosition(index) {\n return this.getPointPositionForValue(index || 0, this.getBaseValue());\n }\n getPointLabelPosition(index) {\n const _this$_pointLabelItem = this._pointLabelItems[index],\n left = _this$_pointLabelItem.left,\n top = _this$_pointLabelItem.top,\n right = _this$_pointLabelItem.right,\n bottom = _this$_pointLabelItem.bottom;\n return {\n left,\n top,\n right,\n bottom\n };\n }\n drawBackground() {\n const _this$options15 = this.options,\n backgroundColor = _this$options15.backgroundColor,\n circular = _this$options15.grid.circular;\n if (backgroundColor) {\n const ctx = this.ctx;\n ctx.save();\n ctx.beginPath();\n pathRadiusLine(this, this.getDistanceFromCenterForValue(this._endValue), circular, this._pointLabels.length);\n ctx.closePath();\n ctx.fillStyle = backgroundColor;\n ctx.fill();\n ctx.restore();\n }\n }\n drawGrid() {\n const ctx = this.ctx;\n const opts = this.options;\n const angleLines = opts.angleLines,\n grid = opts.grid;\n const labelCount = this._pointLabels.length;\n let i, offset, position;\n if (opts.pointLabels.display) {\n drawPointLabels(this, labelCount);\n }\n if (grid.display) {\n this.ticks.forEach((tick, index) => {\n if (index !== 0) {\n offset = this.getDistanceFromCenterForValue(tick.value);\n const optsAtIndex = grid.setContext(this.getContext(index - 1));\n drawRadiusLine(this, optsAtIndex, offset, labelCount);\n }\n });\n }\n if (angleLines.display) {\n ctx.save();\n for (i = labelCount - 1; i >= 0; i--) {\n const optsAtIndex = angleLines.setContext(this.getPointLabelContext(i));\n const color = optsAtIndex.color,\n lineWidth = optsAtIndex.lineWidth;\n if (!lineWidth || !color) {\n continue;\n }\n ctx.lineWidth = lineWidth;\n ctx.strokeStyle = color;\n ctx.setLineDash(optsAtIndex.borderDash);\n ctx.lineDashOffset = optsAtIndex.borderDashOffset;\n offset = this.getDistanceFromCenterForValue(opts.ticks.reverse ? this.min : this.max);\n position = this.getPointPosition(i, offset);\n ctx.beginPath();\n ctx.moveTo(this.xCenter, this.yCenter);\n ctx.lineTo(position.x, position.y);\n ctx.stroke();\n }\n ctx.restore();\n }\n }\n drawBorder() {}\n drawLabels() {\n const ctx = this.ctx;\n const opts = this.options;\n const tickOpts = opts.ticks;\n if (!tickOpts.display) {\n return;\n }\n const startAngle = this.getIndexAngle(0);\n let offset, width;\n ctx.save();\n ctx.translate(this.xCenter, this.yCenter);\n ctx.rotate(startAngle);\n ctx.textAlign = 'center';\n ctx.textBaseline = 'middle';\n this.ticks.forEach((tick, index) => {\n if (index === 0 && !opts.reverse) {\n return;\n }\n const optsAtIndex = tickOpts.setContext(this.getContext(index));\n const tickFont = toFont(optsAtIndex.font);\n offset = this.getDistanceFromCenterForValue(this.ticks[index].value);\n if (optsAtIndex.showLabelBackdrop) {\n ctx.font = tickFont.string;\n width = ctx.measureText(tick.label).width;\n ctx.fillStyle = optsAtIndex.backdropColor;\n const padding = toPadding(optsAtIndex.backdropPadding);\n ctx.fillRect(-width / 2 - padding.left, -offset - tickFont.size / 2 - padding.top, width + padding.width, tickFont.size + padding.height);\n }\n renderText(ctx, tick.label, 0, -offset, tickFont, {\n color: optsAtIndex.color\n });\n });\n ctx.restore();\n }\n drawTitle() {}\n}\nRadialLinearScale.id = 'radialLinear';\nRadialLinearScale.defaults = {\n display: true,\n animate: true,\n position: 'chartArea',\n angleLines: {\n display: true,\n lineWidth: 1,\n borderDash: [],\n borderDashOffset: 0.0\n },\n grid: {\n circular: false\n },\n startAngle: 0,\n ticks: {\n showLabelBackdrop: true,\n callback: Ticks.formatters.numeric\n },\n pointLabels: {\n backdropColor: undefined,\n backdropPadding: 2,\n display: true,\n font: {\n size: 10\n },\n callback(label) {\n return label;\n },\n padding: 5,\n centerPointLabels: false\n }\n};\nRadialLinearScale.defaultRoutes = {\n 'angleLines.color': 'borderColor',\n 'pointLabels.color': 'color',\n 'ticks.color': 'color'\n};\nRadialLinearScale.descriptors = {\n angleLines: {\n _fallback: 'grid'\n }\n};\nconst INTERVALS = {\n millisecond: {\n common: true,\n size: 1,\n steps: 1000\n },\n second: {\n common: true,\n size: 1000,\n steps: 60\n },\n minute: {\n common: true,\n size: 60000,\n steps: 60\n },\n hour: {\n common: true,\n size: 3600000,\n steps: 24\n },\n day: {\n common: true,\n size: 86400000,\n steps: 30\n },\n week: {\n common: false,\n size: 604800000,\n steps: 4\n },\n month: {\n common: true,\n size: 2.628e9,\n steps: 12\n },\n quarter: {\n common: false,\n size: 7.884e9,\n steps: 4\n },\n year: {\n common: true,\n size: 3.154e10\n }\n};\nconst UNITS = Object.keys(INTERVALS);\nfunction sorter(a, b) {\n return a - b;\n}\nfunction parse(scale, input) {\n if (isNullOrUndef(input)) {\n return null;\n }\n const adapter = scale._adapter;\n const _scale$_parseOpts = scale._parseOpts,\n parser = _scale$_parseOpts.parser,\n round = _scale$_parseOpts.round,\n isoWeekday = _scale$_parseOpts.isoWeekday;\n let value = input;\n if (typeof parser === 'function') {\n value = parser(value);\n }\n if (!isNumberFinite(value)) {\n value = typeof parser === 'string' ? adapter.parse(value, parser) : adapter.parse(value);\n }\n if (value === null) {\n return null;\n }\n if (round) {\n value = round === 'week' && (isNumber(isoWeekday) || isoWeekday === true) ? adapter.startOf(value, 'isoWeek', isoWeekday) : adapter.startOf(value, round);\n }\n return +value;\n}\nfunction determineUnitForAutoTicks(minUnit, min, max, capacity) {\n const ilen = UNITS.length;\n for (let i = UNITS.indexOf(minUnit); i < ilen - 1; ++i) {\n const interval = INTERVALS[UNITS[i]];\n const factor = interval.steps ? interval.steps : Number.MAX_SAFE_INTEGER;\n if (interval.common && Math.ceil((max - min) / (factor * interval.size)) <= capacity) {\n return UNITS[i];\n }\n }\n return UNITS[ilen - 1];\n}\nfunction determineUnitForFormatting(scale, numTicks, minUnit, min, max) {\n for (let i = UNITS.length - 1; i >= UNITS.indexOf(minUnit); i--) {\n const unit = UNITS[i];\n if (INTERVALS[unit].common && scale._adapter.diff(max, min, unit) >= numTicks - 1) {\n return unit;\n }\n }\n return UNITS[minUnit ? UNITS.indexOf(minUnit) : 0];\n}\nfunction determineMajorUnit(unit) {\n for (let i = UNITS.indexOf(unit) + 1, ilen = UNITS.length; i < ilen; ++i) {\n if (INTERVALS[UNITS[i]].common) {\n return UNITS[i];\n }\n }\n}\nfunction addTick(ticks, time, timestamps) {\n if (!timestamps) {\n ticks[time] = true;\n } else if (timestamps.length) {\n const _lookup2 = _lookup(timestamps, time),\n lo = _lookup2.lo,\n hi = _lookup2.hi;\n const timestamp = timestamps[lo] >= time ? timestamps[lo] : timestamps[hi];\n ticks[timestamp] = true;\n }\n}\nfunction setMajorTicks(scale, ticks, map, majorUnit) {\n const adapter = scale._adapter;\n const first = +adapter.startOf(ticks[0].value, majorUnit);\n const last = ticks[ticks.length - 1].value;\n let major, index;\n for (major = first; major <= last; major = +adapter.add(major, 1, majorUnit)) {\n index = map[major];\n if (index >= 0) {\n ticks[index].major = true;\n }\n }\n return ticks;\n}\nfunction ticksFromTimestamps(scale, values, majorUnit) {\n const ticks = [];\n const map = {};\n const ilen = values.length;\n let i, value;\n for (i = 0; i < ilen; ++i) {\n value = values[i];\n map[value] = i;\n ticks.push({\n value,\n major: false\n });\n }\n return ilen === 0 || !majorUnit ? ticks : setMajorTicks(scale, ticks, map, majorUnit);\n}\nclass TimeScale extends Scale {\n constructor(props) {\n super(props);\n this._cache = {\n data: [],\n labels: [],\n all: []\n };\n this._unit = 'day';\n this._majorUnit = undefined;\n this._offsets = {};\n this._normalized = false;\n this._parseOpts = undefined;\n }\n init(scaleOpts, opts) {\n const time = scaleOpts.time || (scaleOpts.time = {});\n const adapter = this._adapter = new adapters._date(scaleOpts.adapters.date);\n adapter.init(opts);\n mergeIf(time.displayFormats, adapter.formats());\n this._parseOpts = {\n parser: time.parser,\n round: time.round,\n isoWeekday: time.isoWeekday\n };\n super.init(scaleOpts);\n this._normalized = opts.normalized;\n }\n parse(raw, index) {\n if (raw === undefined) {\n return null;\n }\n return parse(this, raw);\n }\n beforeLayout() {\n super.beforeLayout();\n this._cache = {\n data: [],\n labels: [],\n all: []\n };\n }\n determineDataLimits() {\n const options = this.options;\n const adapter = this._adapter;\n const unit = options.time.unit || 'day';\n let _this$getUserBounds5 = this.getUserBounds(),\n min = _this$getUserBounds5.min,\n max = _this$getUserBounds5.max,\n minDefined = _this$getUserBounds5.minDefined,\n maxDefined = _this$getUserBounds5.maxDefined;\n function _applyBounds(bounds) {\n if (!minDefined && !isNaN(bounds.min)) {\n min = Math.min(min, bounds.min);\n }\n if (!maxDefined && !isNaN(bounds.max)) {\n max = Math.max(max, bounds.max);\n }\n }\n if (!minDefined || !maxDefined) {\n _applyBounds(this._getLabelBounds());\n if (options.bounds !== 'ticks' || options.ticks.source !== 'labels') {\n _applyBounds(this.getMinMax(false));\n }\n }\n min = isNumberFinite(min) && !isNaN(min) ? min : +adapter.startOf(Date.now(), unit);\n max = isNumberFinite(max) && !isNaN(max) ? max : +adapter.endOf(Date.now(), unit) + 1;\n this.min = Math.min(min, max - 1);\n this.max = Math.max(min + 1, max);\n }\n _getLabelBounds() {\n const arr = this.getLabelTimestamps();\n let min = Number.POSITIVE_INFINITY;\n let max = Number.NEGATIVE_INFINITY;\n if (arr.length) {\n min = arr[0];\n max = arr[arr.length - 1];\n }\n return {\n min,\n max\n };\n }\n buildTicks() {\n const options = this.options;\n const timeOpts = options.time;\n const tickOpts = options.ticks;\n const timestamps = tickOpts.source === 'labels' ? this.getLabelTimestamps() : this._generate();\n if (options.bounds === 'ticks' && timestamps.length) {\n this.min = this._userMin || timestamps[0];\n this.max = this._userMax || timestamps[timestamps.length - 1];\n }\n const min = this.min;\n const max = this.max;\n const ticks = _filterBetween(timestamps, min, max);\n this._unit = timeOpts.unit || (tickOpts.autoSkip ? determineUnitForAutoTicks(timeOpts.minUnit, this.min, this.max, this._getLabelCapacity(min)) : determineUnitForFormatting(this, ticks.length, timeOpts.minUnit, this.min, this.max));\n this._majorUnit = !tickOpts.major.enabled || this._unit === 'year' ? undefined : determineMajorUnit(this._unit);\n this.initOffsets(timestamps);\n if (options.reverse) {\n ticks.reverse();\n }\n return ticksFromTimestamps(this, ticks, this._majorUnit);\n }\n afterAutoSkip() {\n if (this.options.offsetAfterAutoskip) {\n this.initOffsets(this.ticks.map(tick => +tick.value));\n }\n }\n initOffsets(timestamps) {\n let start = 0;\n let end = 0;\n let first, last;\n if (this.options.offset && timestamps.length) {\n first = this.getDecimalForValue(timestamps[0]);\n if (timestamps.length === 1) {\n start = 1 - first;\n } else {\n start = (this.getDecimalForValue(timestamps[1]) - first) / 2;\n }\n last = this.getDecimalForValue(timestamps[timestamps.length - 1]);\n if (timestamps.length === 1) {\n end = last;\n } else {\n end = (last - this.getDecimalForValue(timestamps[timestamps.length - 2])) / 2;\n }\n }\n const limit = timestamps.length < 3 ? 0.5 : 0.25;\n start = _limitValue(start, 0, limit);\n end = _limitValue(end, 0, limit);\n this._offsets = {\n start,\n end,\n factor: 1 / (start + 1 + end)\n };\n }\n _generate() {\n const adapter = this._adapter;\n const min = this.min;\n const max = this.max;\n const options = this.options;\n const timeOpts = options.time;\n const minor = timeOpts.unit || determineUnitForAutoTicks(timeOpts.minUnit, min, max, this._getLabelCapacity(min));\n const stepSize = valueOrDefault(timeOpts.stepSize, 1);\n const weekday = minor === 'week' ? timeOpts.isoWeekday : false;\n const hasWeekday = isNumber(weekday) || weekday === true;\n const ticks = {};\n let first = min;\n let time, count;\n if (hasWeekday) {\n first = +adapter.startOf(first, 'isoWeek', weekday);\n }\n first = +adapter.startOf(first, hasWeekday ? 'day' : minor);\n if (adapter.diff(max, min, minor) > 100000 * stepSize) {\n throw new Error(min + ' and ' + max + ' are too far apart with stepSize of ' + stepSize + ' ' + minor);\n }\n const timestamps = options.ticks.source === 'data' && this.getDataTimestamps();\n for (time = first, count = 0; time < max; time = +adapter.add(time, stepSize, minor), count++) {\n addTick(ticks, time, timestamps);\n }\n if (time === max || options.bounds === 'ticks' || count === 1) {\n addTick(ticks, time, timestamps);\n }\n return Object.keys(ticks).sort((a, b) => a - b).map(x => +x);\n }\n getLabelForValue(value) {\n const adapter = this._adapter;\n const timeOpts = this.options.time;\n if (timeOpts.tooltipFormat) {\n return adapter.format(value, timeOpts.tooltipFormat);\n }\n return adapter.format(value, timeOpts.displayFormats.datetime);\n }\n _tickFormatFunction(time, index, ticks, format) {\n const options = this.options;\n const formats = options.time.displayFormats;\n const unit = this._unit;\n const majorUnit = this._majorUnit;\n const minorFormat = unit && formats[unit];\n const majorFormat = majorUnit && formats[majorUnit];\n const tick = ticks[index];\n const major = majorUnit && majorFormat && tick && tick.major;\n const label = this._adapter.format(time, format || (major ? majorFormat : minorFormat));\n const formatter = options.ticks.callback;\n return formatter ? callback(formatter, [label, index, ticks], this) : label;\n }\n generateTickLabels(ticks) {\n let i, ilen, tick;\n for (i = 0, ilen = ticks.length; i < ilen; ++i) {\n tick = ticks[i];\n tick.label = this._tickFormatFunction(tick.value, i, ticks);\n }\n }\n getDecimalForValue(value) {\n return value === null ? NaN : (value - this.min) / (this.max - this.min);\n }\n getPixelForValue(value) {\n const offsets = this._offsets;\n const pos = this.getDecimalForValue(value);\n return this.getPixelForDecimal((offsets.start + pos) * offsets.factor);\n }\n getValueForPixel(pixel) {\n const offsets = this._offsets;\n const pos = this.getDecimalForPixel(pixel) / offsets.factor - offsets.end;\n return this.min + pos * (this.max - this.min);\n }\n _getLabelSize(label) {\n const ticksOpts = this.options.ticks;\n const tickLabelWidth = this.ctx.measureText(label).width;\n const angle = toRadians(this.isHorizontal() ? ticksOpts.maxRotation : ticksOpts.minRotation);\n const cosRotation = Math.cos(angle);\n const sinRotation = Math.sin(angle);\n const tickFontSize = this._resolveTickFontOptions(0).size;\n return {\n w: tickLabelWidth * cosRotation + tickFontSize * sinRotation,\n h: tickLabelWidth * sinRotation + tickFontSize * cosRotation\n };\n }\n _getLabelCapacity(exampleTime) {\n const timeOpts = this.options.time;\n const displayFormats = timeOpts.displayFormats;\n const format = displayFormats[timeOpts.unit] || displayFormats.millisecond;\n const exampleLabel = this._tickFormatFunction(exampleTime, 0, ticksFromTimestamps(this, [exampleTime], this._majorUnit), format);\n const size = this._getLabelSize(exampleLabel);\n const capacity = Math.floor(this.isHorizontal() ? this.width / size.w : this.height / size.h) - 1;\n return capacity > 0 ? capacity : 1;\n }\n getDataTimestamps() {\n let timestamps = this._cache.data || [];\n let i, ilen;\n if (timestamps.length) {\n return timestamps;\n }\n const metas = this.getMatchingVisibleMetas();\n if (this._normalized && metas.length) {\n return this._cache.data = metas[0].controller.getAllParsedValues(this);\n }\n for (i = 0, ilen = metas.length; i < ilen; ++i) {\n timestamps = timestamps.concat(metas[i].controller.getAllParsedValues(this));\n }\n return this._cache.data = this.normalize(timestamps);\n }\n getLabelTimestamps() {\n const timestamps = this._cache.labels || [];\n let i, ilen;\n if (timestamps.length) {\n return timestamps;\n }\n const labels = this.getLabels();\n for (i = 0, ilen = labels.length; i < ilen; ++i) {\n timestamps.push(parse(this, labels[i]));\n }\n return this._cache.labels = this._normalized ? timestamps : this.normalize(timestamps);\n }\n normalize(values) {\n return _arrayUnique(values.sort(sorter));\n }\n}\nTimeScale.id = 'time';\nTimeScale.defaults = {\n bounds: 'data',\n adapters: {},\n time: {\n parser: false,\n unit: false,\n round: false,\n isoWeekday: false,\n minUnit: 'millisecond',\n displayFormats: {}\n },\n ticks: {\n source: 'auto',\n major: {\n enabled: false\n }\n }\n};\nfunction interpolate(table, val, reverse) {\n let lo = 0;\n let hi = table.length - 1;\n let prevSource, nextSource, prevTarget, nextTarget;\n if (reverse) {\n if (val >= table[lo].pos && val <= table[hi].pos) {\n var _lookupByKey2 = _lookupByKey(table, 'pos', val);\n lo = _lookupByKey2.lo;\n hi = _lookupByKey2.hi;\n }\n var _table$lo = table[lo];\n prevSource = _table$lo.pos;\n prevTarget = _table$lo.time;\n var _table$hi = table[hi];\n nextSource = _table$hi.pos;\n nextTarget = _table$hi.time;\n } else {\n if (val >= table[lo].time && val <= table[hi].time) {\n var _lookupByKey3 = _lookupByKey(table, 'time', val);\n lo = _lookupByKey3.lo;\n hi = _lookupByKey3.hi;\n }\n var _table$lo2 = table[lo];\n prevSource = _table$lo2.time;\n prevTarget = _table$lo2.pos;\n var _table$hi2 = table[hi];\n nextSource = _table$hi2.time;\n nextTarget = _table$hi2.pos;\n }\n const span = nextSource - prevSource;\n return span ? prevTarget + (nextTarget - prevTarget) * (val - prevSource) / span : prevTarget;\n}\nclass TimeSeriesScale extends TimeScale {\n constructor(props) {\n super(props);\n this._table = [];\n this._minPos = undefined;\n this._tableRange = undefined;\n }\n initOffsets() {\n const timestamps = this._getTimestampsForTable();\n const table = this._table = this.buildLookupTable(timestamps);\n this._minPos = interpolate(table, this.min);\n this._tableRange = interpolate(table, this.max) - this._minPos;\n super.initOffsets(timestamps);\n }\n buildLookupTable(timestamps) {\n const min = this.min,\n max = this.max;\n const items = [];\n const table = [];\n let i, ilen, prev, curr, next;\n for (i = 0, ilen = timestamps.length; i < ilen; ++i) {\n curr = timestamps[i];\n if (curr >= min && curr <= max) {\n items.push(curr);\n }\n }\n if (items.length < 2) {\n return [{\n time: min,\n pos: 0\n }, {\n time: max,\n pos: 1\n }];\n }\n for (i = 0, ilen = items.length; i < ilen; ++i) {\n next = items[i + 1];\n prev = items[i - 1];\n curr = items[i];\n if (Math.round((next + prev) / 2) !== curr) {\n table.push({\n time: curr,\n pos: i / (ilen - 1)\n });\n }\n }\n return table;\n }\n _getTimestampsForTable() {\n let timestamps = this._cache.all || [];\n if (timestamps.length) {\n return timestamps;\n }\n const data = this.getDataTimestamps();\n const label = this.getLabelTimestamps();\n if (data.length && label.length) {\n timestamps = this.normalize(data.concat(label));\n } else {\n timestamps = data.length ? data : label;\n }\n timestamps = this._cache.all = timestamps;\n return timestamps;\n }\n getDecimalForValue(value) {\n return (interpolate(this._table, value) - this._minPos) / this._tableRange;\n }\n getValueForPixel(pixel) {\n const offsets = this._offsets;\n const decimal = this.getDecimalForPixel(pixel) / offsets.factor - offsets.end;\n return interpolate(this._table, decimal * this._tableRange + this._minPos, true);\n }\n}\nTimeSeriesScale.id = 'timeseries';\nTimeSeriesScale.defaults = TimeScale.defaults;\nvar scales = /*#__PURE__*/Object.freeze({\n __proto__: null,\n CategoryScale: CategoryScale,\n LinearScale: LinearScale,\n LogarithmicScale: LogarithmicScale,\n RadialLinearScale: RadialLinearScale,\n TimeScale: TimeScale,\n TimeSeriesScale: TimeSeriesScale\n});\nconst registerables = [controllers, elements, plugins, scales];\nexport { Animation, Animations, ArcElement, BarController, BarElement, BasePlatform, BasicPlatform, BubbleController, CategoryScale, Chart, DatasetController, plugin_decimation as Decimation, DomPlatform, DoughnutController, Element, index as Filler, Interaction, plugin_legend as Legend, LineController, LineElement, LinearScale, LogarithmicScale, PieController, PointElement, PolarAreaController, RadarController, RadialLinearScale, Scale, ScatterController, plugin_subtitle as SubTitle, Ticks, TimeScale, TimeSeriesScale, plugin_title as Title, plugin_tooltip as Tooltip, adapters as _adapters, _detectPlatform, animator, controllers, elements, layouts, plugins, registerables, registry, scales };","import _extends from \"@babel/runtime/helpers/esm/extends\";\nimport _objectWithoutProperties from \"@babel/runtime/helpers/esm/objectWithoutProperties\";\nimport * as React from 'react';\nimport clsx from 'clsx';\nimport withStyles from '../styles/withStyles';\nimport Typography from '../Typography';\nexport var styles = {\n /* Styles applied to the root element. */\n root: {\n margin: 0,\n padding: '16px 24px',\n flex: '0 0 auto'\n }\n};\nvar DialogTitle = /*#__PURE__*/React.forwardRef(function DialogTitle(props, ref) {\n var children = props.children,\n classes = props.classes,\n className = props.className,\n _props$disableTypogra = props.disableTypography,\n disableTypography = _props$disableTypogra === void 0 ? false : _props$disableTypogra,\n other = _objectWithoutProperties(props, [\"children\", \"classes\", \"className\", \"disableTypography\"]);\n return /*#__PURE__*/React.createElement(\"div\", _extends({\n className: clsx(classes.root, className),\n ref: ref\n }, other), disableTypography ? children : /*#__PURE__*/React.createElement(Typography, {\n component: \"h2\",\n variant: \"h6\"\n }, children));\n});\nprocess.env.NODE_ENV !== \"production\" ? void 0 : void 0;\nexport default withStyles(styles, {\n name: 'MuiDialogTitle'\n})(DialogTitle);","'use strict';\n\nimport toFormData from './toFormData.js';\n\n/**\n * It encodes a string by replacing all characters that are not in the unreserved set with\n * their percent-encoded equivalents\n *\n * @param {string} str - The string to encode.\n *\n * @returns {string} The encoded string.\n */\nfunction encode(str) {\n const charMap = {\n '!': '%21',\n \"'\": '%27',\n '(': '%28',\n ')': '%29',\n '~': '%7E',\n '%20': '+',\n '%00': '\\x00'\n };\n return encodeURIComponent(str).replace(/[!'()~]|%20|%00/g, function replacer(match) {\n return charMap[match];\n });\n}\n\n/**\n * It takes a params object and converts it to a FormData object\n *\n * @param {Object\n\n \n\n \n Meses visíveis \n \n \n {Object.entries(props.months).map(([name, number]) => {\n return \n \n \n \n \n \n
\n );\n}\n\n\n\n","import React from \"react\";\n\nexport function EyeOff(props) {\n return (\n \n );\n}\n\nexport default EyeOff;\n","import React from 'react'\n\nexport function EyeOn(props) {\n return (\n \n );\n}\n\n","import _extends from \"@babel/runtime/helpers/esm/extends\";\nimport _objectWithoutProperties from \"@babel/runtime/helpers/esm/objectWithoutProperties\";\nimport * as React from 'react';\nimport clsx from 'clsx';\nimport withStyles from '../styles/withStyles';\nexport var styles = function styles(theme) {\n return {\n /* Styles applied to the root element. */\n root: {\n flex: '1 1 auto',\n WebkitOverflowScrolling: 'touch',\n // Add iOS momentum scrolling.\n overflowY: 'auto',\n padding: '8px 24px',\n '&:first-child': {\n // dialog without title\n paddingTop: 20\n }\n },\n /* Styles applied to the root element if `dividers={true}`. */\n dividers: {\n padding: '16px 24px',\n borderTop: \"1px solid \".concat(theme.palette.divider),\n borderBottom: \"1px solid \".concat(theme.palette.divider)\n }\n };\n};\nvar DialogContent = /*#__PURE__*/React.forwardRef(function DialogContent(props, ref) {\n var classes = props.classes,\n className = props.className,\n _props$dividers = props.dividers,\n dividers = _props$dividers === void 0 ? false : _props$dividers,\n other = _objectWithoutProperties(props, [\"classes\", \"className\", \"dividers\"]);\n return /*#__PURE__*/React.createElement(\"div\", _extends({\n className: clsx(classes.root, className, dividers && classes.dividers),\n ref: ref\n }, other));\n});\nprocess.env.NODE_ENV !== \"production\" ? void 0 : void 0;\nexport default withStyles(styles, {\n name: 'MuiDialogContent'\n})(DialogContent);","var dP = require('./_object-dp');\nvar createDesc = require('./_property-desc');\nmodule.exports = require('./_descriptors') ? function (object, key, value) {\n return dP.f(object, key, createDesc(1, value));\n} : function (object, key, value) {\n object[key] = value;\n return object;\n};\n","var global = require('./_global');\nvar hide = require('./_hide');\nvar has = require('./_has');\nvar SRC = require('./_uid')('src');\nvar $toString = require('./_function-to-string');\nvar TO_STRING = 'toString';\nvar TPL = ('' + $toString).split(TO_STRING);\n\nrequire('./_core').inspectSource = function (it) {\n return $toString.call(it);\n};\n\n(module.exports = function (O, key, val, safe) {\n var isFunction = typeof val == 'function';\n if (isFunction) has(val, 'name') || hide(val, 'name', key);\n if (O[key] === val) return;\n if (isFunction) has(val, SRC) || hide(val, SRC, O[key] ? '' + O[key] : TPL.join(String(key)));\n if (O === global) {\n O[key] = val;\n } else if (!safe) {\n delete O[key];\n hide(O, key, val);\n } else if (O[key]) {\n O[key] = val;\n } else {\n hide(O, key, val);\n }\n// add fake Function#toString for correct work wrapped methods / constructors with methods like LoDash isNative\n})(Function.prototype, TO_STRING, function toString() {\n return typeof this == 'function' && this[SRC] || $toString.call(this);\n});\n","var hasOwnProperty = {}.hasOwnProperty;\nmodule.exports = function (it, key) {\n return hasOwnProperty.call(it, key);\n};\n","// 19.1.2.9 / 15.2.3.2 Object.getPrototypeOf(O)\nvar has = require('./_has');\nvar toObject = require('./_to-object');\nvar IE_PROTO = require('./_shared-key')('IE_PROTO');\nvar ObjectProto = Object.prototype;\n\nmodule.exports = Object.getPrototypeOf || function (O) {\n O = toObject(O);\n if (has(O, IE_PROTO)) return O[IE_PROTO];\n if (typeof O.constructor == 'function' && O instanceof O.constructor) {\n return O.constructor.prototype;\n } return O instanceof Object ? ObjectProto : null;\n};\n","var $export = require('./_export');\nvar fails = require('./_fails');\nvar defined = require('./_defined');\nvar quot = /\"/g;\n// B.2.3.2.1 CreateHTML(string, tag, attribute, value)\nvar createHTML = function (string, tag, attribute, value) {\n var S = String(defined(string));\n var p1 = '<' + tag;\n if (attribute !== '') p1 += ' ' + attribute + '=\"' + String(value).replace(quot, '"') + '\"';\n return p1 + '>' + S + '';\n};\nmodule.exports = function (NAME, exec) {\n var O = {};\n O[NAME] = exec(createHTML);\n $export($export.P + $export.F * fails(function () {\n var test = ''[NAME]('\"');\n return test !== test.toLowerCase() || test.split('\"').length > 3;\n }), 'String', O);\n};\n","function _objectWithoutPropertiesLoose(source, excluded) {\n if (source == null) return {};\n var target = {};\n var sourceKeys = Object.keys(source);\n var key, i;\n for (i = 0; i < sourceKeys.length; i++) {\n key = sourceKeys[i];\n if (excluded.indexOf(key) >= 0) continue;\n target[key] = source[key];\n }\n return target;\n}\nmodule.exports = _objectWithoutPropertiesLoose, module.exports.__esModule = true, module.exports[\"default\"] = module.exports;","import * as React from 'react';\nimport FormControlContext from './FormControlContext';\nexport default function useFormControl() {\n return React.useContext(FormControlContext);\n}","/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n */\n\nfunction componentWillMount() {\n // Call this.constructor.gDSFP to support sub-classes.\n var state = this.constructor.getDerivedStateFromProps(this.props, this.state);\n if (state !== null && state !== undefined) {\n this.setState(state);\n }\n}\nfunction componentWillReceiveProps(nextProps) {\n // Call this.constructor.gDSFP to support sub-classes.\n // Use the setState() updater to ensure state isn't stale in certain edge cases.\n function updater(prevState) {\n var state = this.constructor.getDerivedStateFromProps(nextProps, prevState);\n return state !== null && state !== undefined ? state : null;\n }\n // Binding \"this\" is important for shallow renderer support.\n this.setState(updater.bind(this));\n}\nfunction componentWillUpdate(nextProps, nextState) {\n try {\n var prevProps = this.props;\n var prevState = this.state;\n this.props = nextProps;\n this.state = nextState;\n this.__reactInternalSnapshotFlag = true;\n this.__reactInternalSnapshot = this.getSnapshotBeforeUpdate(prevProps, prevState);\n } finally {\n this.props = prevProps;\n this.state = prevState;\n }\n}\n\n// React may warn about cWM/cWRP/cWU methods being deprecated.\n// Add a flag to suppress these warnings for this special case.\ncomponentWillMount.__suppressDeprecationWarning = true;\ncomponentWillReceiveProps.__suppressDeprecationWarning = true;\ncomponentWillUpdate.__suppressDeprecationWarning = true;\nfunction polyfill(Component) {\n var prototype = Component.prototype;\n if (!prototype || !prototype.isReactComponent) {\n throw new Error('Can only polyfill class components');\n }\n if (typeof Component.getDerivedStateFromProps !== 'function' && typeof prototype.getSnapshotBeforeUpdate !== 'function') {\n return Component;\n }\n\n // If new component APIs are defined, \"unsafe\" lifecycles won't be called.\n // Error if any of these lifecycles are present,\n // Because they would work differently between older and newer (16.3+) versions of React.\n var foundWillMountName = null;\n var foundWillReceivePropsName = null;\n var foundWillUpdateName = null;\n if (typeof prototype.componentWillMount === 'function') {\n foundWillMountName = 'componentWillMount';\n } else if (typeof prototype.UNSAFE_componentWillMount === 'function') {\n foundWillMountName = 'UNSAFE_componentWillMount';\n }\n if (typeof prototype.componentWillReceiveProps === 'function') {\n foundWillReceivePropsName = 'componentWillReceiveProps';\n } else if (typeof prototype.UNSAFE_componentWillReceiveProps === 'function') {\n foundWillReceivePropsName = 'UNSAFE_componentWillReceiveProps';\n }\n if (typeof prototype.componentWillUpdate === 'function') {\n foundWillUpdateName = 'componentWillUpdate';\n } else if (typeof prototype.UNSAFE_componentWillUpdate === 'function') {\n foundWillUpdateName = 'UNSAFE_componentWillUpdate';\n }\n if (foundWillMountName !== null || foundWillReceivePropsName !== null || foundWillUpdateName !== null) {\n var componentName = Component.displayName || Component.name;\n var newApiName = typeof Component.getDerivedStateFromProps === 'function' ? 'getDerivedStateFromProps()' : 'getSnapshotBeforeUpdate()';\n throw Error('Unsafe legacy lifecycles will not be called for components using new component APIs.\\n\\n' + componentName + ' uses ' + newApiName + ' but also contains the following legacy lifecycles:' + (foundWillMountName !== null ? '\\n ' + foundWillMountName : '') + (foundWillReceivePropsName !== null ? '\\n ' + foundWillReceivePropsName : '') + (foundWillUpdateName !== null ? '\\n ' + foundWillUpdateName : '') + '\\n\\nThe above lifecycles should be removed. Learn more about this warning here:\\n' + 'https://fb.me/react-async-component-lifecycle-hooks');\n }\n\n // React <= 16.2 does not support static getDerivedStateFromProps.\n // As a workaround, use cWM and cWRP to invoke the new static lifecycle.\n // Newer versions of React will ignore these lifecycles if gDSFP exists.\n if (typeof Component.getDerivedStateFromProps === 'function') {\n prototype.componentWillMount = componentWillMount;\n prototype.componentWillReceiveProps = componentWillReceiveProps;\n }\n\n // React <= 16.2 does not support getSnapshotBeforeUpdate.\n // As a workaround, use cWU to invoke the new lifecycle.\n // Newer versions of React will ignore that lifecycle if gSBU exists.\n if (typeof prototype.getSnapshotBeforeUpdate === 'function') {\n if (typeof prototype.componentDidUpdate !== 'function') {\n throw new Error('Cannot polyfill getSnapshotBeforeUpdate() for components that do not define componentDidUpdate() on the prototype');\n }\n prototype.componentWillUpdate = componentWillUpdate;\n var componentDidUpdate = prototype.componentDidUpdate;\n prototype.componentDidUpdate = function componentDidUpdatePolyfill(prevProps, prevState, maybeSnapshot) {\n // 16.3+ will not execute our will-update method;\n // It will pass a snapshot value to did-update though.\n // Older versions will require our polyfilled will-update value.\n // We need to handle both cases, but can't just check for the presence of \"maybeSnapshot\",\n // Because for <= 15.x versions this might be a \"prevContext\" object.\n // We also can't just check \"__reactInternalSnapshot\",\n // Because get-snapshot might return a falsy value.\n // So check for the explicit __reactInternalSnapshotFlag flag to determine behavior.\n var snapshot = this.__reactInternalSnapshotFlag ? this.__reactInternalSnapshot : maybeSnapshot;\n componentDidUpdate.call(this, prevProps, prevState, snapshot);\n };\n }\n return Component;\n}\nexport { polyfill };","import React from \"react\";\n\nexport const LineIcon = (props) => (\n \n);\n\nexport const SquareIcon = (props) => (\n \n);\n\nexport const GrupoAbertoIcon = (props) => (\n \n);\n\nexport const EyeIcon = (props) => (\n \n);\n\nexport const CheckDownIcon = (props) => (\n \n);\n\nexport const ShareIcon = (props) => (\n \n);\n\nexport const InterrogationIcon = (props) => (\n \n);","import $bdjGp$base64js from \"base64-js\";\nimport $bdjGp$unicodetrie from \"unicode-trie\";\nfunction $parcel$interopDefault(a) {\n return a && a.__esModule ? a.default : a;\n}\nvar $f4087201da764553$exports = {};\n$f4087201da764553$exports = JSON.parse('{\"categories\":[\"Cc\",\"Zs\",\"Po\",\"Sc\",\"Ps\",\"Pe\",\"Sm\",\"Pd\",\"Nd\",\"Lu\",\"Sk\",\"Pc\",\"Ll\",\"So\",\"Lo\",\"Pi\",\"Cf\",\"No\",\"Pf\",\"Lt\",\"Lm\",\"Mn\",\"Me\",\"Mc\",\"Nl\",\"Zl\",\"Zp\",\"Cs\",\"Co\"],\"combiningClasses\":[\"Not_Reordered\",\"Above\",\"Above_Right\",\"Below\",\"Attached_Above_Right\",\"Attached_Below\",\"Overlay\",\"Iota_Subscript\",\"Double_Below\",\"Double_Above\",\"Below_Right\",\"Above_Left\",\"CCC10\",\"CCC11\",\"CCC12\",\"CCC13\",\"CCC14\",\"CCC15\",\"CCC16\",\"CCC17\",\"CCC18\",\"CCC19\",\"CCC20\",\"CCC21\",\"CCC22\",\"CCC23\",\"CCC24\",\"CCC25\",\"CCC30\",\"CCC31\",\"CCC32\",\"CCC27\",\"CCC28\",\"CCC29\",\"CCC33\",\"CCC34\",\"CCC35\",\"CCC36\",\"Nukta\",\"Virama\",\"CCC84\",\"CCC91\",\"CCC103\",\"CCC107\",\"CCC118\",\"CCC122\",\"CCC129\",\"CCC130\",\"CCC132\",\"Attached_Above\",\"Below_Left\",\"Left\",\"Kana_Voicing\",\"CCC26\",\"Right\"],\"scripts\":[\"Common\",\"Latin\",\"Bopomofo\",\"Inherited\",\"Greek\",\"Coptic\",\"Cyrillic\",\"Armenian\",\"Hebrew\",\"Arabic\",\"Syriac\",\"Thaana\",\"Nko\",\"Samaritan\",\"Mandaic\",\"Devanagari\",\"Bengali\",\"Gurmukhi\",\"Gujarati\",\"Oriya\",\"Tamil\",\"Telugu\",\"Kannada\",\"Malayalam\",\"Sinhala\",\"Thai\",\"Lao\",\"Tibetan\",\"Myanmar\",\"Georgian\",\"Hangul\",\"Ethiopic\",\"Cherokee\",\"Canadian_Aboriginal\",\"Ogham\",\"Runic\",\"Tagalog\",\"Hanunoo\",\"Buhid\",\"Tagbanwa\",\"Khmer\",\"Mongolian\",\"Limbu\",\"Tai_Le\",\"New_Tai_Lue\",\"Buginese\",\"Tai_Tham\",\"Balinese\",\"Sundanese\",\"Batak\",\"Lepcha\",\"Ol_Chiki\",\"Braille\",\"Glagolitic\",\"Tifinagh\",\"Han\",\"Hiragana\",\"Katakana\",\"Yi\",\"Lisu\",\"Vai\",\"Bamum\",\"Syloti_Nagri\",\"Phags_Pa\",\"Saurashtra\",\"Kayah_Li\",\"Rejang\",\"Javanese\",\"Cham\",\"Tai_Viet\",\"Meetei_Mayek\",\"null\",\"Linear_B\",\"Lycian\",\"Carian\",\"Old_Italic\",\"Gothic\",\"Old_Permic\",\"Ugaritic\",\"Old_Persian\",\"Deseret\",\"Shavian\",\"Osmanya\",\"Osage\",\"Elbasan\",\"Caucasian_Albanian\",\"Linear_A\",\"Cypriot\",\"Imperial_Aramaic\",\"Palmyrene\",\"Nabataean\",\"Hatran\",\"Phoenician\",\"Lydian\",\"Meroitic_Hieroglyphs\",\"Meroitic_Cursive\",\"Kharoshthi\",\"Old_South_Arabian\",\"Old_North_Arabian\",\"Manichaean\",\"Avestan\",\"Inscriptional_Parthian\",\"Inscriptional_Pahlavi\",\"Psalter_Pahlavi\",\"Old_Turkic\",\"Old_Hungarian\",\"Hanifi_Rohingya\",\"Old_Sogdian\",\"Sogdian\",\"Elymaic\",\"Brahmi\",\"Kaithi\",\"Sora_Sompeng\",\"Chakma\",\"Mahajani\",\"Sharada\",\"Khojki\",\"Multani\",\"Khudawadi\",\"Grantha\",\"Newa\",\"Tirhuta\",\"Siddham\",\"Modi\",\"Takri\",\"Ahom\",\"Dogra\",\"Warang_Citi\",\"Nandinagari\",\"Zanabazar_Square\",\"Soyombo\",\"Pau_Cin_Hau\",\"Bhaiksuki\",\"Marchen\",\"Masaram_Gondi\",\"Gunjala_Gondi\",\"Makasar\",\"Cuneiform\",\"Egyptian_Hieroglyphs\",\"Anatolian_Hieroglyphs\",\"Mro\",\"Bassa_Vah\",\"Pahawh_Hmong\",\"Medefaidrin\",\"Miao\",\"Tangut\",\"Nushu\",\"Duployan\",\"SignWriting\",\"Nyiakeng_Puachue_Hmong\",\"Wancho\",\"Mende_Kikakui\",\"Adlam\"],\"eaw\":[\"N\",\"Na\",\"A\",\"W\",\"H\",\"F\"]}');\nconst $747425b437e121da$var$trie = new (0, $bdjGp$unicodetrie)((0, $bdjGp$base64js).toByteArray(\"AAARAAAAAADwfAEAZXl5ONRt+/5bPVFZimRfKoTQJNm37CGE7Iw0j3UsTWKsoyI7kwyyTiEUzSD7NiEzhWYijH0wMVkHE4Mx49fzfo+3nuP4/fdZjvv+XNd5n/d9nef1WZvmKhTxiZndzDQBSEYQqxqKwnsKvGQucFh+6t6cJ792ePQBZv5S9yXSwkyjf/P4T7mTNnIAv1dOVhMlR9lflbUL9JeJguqsjvG9NTj/wLb566VAURnLo2vvRi89S3gW/33ihh2eXpDn40BIW7REl/7coRKIhAFlAiOtbLDTt6mMb4GzMF1gNnvX/sBxtbsAIjfztCNcQjcNDtLThRvuXu5M5g/CBjaLBE4lJm4qy/oZD97+IJryApcXfgWYlkvWbhfXgujOJKVu8B+ozqTLbxyJ5kNiR75CxDqfBM9eOlDMmGeoZ0iQbbS5VUplIwI+ZNXEKQVJxlwqjhOY7w3XwPesbLK5JZE+Tt4X8q8km0dzInsPPzbscrjBMVjF5mOHSeRdJVgKUjLTHiHqXSPkep8N/zFk8167KLp75f6RndkvzdfB6Uz3MmqvRArzdCbs1/iRZjYPLLF3U8Qs+H+Rb8iK51a6NIV2V9+07uJsTGFWpPz8J++7iRu2B6eAKlK/kujrLthwaD/7a6J5w90TusnH1JMAc+gNrql4aspOUG/RrsxUKmPzhHgP4Bleru+6Vfc/MBjgXVx7who94nPn7MPFrnwQP7g0k0Dq0h2GSKO6fTZ8nLodN1SiOUj/5EL/Xo1DBvRm0wmrh3x6phcJ20/9CuMr5h8WPqXMSasLoLHoufTmE7mzYrs6B0dY7KjuCogKqsvxnxAwXWvd9Puc9PnE8DOHT2INHxRlIyVHrqZahtfV2E/A2PDdtA3ewlRHMtFIBKO/T4IozWTQZ+mb+gdKuk/ZHrqloucKdsOSJmlWTSntWjcxVMjUmroXLM10I6TwDLnBq4LP69TxgVeyGsd8yHvhF8ydPlrNRSNs9EP7WmeuSE7Lu10JbOuQcJw/63sDp68wB9iwP5AO+mBpV0R5VDDeyQUFCel1G+4KHBgEVFS0YK+m2sXLWLuGTlkVAd97WwKKdacjWElRCuDRauf33l/yVcDF6sVPKeTes99FC1NpNWcpieGSV/IbO8PCTy5pbUR1U8lxzf4T+y6fZMxOz3LshkQLeeDSd0WmUrQgajmbktrxsb2AZ0ACw2Vgni+gV/m+KvCRWLg08Clx7uhql+v9XySGcjjOHlsp8vBw/e8HS7dtiqF6T/XcSXuaMW66GF1g4q9YyBadHqy3Y5jin1c7yZos6BBr6dsomSHxiUHanYtcYQwnMMZhRhOnaYJeyJzaRuukyCUh48+e/BUvk/aEfDp8ag+jD64BHxNnQ5v/E7WRk7eLjGV13I3oqy45YNONi/1op1oDr7rPjkhPsTXgUpQtGDPlIs55KhQaic9kSGs/UrZ2QKQOflB8MTEQxRF9pullToWO7Eplan6mcMRFnUu2441yxi23x+KqKlr7RWWsi9ZXMWlr8vfP3llk1m2PRj0yudccxBuoa7VfIgRmnFPGX6Pm1WIfMm/Rm4n/xTn8IGqA0GWuqgu48pEUO0U9nN+ZdIvFpPb7VDPphIfRZxznlHeVFebkd9l+raXy9BpTMcIUIvBfgHEb6ndGo8VUkxpief14KjzFOcaANfgvFpvyY8lE8lE4raHizLpluPzMks1hx/e1Hok5yV0p7qQH7GaYeMzzZTFvRpv6k6iaJ4yNqzBvN8J7B430h2wFm1IBPcqbou33G7/NWPgopl4Mllla6e24L3TOTVNkza2zv3QKuDWTeDpClCEYgTQ+5vEBSQZs/rMF50+sm4jofTgWLqgX1x3TkrDEVaRqfY/xZizFZ3Y8/DFEFD31VSfBQ5raEB6nHnZh6ddehtclQJ8fBrldyIh99LNnV32HzKEej04hk6SYjdauCa4aYW0ru/QxvQRGzLKOAQszf3ixJypTW3WWL6BLSF2EMCMIw7OUvWBC6A/gDc2D1jvBapMCc7ztx6jYczwTKsRLL6dMNXb83HS8kdD0pTMMj161zbVHkU0mhSHo9SlBDDXdN6hDvRGizmohtIyR3ot8tF5iUG4GLNcXeGvBudSFrHu+bVZb9jirNVG+rQPI51A7Hu8/b0UeaIaZ4UgDO68PkYx3PE2HWpKapJ764Kxt5TFYpywMy4DLQqVRy11I7SOLhxUFmqiEK52NaijWArIfCg6qG8q5eSiwRCJb1R7GDJG74TrYgx/lVq7w9++Kh929xSJEaoSse5fUOQg9nMAnIZv+7fwVRcNv3gOHI46Vb5jYUC66PYHO6lS+TOmvEQjuYmx4RkffYGxqZIp/DPWNHAixbRBc+XKE3JEOgs4jIwu/dSAwhydruOGF39co91aTs85JJ3Z/LpXoF43hUwJsb/M1Chzdn8HX8vLXnqWUKvRhNLpfAF4PTFqva1sBQG0J+59HyYfmQ3oa4/sxZdapVLlo/fooxSXi/dOEQWIWq8E0FkttEyTFXR2aNMPINMIzZwCNEheYTVltsdaLkMyKoEUluPNAYCM2IG3br0DLy0fVNWKHtbSKbBjfiw7Lu06gQFalC7RC9BwRMSpLYDUo9pDtDfzwUiPJKLJ2LGcSphWBadOI/iJjNqUHV7ucG8yC6+iNM9QYElqBR7ECFXrcTgWQ3eG/tCWacT9bxIkfmxPmi3vOd36KxihAJA73vWNJ+Y9oapXNscVSVqS5g15xOWND/WuUCcA9YAAg6WFbjHamrblZ5c0L6Zx1X58ZittGcfDKU697QRSqW/g+RofNRyvrWMrBn44cPvkRe2HdTu/Cq01C5/riWPHZyXPKHuSDDdW8c1XPgd6ogvLh20qEIu8c19sqr4ufyHrwh37ZN5MkvY1dsGmEz9pUBTxWrvvhNyODyX2Q1k/fbX/T/vbHNcBrmjgDtvBdtZrVtiIg5iXQuzO/DEMvRX8Mi1zymSlt92BGILeKItjoShJXE/H7xwnf0Iewb8BFieJ9MflEBCQYEDm8eZniiEPfGoaYiiEdhQxHQNr2AuRdmbL9mcl18Kumh+HEZLp6z+j35ML9zTbUwahUZCyQQOgQrGfdfQtaR/OYJ/9dYXb2TWZFMijfCA8Nov4sa5FFDUe1T68h4q08WDE7JbbDiej4utRMR9ontevxlXv6LuJTXt1YEv8bDzEt683PuSsIN0afvu0rcBu9AbXZbkOG3K3AhtqQ28N23lXm7S3Yn6KXmAhBhz+GeorJJ4XxO/b3vZk2LXp42+QvsVxGSNVpfSctIFMTR1bD9t70i6sfNF3WKz/uKDEDCpzzztwhL45lsw89H2IpWN10sXHRlhDse9KCdpP5qNNpU84cTY+aiqswqR8XZ9ea0KbVRwRuOGQU3csAtV2fSbnq47U6es6rKlWLWhg3s/B9C9g+oTyp6RtIldR51OOkP5/6nSy6itUVPcMNOp4M/hDdKOz3uK6srbdxOrc2cJgr1Sg02oBxxSky6V7JaG+ziNwlfqnjnvh2/uq1lKfbp+qpwq/D/5OI5gkFl5CejKGxfc2YVJfGqc4E0x5e9PHK2ukbHNI7/RZV6LNe65apbTGjoCaQls0txPPbmQbCQn+/upCoXRZy9yzorWJvZ0KWcbXlBxU/d5I4ERUTxMuVWhSMmF677LNN7NnLwsmKawXkCgbrpcluOl0WChR1qhtSrxGXHu251dEItYhYX3snvn1gS2uXuzdTxCJjZtjsip0iT2sDC0qMS7Bk9su2NyXjFK5/f5ZoWwofg3DtTyjaFqspnOOTSh8xK/CKUFS57guVEkw9xoQuRCwwEO9Lu9z2vYxSa9NFV8DvSxv2C4WYLYF8Nrc4DzWkzNsk81JJOlZ/LYJrGCoj4MmZpnf3AXmzxT4rtl9jsqljEyedz468SGKdBiQzyz/qWKEhFg45ZczlZZ3KGL3l6sn+3TTa3zMVMhPa1obGp/z+fvY0QXTrJTf1XAT3EtQdUfYYlmWZyvPZ/6rWwU7UOQei7pVE0osgN94Iy+T1+omE6z4Rh2O20FjgBeK2y1mcoFiMDOJvuZPn5Moy9fmFH3wyfKvn4+TwfLvt/lHTTVnvrtoUWRBiQXhiNM8nE6ZoWeux/Z0b2unRcdUzdDpmL7CAgd1ToRXwgmHTZOgiGtVT+xr1QH9ObebRTT4NzL+XSpLuuWp62GqQvJVTPoZOeJCb6gIwd9XHMftQ+Kc08IKKdKQANSJ1a2gve3JdRhO0+tNiYzWAZfd7isoeBu67W7xuK8WX7nhJURld98Inb0t/dWOSau/kDvV4DJo/cImw9AO2Gvq0F2n0M7yIZKL8amMbjYld+qFls7hq8Acvq97K2PrCaomuUiesu7qNanGupEl6J/iem8lyr/NMnsTr6o41PO0yhQh3hPFN0wJP7S830je9iTBLzUNgYH+gUZpROo3rN2qgCI+6GewpX8w8CH+ro6QrWiStqmcMzVa3vEel+3/dDxMp0rDv1Q6wTMS3K64zTT6RWzK1y643im25Ja7X2ePCV2mTswd/4jshZPo4bLnerqIosq/hy2bKUAmVn9n4oun1+a0DIZ56UhVwmZHdUNpLa8gmPvxS1eNvCF1T0wo1wKPdCJi0qOrWz7oYRTzgTtkzEzZn308XSLwUog4OWGKJzCn/3FfF9iA32dZHSv30pRCM3KBY9WZoRhtdK/ChHk6DEQBsfV6tN2o1Cn0mLtPBfnkS+qy1L2xfFe9TQPtDE1Be44RTl82E9hPT2rS2+93LFbzhQQO3C/hD2jRFH3BWWbasAfuMhRJFcTri73eE835y016s22DjoFJ862WvLj69fu2TgSF3RHia9D5DSitlQAXYCnbdqjPkR287Lh6dCHDapos+eFDvcZPP2edPmTFxznJE/EBLoQQ0Qmn9EkZOyJmHxMbvKYb8o21ZHmv5YLqgsEPk9gWZwYQY9wLqGXuax/8QlV5qDaPbq9pLPT1yp+zOWKmraEy1OUJI7zdEcEmvBpbdwLrDCgEb2xX8S/nxZgjK4bRi+pbOmbh8bEeoPvU/L9ndx9kntlDALbdAvp0O8ZC3zSUnFg4cePsw7jxewWvL7HRSBLUn6J7vTH9uld5N76JFPgBCdXGF221oEJk++XfRwXplLSyrVO7HFWBEs99nTazKveW3HpbD4dH/YmdAl+lwbSt8BQWyTG7jAsACI7bPPUU9hI9XUHWqQOuezHzUjnx5Qqs6T1qNHfTTHleDtmqK7flA9a0gz2nycIpz1FHBuWxKNtUeTdqP29Fb3tv+tl5JyBqXoR+vCsdzZwZUhf6Lu8bvkB9yQP4x7GGegB0ym0Lpl03Q7e+C0cDsm9GSDepCDji7nUslLyYyluPfvLyKaDSX4xpR+nVYQjQQn5F8KbY1gbIVLiK1J3mW90zTyR1bqApX2BlWh7KG8LAY9/S9nWC0XXh9pZZo6xuir12T43rkaGfQssbQyIslA7uJnSHOV22NhlNtUo0czxPAsXhh8tIQYaTM4l/yAlZlydTcXhlG22Gs/n3BxKBd/3ZjYwg3NaUurVXhNB+afVnFfNr9TbC9ksNdvwpNfeHanyJ8M6GrIVfLlYAPv0ILe4dn0Z+BJSbJkN7eZY/c6+6ttDYcIDeUKIDXqUSE42Xdh5nRbuaObozjht0HJ5H1e+em+NJi/+8kQlyjCbJpPckwThZeIF9/u7lrVIKNeJLCN/TpPAeXxvd31/CUDWHK9MuP1V1TJgngzi4V0qzS3SW3Qy5UiGHqg02wQa5tsEl9s/X9nNMosgLlUgZSfCBj1DiypLfhr9/r0nR0XY2tmhDOcUS4E7cqa4EJBhzqvpbZa35Q5Iz5EqmhYiOGDAYk606Tv74+KGfPjKVuP15rIzgW0I7/niOu9el/sn2bRye0gV+GrePDRDMHjwO1lEdeXH8N+UTO3IoN18kpI3tPxz+fY+n2MGMSGFHAx/83tKeJOl+2i+f1O9v6FfEDBbqrw+lpM8Anav7zHNr7hE78nXUtPNodMbCnITWA7Ma/IHlZ50F9hWge/wzOvSbtqFVFtkS8Of2nssjZwbSFdU+VO8z6tCEc9UA9ACxT5zIUeSrkBB/v1krOpm7bVMrGxEKfI6LcnpB4D8bvn2hDKGqKrJaVAJuDaBEY3F7eXyqnFWlOoFV/8ZLspZiZd7orXLhd4mhHQgbuKbHjJWUzrnm0Dxw/LJLzXCkh7slMxKo8uxZIWZfdKHlfI7uj3LP6ARAuWdF7ZmZ7daOKqKGbz5LxOggTgS39oEioYmrqkCeUDvbxkBYKeHhcLmMN8dMF01ZMb32IpL/cH8R7VHQSI5I0YfL14g9d7P/6cjB1JXXxbozEDbsrPdmL8ph7QW10jio+v7YsqHKQ6xrBbOVtxU0/nFfzUGZwIBLwyUvg49ii+54nv9FyECBpURnQK4Ox6N7lw5fsjdd5l/2SwBcAHMJoyjO1Pifye2dagaOwCVMqdJWAo77pvBe0zdJcTWu5fdzPNfV2p1pc7/JKQ8zhKkwsOELUDhXygPJ5oR8Vpk2lsCen3D3QOQp2zdrSZHjVBstDF/wWO98rrkQ6/7zt/Drip7OHIug1lomNdmRaHRrjmqeodn22sesQQPgzimPOMqC60a5+i/UYh51uZm+ijWkkaI2xjrBO2558DZNZMiuDQlaVAvBy2wLn/bR3FrNzfnO/9oDztYqxZrr7JMIhqmrochbqmQnKowxW29bpqTaJu7kW1VotC72QkYX8OoDDdMDwV1kJRk3mufgJBzf+iwFRJ7XWQwO5ujVglgFgHtycWiMLx5N+6XU+TulLabWjOzoao03fniUW0xvIJNPbk7CQlFZd/RCOPvgQbLjh5ITE8NVJeKt3HGr6JTnFdIzcVOlEtwqbIIX0IM7saC+4N5047MTJ9+Wn11EhyEPIlwsHE5utCeXRjQzlrR+R1Cf/qDzcNbqLXdk3J7gQ39VUrrEkS/VMWjjg+t2oYrqB0tUZClcUF6+LBC3EQ7KnGIwm/qjZX4GKPtjTX1zQKV6nPAb2t/Rza5IqKRf8i2DFEhV/YSifX0YwsiF6TQnp48Gr65TFq0zUe6LGjiY7fq0LSGKL1VnC6ESI2yxvt3XqBx53B3gSlGFeJcPbUbonW1E9E9m4NfuwPh+t5QjRxX34lvBPVxwQd7aeTd+r9dw5CiP1pt8wMZoMdni7GapYdo6KPgeQKcmlFfq4UYhvV0IBgeiR3RnTMBaqDqpZrTRyLdsp4l0IXZTdErfH0sN3dqBG5vRIx3VgCYcHmmkqJ8Hyu3s9K9uBD1d8cZUEx3qYcF5vsqeRpF1GOg8emeWM2OmBlWPdZ6qAXwm3nENFyh+kvXk132PfWAlN0kb7yh4fz2T7VWUY/hEXX5DvxGABC03XRpyOG8t/u3Gh5tZdpsSV9AWaxJN7zwhVglgII1gV28tUViyqn4UMdIh5t+Ea2zo7PO48oba0TwQbiSZOH4YhD578kPF3reuaP7LujPMsjHmaDuId9XEaZBCJhbXJbRg5VCk3KJpryH/+8S3wdhR47pdFcmpZG2p0Bpjp/VbvalgIZMllYX5L31aMPdt1J7r/7wbixt0Mnz2ZvNGTARHPVD+2O1D8SGpWXlVnP2ekgon55YiinADDynyaXtZDXueVqbuTi8z8cHHK325pgqM+mWZwzHeEreMvhZopAScXM14SJHpGwZyRljMlDvcMm9FZ/1e9+r/puOnpXOtc9Iu2fmgBfEP9cGW1Fzb1rGlfJ08pACtq1ZW18bf2cevebzVeHbaA50G9qoUp39JWdPHbYkPCRXjt4gzlq3Cxge28Mky8MoS/+On72kc+ZI2xBtgJytpAQHQ1zrEddMIVyR5urX6yBNu8v5lKC8eLdGKTJtbgIZ3ZyTzSfWmx9f+cvcJe8yM39K/djkp2aUTE/9m2Lj5jg7b8vdRAer7DO3SyLNHs1CAm5x5iAdh2yGJYivArZbCBNY88Tw+w+C1Tbt7wK3zl2rzTHo/D8/gb3c3mYrnEIEipYqPUcdWjnTsSw471O3EUN7Gtg4NOAs9PJrxm03VuZKa5xwXAYCjt7Gs01Km6T2DhOYUMoFcCSu7Hk1p3yP1eG+M3v3Q5luAze6WwBnZIYO0TCucPWK+UJ36KoJ8Y+vpavhLO8g5ed704IjlQdfemrMu//EvPYXTQSGIPPfiagJS9nMqP5IvkxN9pvuJz7h8carPXTKMq8jnTeL0STan6dnLTAqwIswcIwWDR2KwbGddAVN8SYWRB7kfBfBRkSXzvHlIF8D6jo64kUzYk5o/n8oLjKqat0rdXvQ86MkwQGMnnlcasqPPT2+mVtUGb32KuH6cyZQenrRG11TArcAl27+nvOMBDe++EKHf4YdyGf7mznzOz33cFFGEcv329p4qG2hoaQ8ULiMyVz6ENcxhoqGnFIdupcn7GICQWuw3yO3W8S33mzCcMYJ8ywc7U7rmaQf/W5K63Gr4bVTpXOyOp4tbaPyIaatBNpXqlmQUTSZXjxPr19+73PSaT+QnI35YsWn6WpfJjRtK8vlJZoTSgjaRU39AGCkWOZtifJrnefCrqwTKDFmuWUCukEsYcRrMzCoit28wYpP7kSVjMD8WJYQiNc2blMjuqYegmf6SsfC1jqz8XzghMlOX+gn/MKZmgljszrmehEa4V98VreJDxYvHr3j7IeJB9/sBZV41BWT/AZAjuC5XorlIPnZgBAniBEhanp0/0+qZmEWDpu8ige1hUPIyTo6T6gDEcFhWSoduNh8YSu65KgMOGBw7VlNYzNIgwHtq9KP2yyTVysqX5v12sf7D+vQUdR2dRDvCV40rIInXSLWT/yrC6ExOQxBJwIDbeZcl3z1yR5Rj3l8IGpxspapnvBL+fwupA3b6fkFceID9wgiM1ILB0cHVdvo/R4xg8yqKXT8efl0GnGX1/27FUYeUW2L/GNRGGWVGp3i91oaJkb4rybENHre9a2P5viz/yqk8ngWUUS+Kv+fu+9BLFnfLiLXOFcIeBJLhnayCiuDRSqcx0Qu68gVsGYc6EHD500Fkt+gpDj6gvr884n8wZ5o6q7xtL5wA0beXQnffWYkZrs2NGIRgQbsc5NB302SVx+R4ROvmgZaR8wBcji128BMfJ9kcvJ4DC+bQ57kRmv5yxgU4ngZfn0/JNZ8JBwxjTqS+s9kjJFG1unGUGLwMiIuXUD9EFhNIJuyCEAmVZSIGKH4G6v1gRR1LyzQKH2ZqiI1DnHMoDEZspbDjTeaFIAbSvjSq3A+n46y9hhVM8wIpnARSXyzmOD96d9UXvFroSPgGw1dq2vdEqDq9fJN1EbL2WulNmHkFDvxSO9ZT/RX/Bw2gA/BrF90XrJACereVfbV/YXaKfp77Nmx5NjEIUlxojsy7iN7nBHSZigfsbFyVOX1ZTeCCxvqnRSExP4lk5ZeYlRu9caaa743TWNdchRIhEWwadsBIe245C8clpaZ4zrPsk+OwXzxWCvRRumyNSLW5KWaSJyJU95cwheK76gr7228spZ3hmTtLyrfM2QRFqZFMR8/Q6yWfVgwTdfX2Ry4w3+eAO/5VT5nFb5NlzXPvBEAWrNZ6Q3jbH0RF4vcbp+fDngf/ywpoyNQtjrfvcq93AVb1RDWRghvyqgI2BkMr1rwYi8gizZ0G9GmPpMeqPerAQ0dJbzx+KAFM4IBq6iSLpZHUroeyfd9o5o+4fR2EtsZBoJORQEA4SW0CmeXSnblx2e9QkCHIodyqV6+g5ETEpZsLqnd/Na60EKPX/tQpPEcO+COIBPcQdszDzSiHGyQFPly/7KciUh1u+mFfxTCHGv9nn2WqndGgeGjQ/kr02qmTBX7Hc1qiEvgiSz1Tz/sy7Es29wvn6FrDGPP7asXlhOaiHxOctPvTptFA1kHFUk8bME7SsTSnGbFbUrssxrq70LhoSh5OwvQna+w84XdXhZb2sloJ4ZsCg3j+PrjJL08/JBi5zGd6ud/ZxhmcGKLOXPcNunQq5ESW92iJvfsuRrNYtawWwSmNhPYoFj2QqWNF0ffLpGt/ad24RJ8vkb5sXkpyKXmvFG5Vcdzf/44k3PBL/ojJ52+kWGzOArnyp5f969oV3J2c4Li27Nkova9VwRNVKqN0V+gV+mTHitgkXV30aWd3A1RSildEleiNPA+5cp+3+T7X+xfHiRZXQ1s4FA9TxIcnveQs9JSZ5r5qNmgqlW4zMtZ6rYNvgmyVcywKtu8ZxnSbS5vXlBV+NXdIfi3+xzrnJ0TkFL+Un8v1PWOC2PPFCjVPq7qTH7mOpzOYj/b4h0ceT+eHgr97Jqhb1ziVfeANzfN8bFUhPKBi7hJBCukQnB0aGjFTYLJPXL26lQ2b80xrOD5cFWgA8hz3St0e69kwNnD3+nX3gy12FjrjO+ddRvvvfyV3SWbXcxqNHfmsb9u1TV+wHTb9B07/L2sB8WUHJ9eeNomDyysEWZ0deqEhH/oWI2oiEh526gvAK1Nx2kIhNvkYR+tPYHEa9j+nd1VBpQP1uzSjIDO+fDDB7uy029rRjDC5Sk6aKczyz1D5uA9Lu+Rrrapl8JXNL3VRllNQH2K1ZFxOpX8LprttfqQ56MbPM0IttUheXWD/mROOeFqGUbL+kUOVlXLTFX/525g4faLEFO4qWWdmOXMNvVjpIVTWt650HfQjX9oT3Dg5Au6+v1/Ci78La6ZOngYCFPT1AUwxQuZ0yt5xKdNXLaDTISMTeCj16XTryhM36K2mfGRIgot71voWs8tTpL/f1rvcwv3LSDf+/G8THCT7NpfHWcW+lsF/ol8q9Bi6MezNTqp0rpp/kJRiVfNrX/w27cRRTu8RIIqtUblBMkxy4jwAVqCjUJkiPBj2cAoVloG8B2/N5deLdMhDb7xs5nhd3dubJhuj8WbaFRyu1L678DHhhA+rMimNo4C1kGpp0tD/qnCfCFHejpf0LJX43OTr578PY0tnIIrlWyNYyuR/ie6j2xNb1OV6u0dOX/1Dtcd7+ya9W+rY2LmnyQMtk8SMLTon8RAdwOaN2tNg5zVnDKlmVeOxPV2vhHIo9QEPV7jc3f+zVDquiNg1OaHX3cZXJDRY5MJpo+VanAcmqp4oasYLG+wrXUL5vJU0kqk2hGEskhP+Jjigrz1l6QnEwp6n8PMVeJp70Ii6ppeaK9GhF6fJE00ceLyxv08tKiPat4QdxZFgSbQknnEiCLD8Qc1rjazVKM3r3gXnnMeONgdz/yFV1q+haaN+wnF3Fn4uYCI9XsKOuVwDD0LsCO/f0gj5cmxCFcr7sclIcefWjvore+3aSU474cyqDVxH7w1RX3CHsaqsMRX17ZLgjsDXws3kLm2XJdM3Ku383UXqaHqsywzPhx7NFir0Fqjym/w6cxD2U9ypa3dx7Z12w/fi3Jps8sqJ8f8Ah8aZAvkHXvIRyrsxK7rrFaNNdNvjI8+3Emri195DCNa858anj2Qdny6Czshkn4N2+1m+k5S8sunX3Ja7I+JutRzg1mc2e9Yc0Zv9PZn1SwhxIdU9sXwZRTd/J5FoUm0e+PYREeHg3oc2YYzGf2xfJxXExt4pT3RfDRHvMXLUmoXOy63xv5pLuhOEax0dRgSywZ/GH+YBXFgCeTU0hZ8SPEFsn8punp1Kurd1KgXxUZ+la3R5+4ePGR4ZF5UQtOa83+Vj8zh80dfzbhxWCeoJnQ4dkZJM4drzknZOOKx2n3WrvJnzFIS8p0xeic+M3ZRVXIp10tV2DyYKwRxLzulPwzHcLlYTxl4PF7v8l106Azr+6wBFejbq/3P72C/0j78cepY9990/d4eAurn2lqdGKLU8FffnMw7cY7pVeXJRMU73Oxwi2g2vh/+4gX8dvbjfojn/eLVhhYl8GthwCQ50KcZq4z2JeW5eeOnJWFQEnVxDoG459TaC4zXybECEoJ0V5q1tXrQbDMtUxeTV6Pdt1/zJuc7TJoV/9YZFWxUtCf6Ou3Vd/vR/vG0138hJQrHkNeoep5dLe+6umcSquKvMaFpm3EZHDBOvCi0XYyIFHMgX7Cqp3JVXlxJFwQfHSaIUEbI2u1lBVUdlNw4Qa9UsLPEK94Qiln3pyKxQVCeNlx8yd7EegVNQBkFLabKvnietYVB4IPZ1fSor82arbgYec8aSdFMaIluYTYuNx32SxfrjKUdPGq+UNp5YpydoEG3xVLixtmHO9zXxKAnHnPuH2fPGrjx0GcuCDEU+yXUtXh6nfUL+cykws1gJ5vkfYFaFBr9PdCXvVf35OJQxzUMmWjv0W6uGJK11uAGDqSpOwCf6rouSIjPVgw57cJCOQ4b9tkI/Y5WNon9Swe72aZryKo8d+HyHBEdWJKrkary0LIGczA4Irq353Wc0Zga3om7UQiAGCvIl8GGyaqz5zH+1gMP5phWUCpKtttWIyicz09vXg76GxkmiGSMQ06Z9X8BUwqOtauDbPIf4rpK/yYoeAHxJ9soXS9VDe1Aw+awOOxaN8foLrif0TXBvQ55dtRtulRq9emFDBxlQcqKCaD8NeTSE7FOHvcjf/+oKbbtRqz9gbofoc2EzQ3pL6W5JdfJzAWmOk8oeoECe90lVMruwl/ltM015P/zIPazqvdvFmLNVHMIZrwiQ2tIKtGh6PDVH+85ew3caqVt2BsDv5rOcu3G9srQWd7NmgtzCRUXLYknYRSwtH9oUtkqyN3CfP20xQ1faXQl4MEmjQehWR6GmGnkdpYNQYeIG408yAX7uCZmYUic9juOfb+Re28+OVOB+scYK4DaPcBe+5wmji9gymtkMpKo4UKqCz7yxzuN8VIlx9yNozpRJpNaWHtaZVEqP45n2JemTlYBSmNIK1FuSYAUQ1yBLnKxevrjayd+h2i8PjdB3YY6b0nr3JuOXGpPMyh4V2dslpR3DFEvgpsBLqhqLDOWP4yEvIL6f21PpA7/8B\"));\nconst $747425b437e121da$var$log2 = Math.log2 || (n => Math.log(n) / Math.LN2);\nconst $747425b437e121da$var$bits = n => $747425b437e121da$var$log2(n) + 1 | 0;\n// compute the number of bits stored for each field\nconst $747425b437e121da$var$CATEGORY_BITS = $747425b437e121da$var$bits((0, /*@__PURE__*/$parcel$interopDefault($f4087201da764553$exports)).categories.length - 1);\nconst $747425b437e121da$var$COMBINING_BITS = $747425b437e121da$var$bits((0, /*@__PURE__*/$parcel$interopDefault($f4087201da764553$exports)).combiningClasses.length - 1);\nconst $747425b437e121da$var$SCRIPT_BITS = $747425b437e121da$var$bits((0, /*@__PURE__*/$parcel$interopDefault($f4087201da764553$exports)).scripts.length - 1);\nconst $747425b437e121da$var$EAW_BITS = $747425b437e121da$var$bits((0, /*@__PURE__*/$parcel$interopDefault($f4087201da764553$exports)).eaw.length - 1);\nconst $747425b437e121da$var$NUMBER_BITS = 10;\n// compute shift and mask values for each field\nconst $747425b437e121da$var$CATEGORY_SHIFT = $747425b437e121da$var$COMBINING_BITS + $747425b437e121da$var$SCRIPT_BITS + $747425b437e121da$var$EAW_BITS + $747425b437e121da$var$NUMBER_BITS;\nconst $747425b437e121da$var$COMBINING_SHIFT = $747425b437e121da$var$SCRIPT_BITS + $747425b437e121da$var$EAW_BITS + $747425b437e121da$var$NUMBER_BITS;\nconst $747425b437e121da$var$SCRIPT_SHIFT = $747425b437e121da$var$EAW_BITS + $747425b437e121da$var$NUMBER_BITS;\nconst $747425b437e121da$var$EAW_SHIFT = $747425b437e121da$var$NUMBER_BITS;\nconst $747425b437e121da$var$CATEGORY_MASK = (1 << $747425b437e121da$var$CATEGORY_BITS) - 1;\nconst $747425b437e121da$var$COMBINING_MASK = (1 << $747425b437e121da$var$COMBINING_BITS) - 1;\nconst $747425b437e121da$var$SCRIPT_MASK = (1 << $747425b437e121da$var$SCRIPT_BITS) - 1;\nconst $747425b437e121da$var$EAW_MASK = (1 << $747425b437e121da$var$EAW_BITS) - 1;\nconst $747425b437e121da$var$NUMBER_MASK = (1 << $747425b437e121da$var$NUMBER_BITS) - 1;\nfunction $747425b437e121da$export$410364bbb673ddbc(codePoint) {\n const val = $747425b437e121da$var$trie.get(codePoint);\n return (0, /*@__PURE__*/$parcel$interopDefault($f4087201da764553$exports)).categories[val >> $747425b437e121da$var$CATEGORY_SHIFT & $747425b437e121da$var$CATEGORY_MASK];\n}\nfunction $747425b437e121da$export$c03b919c6651ed55(codePoint) {\n const val = $747425b437e121da$var$trie.get(codePoint);\n return (0, /*@__PURE__*/$parcel$interopDefault($f4087201da764553$exports)).combiningClasses[val >> $747425b437e121da$var$COMBINING_SHIFT & $747425b437e121da$var$COMBINING_MASK];\n}\nfunction $747425b437e121da$export$941569448d136665(codePoint) {\n const val = $747425b437e121da$var$trie.get(codePoint);\n return (0, /*@__PURE__*/$parcel$interopDefault($f4087201da764553$exports)).scripts[val >> $747425b437e121da$var$SCRIPT_SHIFT & $747425b437e121da$var$SCRIPT_MASK];\n}\nfunction $747425b437e121da$export$92f6187db8ca6d26(codePoint) {\n const val = $747425b437e121da$var$trie.get(codePoint);\n return (0, /*@__PURE__*/$parcel$interopDefault($f4087201da764553$exports)).eaw[val >> $747425b437e121da$var$EAW_SHIFT & $747425b437e121da$var$EAW_MASK];\n}\nfunction $747425b437e121da$export$7d1258ebb7625a0d(codePoint) {\n let val = $747425b437e121da$var$trie.get(codePoint);\n let num = val & $747425b437e121da$var$NUMBER_MASK;\n if (num === 0) return null;else if (num <= 50) return num - 1;else if (num < 0x1e0) {\n const numerator = (num >> 4) - 12;\n const denominator = (num & 0xf) + 1;\n return numerator / denominator;\n } else if (num < 0x300) {\n val = (num >> 5) - 14;\n let exp = (num & 0x1f) + 2;\n while (exp > 0) {\n val *= 10;\n exp--;\n }\n return val;\n } else {\n val = (num >> 2) - 0xbf;\n let exp = (num & 3) + 1;\n while (exp > 0) {\n val *= 60;\n exp--;\n }\n return val;\n }\n}\nfunction $747425b437e121da$export$52c8ea63abd07594(codePoint) {\n const category = $747425b437e121da$export$410364bbb673ddbc(codePoint);\n return category === \"Lu\" || category === \"Ll\" || category === \"Lt\" || category === \"Lm\" || category === \"Lo\" || category === \"Nl\";\n}\nfunction $747425b437e121da$export$727d9dbc4fbb948f(codePoint) {\n return $747425b437e121da$export$410364bbb673ddbc(codePoint) === \"Nd\";\n}\nfunction $747425b437e121da$export$a5b49f4dc6a07d2c(codePoint) {\n const category = $747425b437e121da$export$410364bbb673ddbc(codePoint);\n return category === \"Pc\" || category === \"Pd\" || category === \"Pe\" || category === \"Pf\" || category === \"Pi\" || category === \"Po\" || category === \"Ps\";\n}\nfunction $747425b437e121da$export$7b6804e8df61fcf5(codePoint) {\n return $747425b437e121da$export$410364bbb673ddbc(codePoint) === \"Ll\";\n}\nfunction $747425b437e121da$export$aebd617640818cda(codePoint) {\n return $747425b437e121da$export$410364bbb673ddbc(codePoint) === \"Lu\";\n}\nfunction $747425b437e121da$export$de8b4ee23b2cf823(codePoint) {\n return $747425b437e121da$export$410364bbb673ddbc(codePoint) === \"Lt\";\n}\nfunction $747425b437e121da$export$3c52dd84024ae72c(codePoint) {\n const category = $747425b437e121da$export$410364bbb673ddbc(codePoint);\n return category === \"Zs\" || category === \"Zl\" || category === \"Zp\";\n}\nfunction $747425b437e121da$export$a11bdcffe109e74b(codePoint) {\n const category = $747425b437e121da$export$410364bbb673ddbc(codePoint);\n return category === \"Nd\" || category === \"No\" || category === \"Nl\" || category === \"Lu\" || category === \"Ll\" || category === \"Lt\" || category === \"Lm\" || category === \"Lo\" || category === \"Me\" || category === \"Mc\";\n}\nfunction $747425b437e121da$export$e33ad6871e762338(codePoint) {\n const category = $747425b437e121da$export$410364bbb673ddbc(codePoint);\n return category === \"Mn\" || category === \"Me\" || category === \"Mc\";\n}\nvar\n// Backwards compatibility.\n$747425b437e121da$export$2e2bcd8739ae039 = {\n getCategory: $747425b437e121da$export$410364bbb673ddbc,\n getCombiningClass: $747425b437e121da$export$c03b919c6651ed55,\n getScript: $747425b437e121da$export$941569448d136665,\n getEastAsianWidth: $747425b437e121da$export$92f6187db8ca6d26,\n getNumericValue: $747425b437e121da$export$7d1258ebb7625a0d,\n isAlphabetic: $747425b437e121da$export$52c8ea63abd07594,\n isDigit: $747425b437e121da$export$727d9dbc4fbb948f,\n isPunctuation: $747425b437e121da$export$a5b49f4dc6a07d2c,\n isLowerCase: $747425b437e121da$export$7b6804e8df61fcf5,\n isUpperCase: $747425b437e121da$export$aebd617640818cda,\n isTitleCase: $747425b437e121da$export$de8b4ee23b2cf823,\n isWhiteSpace: $747425b437e121da$export$3c52dd84024ae72c,\n isBaseForm: $747425b437e121da$export$a11bdcffe109e74b,\n isMark: $747425b437e121da$export$e33ad6871e762338\n};\nexport { $747425b437e121da$export$410364bbb673ddbc as getCategory, $747425b437e121da$export$c03b919c6651ed55 as getCombiningClass, $747425b437e121da$export$941569448d136665 as getScript, $747425b437e121da$export$92f6187db8ca6d26 as getEastAsianWidth, $747425b437e121da$export$7d1258ebb7625a0d as getNumericValue, $747425b437e121da$export$52c8ea63abd07594 as isAlphabetic, $747425b437e121da$export$727d9dbc4fbb948f as isDigit, $747425b437e121da$export$a5b49f4dc6a07d2c as isPunctuation, $747425b437e121da$export$7b6804e8df61fcf5 as isLowerCase, $747425b437e121da$export$aebd617640818cda as isUpperCase, $747425b437e121da$export$de8b4ee23b2cf823 as isTitleCase, $747425b437e121da$export$3c52dd84024ae72c as isWhiteSpace, $747425b437e121da$export$a11bdcffe109e74b as isBaseForm, $747425b437e121da$export$e33ad6871e762338 as isMark, $747425b437e121da$export$2e2bcd8739ae039 as default };","let Between = {\n results:[],\n string:\"\",\n Between:function (sub1,sub2) {\n if(this.string.indexOf(sub1) < 0 || this.string.indexOf(sub2) < 0) return false;\n var SP = this.string.indexOf(sub1)+sub1.length;\n var string1 = this.string.substr(0,SP);\n var string2 = this.string.substr(SP);\n var TP = string1.length + string2.indexOf(sub2);\n return this.string.substring(SP,TP);\n },\n removeFromBetween:function (sub1,sub2) {\n if(this.string.indexOf(sub1) < 0 || this.string.indexOf(sub2) < 0) return false;\n var removal = sub1+this.Between(sub1,sub2)+sub2;\n this.string = this.string.replace(removal,\"\");\n },\n getAllResults:function (sub1,sub2) {\n // first check to see if we do have both substrings\n if(this.string.indexOf(sub1) < 0 || this.string.indexOf(sub2) < 0) return;\n\n // find one result\n var result = this.Between(sub1,sub2);\n // push it to the results array\n this.results.push(result);\n // remove the most recently found one from the string\n this.removeFromBetween(sub1,sub2);\n\n // if there's more substrings\n if(this.string.indexOf(sub1) > -1 && this.string.indexOf(sub2) > -1) {\n this.getAllResults(sub1,sub2);\n }\n else return;\n },\n get:function (string,sub1,sub2) {\n this.results = [];\n this.string = string;\n this.getAllResults(sub1,sub2);\n return this.results;\n }\n};\nexport default Between;","import styled, {css} from \"styled-components\";\nimport React from \"react\";\n\n\nexport const RoundButton = styled.div` \n width: 32px;\n height: 33.4px;\n flex-grow: 0;\n margin: 1.1px 4px 0.7px;\n padding: 0;\n border-radius: 19px;\n display: flex;\n justify-content: center;\n align-items: center;\n color: white; \n cursor: pointer;\n`\n\nexport const Separator = styled.div`\n width: 10px;\n`;\n\nexport const Row = css`\n display: flex;\n align-items: center;\n`\n\nexport const TableStyles = styled.table`\n width: 100%;\n border-spacing: 0 10px;\n`;\n\nexport const Tr = styled.tr`\n td {\n border-top: 1px solid transparent;\n border-bottom: 1px solid #e5e5e5;\n\n &:first-child {\n border-left: 1px solid #e5e5e5;\n border-top-left-radius: 6px;\n border-bottom-left-radius: 6px;\n }\n\n &:last-child {\n border-top-right-radius: 6px;\n border-bottom-right-radius: 6px;\n border-left: 1px solid #cfc8c8;\n }\n }\n\n ${({ white, theme }) =>\n white\n ? {\n \"&:nth-child(odd)\": {\n backgroundColor: white,\n },\n }\n : null}\n`;\n\nexport const ThStyled = styled.th`\n text-align: left;\n font-size: 1.1rem;\n font-weight: bold;\n font-stretch: normal;\n font-style: normal;\n line-height: normal;\n letter-spacing: 0.55px;\n white-space: nowrap;\n color: ${({ theme }) => theme.blueLight};\n padding-left: 2rem;\n`;\n\nconst TdStyled = styled.td`\n background-color: rgba(248, 248, 248, 0.5);\n color: #424242;\n padding-left: 2rem;\n font-size: 12px;\n font-weight: 400;\n font-stretch: normal;\n font-style: normal;\n line-height: normal;\n letter-spacing: 0.05rem;\n`;\n\nconst Cell = styled.div`\n ${Row};\n`;\n\nexport const Td = ({ children, ...props }) => {\n return (\n \n {props.showIcon && }\n\n {open && (\n \n )}\n
\n );\n}\n","import _Object$assign from \"core-js/library/fn/object/assign.js\";\nexport default function _extends() {\n _extends = _Object$assign ? _Object$assign.bind() : function (target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i];\n for (var key in source) {\n if (Object.prototype.hasOwnProperty.call(source, key)) {\n target[key] = source[key];\n }\n }\n }\n return target;\n };\n return _extends.apply(this, arguments);\n}","import { useState, useRef, useEffect } from 'react';\nfunction areInputsEqual(newInputs, lastInputs) {\n if (newInputs.length !== lastInputs.length) {\n return false;\n }\n for (var i = 0; i < newInputs.length; i++) {\n if (newInputs[i] !== lastInputs[i]) {\n return false;\n }\n }\n return true;\n}\nfunction useMemoOne(getResult, inputs) {\n var initial = useState(function () {\n return {\n inputs: inputs,\n result: getResult()\n };\n })[0];\n var isFirstRun = useRef(true);\n var committed = useRef(initial);\n var useCache = isFirstRun.current || Boolean(inputs && committed.current.inputs && areInputsEqual(inputs, committed.current.inputs));\n var cache = useCache ? committed.current : {\n inputs: inputs,\n result: getResult()\n };\n useEffect(function () {\n isFirstRun.current = false;\n committed.current = cache;\n }, [cache]);\n return cache.result;\n}\nfunction useCallbackOne(callback, inputs) {\n return useMemoOne(function () {\n return callback;\n }, inputs);\n}\nvar useMemo = useMemoOne;\nvar useCallback = useCallbackOne;\nexport { useCallback, useCallbackOne, useMemo, useMemoOne };","import _Object$setPrototypeOf from \"core-js/library/fn/object/set-prototype-of.js\";\nexport default function _setPrototypeOf(o, p) {\n _setPrototypeOf = _Object$setPrototypeOf ? _Object$setPrototypeOf.bind() : function _setPrototypeOf(o, p) {\n o.__proto__ = p;\n return o;\n };\n return _setPrototypeOf(o, p);\n}","import _Object$create from \"core-js/library/fn/object/create.js\";\nimport setPrototypeOf from \"./setPrototypeOf.js\";\nexport default function _inheritsLoose(subClass, superClass) {\n subClass.prototype = _Object$create(superClass.prototype);\n subClass.prototype.constructor = subClass;\n setPrototypeOf(subClass, superClass);\n}","var isProduction = process.env.NODE_ENV === 'production';\nvar prefix = 'Invariant failed';\nfunction invariant(condition, message) {\n if (condition) {\n return;\n }\n if (isProduction) {\n throw new Error(prefix);\n }\n var provided = typeof message === 'function' ? message() : message;\n var value = provided ? \"\".concat(prefix, \": \").concat(provided) : prefix;\n throw new Error(value);\n}\nexport { invariant as default };","import _objectSpread from '@babel/runtime/helpers/esm/objectSpread2';\n\n/**\n * Adapted from React: https://github.com/facebook/react/blob/master/packages/shared/formatProdErrorMessage.js\n *\n * Do not require this module directly! Use normal throw error calls. These messages will be replaced with error codes\n * during build.\n * @param {number} code\n */\nfunction formatProdErrorMessage(code) {\n return \"Minified Redux error #\" + code + \"; visit https://redux.js.org/Errors?code=\" + code + \" for the full message or \" + 'use the non-minified dev environment for full errors. ';\n}\n\n// Inlined version of the `symbol-observable` polyfill\nvar $$observable = function () {\n return typeof Symbol === 'function' && Symbol.observable || '@@observable';\n}();\n\n/**\n * These are private action types reserved by Redux.\n * For any unknown actions, you must return the current state.\n * If the current state is undefined, you must return the initial state.\n * Do not reference these action types directly in your code.\n */\nvar randomString = function randomString() {\n return Math.random().toString(36).substring(7).split('').join('.');\n};\nvar ActionTypes = {\n INIT: \"@@redux/INIT\" + randomString(),\n REPLACE: \"@@redux/REPLACE\" + randomString(),\n PROBE_UNKNOWN_ACTION: function PROBE_UNKNOWN_ACTION() {\n return \"@@redux/PROBE_UNKNOWN_ACTION\" + randomString();\n }\n};\n\n/**\n * @param {any} obj The object to inspect.\n * @returns {boolean} True if the argument appears to be a plain object.\n */\nfunction isPlainObject(obj) {\n if (typeof obj !== 'object' || obj === null) return false;\n var proto = obj;\n while (Object.getPrototypeOf(proto) !== null) {\n proto = Object.getPrototypeOf(proto);\n }\n return Object.getPrototypeOf(obj) === proto;\n}\n\n// Inlined / shortened version of `kindOf` from https://github.com/jonschlinkert/kind-of\nfunction miniKindOf(val) {\n if (val === void 0) return 'undefined';\n if (val === null) return 'null';\n var type = typeof val;\n switch (type) {\n case 'boolean':\n case 'string':\n case 'number':\n case 'symbol':\n case 'function':\n {\n return type;\n }\n }\n if (Array.isArray(val)) return 'array';\n if (isDate(val)) return 'date';\n if (isError(val)) return 'error';\n var constructorName = ctorName(val);\n switch (constructorName) {\n case 'Symbol':\n case 'Promise':\n case 'WeakMap':\n case 'WeakSet':\n case 'Map':\n case 'Set':\n return constructorName;\n } // other\n\n return type.slice(8, -1).toLowerCase().replace(/\\s/g, '');\n}\nfunction ctorName(val) {\n return typeof val.constructor === 'function' ? val.constructor.name : null;\n}\nfunction isError(val) {\n return val instanceof Error || typeof val.message === 'string' && val.constructor && typeof val.constructor.stackTraceLimit === 'number';\n}\nfunction isDate(val) {\n if (val instanceof Date) return true;\n return typeof val.toDateString === 'function' && typeof val.getDate === 'function' && typeof val.setDate === 'function';\n}\nfunction kindOf(val) {\n var typeOfVal = typeof val;\n if (process.env.NODE_ENV !== 'production') {\n typeOfVal = miniKindOf(val);\n }\n return typeOfVal;\n}\n\n/**\n * @deprecated\n *\n * **We recommend using the `configureStore` method\n * of the `@reduxjs/toolkit` package**, which replaces `createStore`.\n *\n * Redux Toolkit is our recommended approach for writing Redux logic today,\n * including store setup, reducers, data fetching, and more.\n *\n * **For more details, please read this Redux docs page:**\n * **https://redux.js.org/introduction/why-rtk-is-redux-today**\n *\n * `configureStore` from Redux Toolkit is an improved version of `createStore` that\n * simplifies setup and helps avoid common bugs.\n *\n * You should not be using the `redux` core package by itself today, except for learning purposes.\n * The `createStore` method from the core `redux` package will not be removed, but we encourage\n * all users to migrate to using Redux Toolkit for all Redux code.\n *\n * If you want to use `createStore` without this visual deprecation warning, use\n * the `legacy_createStore` import instead:\n *\n * `import { legacy_createStore as createStore} from 'redux'`\n *\n */\n\nfunction createStore(reducer, preloadedState, enhancer) {\n var _ref2;\n if (typeof preloadedState === 'function' && typeof enhancer === 'function' || typeof enhancer === 'function' && typeof arguments[3] === 'function') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(0) : 'It looks like you are passing several store enhancers to ' + 'createStore(). This is not supported. Instead, compose them ' + 'together to a single function. See https://redux.js.org/tutorials/fundamentals/part-4-store#creating-a-store-with-enhancers for an example.');\n }\n if (typeof preloadedState === 'function' && typeof enhancer === 'undefined') {\n enhancer = preloadedState;\n preloadedState = undefined;\n }\n if (typeof enhancer !== 'undefined') {\n if (typeof enhancer !== 'function') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(1) : \"Expected the enhancer to be a function. Instead, received: '\" + kindOf(enhancer) + \"'\");\n }\n return enhancer(createStore)(reducer, preloadedState);\n }\n if (typeof reducer !== 'function') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(2) : \"Expected the root reducer to be a function. Instead, received: '\" + kindOf(reducer) + \"'\");\n }\n var currentReducer = reducer;\n var currentState = preloadedState;\n var currentListeners = [];\n var nextListeners = currentListeners;\n var isDispatching = false;\n /**\n * This makes a shallow copy of currentListeners so we can use\n * nextListeners as a temporary list while dispatching.\n *\n * This prevents any bugs around consumers calling\n * subscribe/unsubscribe in the middle of a dispatch.\n */\n\n function ensureCanMutateNextListeners() {\n if (nextListeners === currentListeners) {\n nextListeners = currentListeners.slice();\n }\n }\n /**\n * Reads the state tree managed by the store.\n *\n * @returns {any} The current state tree of your application.\n */\n\n function getState() {\n if (isDispatching) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(3) : 'You may not call store.getState() while the reducer is executing. ' + 'The reducer has already received the state as an argument. ' + 'Pass it down from the top reducer instead of reading it from the store.');\n }\n return currentState;\n }\n /**\n * Adds a change listener. It will be called any time an action is dispatched,\n * and some part of the state tree may potentially have changed. You may then\n * call `getState()` to read the current state tree inside the callback.\n *\n * You may call `dispatch()` from a change listener, with the following\n * caveats:\n *\n * 1. The subscriptions are snapshotted just before every `dispatch()` call.\n * If you subscribe or unsubscribe while the listeners are being invoked, this\n * will not have any effect on the `dispatch()` that is currently in progress.\n * However, the next `dispatch()` call, whether nested or not, will use a more\n * recent snapshot of the subscription list.\n *\n * 2. The listener should not expect to see all state changes, as the state\n * might have been updated multiple times during a nested `dispatch()` before\n * the listener is called. It is, however, guaranteed that all subscribers\n * registered before the `dispatch()` started will be called with the latest\n * state by the time it exits.\n *\n * @param {Function} listener A callback to be invoked on every dispatch.\n * @returns {Function} A function to remove this change listener.\n */\n\n function subscribe(listener) {\n if (typeof listener !== 'function') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(4) : \"Expected the listener to be a function. Instead, received: '\" + kindOf(listener) + \"'\");\n }\n if (isDispatching) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(5) : 'You may not call store.subscribe() while the reducer is executing. ' + 'If you would like to be notified after the store has been updated, subscribe from a ' + 'component and invoke store.getState() in the callback to access the latest state. ' + 'See https://redux.js.org/api/store#subscribelistener for more details.');\n }\n var isSubscribed = true;\n ensureCanMutateNextListeners();\n nextListeners.push(listener);\n return function unsubscribe() {\n if (!isSubscribed) {\n return;\n }\n if (isDispatching) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(6) : 'You may not unsubscribe from a store listener while the reducer is executing. ' + 'See https://redux.js.org/api/store#subscribelistener for more details.');\n }\n isSubscribed = false;\n ensureCanMutateNextListeners();\n var index = nextListeners.indexOf(listener);\n nextListeners.splice(index, 1);\n currentListeners = null;\n };\n }\n /**\n * Dispatches an action. It is the only way to trigger a state change.\n *\n * The `reducer` function, used to create the store, will be called with the\n * current state tree and the given `action`. Its return value will\n * be considered the **next** state of the tree, and the change listeners\n * will be notified.\n *\n * The base implementation only supports plain object actions. If you want to\n * dispatch a Promise, an Observable, a thunk, or something else, you need to\n * wrap your store creating function into the corresponding middleware. For\n * example, see the documentation for the `redux-thunk` package. Even the\n * middleware will eventually dispatch plain object actions using this method.\n *\n * @param {Object} action A plain object representing “what changed”. It is\n * a good idea to keep actions serializable so you can record and replay user\n * sessions, or use the time travelling `redux-devtools`. An action must have\n * a `type` property which may not be `undefined`. It is a good idea to use\n * string constants for action types.\n *\n * @returns {Object} For convenience, the same action object you dispatched.\n *\n * Note that, if you use a custom middleware, it may wrap `dispatch()` to\n * return something else (for example, a Promise you can await).\n */\n\n function dispatch(action) {\n if (!isPlainObject(action)) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(7) : \"Actions must be plain objects. Instead, the actual type was: '\" + kindOf(action) + \"'. You may need to add middleware to your store setup to handle dispatching other values, such as 'redux-thunk' to handle dispatching functions. See https://redux.js.org/tutorials/fundamentals/part-4-store#middleware and https://redux.js.org/tutorials/fundamentals/part-6-async-logic#using-the-redux-thunk-middleware for examples.\");\n }\n if (typeof action.type === 'undefined') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(8) : 'Actions may not have an undefined \"type\" property. You may have misspelled an action type string constant.');\n }\n if (isDispatching) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(9) : 'Reducers may not dispatch actions.');\n }\n try {\n isDispatching = true;\n currentState = currentReducer(currentState, action);\n } finally {\n isDispatching = false;\n }\n var listeners = currentListeners = nextListeners;\n for (var i = 0; i < listeners.length; i++) {\n var listener = listeners[i];\n listener();\n }\n return action;\n }\n /**\n * Replaces the reducer currently used by the store to calculate the state.\n *\n * You might need this if your app implements code splitting and you want to\n * load some of the reducers dynamically. You might also need this if you\n * implement a hot reloading mechanism for Redux.\n *\n * @param {Function} nextReducer The reducer for the store to use instead.\n * @returns {void}\n */\n\n function replaceReducer(nextReducer) {\n if (typeof nextReducer !== 'function') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(10) : \"Expected the nextReducer to be a function. Instead, received: '\" + kindOf(nextReducer));\n }\n currentReducer = nextReducer; // This action has a similiar effect to ActionTypes.INIT.\n // Any reducers that existed in both the new and old rootReducer\n // will receive the previous state. This effectively populates\n // the new state tree with any relevant data from the old one.\n\n dispatch({\n type: ActionTypes.REPLACE\n });\n }\n /**\n * Interoperability point for observable/reactive libraries.\n * @returns {observable} A minimal observable of state changes.\n * For more information, see the observable proposal:\n * https://github.com/tc39/proposal-observable\n */\n\n function observable() {\n var _ref;\n var outerSubscribe = subscribe;\n return _ref = {\n /**\n * The minimal observable subscription method.\n * @param {Object} observer Any object that can be used as an observer.\n * The observer object should have a `next` method.\n * @returns {subscription} An object with an `unsubscribe` method that can\n * be used to unsubscribe the observable from the store, and prevent further\n * emission of values from the observable.\n */\n subscribe: function subscribe(observer) {\n if (typeof observer !== 'object' || observer === null) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(11) : \"Expected the observer to be an object. Instead, received: '\" + kindOf(observer) + \"'\");\n }\n function observeState() {\n if (observer.next) {\n observer.next(getState());\n }\n }\n observeState();\n var unsubscribe = outerSubscribe(observeState);\n return {\n unsubscribe: unsubscribe\n };\n }\n }, _ref[$$observable] = function () {\n return this;\n }, _ref;\n } // When a store is created, an \"INIT\" action is dispatched so that every\n // reducer returns their initial state. This effectively populates\n // the initial state tree.\n\n dispatch({\n type: ActionTypes.INIT\n });\n return _ref2 = {\n dispatch: dispatch,\n subscribe: subscribe,\n getState: getState,\n replaceReducer: replaceReducer\n }, _ref2[$$observable] = observable, _ref2;\n}\n/**\n * Creates a Redux store that holds the state tree.\n *\n * **We recommend using `configureStore` from the\n * `@reduxjs/toolkit` package**, which replaces `createStore`:\n * **https://redux.js.org/introduction/why-rtk-is-redux-today**\n *\n * The only way to change the data in the store is to call `dispatch()` on it.\n *\n * There should only be a single store in your app. To specify how different\n * parts of the state tree respond to actions, you may combine several reducers\n * into a single reducer function by using `combineReducers`.\n *\n * @param {Function} reducer A function that returns the next state tree, given\n * the current state tree and the action to handle.\n *\n * @param {any} [preloadedState] The initial state. You may optionally specify it\n * to hydrate the state from the server in universal apps, or to restore a\n * previously serialized user session.\n * If you use `combineReducers` to produce the root reducer function, this must be\n * an object with the same shape as `combineReducers` keys.\n *\n * @param {Function} [enhancer] The store enhancer. You may optionally specify it\n * to enhance the store with third-party capabilities such as middleware,\n * time travel, persistence, etc. The only store enhancer that ships with Redux\n * is `applyMiddleware()`.\n *\n * @returns {Store} A Redux store that lets you read the state, dispatch actions\n * and subscribe to changes.\n */\n\nvar legacy_createStore = createStore;\n\n/**\n * Prints a warning in the console if it exists.\n *\n * @param {String} message The warning message.\n * @returns {void}\n */\nfunction warning(message) {\n /* eslint-disable no-console */\n if (typeof console !== 'undefined' && typeof console.error === 'function') {\n console.error(message);\n }\n /* eslint-enable no-console */\n\n try {\n // This error was thrown as a convenience so that if you enable\n // \"break on all exceptions\" in your console,\n // it would pause the execution at this line.\n throw new Error(message);\n } catch (e) {} // eslint-disable-line no-empty\n}\n\nfunction getUnexpectedStateShapeWarningMessage(inputState, reducers, action, unexpectedKeyCache) {\n var reducerKeys = Object.keys(reducers);\n var argumentName = action && action.type === ActionTypes.INIT ? 'preloadedState argument passed to createStore' : 'previous state received by the reducer';\n if (reducerKeys.length === 0) {\n return 'Store does not have a valid reducer. Make sure the argument passed ' + 'to combineReducers is an object whose values are reducers.';\n }\n if (!isPlainObject(inputState)) {\n return \"The \" + argumentName + \" has unexpected type of \\\"\" + kindOf(inputState) + \"\\\". Expected argument to be an object with the following \" + (\"keys: \\\"\" + reducerKeys.join('\", \"') + \"\\\"\");\n }\n var unexpectedKeys = Object.keys(inputState).filter(function (key) {\n return !reducers.hasOwnProperty(key) && !unexpectedKeyCache[key];\n });\n unexpectedKeys.forEach(function (key) {\n unexpectedKeyCache[key] = true;\n });\n if (action && action.type === ActionTypes.REPLACE) return;\n if (unexpectedKeys.length > 0) {\n return \"Unexpected \" + (unexpectedKeys.length > 1 ? 'keys' : 'key') + \" \" + (\"\\\"\" + unexpectedKeys.join('\", \"') + \"\\\" found in \" + argumentName + \". \") + \"Expected to find one of the known reducer keys instead: \" + (\"\\\"\" + reducerKeys.join('\", \"') + \"\\\". Unexpected keys will be ignored.\");\n }\n}\nfunction assertReducerShape(reducers) {\n Object.keys(reducers).forEach(function (key) {\n var reducer = reducers[key];\n var initialState = reducer(undefined, {\n type: ActionTypes.INIT\n });\n if (typeof initialState === 'undefined') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(12) : \"The slice reducer for key \\\"\" + key + \"\\\" returned undefined during initialization. \" + \"If the state passed to the reducer is undefined, you must \" + \"explicitly return the initial state. The initial state may \" + \"not be undefined. If you don't want to set a value for this reducer, \" + \"you can use null instead of undefined.\");\n }\n if (typeof reducer(undefined, {\n type: ActionTypes.PROBE_UNKNOWN_ACTION()\n }) === 'undefined') {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(13) : \"The slice reducer for key \\\"\" + key + \"\\\" returned undefined when probed with a random type. \" + (\"Don't try to handle '\" + ActionTypes.INIT + \"' or other actions in \\\"redux/*\\\" \") + \"namespace. They are considered private. Instead, you must return the \" + \"current state for any unknown actions, unless it is undefined, \" + \"in which case you must return the initial state, regardless of the \" + \"action type. The initial state may not be undefined, but can be null.\");\n }\n });\n}\n/**\n * Turns an object whose values are different reducer functions, into a single\n * reducer function. It will call every child reducer, and gather their results\n * into a single state object, whose keys correspond to the keys of the passed\n * reducer functions.\n *\n * @param {Object} reducers An object whose values correspond to different\n * reducer functions that need to be combined into one. One handy way to obtain\n * it is to use ES6 `import * as reducers` syntax. The reducers may never return\n * undefined for any action. Instead, they should return their initial state\n * if the state passed to them was undefined, and the current state for any\n * unrecognized action.\n *\n * @returns {Function} A reducer function that invokes every reducer inside the\n * passed object, and builds a state object with the same shape.\n */\n\nfunction combineReducers(reducers) {\n var reducerKeys = Object.keys(reducers);\n var finalReducers = {};\n for (var i = 0; i < reducerKeys.length; i++) {\n var key = reducerKeys[i];\n if (process.env.NODE_ENV !== 'production') {\n if (typeof reducers[key] === 'undefined') {\n warning(\"No reducer provided for key \\\"\" + key + \"\\\"\");\n }\n }\n if (typeof reducers[key] === 'function') {\n finalReducers[key] = reducers[key];\n }\n }\n var finalReducerKeys = Object.keys(finalReducers); // This is used to make sure we don't warn about the same\n // keys multiple times.\n\n var unexpectedKeyCache;\n if (process.env.NODE_ENV !== 'production') {\n unexpectedKeyCache = {};\n }\n var shapeAssertionError;\n try {\n assertReducerShape(finalReducers);\n } catch (e) {\n shapeAssertionError = e;\n }\n return function combination(state, action) {\n if (state === void 0) {\n state = {};\n }\n if (shapeAssertionError) {\n throw shapeAssertionError;\n }\n if (process.env.NODE_ENV !== 'production') {\n var warningMessage = getUnexpectedStateShapeWarningMessage(state, finalReducers, action, unexpectedKeyCache);\n if (warningMessage) {\n warning(warningMessage);\n }\n }\n var hasChanged = false;\n var nextState = {};\n for (var _i = 0; _i < finalReducerKeys.length; _i++) {\n var _key = finalReducerKeys[_i];\n var reducer = finalReducers[_key];\n var previousStateForKey = state[_key];\n var nextStateForKey = reducer(previousStateForKey, action);\n if (typeof nextStateForKey === 'undefined') {\n var actionType = action && action.type;\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(14) : \"When called with an action of type \" + (actionType ? \"\\\"\" + String(actionType) + \"\\\"\" : '(unknown type)') + \", the slice reducer for key \\\"\" + _key + \"\\\" returned undefined. \" + \"To ignore an action, you must explicitly return the previous state. \" + \"If you want this reducer to hold no value, you can return null instead of undefined.\");\n }\n nextState[_key] = nextStateForKey;\n hasChanged = hasChanged || nextStateForKey !== previousStateForKey;\n }\n hasChanged = hasChanged || finalReducerKeys.length !== Object.keys(state).length;\n return hasChanged ? nextState : state;\n };\n}\nfunction bindActionCreator(actionCreator, dispatch) {\n return function () {\n return dispatch(actionCreator.apply(this, arguments));\n };\n}\n/**\n * Turns an object whose values are action creators, into an object with the\n * same keys, but with every function wrapped into a `dispatch` call so they\n * may be invoked directly. This is just a convenience method, as you can call\n * `store.dispatch(MyActionCreators.doSomething())` yourself just fine.\n *\n * For convenience, you can also pass an action creator as the first argument,\n * and get a dispatch wrapped function in return.\n *\n * @param {Function|Object} actionCreators An object whose values are action\n * creator functions. One handy way to obtain it is to use ES6 `import * as`\n * syntax. You may also pass a single function.\n *\n * @param {Function} dispatch The `dispatch` function available on your Redux\n * store.\n *\n * @returns {Function|Object} The object mimicking the original object, but with\n * every action creator wrapped into the `dispatch` call. If you passed a\n * function as `actionCreators`, the return value will also be a single\n * function.\n */\n\nfunction bindActionCreators(actionCreators, dispatch) {\n if (typeof actionCreators === 'function') {\n return bindActionCreator(actionCreators, dispatch);\n }\n if (typeof actionCreators !== 'object' || actionCreators === null) {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(16) : \"bindActionCreators expected an object or a function, but instead received: '\" + kindOf(actionCreators) + \"'. \" + \"Did you write \\\"import ActionCreators from\\\" instead of \\\"import * as ActionCreators from\\\"?\");\n }\n var boundActionCreators = {};\n for (var key in actionCreators) {\n var actionCreator = actionCreators[key];\n if (typeof actionCreator === 'function') {\n boundActionCreators[key] = bindActionCreator(actionCreator, dispatch);\n }\n }\n return boundActionCreators;\n}\n\n/**\n * Composes single-argument functions from right to left. The rightmost\n * function can take multiple arguments as it provides the signature for\n * the resulting composite function.\n *\n * @param {...Function} funcs The functions to compose.\n * @returns {Function} A function obtained by composing the argument functions\n * from right to left. For example, compose(f, g, h) is identical to doing\n * (...args) => f(g(h(...args))).\n */\nfunction compose() {\n for (var _len = arguments.length, funcs = new Array(_len), _key = 0; _key < _len; _key++) {\n funcs[_key] = arguments[_key];\n }\n if (funcs.length === 0) {\n return function (arg) {\n return arg;\n };\n }\n if (funcs.length === 1) {\n return funcs[0];\n }\n return funcs.reduce(function (a, b) {\n return function () {\n return a(b.apply(void 0, arguments));\n };\n });\n}\n\n/**\n * Creates a store enhancer that applies middleware to the dispatch method\n * of the Redux store. This is handy for a variety of tasks, such as expressing\n * asynchronous actions in a concise manner, or logging every action payload.\n *\n * See `redux-thunk` package as an example of the Redux middleware.\n *\n * Because middleware is potentially asynchronous, this should be the first\n * store enhancer in the composition chain.\n *\n * Note that each middleware will be given the `dispatch` and `getState` functions\n * as named arguments.\n *\n * @param {...Function} middlewares The middleware chain to be applied.\n * @returns {Function} A store enhancer applying the middleware.\n */\n\nfunction applyMiddleware() {\n for (var _len = arguments.length, middlewares = new Array(_len), _key = 0; _key < _len; _key++) {\n middlewares[_key] = arguments[_key];\n }\n return function (createStore) {\n return function () {\n var store = createStore.apply(void 0, arguments);\n var _dispatch = function dispatch() {\n throw new Error(process.env.NODE_ENV === \"production\" ? formatProdErrorMessage(15) : 'Dispatching while constructing your middleware is not allowed. ' + 'Other middleware would not be applied to this dispatch.');\n };\n var middlewareAPI = {\n getState: store.getState,\n dispatch: function dispatch() {\n return _dispatch.apply(void 0, arguments);\n }\n };\n var chain = middlewares.map(function (middleware) {\n return middleware(middlewareAPI);\n });\n _dispatch = compose.apply(void 0, chain)(store.dispatch);\n return _objectSpread(_objectSpread({}, store), {}, {\n dispatch: _dispatch\n });\n };\n };\n}\nexport { ActionTypes as __DO_NOT_USE__ActionTypes, applyMiddleware, bindActionCreators, combineReducers, compose, createStore, legacy_createStore };","import React from 'react';\nexport var ReactReduxContext = /*#__PURE__*/React.createContext(null);\nif (process.env.NODE_ENV !== 'production') {\n ReactReduxContext.displayName = 'ReactRedux';\n}\nexport default ReactReduxContext;","// Default to a dummy \"batch\" implementation that just runs the callback\nfunction defaultNoopBatch(callback) {\n callback();\n}\nvar batch = defaultNoopBatch; // Allow injecting another batching function later\n\nexport var setBatch = function setBatch(newBatch) {\n return batch = newBatch;\n}; // Supply a getter just to skip dealing with ESM bindings\n\nexport var getBatch = function getBatch() {\n return batch;\n};","import { getBatch } from './batch'; // encapsulates the subscription logic for connecting a component to the redux store, as\n// well as nesting subscriptions of descendant components, so that we can ensure the\n// ancestor components re-render before descendants\n\nfunction createListenerCollection() {\n var batch = getBatch();\n var first = null;\n var last = null;\n return {\n clear: function clear() {\n first = null;\n last = null;\n },\n notify: function notify() {\n batch(function () {\n var listener = first;\n while (listener) {\n listener.callback();\n listener = listener.next;\n }\n });\n },\n get: function get() {\n var listeners = [];\n var listener = first;\n while (listener) {\n listeners.push(listener);\n listener = listener.next;\n }\n return listeners;\n },\n subscribe: function subscribe(callback) {\n var isSubscribed = true;\n var listener = last = {\n callback: callback,\n next: null,\n prev: last\n };\n if (listener.prev) {\n listener.prev.next = listener;\n } else {\n first = listener;\n }\n return function unsubscribe() {\n if (!isSubscribed || first === null) return;\n isSubscribed = false;\n if (listener.next) {\n listener.next.prev = listener.prev;\n } else {\n last = listener.prev;\n }\n if (listener.prev) {\n listener.prev.next = listener.next;\n } else {\n first = listener.next;\n }\n };\n }\n };\n}\nvar nullListeners = {\n notify: function notify() {},\n get: function get() {\n return [];\n }\n};\nexport function createSubscription(store, parentSub) {\n var unsubscribe;\n var listeners = nullListeners;\n function addNestedSub(listener) {\n trySubscribe();\n return listeners.subscribe(listener);\n }\n function notifyNestedSubs() {\n listeners.notify();\n }\n function handleChangeWrapper() {\n if (subscription.onStateChange) {\n subscription.onStateChange();\n }\n }\n function isSubscribed() {\n return Boolean(unsubscribe);\n }\n function trySubscribe() {\n if (!unsubscribe) {\n unsubscribe = parentSub ? parentSub.addNestedSub(handleChangeWrapper) : store.subscribe(handleChangeWrapper);\n listeners = createListenerCollection();\n }\n }\n function tryUnsubscribe() {\n if (unsubscribe) {\n unsubscribe();\n unsubscribe = undefined;\n listeners.clear();\n listeners = nullListeners;\n }\n }\n var subscription = {\n addNestedSub: addNestedSub,\n notifyNestedSubs: notifyNestedSubs,\n handleChangeWrapper: handleChangeWrapper,\n isSubscribed: isSubscribed,\n trySubscribe: trySubscribe,\n tryUnsubscribe: tryUnsubscribe,\n getListeners: function getListeners() {\n return listeners;\n }\n };\n return subscription;\n}","import { useEffect, useLayoutEffect } from 'react'; // React currently throws a warning when using useLayoutEffect on the server.\n// To get around it, we can conditionally useEffect on the server (no-op) and\n// useLayoutEffect in the browser. We need useLayoutEffect to ensure the store\n// subscription callback always has the selector from the latest render commit\n// available, otherwise a store update may happen between render and the effect,\n// which may cause missed updates; we also must ensure the store subscription\n// is created synchronously, otherwise a store update may occur before the\n// subscription is created and an inconsistent state may be observed\n\nexport var useIsomorphicLayoutEffect = typeof window !== 'undefined' && typeof window.document !== 'undefined' && typeof window.document.createElement !== 'undefined' ? useLayoutEffect : useEffect;","import React, { useMemo } from 'react';\nimport { ReactReduxContext } from './Context';\nimport { createSubscription } from '../utils/Subscription';\nimport { useIsomorphicLayoutEffect } from '../utils/useIsomorphicLayoutEffect';\nfunction Provider(_ref) {\n var store = _ref.store,\n context = _ref.context,\n children = _ref.children;\n var contextValue = useMemo(function () {\n var subscription = createSubscription(store);\n return {\n store: store,\n subscription: subscription\n };\n }, [store]);\n var previousState = useMemo(function () {\n return store.getState();\n }, [store]);\n useIsomorphicLayoutEffect(function () {\n var subscription = contextValue.subscription;\n subscription.onStateChange = subscription.notifyNestedSubs;\n subscription.trySubscribe();\n if (previousState !== store.getState()) {\n subscription.notifyNestedSubs();\n }\n return function () {\n subscription.tryUnsubscribe();\n subscription.onStateChange = null;\n };\n }, [contextValue, previousState]);\n var Context = context || ReactReduxContext;\n return /*#__PURE__*/React.createElement(Context.Provider, {\n value: contextValue\n }, children);\n}\nif (process.env.NODE_ENV !== 'production') {}\nexport default Provider;","import _extends from \"@babel/runtime/helpers/esm/extends\";\nimport _objectWithoutPropertiesLoose from \"@babel/runtime/helpers/esm/objectWithoutPropertiesLoose\";\nvar _excluded = [\"getDisplayName\", \"methodName\", \"renderCountProp\", \"shouldHandleStateChanges\", \"storeKey\", \"withRef\", \"forwardRef\", \"context\"],\n _excluded2 = [\"reactReduxForwardedRef\"];\nimport hoistStatics from 'hoist-non-react-statics';\nimport React, { useContext, useMemo, useRef, useReducer } from 'react';\nimport { isValidElementType, isContextConsumer } from 'react-is';\nimport { createSubscription } from '../utils/Subscription';\nimport { useIsomorphicLayoutEffect } from '../utils/useIsomorphicLayoutEffect';\nimport { ReactReduxContext } from './Context'; // Define some constant arrays just to avoid re-creating these\n\nvar EMPTY_ARRAY = [];\nvar NO_SUBSCRIPTION_ARRAY = [null, null];\nvar stringifyComponent = function stringifyComponent(Comp) {\n try {\n return JSON.stringify(Comp);\n } catch (err) {\n return String(Comp);\n }\n};\nfunction storeStateUpdatesReducer(state, action) {\n var updateCount = state[1];\n return [action.payload, updateCount + 1];\n}\nfunction useIsomorphicLayoutEffectWithArgs(effectFunc, effectArgs, dependencies) {\n useIsomorphicLayoutEffect(function () {\n return effectFunc.apply(void 0, effectArgs);\n }, dependencies);\n}\nfunction captureWrapperProps(lastWrapperProps, lastChildProps, renderIsScheduled, wrapperProps, actualChildProps, childPropsFromStoreUpdate, notifyNestedSubs) {\n // We want to capture the wrapper props and child props we used for later comparisons\n lastWrapperProps.current = wrapperProps;\n lastChildProps.current = actualChildProps;\n renderIsScheduled.current = false; // If the render was from a store update, clear out that reference and cascade the subscriber update\n\n if (childPropsFromStoreUpdate.current) {\n childPropsFromStoreUpdate.current = null;\n notifyNestedSubs();\n }\n}\nfunction subscribeUpdates(shouldHandleStateChanges, store, subscription, childPropsSelector, lastWrapperProps, lastChildProps, renderIsScheduled, childPropsFromStoreUpdate, notifyNestedSubs, forceComponentUpdateDispatch) {\n // If we're not subscribed to the store, nothing to do here\n if (!shouldHandleStateChanges) return; // Capture values for checking if and when this component unmounts\n\n var didUnsubscribe = false;\n var lastThrownError = null; // We'll run this callback every time a store subscription update propagates to this component\n\n var checkForUpdates = function checkForUpdates() {\n if (didUnsubscribe) {\n // Don't run stale listeners.\n // Redux doesn't guarantee unsubscriptions happen until next dispatch.\n return;\n }\n var latestStoreState = store.getState();\n var newChildProps, error;\n try {\n // Actually run the selector with the most recent store state and wrapper props\n // to determine what the child props should be\n newChildProps = childPropsSelector(latestStoreState, lastWrapperProps.current);\n } catch (e) {\n error = e;\n lastThrownError = e;\n }\n if (!error) {\n lastThrownError = null;\n } // If the child props haven't changed, nothing to do here - cascade the subscription update\n\n if (newChildProps === lastChildProps.current) {\n if (!renderIsScheduled.current) {\n notifyNestedSubs();\n }\n } else {\n // Save references to the new child props. Note that we track the \"child props from store update\"\n // as a ref instead of a useState/useReducer because we need a way to determine if that value has\n // been processed. If this went into useState/useReducer, we couldn't clear out the value without\n // forcing another re-render, which we don't want.\n lastChildProps.current = newChildProps;\n childPropsFromStoreUpdate.current = newChildProps;\n renderIsScheduled.current = true; // If the child props _did_ change (or we caught an error), this wrapper component needs to re-render\n\n forceComponentUpdateDispatch({\n type: 'STORE_UPDATED',\n payload: {\n error: error\n }\n });\n }\n }; // Actually subscribe to the nearest connected ancestor (or store)\n\n subscription.onStateChange = checkForUpdates;\n subscription.trySubscribe(); // Pull data from the store after first render in case the store has\n // changed since we began.\n\n checkForUpdates();\n var unsubscribeWrapper = function unsubscribeWrapper() {\n didUnsubscribe = true;\n subscription.tryUnsubscribe();\n subscription.onStateChange = null;\n if (lastThrownError) {\n // It's possible that we caught an error due to a bad mapState function, but the\n // parent re-rendered without this component and we're about to unmount.\n // This shouldn't happen as long as we do top-down subscriptions correctly, but\n // if we ever do those wrong, this throw will surface the error in our tests.\n // In that case, throw the error from here so it doesn't get lost.\n throw lastThrownError;\n }\n };\n return unsubscribeWrapper;\n}\nvar initStateUpdates = function initStateUpdates() {\n return [null, 0];\n};\nexport default function connectAdvanced(\n/*\r\n selectorFactory is a func that is responsible for returning the selector function used to\r\n compute new props from state, props, and dispatch. For example:\r\n export default connectAdvanced((dispatch, options) => (state, props) => ({\r\n thing: state.things[props.thingId],\r\n saveThing: fields => dispatch(actionCreators.saveThing(props.thingId, fields)),\r\n }))(YourComponent)\r\n Access to dispatch is provided to the factory so selectorFactories can bind actionCreators\r\n outside of their selector as an optimization. Options passed to connectAdvanced are passed to\r\n the selectorFactory, along with displayName and WrappedComponent, as the second argument.\r\n Note that selectorFactory is responsible for all caching/memoization of inbound and outbound\r\n props. Do not use connectAdvanced directly without memoizing results between calls to your\r\n selector, otherwise the Connect component will re-render on every state or props change.\r\n*/\nselectorFactory,\n// options object:\n_ref) {\n if (_ref === void 0) {\n _ref = {};\n }\n var _ref2 = _ref,\n _ref2$getDisplayName = _ref2.getDisplayName,\n getDisplayName = _ref2$getDisplayName === void 0 ? function (name) {\n return \"ConnectAdvanced(\" + name + \")\";\n } : _ref2$getDisplayName,\n _ref2$methodName = _ref2.methodName,\n methodName = _ref2$methodName === void 0 ? 'connectAdvanced' : _ref2$methodName,\n _ref2$renderCountProp = _ref2.renderCountProp,\n renderCountProp = _ref2$renderCountProp === void 0 ? undefined : _ref2$renderCountProp,\n _ref2$shouldHandleSta = _ref2.shouldHandleStateChanges,\n shouldHandleStateChanges = _ref2$shouldHandleSta === void 0 ? true : _ref2$shouldHandleSta,\n _ref2$storeKey = _ref2.storeKey,\n storeKey = _ref2$storeKey === void 0 ? 'store' : _ref2$storeKey,\n _ref2$withRef = _ref2.withRef,\n withRef = _ref2$withRef === void 0 ? false : _ref2$withRef,\n _ref2$forwardRef = _ref2.forwardRef,\n forwardRef = _ref2$forwardRef === void 0 ? false : _ref2$forwardRef,\n _ref2$context = _ref2.context,\n context = _ref2$context === void 0 ? ReactReduxContext : _ref2$context,\n connectOptions = _objectWithoutPropertiesLoose(_ref2, _excluded);\n if (process.env.NODE_ENV !== 'production') {\n if (renderCountProp !== undefined) {\n throw new Error(\"renderCountProp is removed. render counting is built into the latest React Dev Tools profiling extension\");\n }\n if (withRef) {\n throw new Error('withRef is removed. To access the wrapped instance, use a ref on the connected component');\n }\n var customStoreWarningMessage = 'To use a custom Redux store for specific components, create a custom React context with ' + \"React.createContext(), and pass the context object to React Redux's Provider and specific components\" + ' like: {counter}
\r\n * }\r\n */\n\nexport var useSelector = /*#__PURE__*/createSelectorHook();","export * from './exports';\nimport { unstable_batchedUpdates as batch } from './utils/reactBatchedUpdates';\nimport { setBatch } from './utils/batch'; // Enable batched updates in our subscriptions for use\n// with standard React renderers (ReactDOM, React Native)\n\nsetBatch(batch);\nexport { batch };","import invariant from 'tiny-invariant';\nvar getRect = function getRect(_ref) {\n var top = _ref.top,\n right = _ref.right,\n bottom = _ref.bottom,\n left = _ref.left;\n var width = right - left;\n var height = bottom - top;\n var rect = {\n top: top,\n right: right,\n bottom: bottom,\n left: left,\n width: width,\n height: height,\n x: left,\n y: top,\n center: {\n x: (right + left) / 2,\n y: (bottom + top) / 2\n }\n };\n return rect;\n};\nvar expand = function expand(target, expandBy) {\n return {\n top: target.top - expandBy.top,\n left: target.left - expandBy.left,\n bottom: target.bottom + expandBy.bottom,\n right: target.right + expandBy.right\n };\n};\nvar shrink = function shrink(target, shrinkBy) {\n return {\n top: target.top + shrinkBy.top,\n left: target.left + shrinkBy.left,\n bottom: target.bottom - shrinkBy.bottom,\n right: target.right - shrinkBy.right\n };\n};\nvar shift = function shift(target, shiftBy) {\n return {\n top: target.top + shiftBy.y,\n left: target.left + shiftBy.x,\n bottom: target.bottom + shiftBy.y,\n right: target.right + shiftBy.x\n };\n};\nvar noSpacing = {\n top: 0,\n right: 0,\n bottom: 0,\n left: 0\n};\nvar createBox = function createBox(_ref2) {\n var borderBox = _ref2.borderBox,\n _ref2$margin = _ref2.margin,\n margin = _ref2$margin === void 0 ? noSpacing : _ref2$margin,\n _ref2$border = _ref2.border,\n border = _ref2$border === void 0 ? noSpacing : _ref2$border,\n _ref2$padding = _ref2.padding,\n padding = _ref2$padding === void 0 ? noSpacing : _ref2$padding;\n var marginBox = getRect(expand(borderBox, margin));\n var paddingBox = getRect(shrink(borderBox, border));\n var contentBox = getRect(shrink(paddingBox, padding));\n return {\n marginBox: marginBox,\n borderBox: getRect(borderBox),\n paddingBox: paddingBox,\n contentBox: contentBox,\n margin: margin,\n border: border,\n padding: padding\n };\n};\nvar parse = function parse(raw) {\n var value = raw.slice(0, -2);\n var suffix = raw.slice(-2);\n if (suffix !== 'px') {\n return 0;\n }\n var result = Number(value);\n !!isNaN(result) ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Could not parse value [raw: \" + raw + \", without suffix: \" + value + \"]\") : invariant(false) : void 0;\n return result;\n};\nvar getWindowScroll = function getWindowScroll() {\n return {\n x: window.pageXOffset,\n y: window.pageYOffset\n };\n};\nvar offset = function offset(original, change) {\n var borderBox = original.borderBox,\n border = original.border,\n margin = original.margin,\n padding = original.padding;\n var shifted = shift(borderBox, change);\n return createBox({\n borderBox: shifted,\n border: border,\n margin: margin,\n padding: padding\n });\n};\nvar withScroll = function withScroll(original, scroll) {\n if (scroll === void 0) {\n scroll = getWindowScroll();\n }\n return offset(original, scroll);\n};\nvar calculateBox = function calculateBox(borderBox, styles) {\n var margin = {\n top: parse(styles.marginTop),\n right: parse(styles.marginRight),\n bottom: parse(styles.marginBottom),\n left: parse(styles.marginLeft)\n };\n var padding = {\n top: parse(styles.paddingTop),\n right: parse(styles.paddingRight),\n bottom: parse(styles.paddingBottom),\n left: parse(styles.paddingLeft)\n };\n var border = {\n top: parse(styles.borderTopWidth),\n right: parse(styles.borderRightWidth),\n bottom: parse(styles.borderBottomWidth),\n left: parse(styles.borderLeftWidth)\n };\n return createBox({\n borderBox: borderBox,\n margin: margin,\n padding: padding,\n border: border\n });\n};\nvar getBox = function getBox(el) {\n var borderBox = el.getBoundingClientRect();\n var styles = window.getComputedStyle(el);\n return calculateBox(borderBox, styles);\n};\nexport { calculateBox, createBox, expand, getBox, getRect, offset, shrink, withScroll };","var rafSchd = function rafSchd(fn) {\n var lastArgs = [];\n var frameId = null;\n var wrapperFn = function wrapperFn() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n lastArgs = args;\n if (frameId) {\n return;\n }\n frameId = requestAnimationFrame(function () {\n frameId = null;\n fn.apply(void 0, lastArgs);\n });\n };\n wrapperFn.cancel = function () {\n if (!frameId) {\n return;\n }\n cancelAnimationFrame(frameId);\n frameId = null;\n };\n return wrapperFn;\n};\nexport default rafSchd;","import _extends from '@babel/runtime-corejs2/helpers/esm/extends';\nimport React, { useLayoutEffect, useEffect, useRef, useContext, useState } from 'react';\nimport { useMemo, useCallback } from 'use-memo-one';\nimport _inheritsLoose from '@babel/runtime-corejs2/helpers/esm/inheritsLoose';\nimport invariant from 'tiny-invariant';\nimport { createStore as createStore$1, applyMiddleware, compose, bindActionCreators } from 'redux';\nimport { Provider, connect } from 'react-redux';\nimport { getRect, expand, offset, withScroll, createBox, getBox, calculateBox } from 'css-box-model';\nimport memoizeOne from 'memoize-one';\nimport _Object$values from '@babel/runtime-corejs2/core-js/object/values';\nimport _Object$keys from '@babel/runtime-corejs2/core-js/object/keys';\nimport _Date$now from '@babel/runtime-corejs2/core-js/date/now';\nimport rafSchd from 'raf-schd';\nimport _Object$assign from '@babel/runtime-corejs2/core-js/object/assign';\nimport _Number$isInteger from '@babel/runtime-corejs2/core-js/number/is-integer';\nvar isProduction = process.env.NODE_ENV === 'production';\nvar spacesAndTabs = /[ \\t]{2,}/g;\nvar lineStartWithSpaces = /^[ \\t]*/gm;\nvar clean = function clean(value) {\n return value.replace(spacesAndTabs, ' ').replace(lineStartWithSpaces, '').trim();\n};\nvar getDevMessage = function getDevMessage(message) {\n return clean(\"\\n %creact-beautiful-dnd\\n\\n %c\" + clean(message) + \"\\n\\n %c\\uD83D\\uDC77\\u200D This is a development only message. It will be removed in production builds.\\n\");\n};\nvar getFormattedMessage = function getFormattedMessage(message) {\n return [getDevMessage(message), 'color: #00C584; font-size: 1.2em; font-weight: bold;', 'line-height: 1.5', 'color: #723874;'];\n};\nvar isDisabledFlag = '__react-beautiful-dnd-disable-dev-warnings';\nvar warning = function warning(message) {\n var _console;\n if (isProduction) {\n return;\n }\n if (typeof window !== 'undefined' && window[isDisabledFlag]) {\n return;\n }\n (_console = console).warn.apply(_console, getFormattedMessage(message));\n};\nfunction printFatalError(error) {\n var _console;\n if (process.env.NODE_ENV === 'production') {\n return;\n }\n (_console = console).error.apply(_console, getFormattedMessage(\"\\n An error has occurred while a drag is occurring.\\n Any existing drag will be cancelled.\\n\\n > \" + error.message + \"\\n \"));\n console.error('raw', error);\n}\nfunction shouldRecover(error) {\n return error.message.indexOf('Invariant failed') !== -1;\n}\nvar ErrorBoundary = function (_React$Component) {\n _inheritsLoose(ErrorBoundary, _React$Component);\n function ErrorBoundary() {\n var _this;\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n _this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this;\n _this.onError = void 0;\n _this.setOnError = function (fn) {\n _this.onError = fn;\n };\n _this.onFatalError = function (error) {\n printFatalError(error);\n if (_this.onError) {\n _this.onError();\n } else {\n process.env.NODE_ENV !== \"production\" ? warning('Could not find recovering function') : void 0;\n }\n if (shouldRecover(error)) {\n _this.setState({});\n }\n };\n return _this;\n }\n var _proto = ErrorBoundary.prototype;\n _proto.componentDidMount = function componentDidMount() {\n window.addEventListener('error', this.onFatalError);\n };\n _proto.componentWillUnmount = function componentWillUnmount() {\n window.removeEventListener('error', this.onFatalError);\n };\n _proto.componentDidCatch = function componentDidCatch(error) {\n this.onFatalError(error);\n if (!shouldRecover(error)) {\n throw error;\n }\n };\n _proto.render = function render() {\n return this.props.children(this.setOnError);\n };\n return ErrorBoundary;\n}(React.Component);\nvar origin = {\n x: 0,\n y: 0\n};\nvar add = function add(point1, point2) {\n return {\n x: point1.x + point2.x,\n y: point1.y + point2.y\n };\n};\nvar subtract = function subtract(point1, point2) {\n return {\n x: point1.x - point2.x,\n y: point1.y - point2.y\n };\n};\nvar isEqual = function isEqual(point1, point2) {\n return point1.x === point2.x && point1.y === point2.y;\n};\nvar negate = function negate(point) {\n return {\n x: point.x !== 0 ? -point.x : 0,\n y: point.y !== 0 ? -point.y : 0\n };\n};\nvar patch = function patch(line, value, otherValue) {\n var _ref;\n if (otherValue === void 0) {\n otherValue = 0;\n }\n return _ref = {}, _ref[line] = value, _ref[line === 'x' ? 'y' : 'x'] = otherValue, _ref;\n};\nvar distance = function distance(point1, point2) {\n return Math.sqrt(Math.pow(point2.x - point1.x, 2) + Math.pow(point2.y - point1.y, 2));\n};\nvar closest = function closest(target, points) {\n return Math.min.apply(Math, points.map(function (point) {\n return distance(target, point);\n }));\n};\nvar apply = function apply(fn) {\n return function (point) {\n return {\n x: fn(point.x),\n y: fn(point.y)\n };\n };\n};\nvar executeClip = function (frame, subject) {\n var result = getRect({\n top: Math.max(subject.top, frame.top),\n right: Math.min(subject.right, frame.right),\n bottom: Math.min(subject.bottom, frame.bottom),\n left: Math.max(subject.left, frame.left)\n });\n if (result.width <= 0 || result.height <= 0) {\n return null;\n }\n return result;\n};\nvar isEqual$1 = function isEqual(first, second) {\n return first.top === second.top && first.right === second.right && first.bottom === second.bottom && first.left === second.left;\n};\nvar offsetByPosition = function offsetByPosition(spacing, point) {\n return {\n top: spacing.top + point.y,\n left: spacing.left + point.x,\n bottom: spacing.bottom + point.y,\n right: spacing.right + point.x\n };\n};\nvar getCorners = function getCorners(spacing) {\n return [{\n x: spacing.left,\n y: spacing.top\n }, {\n x: spacing.right,\n y: spacing.top\n }, {\n x: spacing.left,\n y: spacing.bottom\n }, {\n x: spacing.right,\n y: spacing.bottom\n }];\n};\nvar noSpacing = {\n top: 0,\n right: 0,\n bottom: 0,\n left: 0\n};\nvar scroll = function scroll(target, frame) {\n if (!frame) {\n return target;\n }\n return offsetByPosition(target, frame.scroll.diff.displacement);\n};\nvar increase = function increase(target, axis, withPlaceholder) {\n if (withPlaceholder && withPlaceholder.increasedBy) {\n var _extends2;\n return _extends({}, target, (_extends2 = {}, _extends2[axis.end] = target[axis.end] + withPlaceholder.increasedBy[axis.line], _extends2));\n }\n return target;\n};\nvar clip = function clip(target, frame) {\n if (frame && frame.shouldClipSubject) {\n return executeClip(frame.pageMarginBox, target);\n }\n return getRect(target);\n};\nvar getSubject = function (_ref) {\n var page = _ref.page,\n withPlaceholder = _ref.withPlaceholder,\n axis = _ref.axis,\n frame = _ref.frame;\n var scrolled = scroll(page.marginBox, frame);\n var increased = increase(scrolled, axis, withPlaceholder);\n var clipped = clip(increased, frame);\n return {\n page: page,\n withPlaceholder: withPlaceholder,\n active: clipped\n };\n};\nvar scrollDroppable = function (droppable, newScroll) {\n !droppable.frame ? process.env.NODE_ENV !== \"production\" ? invariant(false) : invariant(false) : void 0;\n var scrollable = droppable.frame;\n var scrollDiff = subtract(newScroll, scrollable.scroll.initial);\n var scrollDisplacement = negate(scrollDiff);\n var frame = _extends({}, scrollable, {\n scroll: {\n initial: scrollable.scroll.initial,\n current: newScroll,\n diff: {\n value: scrollDiff,\n displacement: scrollDisplacement\n },\n max: scrollable.scroll.max\n }\n });\n var subject = getSubject({\n page: droppable.subject.page,\n withPlaceholder: droppable.subject.withPlaceholder,\n axis: droppable.axis,\n frame: frame\n });\n var result = _extends({}, droppable, {\n frame: frame,\n subject: subject\n });\n return result;\n};\nvar records = {};\nvar isEnabled = false;\nvar isTimingsEnabled = function isTimingsEnabled() {\n return isEnabled;\n};\nvar start = function start(key) {\n if (process.env.NODE_ENV !== 'production') {\n if (!isTimingsEnabled()) {\n return;\n }\n var now = performance.now();\n records[key] = now;\n }\n};\nvar finish = function finish(key) {\n if (process.env.NODE_ENV !== 'production') {\n if (!isTimingsEnabled()) {\n return;\n }\n var now = performance.now();\n var previous = records[key];\n if (!previous) {\n console.warn('cannot finish timing as no previous time found', key);\n return;\n }\n var result = now - previous;\n var rounded = result.toFixed(2);\n var style = function () {\n if (result < 12) {\n return {\n textColor: 'green',\n symbol: '✅'\n };\n }\n if (result < 40) {\n return {\n textColor: 'orange',\n symbol: '⚠️'\n };\n }\n return {\n textColor: 'red',\n symbol: '❌'\n };\n }();\n console.log(style.symbol + \" %cTiming %c\" + rounded + \" %cms %c\" + key, 'color: blue; font-weight: bold;', \"color: \" + style.textColor + \"; font-size: 1.1em;\", 'color: grey;', 'color: purple; font-weight: bold;');\n }\n};\nvar whatIsDraggedOver = function (impact) {\n var merge = impact.merge,\n destination = impact.destination;\n if (destination) {\n return destination.droppableId;\n }\n if (merge) {\n return merge.combine.droppableId;\n }\n return null;\n};\nfunction values(map) {\n return _Object$values(map);\n}\nfunction findIndex(list, predicate) {\n if (list.findIndex) {\n return list.findIndex(predicate);\n }\n for (var i = 0; i < list.length; i++) {\n if (predicate(list[i])) {\n return i;\n }\n }\n return -1;\n}\nfunction find(list, predicate) {\n if (list.find) {\n return list.find(predicate);\n }\n var index = findIndex(list, predicate);\n if (index !== -1) {\n return list[index];\n }\n return undefined;\n}\nvar toDroppableMap = memoizeOne(function (droppables) {\n return droppables.reduce(function (previous, current) {\n previous[current.descriptor.id] = current;\n return previous;\n }, {});\n});\nvar toDraggableMap = memoizeOne(function (draggables) {\n return draggables.reduce(function (previous, current) {\n previous[current.descriptor.id] = current;\n return previous;\n }, {});\n});\nvar toDroppableList = memoizeOne(function (droppables) {\n return values(droppables);\n});\nvar toDraggableList = memoizeOne(function (draggables) {\n return values(draggables);\n});\nvar isWithin = function (lowerBound, upperBound) {\n return function (value) {\n return lowerBound <= value && value <= upperBound;\n };\n};\nvar isPositionInFrame = function (frame) {\n var isWithinVertical = isWithin(frame.top, frame.bottom);\n var isWithinHorizontal = isWithin(frame.left, frame.right);\n return function (point) {\n return isWithinVertical(point.y) && isWithinVertical(point.y) && isWithinHorizontal(point.x) && isWithinHorizontal(point.x);\n };\n};\nvar getDroppableOver = function (_ref) {\n var target = _ref.target,\n droppables = _ref.droppables;\n var maybe = find(toDroppableList(droppables), function (droppable) {\n if (!droppable.isEnabled) {\n return false;\n }\n var active = droppable.subject.active;\n if (!active) {\n return false;\n }\n return isPositionInFrame(active)(target);\n });\n return maybe ? maybe.descriptor.id : null;\n};\nvar getDraggablesInsideDroppable = memoizeOne(function (droppableId, draggables) {\n var result = toDraggableList(draggables).filter(function (draggable) {\n return droppableId === draggable.descriptor.droppableId;\n }).sort(function (a, b) {\n return a.descriptor.index - b.descriptor.index;\n });\n return result;\n});\nvar withDroppableScroll = function (droppable, point) {\n var frame = droppable.frame;\n if (!frame) {\n return point;\n }\n return add(point, frame.scroll.diff.value);\n};\nvar vertical = {\n direction: 'vertical',\n line: 'y',\n crossAxisLine: 'x',\n start: 'top',\n end: 'bottom',\n size: 'height',\n crossAxisStart: 'left',\n crossAxisEnd: 'right',\n crossAxisSize: 'width'\n};\nvar horizontal = {\n direction: 'horizontal',\n line: 'x',\n crossAxisLine: 'y',\n start: 'left',\n end: 'right',\n size: 'width',\n crossAxisStart: 'top',\n crossAxisEnd: 'bottom',\n crossAxisSize: 'height'\n};\nvar isUserMovingForward = function (axis, direction) {\n return axis === vertical ? direction.vertical === 'down' : direction.horizontal === 'right';\n};\nvar didStartDisplaced = function (draggableId, onLift) {\n return Boolean(onLift.wasDisplaced[draggableId]);\n};\nvar getCombinedItemDisplacement = function (_ref) {\n var displaced = _ref.displaced,\n onLift = _ref.onLift,\n combineWith = _ref.combineWith,\n displacedBy = _ref.displacedBy;\n var isDisplaced = Boolean(displaced[combineWith]);\n if (didStartDisplaced(combineWith, onLift)) {\n return isDisplaced ? origin : negate(displacedBy.point);\n }\n return isDisplaced ? displacedBy.point : origin;\n};\nvar getWhenEntered = function getWhenEntered(id, current, oldMerge) {\n if (!oldMerge) {\n return current;\n }\n if (id !== oldMerge.combine.draggableId) {\n return current;\n }\n return oldMerge.whenEntered;\n};\nvar isCombiningWith = function isCombiningWith(_ref) {\n var id = _ref.id,\n currentCenter = _ref.currentCenter,\n axis = _ref.axis,\n borderBox = _ref.borderBox,\n displaceBy = _ref.displaceBy,\n currentUserDirection = _ref.currentUserDirection,\n oldMerge = _ref.oldMerge;\n var start = borderBox[axis.start] + displaceBy[axis.line];\n var end = borderBox[axis.end] + displaceBy[axis.line];\n var size = borderBox[axis.size];\n var twoThirdsOfSize = size * 0.666;\n var whenEntered = getWhenEntered(id, currentUserDirection, oldMerge);\n var isMovingForward = isUserMovingForward(axis, whenEntered);\n var targetCenter = currentCenter[axis.line];\n if (isMovingForward) {\n return isWithin(start, start + twoThirdsOfSize)(targetCenter);\n }\n return isWithin(end - twoThirdsOfSize, end)(targetCenter);\n};\nvar getCombineImpact = function (_ref2) {\n var currentCenter = _ref2.pageBorderBoxCenterWithDroppableScrollChange,\n previousImpact = _ref2.previousImpact,\n destination = _ref2.destination,\n insideDestinationWithoutDraggable = _ref2.insideDestinationWithoutDraggable,\n userDirection = _ref2.userDirection,\n onLift = _ref2.onLift;\n if (!destination.isCombineEnabled) {\n return null;\n }\n var axis = destination.axis;\n var map = previousImpact.movement.map;\n var canBeDisplacedBy = previousImpact.movement.displacedBy;\n var oldMerge = previousImpact.merge;\n var target = find(insideDestinationWithoutDraggable, function (child) {\n var id = child.descriptor.id;\n var displaceBy = getCombinedItemDisplacement({\n displaced: map,\n onLift: onLift,\n combineWith: id,\n displacedBy: canBeDisplacedBy\n });\n return isCombiningWith({\n id: id,\n currentCenter: currentCenter,\n axis: axis,\n borderBox: child.page.borderBox,\n displaceBy: displaceBy,\n currentUserDirection: userDirection,\n oldMerge: oldMerge\n });\n });\n if (!target) {\n return null;\n }\n var merge = {\n whenEntered: getWhenEntered(target.descriptor.id, userDirection, oldMerge),\n combine: {\n draggableId: target.descriptor.id,\n droppableId: destination.descriptor.id\n }\n };\n var withMerge = _extends({}, previousImpact, {\n destination: null,\n merge: merge\n });\n return withMerge;\n};\nvar isPartiallyVisibleThroughFrame = function (frame) {\n var isWithinVertical = isWithin(frame.top, frame.bottom);\n var isWithinHorizontal = isWithin(frame.left, frame.right);\n return function (subject) {\n var isContained = isWithinVertical(subject.top) && isWithinVertical(subject.bottom) && isWithinHorizontal(subject.left) && isWithinHorizontal(subject.right);\n if (isContained) {\n return true;\n }\n var isPartiallyVisibleVertically = isWithinVertical(subject.top) || isWithinVertical(subject.bottom);\n var isPartiallyVisibleHorizontally = isWithinHorizontal(subject.left) || isWithinHorizontal(subject.right);\n var isPartiallyContained = isPartiallyVisibleVertically && isPartiallyVisibleHorizontally;\n if (isPartiallyContained) {\n return true;\n }\n var isBiggerVertically = subject.top < frame.top && subject.bottom > frame.bottom;\n var isBiggerHorizontally = subject.left < frame.left && subject.right > frame.right;\n var isTargetBiggerThanFrame = isBiggerVertically && isBiggerHorizontally;\n if (isTargetBiggerThanFrame) {\n return true;\n }\n var isTargetBiggerOnOneAxis = isBiggerVertically && isPartiallyVisibleHorizontally || isBiggerHorizontally && isPartiallyVisibleVertically;\n return isTargetBiggerOnOneAxis;\n };\n};\nvar isTotallyVisibleThroughFrame = function (frame) {\n var isWithinVertical = isWithin(frame.top, frame.bottom);\n var isWithinHorizontal = isWithin(frame.left, frame.right);\n return function (subject) {\n var isContained = isWithinVertical(subject.top) && isWithinVertical(subject.bottom) && isWithinHorizontal(subject.left) && isWithinHorizontal(subject.right);\n return isContained;\n };\n};\nvar isTotallyVisibleThroughFrameOnAxis = function (axis) {\n return function (frame) {\n var isWithinVertical = isWithin(frame.top, frame.bottom);\n var isWithinHorizontal = isWithin(frame.left, frame.right);\n return function (subject) {\n if (axis === vertical) {\n return isWithinVertical(subject.top) && isWithinVertical(subject.bottom);\n }\n return isWithinHorizontal(subject.left) && isWithinHorizontal(subject.right);\n };\n };\n};\nvar getDroppableDisplaced = function getDroppableDisplaced(target, destination) {\n var displacement = destination.frame ? destination.frame.scroll.diff.displacement : origin;\n return offsetByPosition(target, displacement);\n};\nvar isVisibleInDroppable = function isVisibleInDroppable(target, destination, isVisibleThroughFrameFn) {\n if (!destination.subject.active) {\n return false;\n }\n return isVisibleThroughFrameFn(destination.subject.active)(target);\n};\nvar isVisibleInViewport = function isVisibleInViewport(target, viewport, isVisibleThroughFrameFn) {\n return isVisibleThroughFrameFn(viewport)(target);\n};\nvar isVisible = function isVisible(_ref) {\n var toBeDisplaced = _ref.target,\n destination = _ref.destination,\n viewport = _ref.viewport,\n withDroppableDisplacement = _ref.withDroppableDisplacement,\n isVisibleThroughFrameFn = _ref.isVisibleThroughFrameFn;\n var displacedTarget = withDroppableDisplacement ? getDroppableDisplaced(toBeDisplaced, destination) : toBeDisplaced;\n return isVisibleInDroppable(displacedTarget, destination, isVisibleThroughFrameFn) && isVisibleInViewport(displacedTarget, viewport, isVisibleThroughFrameFn);\n};\nvar isPartiallyVisible = function isPartiallyVisible(args) {\n return isVisible(_extends({}, args, {\n isVisibleThroughFrameFn: isPartiallyVisibleThroughFrame\n }));\n};\nvar isTotallyVisible = function isTotallyVisible(args) {\n return isVisible(_extends({}, args, {\n isVisibleThroughFrameFn: isTotallyVisibleThroughFrame\n }));\n};\nvar isTotallyVisibleOnAxis = function isTotallyVisibleOnAxis(args) {\n return isVisible(_extends({}, args, {\n isVisibleThroughFrameFn: isTotallyVisibleThroughFrameOnAxis(args.destination.axis)\n }));\n};\nvar getShouldAnimate = function getShouldAnimate(forceShouldAnimate, isVisible, previous) {\n if (typeof forceShouldAnimate === 'boolean') {\n return forceShouldAnimate;\n }\n if (!isVisible) {\n return false;\n }\n if (!previous) {\n return true;\n }\n return previous.shouldAnimate;\n};\nvar getTarget = function getTarget(draggable, onLift) {\n var marginBox = draggable.page.marginBox;\n if (!didStartDisplaced(draggable.descriptor.id, onLift)) {\n return marginBox;\n }\n var expandBy = {\n top: onLift.displacedBy.point.y,\n right: 0,\n bottom: 0,\n left: onLift.displacedBy.point.x\n };\n return getRect(expand(marginBox, expandBy));\n};\nvar getDisplacement = function (_ref) {\n var draggable = _ref.draggable,\n destination = _ref.destination,\n previousImpact = _ref.previousImpact,\n viewport = _ref.viewport,\n onLift = _ref.onLift,\n forceShouldAnimate = _ref.forceShouldAnimate;\n var id = draggable.descriptor.id;\n var map = previousImpact.movement.map;\n var target = getTarget(draggable, onLift);\n var isVisible = isPartiallyVisible({\n target: target,\n destination: destination,\n viewport: viewport,\n withDroppableDisplacement: true\n });\n var shouldAnimate = getShouldAnimate(forceShouldAnimate, isVisible, map[id]);\n var displacement = {\n draggableId: id,\n isVisible: isVisible,\n shouldAnimate: shouldAnimate\n };\n return displacement;\n};\nvar getDisplacementMap = memoizeOne(function (displaced) {\n return displaced.reduce(function (map, displacement) {\n map[displacement.draggableId] = displacement;\n return map;\n }, {});\n});\nvar getDisplacedBy = memoizeOne(function (axis, displaceBy) {\n var displacement = displaceBy[axis.line];\n return {\n value: displacement,\n point: patch(axis.line, displacement)\n };\n});\nvar getReorderImpact = function (_ref) {\n var currentCenter = _ref.pageBorderBoxCenterWithDroppableScrollChange,\n draggable = _ref.draggable,\n destination = _ref.destination,\n insideDestinationWithoutDraggable = _ref.insideDestinationWithoutDraggable,\n previousImpact = _ref.previousImpact,\n viewport = _ref.viewport,\n userDirection = _ref.userDirection,\n onLift = _ref.onLift;\n var axis = destination.axis;\n var isMovingForward = isUserMovingForward(destination.axis, userDirection);\n var displacedBy = getDisplacedBy(destination.axis, draggable.displaceBy);\n var targetCenter = currentCenter[axis.line];\n var displacement = displacedBy.value;\n var displaced = insideDestinationWithoutDraggable.filter(function (child) {\n var borderBox = child.page.borderBox;\n var start = borderBox[axis.start];\n var end = borderBox[axis.end];\n var didStartDisplaced$1 = didStartDisplaced(child.descriptor.id, onLift);\n if (isMovingForward) {\n if (didStartDisplaced$1) {\n return targetCenter < start;\n }\n return targetCenter < start + displacement;\n }\n if (didStartDisplaced$1) {\n return targetCenter <= end - displacement;\n }\n return targetCenter <= end;\n }).map(function (dimension) {\n return getDisplacement({\n draggable: dimension,\n destination: destination,\n previousImpact: previousImpact,\n viewport: viewport.frame,\n onLift: onLift\n });\n });\n var newIndex = insideDestinationWithoutDraggable.length - displaced.length;\n var movement = {\n displacedBy: displacedBy,\n displaced: displaced,\n map: getDisplacementMap(displaced)\n };\n var impact = {\n movement: movement,\n destination: {\n droppableId: destination.descriptor.id,\n index: newIndex\n },\n merge: null\n };\n return impact;\n};\nvar noDisplacedBy = {\n point: origin,\n value: 0\n};\nvar noMovement = {\n displaced: [],\n map: {},\n displacedBy: noDisplacedBy\n};\nvar noImpact = {\n movement: noMovement,\n destination: null,\n merge: null\n};\nvar removeDraggableFromList = memoizeOne(function (remove, list) {\n return list.filter(function (item) {\n return item.descriptor.id !== remove.descriptor.id;\n });\n});\nvar getDragImpact = function (_ref) {\n var pageBorderBoxCenter = _ref.pageBorderBoxCenter,\n draggable = _ref.draggable,\n draggables = _ref.draggables,\n droppables = _ref.droppables,\n previousImpact = _ref.previousImpact,\n viewport = _ref.viewport,\n userDirection = _ref.userDirection,\n onLift = _ref.onLift;\n var destinationId = getDroppableOver({\n target: pageBorderBoxCenter,\n droppables: droppables\n });\n if (!destinationId) {\n return noImpact;\n }\n var destination = droppables[destinationId];\n var insideDestination = getDraggablesInsideDroppable(destination.descriptor.id, draggables);\n var insideDestinationWithoutDraggable = removeDraggableFromList(draggable, insideDestination);\n var pageBorderBoxCenterWithDroppableScrollChange = withDroppableScroll(destination, pageBorderBoxCenter);\n var withMerge = getCombineImpact({\n pageBorderBoxCenterWithDroppableScrollChange: pageBorderBoxCenterWithDroppableScrollChange,\n previousImpact: previousImpact,\n destination: destination,\n insideDestinationWithoutDraggable: insideDestinationWithoutDraggable,\n userDirection: userDirection,\n onLift: onLift\n });\n if (withMerge) {\n return withMerge;\n }\n return getReorderImpact({\n pageBorderBoxCenterWithDroppableScrollChange: pageBorderBoxCenterWithDroppableScrollChange,\n destination: destination,\n draggable: draggable,\n insideDestinationWithoutDraggable: insideDestinationWithoutDraggable,\n previousImpact: previousImpact,\n viewport: viewport,\n userDirection: userDirection,\n onLift: onLift\n });\n};\nvar getHomeLocation = function (descriptor) {\n return {\n index: descriptor.index,\n droppableId: descriptor.droppableId\n };\n};\nvar getHomeOnLift = function (_ref) {\n var draggable = _ref.draggable,\n home = _ref.home,\n draggables = _ref.draggables,\n viewport = _ref.viewport;\n var displacedBy = getDisplacedBy(home.axis, draggable.displaceBy);\n var insideHome = getDraggablesInsideDroppable(home.descriptor.id, draggables);\n var originallyDisplaced = insideHome.slice(draggable.descriptor.index + 1);\n var wasDisplaced = originallyDisplaced.reduce(function (previous, item) {\n previous[item.descriptor.id] = true;\n return previous;\n }, {});\n var onLift = {\n displacedBy: displacedBy,\n wasDisplaced: wasDisplaced\n };\n var displaced = originallyDisplaced.map(function (dimension) {\n return getDisplacement({\n draggable: dimension,\n destination: home,\n previousImpact: noImpact,\n viewport: viewport.frame,\n forceShouldAnimate: false,\n onLift: onLift\n });\n });\n var movement = {\n displaced: displaced,\n map: getDisplacementMap(displaced),\n displacedBy: displacedBy\n };\n var impact = {\n movement: movement,\n destination: getHomeLocation(draggable.descriptor),\n merge: null\n };\n return {\n impact: impact,\n onLift: onLift\n };\n};\nvar getDragPositions = function (_ref) {\n var oldInitial = _ref.initial,\n oldCurrent = _ref.current,\n oldClientBorderBoxCenter = _ref.oldClientBorderBoxCenter,\n newClientBorderBoxCenter = _ref.newClientBorderBoxCenter,\n viewport = _ref.viewport;\n var shift = subtract(newClientBorderBoxCenter, oldClientBorderBoxCenter);\n var initial = function () {\n var client = {\n selection: add(oldInitial.client.selection, shift),\n borderBoxCenter: newClientBorderBoxCenter,\n offset: origin\n };\n var page = {\n selection: add(client.selection, viewport.scroll.initial),\n borderBoxCenter: add(client.selection, viewport.scroll.initial)\n };\n return {\n client: client,\n page: page\n };\n }();\n var current = function () {\n var reverse = negate(shift);\n var offset = add(oldCurrent.client.offset, reverse);\n var client = {\n selection: add(initial.client.selection, offset),\n borderBoxCenter: add(initial.client.borderBoxCenter, offset),\n offset: offset\n };\n var page = {\n selection: add(client.selection, viewport.scroll.current),\n borderBoxCenter: add(client.borderBoxCenter, viewport.scroll.current)\n };\n !isEqual(oldCurrent.client.borderBoxCenter, client.borderBoxCenter) ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"\\n Incorrect new client center position.\\n Expected (\" + oldCurrent.client.borderBoxCenter.x + \", \" + oldCurrent.client.borderBoxCenter.y + \")\\n to equal (\" + client.borderBoxCenter.x + \", \" + client.borderBoxCenter.y + \")\\n \") : invariant(false) : void 0;\n return {\n client: client,\n page: page\n };\n }();\n return {\n current: current,\n initial: initial\n };\n};\nvar offsetDraggable = function (_ref) {\n var draggable = _ref.draggable,\n offset$1 = _ref.offset,\n initialWindowScroll = _ref.initialWindowScroll;\n var client = offset(draggable.client, offset$1);\n var page = withScroll(client, initialWindowScroll);\n var moved = _extends({}, draggable, {\n placeholder: _extends({}, draggable.placeholder, {\n client: client\n }),\n client: client,\n page: page\n });\n return moved;\n};\nvar adjustExistingForAdditionsAndRemovals = function (_ref) {\n var existing = _ref.existing,\n droppables = _ref.droppables,\n addedDraggables = _ref.additions,\n removedDraggables = _ref.removals,\n viewport = _ref.viewport;\n var shifted = {};\n toDroppableList(droppables).forEach(function (droppable) {\n var axis = droppable.axis;\n var original = getDraggablesInsideDroppable(droppable.descriptor.id, existing);\n var toShift = {};\n var addShift = function addShift(id, shift) {\n var previous = toShift[id];\n if (!previous) {\n toShift[id] = shift;\n return;\n }\n toShift[id] = {\n indexChange: previous.indexChange + shift.indexChange,\n offset: add(previous.offset, shift.offset)\n };\n };\n var removals = toDraggableMap(removedDraggables.map(function (id) {\n var item = existing[id];\n !item ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Could not find removed draggable \\\"\" + id + \"\\\"\") : invariant(false) : void 0;\n return item;\n }).filter(function (draggable) {\n return draggable.descriptor.droppableId === droppable.descriptor.id;\n }));\n var withRemovals = original.filter(function (item, index) {\n var isBeingRemoved = Boolean(removals[item.descriptor.id]);\n if (!isBeingRemoved) {\n return true;\n }\n var offset = negate(patch(axis.line, item.displaceBy[axis.line]));\n original.slice(index).forEach(function (sibling) {\n if (removals[sibling.descriptor.id]) {\n return;\n }\n addShift(sibling.descriptor.id, {\n indexChange: -1,\n offset: offset\n });\n });\n return false;\n });\n var additions = addedDraggables.filter(function (draggable) {\n return draggable.descriptor.droppableId === droppable.descriptor.id;\n });\n var withAdditions = withRemovals.slice(0);\n additions.forEach(function (item) {\n withAdditions.splice(item.descriptor.index, 0, item);\n });\n var additionMap = toDraggableMap(additions);\n withAdditions.forEach(function (item, index) {\n var wasAdded = Boolean(additionMap[item.descriptor.id]);\n if (!wasAdded) {\n return;\n }\n var offset = patch(axis.line, item.client.marginBox[axis.size]);\n withAdditions.slice(index).forEach(function (sibling) {\n if (additionMap[sibling.descriptor.id]) {\n return;\n }\n addShift(sibling.descriptor.id, {\n indexChange: 1,\n offset: offset\n });\n });\n });\n withAdditions.forEach(function (item) {\n if (additionMap[item.descriptor.id]) {\n return;\n }\n var shift = toShift[item.descriptor.id];\n if (!shift) {\n return;\n }\n var moved = offsetDraggable({\n draggable: item,\n offset: shift.offset,\n initialWindowScroll: viewport.scroll.initial\n });\n var index = item.descriptor.index + shift.indexChange;\n var updated = _extends({}, moved, {\n descriptor: _extends({}, item.descriptor, {\n index: index\n })\n });\n shifted[moved.descriptor.id] = updated;\n });\n });\n var map = _extends({}, existing, shifted);\n return map;\n};\nvar adjustAdditionsForScrollChanges = function (_ref) {\n var additions = _ref.additions,\n updatedDroppables = _ref.updatedDroppables,\n viewport = _ref.viewport;\n var windowScrollChange = viewport.scroll.diff.value;\n return additions.map(function (draggable) {\n var droppableId = draggable.descriptor.droppableId;\n var modified = updatedDroppables[droppableId];\n var frame = modified.frame;\n !frame ? process.env.NODE_ENV !== \"production\" ? invariant(false) : invariant(false) : void 0;\n var droppableScrollChange = frame.scroll.diff.value;\n var totalChange = add(windowScrollChange, droppableScrollChange);\n var moved = offsetDraggable({\n draggable: draggable,\n offset: totalChange,\n initialWindowScroll: viewport.scroll.initial\n });\n return moved;\n });\n};\nvar adjustAdditionsForCollapsedHome = function (_ref) {\n var additions = _ref.additions,\n dragging = _ref.dragging,\n home = _ref.home,\n viewport = _ref.viewport;\n var displacedBy = getDisplacedBy(home.axis, dragging.displaceBy);\n return additions.map(function (draggable) {\n if (draggable.descriptor.droppableId !== home.descriptor.id) {\n return draggable;\n }\n if (draggable.descriptor.index < dragging.descriptor.index) {\n return draggable;\n }\n return offsetDraggable({\n draggable: draggable,\n offset: displacedBy.point,\n initialWindowScroll: viewport.scroll.initial\n });\n });\n};\nvar updateDraggables = function (_ref) {\n var updatedDroppables = _ref.updatedDroppables,\n criticalId = _ref.criticalId,\n unmodifiedExisting = _ref.existing,\n unmodifiedAdditions = _ref.additions,\n removals = _ref.removals,\n viewport = _ref.viewport;\n var existing = adjustExistingForAdditionsAndRemovals({\n droppables: updatedDroppables,\n existing: unmodifiedExisting,\n additions: unmodifiedAdditions,\n removals: removals,\n viewport: viewport\n });\n var dragging = existing[criticalId];\n var home = updatedDroppables[dragging.descriptor.droppableId];\n var scrolledAdditions = adjustAdditionsForScrollChanges({\n additions: unmodifiedAdditions,\n updatedDroppables: updatedDroppables,\n viewport: viewport\n });\n var additions = adjustAdditionsForCollapsedHome({\n additions: scrolledAdditions,\n dragging: dragging,\n home: home,\n viewport: viewport\n });\n var map = _extends({}, existing, toDraggableMap(additions));\n removals.forEach(function (id) {\n delete map[id];\n });\n return map;\n};\nvar getMaxScroll = function (_ref) {\n var scrollHeight = _ref.scrollHeight,\n scrollWidth = _ref.scrollWidth,\n height = _ref.height,\n width = _ref.width;\n var maxScroll = subtract({\n x: scrollWidth,\n y: scrollHeight\n }, {\n x: width,\n y: height\n });\n var adjustedMaxScroll = {\n x: Math.max(0, maxScroll.x),\n y: Math.max(0, maxScroll.y)\n };\n return adjustedMaxScroll;\n};\nvar getDroppableDimension = function (_ref) {\n var descriptor = _ref.descriptor,\n isEnabled = _ref.isEnabled,\n isCombineEnabled = _ref.isCombineEnabled,\n isFixedOnPage = _ref.isFixedOnPage,\n direction = _ref.direction,\n client = _ref.client,\n page = _ref.page,\n closest = _ref.closest;\n var frame = function () {\n if (!closest) {\n return null;\n }\n var scrollSize = closest.scrollSize,\n frameClient = closest.client;\n var maxScroll = getMaxScroll({\n scrollHeight: scrollSize.scrollHeight,\n scrollWidth: scrollSize.scrollWidth,\n height: frameClient.paddingBox.height,\n width: frameClient.paddingBox.width\n });\n return {\n pageMarginBox: closest.page.marginBox,\n frameClient: frameClient,\n scrollSize: scrollSize,\n shouldClipSubject: closest.shouldClipSubject,\n scroll: {\n initial: closest.scroll,\n current: closest.scroll,\n max: maxScroll,\n diff: {\n value: origin,\n displacement: origin\n }\n }\n };\n }();\n var axis = direction === 'vertical' ? vertical : horizontal;\n var subject = getSubject({\n page: page,\n withPlaceholder: null,\n axis: axis,\n frame: frame\n });\n var dimension = {\n descriptor: descriptor,\n isCombineEnabled: isCombineEnabled,\n isFixedOnPage: isFixedOnPage,\n axis: axis,\n isEnabled: isEnabled,\n client: client,\n page: page,\n frame: frame,\n subject: subject\n };\n return dimension;\n};\nvar isHomeOf = function (draggable, destination) {\n return draggable.descriptor.droppableId === destination.descriptor.id;\n};\nvar getRequiredGrowthForPlaceholder = function getRequiredGrowthForPlaceholder(droppable, placeholderSize, draggables) {\n var axis = droppable.axis;\n var availableSpace = droppable.subject.page.contentBox[axis.size];\n var insideDroppable = getDraggablesInsideDroppable(droppable.descriptor.id, draggables);\n var spaceUsed = insideDroppable.reduce(function (sum, dimension) {\n return sum + dimension.client.marginBox[axis.size];\n }, 0);\n var requiredSpace = spaceUsed + placeholderSize[axis.line];\n var needsToGrowBy = requiredSpace - availableSpace;\n if (needsToGrowBy <= 0) {\n return null;\n }\n return patch(axis.line, needsToGrowBy);\n};\nvar withMaxScroll = function withMaxScroll(frame, max) {\n return _extends({}, frame, {\n scroll: _extends({}, frame.scroll, {\n max: max\n })\n });\n};\nvar addPlaceholder = function addPlaceholder(droppable, draggable, draggables) {\n var frame = droppable.frame;\n !!isHomeOf(draggable, droppable) ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Should not add placeholder space to home list') : invariant(false) : void 0;\n !!droppable.subject.withPlaceholder ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot add placeholder size to a subject when it already has one') : invariant(false) : void 0;\n var placeholderSize = getDisplacedBy(droppable.axis, draggable.displaceBy).point;\n var requiredGrowth = getRequiredGrowthForPlaceholder(droppable, placeholderSize, draggables);\n var added = {\n placeholderSize: placeholderSize,\n increasedBy: requiredGrowth,\n oldFrameMaxScroll: droppable.frame ? droppable.frame.scroll.max : null\n };\n if (!frame) {\n var _subject = getSubject({\n page: droppable.subject.page,\n withPlaceholder: added,\n axis: droppable.axis,\n frame: droppable.frame\n });\n return _extends({}, droppable, {\n subject: _subject\n });\n }\n var maxScroll = requiredGrowth ? add(frame.scroll.max, requiredGrowth) : frame.scroll.max;\n var newFrame = withMaxScroll(frame, maxScroll);\n var subject = getSubject({\n page: droppable.subject.page,\n withPlaceholder: added,\n axis: droppable.axis,\n frame: newFrame\n });\n return _extends({}, droppable, {\n subject: subject,\n frame: newFrame\n });\n};\nvar removePlaceholder = function removePlaceholder(droppable) {\n var added = droppable.subject.withPlaceholder;\n !added ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot remove placeholder form subject when there was none') : invariant(false) : void 0;\n var frame = droppable.frame;\n if (!frame) {\n var _subject2 = getSubject({\n page: droppable.subject.page,\n axis: droppable.axis,\n frame: null,\n withPlaceholder: null\n });\n return _extends({}, droppable, {\n subject: _subject2\n });\n }\n var oldMaxScroll = added.oldFrameMaxScroll;\n !oldMaxScroll ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Expected droppable with frame to have old max frame scroll when removing placeholder') : invariant(false) : void 0;\n var newFrame = withMaxScroll(frame, oldMaxScroll);\n var subject = getSubject({\n page: droppable.subject.page,\n axis: droppable.axis,\n frame: newFrame,\n withPlaceholder: null\n });\n return _extends({}, droppable, {\n subject: subject,\n frame: newFrame\n });\n};\nvar getFrame = function (droppable) {\n var frame = droppable.frame;\n !frame ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Expected Droppable to have a frame') : invariant(false) : void 0;\n return frame;\n};\nvar throwIfSpacingChange = function throwIfSpacingChange(old, fresh) {\n if (process.env.NODE_ENV !== 'production') {\n var getMessage = function getMessage(spacingType) {\n return \"Cannot change the \" + spacingType + \" of a Droppable during a drag\";\n };\n !isEqual$1(old.margin, fresh.margin) ? process.env.NODE_ENV !== \"production\" ? invariant(false, getMessage('margin')) : invariant(false) : void 0;\n !isEqual$1(old.border, fresh.border) ? process.env.NODE_ENV !== \"production\" ? invariant(false, getMessage('border')) : invariant(false) : void 0;\n !isEqual$1(old.padding, fresh.padding) ? process.env.NODE_ENV !== \"production\" ? invariant(false, getMessage('padding')) : invariant(false) : void 0;\n }\n};\nvar adjustBorderBoxSize = function adjustBorderBoxSize(axis, old, fresh) {\n return {\n top: old.top,\n left: old.left,\n right: old.left + fresh.width,\n bottom: old.top + fresh.height\n };\n};\nvar updateDroppables = function (_ref) {\n var modified = _ref.modified,\n existing = _ref.existing,\n viewport = _ref.viewport;\n if (!modified.length) {\n return existing;\n }\n var adjusted = modified.map(function (provided) {\n var raw = existing[provided.descriptor.id];\n !raw ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Could not locate droppable in existing droppables') : invariant(false) : void 0;\n var hasPlaceholder = Boolean(raw.subject.withPlaceholder);\n var dimension = hasPlaceholder ? removePlaceholder(raw) : raw;\n var oldClient = dimension.client;\n var newClient = provided.client;\n var oldScrollable = getFrame(dimension);\n var newScrollable = getFrame(provided);\n if (process.env.NODE_ENV !== 'production') {\n throwIfSpacingChange(dimension.client, provided.client);\n throwIfSpacingChange(oldScrollable.frameClient, newScrollable.frameClient);\n var isFrameEqual = oldScrollable.frameClient.borderBox.height === newScrollable.frameClient.borderBox.height && oldScrollable.frameClient.borderBox.width === newScrollable.frameClient.borderBox.width;\n !isFrameEqual ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'The width and height of your Droppable scroll container cannot change when adding or removing Draggables during a drag') : invariant(false) : void 0;\n }\n var client = createBox({\n borderBox: adjustBorderBoxSize(dimension.axis, oldClient.borderBox, newClient.borderBox),\n margin: oldClient.margin,\n border: oldClient.border,\n padding: oldClient.padding\n });\n var closest = {\n client: oldScrollable.frameClient,\n page: withScroll(oldScrollable.frameClient, viewport.scroll.initial),\n shouldClipSubject: oldScrollable.shouldClipSubject,\n scrollSize: newScrollable.scrollSize,\n scroll: oldScrollable.scroll.initial\n };\n var withSizeChanged = getDroppableDimension({\n descriptor: provided.descriptor,\n isEnabled: provided.isEnabled,\n isCombineEnabled: provided.isCombineEnabled,\n isFixedOnPage: provided.isFixedOnPage,\n direction: provided.axis.direction,\n client: client,\n page: withScroll(client, viewport.scroll.initial),\n closest: closest\n });\n var scrolled = scrollDroppable(withSizeChanged, newScrollable.scroll.current);\n return scrolled;\n });\n var result = _extends({}, existing, toDroppableMap(adjusted));\n return result;\n};\nvar withNoAnimatedDisplacement = function (impact) {\n var displaced = impact.movement.displaced;\n if (!displaced.length) {\n return impact;\n }\n var withoutAnimation = displaced.map(function (displacement) {\n if (!displacement.isVisible) {\n return displacement;\n }\n if (!displacement.shouldAnimate) {\n return displacement;\n }\n return _extends({}, displacement, {\n shouldAnimate: false\n });\n });\n var result = _extends({}, impact, {\n movement: _extends({}, impact.movement, {\n displaced: withoutAnimation,\n map: getDisplacementMap(withoutAnimation)\n })\n });\n return result;\n};\nvar patchDroppableMap = function (droppables, updated) {\n var _extends2;\n return _extends({}, droppables, (_extends2 = {}, _extends2[updated.descriptor.id] = updated, _extends2));\n};\nvar clearUnusedPlaceholder = function clearUnusedPlaceholder(_ref) {\n var previousImpact = _ref.previousImpact,\n impact = _ref.impact,\n droppables = _ref.droppables;\n var last = whatIsDraggedOver(previousImpact);\n var now = whatIsDraggedOver(impact);\n if (!last) {\n return droppables;\n }\n if (last === now) {\n return droppables;\n }\n var lastDroppable = droppables[last];\n if (!lastDroppable.subject.withPlaceholder) {\n return droppables;\n }\n var updated = removePlaceholder(lastDroppable);\n return patchDroppableMap(droppables, updated);\n};\nvar recomputePlaceholders = function (_ref2) {\n var draggable = _ref2.draggable,\n draggables = _ref2.draggables,\n droppables = _ref2.droppables,\n previousImpact = _ref2.previousImpact,\n impact = _ref2.impact;\n var cleaned = clearUnusedPlaceholder({\n previousImpact: previousImpact,\n impact: impact,\n droppables: droppables\n });\n var isOver = whatIsDraggedOver(impact);\n if (!isOver) {\n return cleaned;\n }\n var droppable = droppables[isOver];\n if (isHomeOf(draggable, droppable)) {\n return cleaned;\n }\n if (droppable.subject.withPlaceholder) {\n return cleaned;\n }\n var patched = addPlaceholder(droppable, draggable, draggables);\n return patchDroppableMap(cleaned, patched);\n};\nvar timingsKey = 'Processing dynamic changes';\nvar publishWhileDragging = function (_ref) {\n var _extends2, _extends3;\n var state = _ref.state,\n published = _ref.published;\n start(timingsKey);\n var updatedDroppables = updateDroppables({\n modified: published.modified,\n existing: state.dimensions.droppables,\n viewport: state.viewport\n });\n var draggables = updateDraggables({\n updatedDroppables: updatedDroppables,\n criticalId: state.critical.draggable.id,\n existing: state.dimensions.draggables,\n additions: published.additions,\n removals: published.removals,\n viewport: state.viewport\n });\n var critical = {\n draggable: draggables[state.critical.draggable.id].descriptor,\n droppable: updatedDroppables[state.critical.droppable.id].descriptor\n };\n var original = state.dimensions.draggables[critical.draggable.id];\n var updated = draggables[critical.draggable.id];\n var droppables = recomputePlaceholders({\n draggable: updated,\n draggables: draggables,\n droppables: updatedDroppables,\n previousImpact: state.impact,\n impact: state.impact\n });\n var dimensions = {\n draggables: draggables,\n droppables: droppables\n };\n var _getDragPositions = getDragPositions({\n initial: state.initial,\n current: state.current,\n oldClientBorderBoxCenter: original.client.borderBox.center,\n newClientBorderBoxCenter: updated.client.borderBox.center,\n viewport: state.viewport\n }),\n initial = _getDragPositions.initial,\n current = _getDragPositions.current;\n var _getHomeOnLift = getHomeOnLift({\n draggable: updated,\n home: dimensions.droppables[critical.droppable.id],\n draggables: dimensions.draggables,\n viewport: state.viewport\n }),\n homeImpact = _getHomeOnLift.impact,\n onLift = _getHomeOnLift.onLift;\n var impact = withNoAnimatedDisplacement(getDragImpact({\n pageBorderBoxCenter: current.page.borderBoxCenter,\n draggable: updated,\n draggables: dimensions.draggables,\n droppables: dimensions.droppables,\n previousImpact: homeImpact,\n viewport: state.viewport,\n userDirection: state.userDirection,\n onLift: onLift\n }));\n var isOrphaned = Boolean(state.movementMode === 'SNAP' && !whatIsDraggedOver(impact));\n !!isOrphaned ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Dragging item no longer has a valid merge/destination after a dynamic update. This is not supported') : invariant(false) : void 0;\n finish(timingsKey);\n var draggingState = _extends({\n phase: 'DRAGGING'\n }, state, (_extends2 = {}, _extends2[\"phase\"] = 'DRAGGING', _extends2.critical = critical, _extends2.current = current, _extends2.initial = initial, _extends2.impact = impact, _extends2.dimensions = dimensions, _extends2.onLift = onLift, _extends2.onLiftImpact = homeImpact, _extends2.forceShouldAnimate = false, _extends2));\n if (state.phase === 'COLLECTING') {\n return draggingState;\n }\n var dropPending = _extends({\n phase: 'DROP_PENDING'\n }, draggingState, (_extends3 = {}, _extends3[\"phase\"] = 'DROP_PENDING', _extends3.reason = state.reason, _extends3.isWaiting = false, _extends3));\n return dropPending;\n};\nvar forward = {\n vertical: 'down',\n horizontal: 'right'\n};\nvar backward = {\n vertical: 'up',\n horizontal: 'left'\n};\nvar moveToNextCombine = function (_ref) {\n var isMovingForward = _ref.isMovingForward,\n isInHomeList = _ref.isInHomeList,\n draggable = _ref.draggable,\n destination = _ref.destination,\n originalInsideDestination = _ref.insideDestination,\n previousImpact = _ref.previousImpact;\n if (!destination.isCombineEnabled) {\n return null;\n }\n if (previousImpact.merge) {\n return null;\n }\n var location = previousImpact.destination;\n !location ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Need a previous location to move from into a combine') : invariant(false) : void 0;\n var currentIndex = location.index;\n var currentInsideDestination = function () {\n var shallow = originalInsideDestination.slice();\n if (isInHomeList) {\n shallow.splice(draggable.descriptor.index, 1);\n }\n shallow.splice(location.index, 0, draggable);\n return shallow;\n }();\n var targetIndex = isMovingForward ? currentIndex + 1 : currentIndex - 1;\n if (targetIndex < 0) {\n return null;\n }\n if (targetIndex > currentInsideDestination.length - 1) {\n return null;\n }\n var target = currentInsideDestination[targetIndex];\n !(target !== draggable) ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot combine with self') : invariant(false) : void 0;\n var merge = {\n whenEntered: isMovingForward ? forward : backward,\n combine: {\n draggableId: target.descriptor.id,\n droppableId: destination.descriptor.id\n }\n };\n var impact = {\n movement: previousImpact.movement,\n destination: null,\n merge: merge\n };\n return impact;\n};\nvar addClosest = function addClosest(add, displaced) {\n var added = {\n draggableId: add.descriptor.id,\n isVisible: true,\n shouldAnimate: true\n };\n return [added].concat(displaced);\n};\nvar removeClosest = function removeClosest(displaced) {\n return displaced.slice(1);\n};\nvar fromReorder = function (_ref) {\n var isMovingForward = _ref.isMovingForward,\n isInHomeList = _ref.isInHomeList,\n draggable = _ref.draggable,\n initialInside = _ref.insideDestination,\n location = _ref.location;\n var insideDestination = initialInside.slice();\n var currentIndex = location.index;\n var isInForeignList = !isInHomeList;\n if (isInForeignList) {\n insideDestination.splice(location.index, 0, draggable);\n }\n var proposedIndex = isMovingForward ? currentIndex + 1 : currentIndex - 1;\n if (proposedIndex < 0) {\n return null;\n }\n if (proposedIndex > insideDestination.length - 1) {\n return null;\n }\n return {\n proposedIndex: proposedIndex,\n modifyDisplacement: true\n };\n};\nvar fromCombine = function (_ref) {\n var isMovingForward = _ref.isMovingForward,\n destination = _ref.destination,\n previousImpact = _ref.previousImpact,\n draggables = _ref.draggables,\n merge = _ref.merge,\n onLift = _ref.onLift;\n if (!destination.isCombineEnabled) {\n return null;\n }\n var movement = previousImpact.movement;\n var combineId = merge.combine.draggableId;\n var combine = draggables[combineId];\n var combineIndex = combine.descriptor.index;\n var wasDisplacedAtStart = didStartDisplaced(combineId, onLift);\n if (wasDisplacedAtStart) {\n var hasDisplacedFromStart = !movement.map[combineId];\n if (hasDisplacedFromStart) {\n if (isMovingForward) {\n return {\n proposedIndex: combineIndex,\n modifyDisplacement: false\n };\n }\n return {\n proposedIndex: combineIndex - 1,\n modifyDisplacement: true\n };\n }\n if (isMovingForward) {\n return {\n proposedIndex: combineIndex,\n modifyDisplacement: true\n };\n }\n return {\n proposedIndex: combineIndex - 1,\n modifyDisplacement: false\n };\n }\n var isDisplaced = Boolean(movement.map[combineId]);\n if (isDisplaced) {\n if (isMovingForward) {\n return {\n proposedIndex: combineIndex + 1,\n modifyDisplacement: true\n };\n }\n return {\n proposedIndex: combineIndex,\n modifyDisplacement: false\n };\n }\n if (isMovingForward) {\n return {\n proposedIndex: combineIndex + 1,\n modifyDisplacement: false\n };\n }\n return {\n proposedIndex: combineIndex,\n modifyDisplacement: true\n };\n};\nvar moveToNextIndex = function (_ref) {\n var isMovingForward = _ref.isMovingForward,\n isInHomeList = _ref.isInHomeList,\n draggable = _ref.draggable,\n draggables = _ref.draggables,\n destination = _ref.destination,\n insideDestination = _ref.insideDestination,\n previousImpact = _ref.previousImpact,\n onLift = _ref.onLift;\n var instruction = function () {\n if (previousImpact.destination) {\n return fromReorder({\n isMovingForward: isMovingForward,\n isInHomeList: isInHomeList,\n draggable: draggable,\n location: previousImpact.destination,\n insideDestination: insideDestination\n });\n }\n if (previousImpact.merge) {\n return fromCombine({\n isMovingForward: isMovingForward,\n destination: destination,\n previousImpact: previousImpact,\n draggables: draggables,\n merge: previousImpact.merge,\n onLift: onLift\n });\n }\n return null;\n }();\n if (instruction == null) {\n return null;\n }\n var proposedIndex = instruction.proposedIndex,\n modifyDisplacement = instruction.modifyDisplacement;\n var displacedBy = getDisplacedBy(destination.axis, draggable.displaceBy);\n var displaced = function () {\n var lastDisplaced = previousImpact.movement.displaced;\n if (!modifyDisplacement) {\n return lastDisplaced;\n }\n if (isMovingForward) {\n return removeClosest(lastDisplaced);\n }\n var withoutDraggable = removeDraggableFromList(draggable, insideDestination);\n var atProposedIndex = withoutDraggable[proposedIndex];\n return addClosest(atProposedIndex, lastDisplaced);\n }();\n return {\n movement: {\n displacedBy: displacedBy,\n displaced: displaced,\n map: getDisplacementMap(displaced)\n },\n destination: {\n droppableId: destination.descriptor.id,\n index: proposedIndex\n },\n merge: null\n };\n};\nvar whenCombining = function (_ref) {\n var combine = _ref.combine,\n onLift = _ref.onLift,\n movement = _ref.movement,\n draggables = _ref.draggables;\n var combineWith = combine.draggableId;\n var center = draggables[combineWith].page.borderBox.center;\n var displaceBy = getCombinedItemDisplacement({\n displaced: movement.map,\n onLift: onLift,\n combineWith: combineWith,\n displacedBy: movement.displacedBy\n });\n return add(center, displaceBy);\n};\nvar distanceFromStartToBorderBoxCenter = function distanceFromStartToBorderBoxCenter(axis, box) {\n return box.margin[axis.start] + box.borderBox[axis.size] / 2;\n};\nvar distanceFromEndToBorderBoxCenter = function distanceFromEndToBorderBoxCenter(axis, box) {\n return box.margin[axis.end] + box.borderBox[axis.size] / 2;\n};\nvar getCrossAxisBorderBoxCenter = function getCrossAxisBorderBoxCenter(axis, target, isMoving) {\n return target[axis.crossAxisStart] + isMoving.margin[axis.crossAxisStart] + isMoving.borderBox[axis.crossAxisSize] / 2;\n};\nvar goAfter = function goAfter(_ref) {\n var axis = _ref.axis,\n moveRelativeTo = _ref.moveRelativeTo,\n isMoving = _ref.isMoving;\n return patch(axis.line, moveRelativeTo.marginBox[axis.end] + distanceFromStartToBorderBoxCenter(axis, isMoving), getCrossAxisBorderBoxCenter(axis, moveRelativeTo.marginBox, isMoving));\n};\nvar goBefore = function goBefore(_ref2) {\n var axis = _ref2.axis,\n moveRelativeTo = _ref2.moveRelativeTo,\n isMoving = _ref2.isMoving;\n return patch(axis.line, moveRelativeTo.marginBox[axis.start] - distanceFromEndToBorderBoxCenter(axis, isMoving), getCrossAxisBorderBoxCenter(axis, moveRelativeTo.marginBox, isMoving));\n};\nvar goIntoStart = function goIntoStart(_ref3) {\n var axis = _ref3.axis,\n moveInto = _ref3.moveInto,\n isMoving = _ref3.isMoving;\n return patch(axis.line, moveInto.contentBox[axis.start] + distanceFromStartToBorderBoxCenter(axis, isMoving), getCrossAxisBorderBoxCenter(axis, moveInto.contentBox, isMoving));\n};\nvar whenReordering = function (_ref) {\n var movement = _ref.movement,\n draggable = _ref.draggable,\n draggables = _ref.draggables,\n droppable = _ref.droppable,\n onLift = _ref.onLift;\n var insideDestination = getDraggablesInsideDroppable(droppable.descriptor.id, draggables);\n var draggablePage = draggable.page;\n var axis = droppable.axis;\n if (!insideDestination.length) {\n return goIntoStart({\n axis: axis,\n moveInto: droppable.page,\n isMoving: draggablePage\n });\n }\n var displaced = movement.displaced,\n displacedBy = movement.displacedBy;\n if (displaced.length) {\n var closestAfter = draggables[displaced[0].draggableId];\n if (didStartDisplaced(closestAfter.descriptor.id, onLift)) {\n return goBefore({\n axis: axis,\n moveRelativeTo: closestAfter.page,\n isMoving: draggablePage\n });\n }\n var withDisplacement = offset(closestAfter.page, displacedBy.point);\n return goBefore({\n axis: axis,\n moveRelativeTo: withDisplacement,\n isMoving: draggablePage\n });\n }\n var last = insideDestination[insideDestination.length - 1];\n if (last.descriptor.id === draggable.descriptor.id) {\n return draggablePage.borderBox.center;\n }\n if (didStartDisplaced(last.descriptor.id, onLift)) {\n var page = offset(last.page, negate(onLift.displacedBy.point));\n return goAfter({\n axis: axis,\n moveRelativeTo: page,\n isMoving: draggablePage\n });\n }\n return goAfter({\n axis: axis,\n moveRelativeTo: last.page,\n isMoving: draggablePage\n });\n};\nvar withDroppableDisplacement = function (droppable, point) {\n var frame = droppable.frame;\n if (!frame) {\n return point;\n }\n return add(point, frame.scroll.diff.displacement);\n};\nvar getResultWithoutDroppableDisplacement = function getResultWithoutDroppableDisplacement(_ref) {\n var impact = _ref.impact,\n draggable = _ref.draggable,\n droppable = _ref.droppable,\n draggables = _ref.draggables,\n onLift = _ref.onLift;\n var merge = impact.merge;\n var destination = impact.destination;\n var original = draggable.page.borderBox.center;\n if (!droppable) {\n return original;\n }\n if (destination) {\n return whenReordering({\n movement: impact.movement,\n draggable: draggable,\n draggables: draggables,\n droppable: droppable,\n onLift: onLift\n });\n }\n if (merge) {\n return whenCombining({\n movement: impact.movement,\n combine: merge.combine,\n draggables: draggables,\n onLift: onLift\n });\n }\n return original;\n};\nvar getPageBorderBoxCenterFromImpact = function (args) {\n var withoutDisplacement = getResultWithoutDroppableDisplacement(args);\n var droppable = args.droppable;\n var withDisplacement = droppable ? withDroppableDisplacement(droppable, withoutDisplacement) : withoutDisplacement;\n return withDisplacement;\n};\nvar scrollViewport = function (viewport, newScroll) {\n var diff = subtract(newScroll, viewport.scroll.initial);\n var displacement = negate(diff);\n var frame = getRect({\n top: newScroll.y,\n bottom: newScroll.y + viewport.frame.height,\n left: newScroll.x,\n right: newScroll.x + viewport.frame.width\n });\n var updated = {\n frame: frame,\n scroll: {\n initial: viewport.scroll.initial,\n max: viewport.scroll.max,\n current: newScroll,\n diff: {\n value: diff,\n displacement: displacement\n }\n }\n };\n return updated;\n};\nvar withNewDisplacement = function (impact, displaced) {\n return _extends({}, impact, {\n movement: _extends({}, impact.movement, {\n displaced: displaced,\n map: getDisplacementMap(displaced)\n })\n });\n};\nvar speculativelyIncrease = function (_ref) {\n var impact = _ref.impact,\n viewport = _ref.viewport,\n destination = _ref.destination,\n draggables = _ref.draggables,\n maxScrollChange = _ref.maxScrollChange,\n onLift = _ref.onLift;\n var displaced = impact.movement.displaced;\n var scrolledViewport = scrollViewport(viewport, add(viewport.scroll.current, maxScrollChange));\n var scrolledDroppable = destination.frame ? scrollDroppable(destination, add(destination.frame.scroll.current, maxScrollChange)) : destination;\n var updated = displaced.map(function (entry) {\n if (entry.isVisible) {\n return entry;\n }\n var draggable = draggables[entry.draggableId];\n var withScrolledViewport = getDisplacement({\n draggable: draggable,\n destination: destination,\n previousImpact: impact,\n viewport: scrolledViewport.frame,\n onLift: onLift,\n forceShouldAnimate: false\n });\n if (withScrolledViewport.isVisible) {\n return withScrolledViewport;\n }\n var withScrolledDroppable = getDisplacement({\n draggable: draggable,\n destination: scrolledDroppable,\n previousImpact: impact,\n viewport: viewport.frame,\n onLift: onLift,\n forceShouldAnimate: false\n });\n if (withScrolledDroppable.isVisible) {\n return withScrolledDroppable;\n }\n return entry;\n });\n return withNewDisplacement(impact, updated);\n};\nvar withViewportDisplacement = function (viewport, point) {\n return add(viewport.scroll.diff.displacement, point);\n};\nvar getClientFromPageBorderBoxCenter = function (_ref) {\n var pageBorderBoxCenter = _ref.pageBorderBoxCenter,\n draggable = _ref.draggable,\n viewport = _ref.viewport;\n var withoutPageScrollChange = withViewportDisplacement(viewport, pageBorderBoxCenter);\n var offset = subtract(withoutPageScrollChange, draggable.page.borderBox.center);\n return add(draggable.client.borderBox.center, offset);\n};\nvar isTotallyVisibleInNewLocation = function (_ref) {\n var draggable = _ref.draggable,\n destination = _ref.destination,\n newPageBorderBoxCenter = _ref.newPageBorderBoxCenter,\n viewport = _ref.viewport,\n withDroppableDisplacement = _ref.withDroppableDisplacement,\n _ref$onlyOnMainAxis = _ref.onlyOnMainAxis,\n onlyOnMainAxis = _ref$onlyOnMainAxis === void 0 ? false : _ref$onlyOnMainAxis;\n var changeNeeded = subtract(newPageBorderBoxCenter, draggable.page.borderBox.center);\n var shifted = offsetByPosition(draggable.page.borderBox, changeNeeded);\n var args = {\n target: shifted,\n destination: destination,\n withDroppableDisplacement: withDroppableDisplacement,\n viewport: viewport\n };\n return onlyOnMainAxis ? isTotallyVisibleOnAxis(args) : isTotallyVisible(args);\n};\nvar moveToNextPlace = function (_ref) {\n var isMovingForward = _ref.isMovingForward,\n draggable = _ref.draggable,\n destination = _ref.destination,\n draggables = _ref.draggables,\n previousImpact = _ref.previousImpact,\n viewport = _ref.viewport,\n previousPageBorderBoxCenter = _ref.previousPageBorderBoxCenter,\n previousClientSelection = _ref.previousClientSelection,\n onLift = _ref.onLift;\n if (!destination.isEnabled) {\n return null;\n }\n var insideDestination = getDraggablesInsideDroppable(destination.descriptor.id, draggables);\n var isInHomeList = isHomeOf(draggable, destination);\n var impact = moveToNextCombine({\n isInHomeList: isInHomeList,\n isMovingForward: isMovingForward,\n draggable: draggable,\n destination: destination,\n insideDestination: insideDestination,\n previousImpact: previousImpact\n }) || moveToNextIndex({\n isMovingForward: isMovingForward,\n isInHomeList: isInHomeList,\n draggable: draggable,\n draggables: draggables,\n destination: destination,\n insideDestination: insideDestination,\n previousImpact: previousImpact,\n onLift: onLift\n });\n if (!impact) {\n return null;\n }\n var pageBorderBoxCenter = getPageBorderBoxCenterFromImpact({\n impact: impact,\n draggable: draggable,\n droppable: destination,\n draggables: draggables,\n onLift: onLift\n });\n var isVisibleInNewLocation = isTotallyVisibleInNewLocation({\n draggable: draggable,\n destination: destination,\n newPageBorderBoxCenter: pageBorderBoxCenter,\n viewport: viewport.frame,\n withDroppableDisplacement: false,\n onlyOnMainAxis: true\n });\n if (isVisibleInNewLocation) {\n var clientSelection = getClientFromPageBorderBoxCenter({\n pageBorderBoxCenter: pageBorderBoxCenter,\n draggable: draggable,\n viewport: viewport\n });\n return {\n clientSelection: clientSelection,\n impact: impact,\n scrollJumpRequest: null\n };\n }\n var distance = subtract(pageBorderBoxCenter, previousPageBorderBoxCenter);\n var cautious = speculativelyIncrease({\n impact: impact,\n viewport: viewport,\n destination: destination,\n draggables: draggables,\n maxScrollChange: distance,\n onLift: onLift\n });\n return {\n clientSelection: previousClientSelection,\n impact: cautious,\n scrollJumpRequest: distance\n };\n};\nvar getKnownActive = function getKnownActive(droppable) {\n var rect = droppable.subject.active;\n !rect ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot get clipped area from droppable') : invariant(false) : void 0;\n return rect;\n};\nvar getBestCrossAxisDroppable = function (_ref) {\n var isMovingForward = _ref.isMovingForward,\n pageBorderBoxCenter = _ref.pageBorderBoxCenter,\n source = _ref.source,\n droppables = _ref.droppables,\n viewport = _ref.viewport;\n var active = source.subject.active;\n if (!active) {\n return null;\n }\n var axis = source.axis;\n var isBetweenSourceClipped = isWithin(active[axis.start], active[axis.end]);\n var candidates = toDroppableList(droppables).filter(function (droppable) {\n return droppable !== source;\n }).filter(function (droppable) {\n return droppable.isEnabled;\n }).filter(function (droppable) {\n return Boolean(droppable.subject.active);\n }).filter(function (droppable) {\n return isPartiallyVisibleThroughFrame(viewport.frame)(getKnownActive(droppable));\n }).filter(function (droppable) {\n var activeOfTarget = getKnownActive(droppable);\n if (isMovingForward) {\n return active[axis.crossAxisEnd] < activeOfTarget[axis.crossAxisEnd];\n }\n return activeOfTarget[axis.crossAxisStart] < active[axis.crossAxisStart];\n }).filter(function (droppable) {\n var activeOfTarget = getKnownActive(droppable);\n var isBetweenDestinationClipped = isWithin(activeOfTarget[axis.start], activeOfTarget[axis.end]);\n return isBetweenSourceClipped(activeOfTarget[axis.start]) || isBetweenSourceClipped(activeOfTarget[axis.end]) || isBetweenDestinationClipped(active[axis.start]) || isBetweenDestinationClipped(active[axis.end]);\n }).sort(function (a, b) {\n var first = getKnownActive(a)[axis.crossAxisStart];\n var second = getKnownActive(b)[axis.crossAxisStart];\n if (isMovingForward) {\n return first - second;\n }\n return second - first;\n }).filter(function (droppable, index, array) {\n return getKnownActive(droppable)[axis.crossAxisStart] === getKnownActive(array[0])[axis.crossAxisStart];\n });\n if (!candidates.length) {\n return null;\n }\n if (candidates.length === 1) {\n return candidates[0];\n }\n var contains = candidates.filter(function (droppable) {\n var isWithinDroppable = isWithin(getKnownActive(droppable)[axis.start], getKnownActive(droppable)[axis.end]);\n return isWithinDroppable(pageBorderBoxCenter[axis.line]);\n });\n if (contains.length === 1) {\n return contains[0];\n }\n if (contains.length > 1) {\n return contains.sort(function (a, b) {\n return getKnownActive(a)[axis.start] - getKnownActive(b)[axis.start];\n })[0];\n }\n return candidates.sort(function (a, b) {\n var first = closest(pageBorderBoxCenter, getCorners(getKnownActive(a)));\n var second = closest(pageBorderBoxCenter, getCorners(getKnownActive(b)));\n if (first !== second) {\n return first - second;\n }\n return getKnownActive(a)[axis.start] - getKnownActive(b)[axis.start];\n })[0];\n};\nvar getCurrentPageBorderBoxCenter = function getCurrentPageBorderBoxCenter(draggable, onLift) {\n var original = draggable.page.borderBox.center;\n return didStartDisplaced(draggable.descriptor.id, onLift) ? subtract(original, onLift.displacedBy.point) : original;\n};\nvar getCurrentPageBorderBox = function getCurrentPageBorderBox(draggable, onLift) {\n var original = draggable.page.borderBox;\n return didStartDisplaced(draggable.descriptor.id, onLift) ? offsetByPosition(original, negate(onLift.displacedBy.point)) : original;\n};\nvar getClosestDraggable = function (_ref) {\n var pageBorderBoxCenter = _ref.pageBorderBoxCenter,\n viewport = _ref.viewport,\n destination = _ref.destination,\n insideDestination = _ref.insideDestination,\n onLift = _ref.onLift;\n var sorted = insideDestination.filter(function (draggable) {\n return isTotallyVisible({\n target: getCurrentPageBorderBox(draggable, onLift),\n destination: destination,\n viewport: viewport.frame,\n withDroppableDisplacement: true\n });\n }).sort(function (a, b) {\n var distanceToA = distance(pageBorderBoxCenter, withDroppableDisplacement(destination, getCurrentPageBorderBoxCenter(a, onLift)));\n var distanceToB = distance(pageBorderBoxCenter, withDroppableDisplacement(destination, getCurrentPageBorderBoxCenter(b, onLift)));\n if (distanceToA < distanceToB) {\n return -1;\n }\n if (distanceToB < distanceToA) {\n return 1;\n }\n return a.descriptor.index - b.descriptor.index;\n });\n return sorted[0] || null;\n};\nvar moveToNewDroppable = function (_ref) {\n var previousPageBorderBoxCenter = _ref.previousPageBorderBoxCenter,\n moveRelativeTo = _ref.moveRelativeTo,\n insideDestination = _ref.insideDestination,\n draggable = _ref.draggable,\n draggables = _ref.draggables,\n destination = _ref.destination,\n previousImpact = _ref.previousImpact,\n viewport = _ref.viewport,\n onLift = _ref.onLift;\n if (!moveRelativeTo) {\n if (insideDestination.length) {\n return null;\n }\n var proposed = {\n movement: noMovement,\n destination: {\n droppableId: destination.descriptor.id,\n index: 0\n },\n merge: null\n };\n var proposedPageBorderBoxCenter = getPageBorderBoxCenterFromImpact({\n impact: proposed,\n draggable: draggable,\n droppable: destination,\n draggables: draggables,\n onLift: onLift\n });\n var withPlaceholder = isHomeOf(draggable, destination) ? destination : addPlaceholder(destination, draggable, draggables);\n var isVisibleInNewLocation = isTotallyVisibleInNewLocation({\n draggable: draggable,\n destination: withPlaceholder,\n newPageBorderBoxCenter: proposedPageBorderBoxCenter,\n viewport: viewport.frame,\n withDroppableDisplacement: false,\n onlyOnMainAxis: true\n });\n return isVisibleInNewLocation ? proposed : null;\n }\n var isGoingBeforeTarget = Boolean(previousPageBorderBoxCenter[destination.axis.line] < moveRelativeTo.page.borderBox.center[destination.axis.line]);\n var targetIndex = insideDestination.indexOf(moveRelativeTo);\n !(targetIndex !== -1) ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot find target in list') : invariant(false) : void 0;\n var proposedIndex = function () {\n if (moveRelativeTo.descriptor.id === draggable.descriptor.id) {\n return targetIndex;\n }\n if (isGoingBeforeTarget) {\n return targetIndex;\n }\n return targetIndex + 1;\n }();\n var displaced = removeDraggableFromList(draggable, insideDestination).slice(proposedIndex).map(function (dimension) {\n return getDisplacement({\n draggable: dimension,\n destination: destination,\n viewport: viewport.frame,\n previousImpact: previousImpact,\n onLift: onLift\n });\n });\n var displacedBy = getDisplacedBy(destination.axis, draggable.displaceBy);\n var impact = {\n movement: {\n displacedBy: displacedBy,\n displaced: displaced,\n map: getDisplacementMap(displaced)\n },\n destination: {\n droppableId: destination.descriptor.id,\n index: proposedIndex\n },\n merge: null\n };\n return impact;\n};\nvar moveCrossAxis = function (_ref) {\n var isMovingForward = _ref.isMovingForward,\n previousPageBorderBoxCenter = _ref.previousPageBorderBoxCenter,\n draggable = _ref.draggable,\n isOver = _ref.isOver,\n draggables = _ref.draggables,\n droppables = _ref.droppables,\n previousImpact = _ref.previousImpact,\n viewport = _ref.viewport,\n onLift = _ref.onLift;\n var destination = getBestCrossAxisDroppable({\n isMovingForward: isMovingForward,\n pageBorderBoxCenter: previousPageBorderBoxCenter,\n source: isOver,\n droppables: droppables,\n viewport: viewport\n });\n if (!destination) {\n return null;\n }\n var insideDestination = getDraggablesInsideDroppable(destination.descriptor.id, draggables);\n var moveRelativeTo = getClosestDraggable({\n pageBorderBoxCenter: previousPageBorderBoxCenter,\n viewport: viewport,\n destination: destination,\n insideDestination: insideDestination,\n onLift: onLift\n });\n var impact = moveToNewDroppable({\n previousPageBorderBoxCenter: previousPageBorderBoxCenter,\n destination: destination,\n draggable: draggable,\n draggables: draggables,\n moveRelativeTo: moveRelativeTo,\n insideDestination: insideDestination,\n previousImpact: previousImpact,\n viewport: viewport,\n onLift: onLift\n });\n if (!impact) {\n return null;\n }\n var pageBorderBoxCenter = getPageBorderBoxCenterFromImpact({\n impact: impact,\n draggable: draggable,\n droppable: destination,\n draggables: draggables,\n onLift: onLift\n });\n var clientSelection = getClientFromPageBorderBoxCenter({\n pageBorderBoxCenter: pageBorderBoxCenter,\n draggable: draggable,\n viewport: viewport\n });\n return {\n clientSelection: clientSelection,\n impact: impact,\n scrollJumpRequest: null\n };\n};\nvar getDroppableOver$1 = function getDroppableOver(impact, droppables) {\n var id = whatIsDraggedOver(impact);\n return id ? droppables[id] : null;\n};\nvar moveInDirection = function (_ref) {\n var state = _ref.state,\n type = _ref.type;\n var isActuallyOver = getDroppableOver$1(state.impact, state.dimensions.droppables);\n var isMainAxisMovementAllowed = Boolean(isActuallyOver);\n var home = state.dimensions.droppables[state.critical.droppable.id];\n var isOver = isActuallyOver || home;\n var direction = isOver.axis.direction;\n var isMovingOnMainAxis = direction === 'vertical' && (type === 'MOVE_UP' || type === 'MOVE_DOWN') || direction === 'horizontal' && (type === 'MOVE_LEFT' || type === 'MOVE_RIGHT');\n if (isMovingOnMainAxis && !isMainAxisMovementAllowed) {\n return null;\n }\n var isMovingForward = type === 'MOVE_DOWN' || type === 'MOVE_RIGHT';\n var draggable = state.dimensions.draggables[state.critical.draggable.id];\n var previousPageBorderBoxCenter = state.current.page.borderBoxCenter;\n var _state$dimensions = state.dimensions,\n draggables = _state$dimensions.draggables,\n droppables = _state$dimensions.droppables;\n return isMovingOnMainAxis ? moveToNextPlace({\n isMovingForward: isMovingForward,\n previousPageBorderBoxCenter: previousPageBorderBoxCenter,\n draggable: draggable,\n destination: isOver,\n draggables: draggables,\n viewport: state.viewport,\n previousClientSelection: state.current.client.selection,\n previousImpact: state.impact,\n onLift: state.onLift\n }) : moveCrossAxis({\n isMovingForward: isMovingForward,\n previousPageBorderBoxCenter: previousPageBorderBoxCenter,\n draggable: draggable,\n isOver: isOver,\n draggables: draggables,\n droppables: droppables,\n previousImpact: state.impact,\n viewport: state.viewport,\n onLift: state.onLift\n });\n};\nfunction isMovementAllowed(state) {\n return state.phase === 'DRAGGING' || state.phase === 'COLLECTING';\n}\nvar getVertical = function getVertical(previous, diff) {\n if (diff === 0) {\n return previous;\n }\n return diff > 0 ? 'down' : 'up';\n};\nvar getHorizontal = function getHorizontal(previous, diff) {\n if (diff === 0) {\n return previous;\n }\n return diff > 0 ? 'right' : 'left';\n};\nvar getUserDirection = function (previous, oldPageBorderBoxCenter, newPageBorderBoxCenter) {\n var diff = subtract(newPageBorderBoxCenter, oldPageBorderBoxCenter);\n return {\n horizontal: getHorizontal(previous.horizontal, diff.x),\n vertical: getVertical(previous.vertical, diff.y)\n };\n};\nvar update = function (_ref) {\n var state = _ref.state,\n forcedClientSelection = _ref.clientSelection,\n forcedDimensions = _ref.dimensions,\n forcedViewport = _ref.viewport,\n forcedImpact = _ref.impact,\n scrollJumpRequest = _ref.scrollJumpRequest;\n var viewport = forcedViewport || state.viewport;\n var currentWindowScroll = viewport.scroll.current;\n var dimensions = forcedDimensions || state.dimensions;\n var clientSelection = forcedClientSelection || state.current.client.selection;\n var offset = subtract(clientSelection, state.initial.client.selection);\n var client = {\n offset: offset,\n selection: clientSelection,\n borderBoxCenter: add(state.initial.client.borderBoxCenter, offset)\n };\n var page = {\n selection: add(client.selection, currentWindowScroll),\n borderBoxCenter: add(client.borderBoxCenter, currentWindowScroll)\n };\n var current = {\n client: client,\n page: page\n };\n var userDirection = getUserDirection(state.userDirection, state.current.page.borderBoxCenter, current.page.borderBoxCenter);\n if (state.phase === 'COLLECTING') {\n return _extends({\n phase: 'COLLECTING'\n }, state, {\n dimensions: dimensions,\n viewport: viewport,\n current: current,\n userDirection: userDirection\n });\n }\n var draggable = dimensions.draggables[state.critical.draggable.id];\n var newImpact = forcedImpact || getDragImpact({\n pageBorderBoxCenter: page.borderBoxCenter,\n draggable: draggable,\n draggables: dimensions.draggables,\n droppables: dimensions.droppables,\n previousImpact: state.impact,\n viewport: viewport,\n userDirection: userDirection,\n onLift: state.onLift\n });\n var withUpdatedPlaceholders = recomputePlaceholders({\n draggable: draggable,\n impact: newImpact,\n previousImpact: state.impact,\n draggables: dimensions.draggables,\n droppables: dimensions.droppables\n });\n var result = _extends({}, state, {\n current: current,\n userDirection: userDirection,\n dimensions: {\n draggables: dimensions.draggables,\n droppables: withUpdatedPlaceholders\n },\n impact: newImpact,\n viewport: viewport,\n scrollJumpRequest: scrollJumpRequest || null,\n forceShouldAnimate: scrollJumpRequest ? false : null\n });\n return result;\n};\nvar recompute = function (_ref) {\n var impact = _ref.impact,\n viewport = _ref.viewport,\n destination = _ref.destination,\n draggables = _ref.draggables,\n onLift = _ref.onLift,\n forceShouldAnimate = _ref.forceShouldAnimate;\n var updated = impact.movement.displaced.map(function (entry) {\n return getDisplacement({\n draggable: draggables[entry.draggableId],\n destination: destination,\n previousImpact: impact,\n viewport: viewport.frame,\n onLift: onLift,\n forceShouldAnimate: forceShouldAnimate\n });\n });\n return withNewDisplacement(impact, updated);\n};\nvar getClientBorderBoxCenter = function (_ref) {\n var impact = _ref.impact,\n draggable = _ref.draggable,\n droppable = _ref.droppable,\n draggables = _ref.draggables,\n viewport = _ref.viewport,\n onLift = _ref.onLift;\n var pageBorderBoxCenter = getPageBorderBoxCenterFromImpact({\n impact: impact,\n draggable: draggable,\n draggables: draggables,\n droppable: droppable,\n onLift: onLift\n });\n return getClientFromPageBorderBoxCenter({\n pageBorderBoxCenter: pageBorderBoxCenter,\n draggable: draggable,\n viewport: viewport\n });\n};\nvar refreshSnap = function (_ref) {\n var state = _ref.state,\n forcedDimensions = _ref.dimensions,\n forcedViewport = _ref.viewport;\n !(state.movementMode === 'SNAP') ? process.env.NODE_ENV !== \"production\" ? invariant(false) : invariant(false) : void 0;\n var needsVisibilityCheck = state.impact;\n var viewport = forcedViewport || state.viewport;\n var dimensions = forcedDimensions || state.dimensions;\n var draggables = dimensions.draggables,\n droppables = dimensions.droppables;\n var draggable = draggables[state.critical.draggable.id];\n var isOver = whatIsDraggedOver(needsVisibilityCheck);\n !isOver ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Must be over a destination in SNAP movement mode') : invariant(false) : void 0;\n var destination = droppables[isOver];\n var impact = recompute({\n impact: needsVisibilityCheck,\n viewport: viewport,\n destination: destination,\n draggables: draggables,\n onLift: state.onLift\n });\n var clientSelection = getClientBorderBoxCenter({\n impact: impact,\n draggable: draggable,\n droppable: destination,\n draggables: draggables,\n viewport: viewport,\n onLift: state.onLift\n });\n return update({\n impact: impact,\n clientSelection: clientSelection,\n state: state,\n dimensions: dimensions,\n viewport: viewport\n });\n};\nvar patchDimensionMap = function (dimensions, updated) {\n return {\n draggables: dimensions.draggables,\n droppables: patchDroppableMap(dimensions.droppables, updated)\n };\n};\nvar isSnapping = function isSnapping(state) {\n return state.movementMode === 'SNAP';\n};\nvar postDroppableChange = function postDroppableChange(state, updated, isEnabledChanging) {\n var dimensions = patchDimensionMap(state.dimensions, updated);\n if (!isSnapping(state) || isEnabledChanging) {\n return update({\n state: state,\n dimensions: dimensions\n });\n }\n return refreshSnap({\n state: state,\n dimensions: dimensions\n });\n};\nvar idle = {\n phase: 'IDLE',\n completed: null,\n shouldFlush: false\n};\nvar reducer = function (state, action) {\n if (state === void 0) {\n state = idle;\n }\n if (action.type === 'CLEAN') {\n return _extends({}, idle, {\n shouldFlush: action.payload.shouldFlush\n });\n }\n if (action.type === 'INITIAL_PUBLISH') {\n !(state.phase === 'IDLE') ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'INITIAL_PUBLISH must come after a IDLE phase') : invariant(false) : void 0;\n var _action$payload = action.payload,\n critical = _action$payload.critical,\n clientSelection = _action$payload.clientSelection,\n viewport = _action$payload.viewport,\n dimensions = _action$payload.dimensions,\n movementMode = _action$payload.movementMode;\n var draggable = dimensions.draggables[critical.draggable.id];\n var home = dimensions.droppables[critical.droppable.id];\n var client = {\n selection: clientSelection,\n borderBoxCenter: draggable.client.borderBox.center,\n offset: origin\n };\n var initial = {\n client: client,\n page: {\n selection: add(client.selection, viewport.scroll.initial),\n borderBoxCenter: add(client.selection, viewport.scroll.initial)\n }\n };\n var isWindowScrollAllowed = toDroppableList(dimensions.droppables).every(function (item) {\n return !item.isFixedOnPage;\n });\n var _getHomeOnLift = getHomeOnLift({\n draggable: draggable,\n home: home,\n draggables: dimensions.draggables,\n viewport: viewport\n }),\n impact = _getHomeOnLift.impact,\n onLift = _getHomeOnLift.onLift;\n var result = {\n phase: 'DRAGGING',\n isDragging: true,\n critical: critical,\n movementMode: movementMode,\n dimensions: dimensions,\n initial: initial,\n current: initial,\n isWindowScrollAllowed: isWindowScrollAllowed,\n impact: impact,\n onLift: onLift,\n onLiftImpact: impact,\n viewport: viewport,\n userDirection: forward,\n scrollJumpRequest: null,\n forceShouldAnimate: null\n };\n return result;\n }\n if (action.type === 'COLLECTION_STARTING') {\n var _extends2;\n if (state.phase === 'COLLECTING' || state.phase === 'DROP_PENDING') {\n return state;\n }\n !(state.phase === 'DRAGGING') ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Collection cannot start from phase \" + state.phase) : invariant(false) : void 0;\n var _result = _extends({\n phase: 'COLLECTING'\n }, state, (_extends2 = {}, _extends2[\"phase\"] = 'COLLECTING', _extends2));\n return _result;\n }\n if (action.type === 'PUBLISH_WHILE_DRAGGING') {\n !(state.phase === 'COLLECTING' || state.phase === 'DROP_PENDING') ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Unexpected \" + action.type + \" received in phase \" + state.phase) : invariant(false) : void 0;\n return publishWhileDragging({\n state: state,\n published: action.payload\n });\n }\n if (action.type === 'MOVE') {\n if (state.phase === 'DROP_PENDING') {\n return state;\n }\n !isMovementAllowed(state) ? process.env.NODE_ENV !== \"production\" ? invariant(false, action.type + \" not permitted in phase \" + state.phase) : invariant(false) : void 0;\n var _clientSelection = action.payload.client;\n if (isEqual(_clientSelection, state.current.client.selection)) {\n return state;\n }\n return update({\n state: state,\n clientSelection: _clientSelection,\n impact: isSnapping(state) ? state.impact : null\n });\n }\n if (action.type === 'UPDATE_DROPPABLE_SCROLL') {\n if (state.phase === 'DROP_PENDING') {\n return state;\n }\n if (state.phase === 'COLLECTING') {\n return state;\n }\n !isMovementAllowed(state) ? process.env.NODE_ENV !== \"production\" ? invariant(false, action.type + \" not permitted in phase \" + state.phase) : invariant(false) : void 0;\n var _action$payload2 = action.payload,\n id = _action$payload2.id,\n offset = _action$payload2.offset;\n var target = state.dimensions.droppables[id];\n if (!target) {\n return state;\n }\n var scrolled = scrollDroppable(target, offset);\n return postDroppableChange(state, scrolled, false);\n }\n if (action.type === 'UPDATE_DROPPABLE_IS_ENABLED') {\n if (state.phase === 'DROP_PENDING') {\n return state;\n }\n !isMovementAllowed(state) ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Attempting to move in an unsupported phase \" + state.phase) : invariant(false) : void 0;\n var _action$payload3 = action.payload,\n _id = _action$payload3.id,\n isEnabled = _action$payload3.isEnabled;\n var _target = state.dimensions.droppables[_id];\n !_target ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Cannot find Droppable[id: \" + _id + \"] to toggle its enabled state\") : invariant(false) : void 0;\n !(_target.isEnabled !== isEnabled) ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Trying to set droppable isEnabled to \" + String(isEnabled) + \"\\n but it is already \" + String(_target.isEnabled)) : invariant(false) : void 0;\n var updated = _extends({}, _target, {\n isEnabled: isEnabled\n });\n return postDroppableChange(state, updated, true);\n }\n if (action.type === 'UPDATE_DROPPABLE_IS_COMBINE_ENABLED') {\n if (state.phase === 'DROP_PENDING') {\n return state;\n }\n !isMovementAllowed(state) ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Attempting to move in an unsupported phase \" + state.phase) : invariant(false) : void 0;\n var _action$payload4 = action.payload,\n _id2 = _action$payload4.id,\n isCombineEnabled = _action$payload4.isCombineEnabled;\n var _target2 = state.dimensions.droppables[_id2];\n !_target2 ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Cannot find Droppable[id: \" + _id2 + \"] to toggle its isCombineEnabled state\") : invariant(false) : void 0;\n !(_target2.isCombineEnabled !== isCombineEnabled) ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Trying to set droppable isCombineEnabled to \" + String(isCombineEnabled) + \"\\n but it is already \" + String(_target2.isCombineEnabled)) : invariant(false) : void 0;\n var _updated = _extends({}, _target2, {\n isCombineEnabled: isCombineEnabled\n });\n return postDroppableChange(state, _updated, true);\n }\n if (action.type === 'MOVE_BY_WINDOW_SCROLL') {\n if (state.phase === 'DROP_PENDING' || state.phase === 'DROP_ANIMATING') {\n return state;\n }\n !isMovementAllowed(state) ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Cannot move by window in phase \" + state.phase) : invariant(false) : void 0;\n !state.isWindowScrollAllowed ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Window scrolling is currently not supported for fixed lists. Aborting drag') : invariant(false) : void 0;\n var newScroll = action.payload.newScroll;\n if (isEqual(state.viewport.scroll.current, newScroll)) {\n return state;\n }\n var _viewport = scrollViewport(state.viewport, newScroll);\n if (isSnapping(state)) {\n return refreshSnap({\n state: state,\n viewport: _viewport\n });\n }\n return update({\n state: state,\n viewport: _viewport\n });\n }\n if (action.type === 'UPDATE_VIEWPORT_MAX_SCROLL') {\n if (!isMovementAllowed(state)) {\n return state;\n }\n var maxScroll = action.payload.maxScroll;\n if (isEqual(maxScroll, state.viewport.scroll.max)) {\n return state;\n }\n var withMaxScroll = _extends({}, state.viewport, {\n scroll: _extends({}, state.viewport.scroll, {\n max: maxScroll\n })\n });\n return _extends({\n phase: 'DRAGGING'\n }, state, {\n viewport: withMaxScroll\n });\n }\n if (action.type === 'MOVE_UP' || action.type === 'MOVE_DOWN' || action.type === 'MOVE_LEFT' || action.type === 'MOVE_RIGHT') {\n if (state.phase === 'COLLECTING' || state.phase === 'DROP_PENDING') {\n return state;\n }\n !(state.phase === 'DRAGGING') ? process.env.NODE_ENV !== \"production\" ? invariant(false, action.type + \" received while not in DRAGGING phase\") : invariant(false) : void 0;\n var _result2 = moveInDirection({\n state: state,\n type: action.type\n });\n if (!_result2) {\n return state;\n }\n return update({\n state: state,\n impact: _result2.impact,\n clientSelection: _result2.clientSelection,\n scrollJumpRequest: _result2.scrollJumpRequest\n });\n }\n if (action.type === 'DROP_PENDING') {\n var _extends3;\n var reason = action.payload.reason;\n !(state.phase === 'COLLECTING') ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Can only move into the DROP_PENDING phase from the COLLECTING phase') : invariant(false) : void 0;\n var newState = _extends({\n phase: 'DROP_PENDING'\n }, state, (_extends3 = {}, _extends3[\"phase\"] = 'DROP_PENDING', _extends3.isWaiting = true, _extends3.reason = reason, _extends3));\n return newState;\n }\n if (action.type === 'DROP_ANIMATE') {\n var _action$payload5 = action.payload,\n completed = _action$payload5.completed,\n dropDuration = _action$payload5.dropDuration,\n newHomeClientOffset = _action$payload5.newHomeClientOffset;\n !(state.phase === 'DRAGGING' || state.phase === 'DROP_PENDING') ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Cannot animate drop from phase \" + state.phase) : invariant(false) : void 0;\n var _result3 = {\n phase: 'DROP_ANIMATING',\n dimensions: state.dimensions,\n completed: completed,\n dropDuration: dropDuration,\n newHomeClientOffset: newHomeClientOffset\n };\n return _result3;\n }\n if (action.type === 'DROP_COMPLETE') {\n var _action$payload6 = action.payload,\n _completed = _action$payload6.completed,\n shouldFlush = _action$payload6.shouldFlush;\n return {\n phase: 'IDLE',\n completed: _completed,\n shouldFlush: shouldFlush\n };\n }\n return state;\n};\nvar lift = function lift(args) {\n return {\n type: 'LIFT',\n payload: args\n };\n};\nvar initialPublish = function initialPublish(args) {\n return {\n type: 'INITIAL_PUBLISH',\n payload: args\n };\n};\nvar publishWhileDragging$1 = function publishWhileDragging(args) {\n return {\n type: 'PUBLISH_WHILE_DRAGGING',\n payload: args\n };\n};\nvar collectionStarting = function collectionStarting() {\n return {\n type: 'COLLECTION_STARTING',\n payload: null\n };\n};\nvar updateDroppableScroll = function updateDroppableScroll(args) {\n return {\n type: 'UPDATE_DROPPABLE_SCROLL',\n payload: args\n };\n};\nvar updateDroppableIsEnabled = function updateDroppableIsEnabled(args) {\n return {\n type: 'UPDATE_DROPPABLE_IS_ENABLED',\n payload: args\n };\n};\nvar updateDroppableIsCombineEnabled = function updateDroppableIsCombineEnabled(args) {\n return {\n type: 'UPDATE_DROPPABLE_IS_COMBINE_ENABLED',\n payload: args\n };\n};\nvar move = function move(args) {\n return {\n type: 'MOVE',\n payload: args\n };\n};\nvar moveByWindowScroll = function moveByWindowScroll(args) {\n return {\n type: 'MOVE_BY_WINDOW_SCROLL',\n payload: args\n };\n};\nvar updateViewportMaxScroll = function updateViewportMaxScroll(args) {\n return {\n type: 'UPDATE_VIEWPORT_MAX_SCROLL',\n payload: args\n };\n};\nvar moveUp = function moveUp() {\n return {\n type: 'MOVE_UP',\n payload: null\n };\n};\nvar moveDown = function moveDown() {\n return {\n type: 'MOVE_DOWN',\n payload: null\n };\n};\nvar moveRight = function moveRight() {\n return {\n type: 'MOVE_RIGHT',\n payload: null\n };\n};\nvar moveLeft = function moveLeft() {\n return {\n type: 'MOVE_LEFT',\n payload: null\n };\n};\nvar clean$1 = function clean(args) {\n if (args === void 0) {\n args = {\n shouldFlush: false\n };\n }\n return {\n type: 'CLEAN',\n payload: args\n };\n};\nvar animateDrop = function animateDrop(args) {\n return {\n type: 'DROP_ANIMATE',\n payload: args\n };\n};\nvar completeDrop = function completeDrop(args) {\n return {\n type: 'DROP_COMPLETE',\n payload: args\n };\n};\nvar drop = function drop(args) {\n return {\n type: 'DROP',\n payload: args\n };\n};\nvar dropPending = function dropPending(args) {\n return {\n type: 'DROP_PENDING',\n payload: args\n };\n};\nvar dropAnimationFinished = function dropAnimationFinished() {\n return {\n type: 'DROP_ANIMATION_FINISHED',\n payload: null\n };\n};\nvar lift$1 = function (marshal) {\n return function (_ref) {\n var getState = _ref.getState,\n dispatch = _ref.dispatch;\n return function (next) {\n return function (action) {\n if (action.type !== 'LIFT') {\n next(action);\n return;\n }\n var _action$payload = action.payload,\n id = _action$payload.id,\n clientSelection = _action$payload.clientSelection,\n movementMode = _action$payload.movementMode;\n var initial = getState();\n if (initial.phase === 'DROP_ANIMATING') {\n dispatch(completeDrop({\n completed: initial.completed,\n shouldFlush: true\n }));\n }\n !(getState().phase === 'IDLE') ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Incorrect phase to start a drag') : invariant(false) : void 0;\n var scrollOptions = {\n shouldPublishImmediately: movementMode === 'SNAP'\n };\n var request = {\n draggableId: id,\n scrollOptions: scrollOptions\n };\n var _marshal$startPublish = marshal.startPublishing(request),\n critical = _marshal$startPublish.critical,\n dimensions = _marshal$startPublish.dimensions,\n viewport = _marshal$startPublish.viewport;\n dispatch(initialPublish({\n critical: critical,\n dimensions: dimensions,\n clientSelection: clientSelection,\n movementMode: movementMode,\n viewport: viewport\n }));\n };\n };\n };\n};\nvar style = function (marshal) {\n return function () {\n return function (next) {\n return function (action) {\n if (action.type === 'INITIAL_PUBLISH') {\n marshal.dragging();\n }\n if (action.type === 'DROP_ANIMATE') {\n marshal.dropping(action.payload.completed.result.reason);\n }\n if (action.type === 'CLEAN' || action.type === 'DROP_COMPLETE') {\n marshal.resting();\n }\n next(action);\n };\n };\n };\n};\nvar curves = {\n outOfTheWay: 'cubic-bezier(0.2, 0, 0, 1)',\n drop: 'cubic-bezier(.2,1,.1,1)'\n};\nvar combine = {\n opacity: {\n drop: 0,\n combining: 0.7\n },\n scale: {\n drop: 0.75\n }\n};\nvar timings = {\n outOfTheWay: 0.2,\n minDropTime: 0.33,\n maxDropTime: 0.55\n};\nvar outOfTheWayTiming = timings.outOfTheWay + \"s \" + curves.outOfTheWay;\nvar transitions = {\n fluid: \"opacity \" + outOfTheWayTiming,\n snap: \"transform \" + outOfTheWayTiming + \", opacity \" + outOfTheWayTiming,\n drop: function drop(duration) {\n var timing = duration + \"s \" + curves.drop;\n return \"transform \" + timing + \", opacity \" + timing;\n },\n outOfTheWay: \"transform \" + outOfTheWayTiming,\n placeholder: \"height \" + outOfTheWayTiming + \", width \" + outOfTheWayTiming + \", margin \" + outOfTheWayTiming\n};\nvar moveTo = function moveTo(offset) {\n return isEqual(offset, origin) ? null : \"translate(\" + offset.x + \"px, \" + offset.y + \"px)\";\n};\nvar transforms = {\n moveTo: moveTo,\n drop: function drop(offset, isCombining) {\n var translate = moveTo(offset);\n if (!translate) {\n return null;\n }\n if (!isCombining) {\n return translate;\n }\n return translate + \" scale(\" + combine.scale.drop + \")\";\n }\n};\nvar minDropTime = timings.minDropTime,\n maxDropTime = timings.maxDropTime;\nvar dropTimeRange = maxDropTime - minDropTime;\nvar maxDropTimeAtDistance = 1500;\nvar cancelDropModifier = 0.6;\nvar getDropDuration = function (_ref) {\n var current = _ref.current,\n destination = _ref.destination,\n reason = _ref.reason;\n var distance$1 = distance(current, destination);\n if (distance$1 <= 0) {\n return minDropTime;\n }\n if (distance$1 >= maxDropTimeAtDistance) {\n return maxDropTime;\n }\n var percentage = distance$1 / maxDropTimeAtDistance;\n var duration = minDropTime + dropTimeRange * percentage;\n var withDuration = reason === 'CANCEL' ? duration * cancelDropModifier : duration;\n return Number(withDuration.toFixed(2));\n};\nvar getNewHomeClientOffset = function (_ref) {\n var impact = _ref.impact,\n draggable = _ref.draggable,\n dimensions = _ref.dimensions,\n viewport = _ref.viewport,\n onLift = _ref.onLift;\n var draggables = dimensions.draggables,\n droppables = dimensions.droppables;\n var droppableId = whatIsDraggedOver(impact);\n var destination = droppableId ? droppables[droppableId] : null;\n var home = droppables[draggable.descriptor.droppableId];\n var newClientCenter = getClientBorderBoxCenter({\n impact: impact,\n draggable: draggable,\n draggables: draggables,\n onLift: onLift,\n droppable: destination || home,\n viewport: viewport\n });\n var offset = subtract(newClientCenter, draggable.client.borderBox.center);\n var merge = impact.merge;\n if (merge && didStartDisplaced(merge.combine.draggableId, onLift)) {\n return subtract(offset, onLift.displacedBy.point);\n }\n return offset;\n};\nvar getDropImpact = function (_ref) {\n var reason = _ref.reason,\n lastImpact = _ref.lastImpact,\n home = _ref.home,\n viewport = _ref.viewport,\n draggables = _ref.draggables,\n onLiftImpact = _ref.onLiftImpact,\n onLift = _ref.onLift;\n var didDropInsideDroppable = reason === 'DROP' && Boolean(whatIsDraggedOver(lastImpact));\n if (!didDropInsideDroppable) {\n var impact = recompute({\n impact: onLiftImpact,\n destination: home,\n viewport: viewport,\n draggables: draggables,\n onLift: onLift,\n forceShouldAnimate: true\n });\n return {\n impact: impact,\n didDropInsideDroppable: didDropInsideDroppable\n };\n }\n if (lastImpact.destination) {\n return {\n impact: lastImpact,\n didDropInsideDroppable: didDropInsideDroppable\n };\n }\n var withoutMovement = _extends({}, lastImpact, {\n movement: noMovement\n });\n return {\n impact: withoutMovement,\n didDropInsideDroppable: didDropInsideDroppable\n };\n};\nvar drop$1 = function (_ref) {\n var getState = _ref.getState,\n dispatch = _ref.dispatch;\n return function (next) {\n return function (action) {\n if (action.type !== 'DROP') {\n next(action);\n return;\n }\n var state = getState();\n var reason = action.payload.reason;\n if (state.phase === 'COLLECTING') {\n dispatch(dropPending({\n reason: reason\n }));\n return;\n }\n if (state.phase === 'IDLE') {\n return;\n }\n var isWaitingForDrop = state.phase === 'DROP_PENDING' && state.isWaiting;\n !!isWaitingForDrop ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'A DROP action occurred while DROP_PENDING and still waiting') : invariant(false) : void 0;\n !(state.phase === 'DRAGGING' || state.phase === 'DROP_PENDING') ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"Cannot drop in phase: \" + state.phase) : invariant(false) : void 0;\n var critical = state.critical;\n var dimensions = state.dimensions;\n var _getDropImpact = getDropImpact({\n reason: reason,\n lastImpact: state.impact,\n onLift: state.onLift,\n onLiftImpact: state.onLiftImpact,\n home: state.dimensions.droppables[state.critical.droppable.id],\n viewport: state.viewport,\n draggables: state.dimensions.draggables\n }),\n impact = _getDropImpact.impact,\n didDropInsideDroppable = _getDropImpact.didDropInsideDroppable;\n var draggable = dimensions.draggables[state.critical.draggable.id];\n var destination = didDropInsideDroppable ? impact.destination : null;\n var combine = didDropInsideDroppable && impact.merge ? impact.merge.combine : null;\n var source = {\n index: critical.draggable.index,\n droppableId: critical.droppable.id\n };\n var result = {\n draggableId: draggable.descriptor.id,\n type: draggable.descriptor.type,\n source: source,\n reason: reason,\n mode: state.movementMode,\n destination: destination,\n combine: combine\n };\n var newHomeClientOffset = getNewHomeClientOffset({\n impact: impact,\n draggable: draggable,\n dimensions: dimensions,\n viewport: state.viewport,\n onLift: state.onLift\n });\n var completed = {\n critical: state.critical,\n result: result,\n impact: impact\n };\n var isAnimationRequired = !isEqual(state.current.client.offset, newHomeClientOffset) || Boolean(result.combine);\n if (!isAnimationRequired) {\n dispatch(completeDrop({\n completed: completed,\n shouldFlush: false\n }));\n return;\n }\n var dropDuration = getDropDuration({\n current: state.current.client.offset,\n destination: newHomeClientOffset,\n reason: reason\n });\n var args = {\n newHomeClientOffset: newHomeClientOffset,\n dropDuration: dropDuration,\n completed: completed\n };\n dispatch(animateDrop(args));\n };\n };\n};\nvar position = function position(index) {\n return index + 1;\n};\nvar onDragStart = function onDragStart(start) {\n return \"\\n You have lifted an item in position \" + position(start.source.index) + \".\\n Use the arrow keys to move, space bar to drop, and escape to cancel.\\n\";\n};\nvar withLocation = function withLocation(source, destination) {\n var isInHomeList = source.droppableId === destination.droppableId;\n var startPosition = position(source.index);\n var endPosition = position(destination.index);\n if (isInHomeList) {\n return \"\\n You have moved the item from position \" + startPosition + \"\\n to position \" + endPosition + \"\\n \";\n }\n return \"\\n You have moved the item from position \" + startPosition + \"\\n in list \" + source.droppableId + \"\\n to list \" + destination.droppableId + \"\\n in position \" + endPosition + \"\\n \";\n};\nvar withCombine = function withCombine(id, source, combine) {\n var inHomeList = source.droppableId === combine.droppableId;\n if (inHomeList) {\n return \"\\n The item \" + id + \"\\n has been combined with \" + combine.draggableId;\n }\n return \"\\n The item \" + id + \"\\n in list \" + source.droppableId + \"\\n has been combined with \" + combine.draggableId + \"\\n in list \" + combine.droppableId + \"\\n \";\n};\nvar onDragUpdate = function onDragUpdate(update) {\n var location = update.destination;\n if (location) {\n return withLocation(update.source, location);\n }\n var combine = update.combine;\n if (combine) {\n return withCombine(update.draggableId, update.source, combine);\n }\n return 'You are over an area that cannot be dropped on';\n};\nvar returnedToStart = function returnedToStart(source) {\n return \"\\n The item has returned to its starting position\\n of \" + position(source.index) + \"\\n\";\n};\nvar onDragEnd = function onDragEnd(result) {\n if (result.reason === 'CANCEL') {\n return \"\\n Movement cancelled.\\n \" + returnedToStart(result.source) + \"\\n \";\n }\n var location = result.destination;\n var combine = result.combine;\n if (location) {\n return \"\\n You have dropped the item.\\n \" + withLocation(result.source, location) + \"\\n \";\n }\n if (combine) {\n return \"\\n You have dropped the item.\\n \" + withCombine(result.draggableId, result.source, combine) + \"\\n \";\n }\n return \"\\n The item has been dropped while not over a drop area.\\n \" + returnedToStart(result.source) + \"\\n \";\n};\nvar preset = {\n onDragStart: onDragStart,\n onDragUpdate: onDragUpdate,\n onDragEnd: onDragEnd\n};\nvar getExpiringAnnounce = function (announce) {\n var wasCalled = false;\n var isExpired = false;\n var timeoutId = setTimeout(function () {\n isExpired = true;\n });\n var result = function result(message) {\n if (wasCalled) {\n process.env.NODE_ENV !== \"production\" ? warning('Announcement already made. Not making a second announcement') : void 0;\n return;\n }\n if (isExpired) {\n process.env.NODE_ENV !== \"production\" ? warning(\"\\n Announcements cannot be made asynchronously.\\n Default message has already been announced.\\n \") : void 0;\n return;\n }\n wasCalled = true;\n announce(message);\n clearTimeout(timeoutId);\n };\n result.wasCalled = function () {\n return wasCalled;\n };\n return result;\n};\nvar getAsyncMarshal = function () {\n var entries = [];\n var execute = function execute(timerId) {\n var index = findIndex(entries, function (item) {\n return item.timerId === timerId;\n });\n !(index !== -1) ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Could not find timer') : invariant(false) : void 0;\n var _entries$splice = entries.splice(index, 1),\n entry = _entries$splice[0];\n entry.callback();\n };\n var add = function add(fn) {\n var timerId = setTimeout(function () {\n return execute(timerId);\n });\n var entry = {\n timerId: timerId,\n callback: fn\n };\n entries.push(entry);\n };\n var flush = function flush() {\n if (!entries.length) {\n return;\n }\n var shallow = [].concat(entries);\n entries.length = 0;\n shallow.forEach(function (entry) {\n clearTimeout(entry.timerId);\n entry.callback();\n });\n };\n return {\n add: add,\n flush: flush\n };\n};\nvar areLocationsEqual = function areLocationsEqual(first, second) {\n if (first == null && second == null) {\n return true;\n }\n if (first == null || second == null) {\n return false;\n }\n return first.droppableId === second.droppableId && first.index === second.index;\n};\nvar isCombineEqual = function isCombineEqual(first, second) {\n if (first == null && second == null) {\n return true;\n }\n if (first == null || second == null) {\n return false;\n }\n return first.draggableId === second.draggableId && first.droppableId === second.droppableId;\n};\nvar isCriticalEqual = function isCriticalEqual(first, second) {\n if (first === second) {\n return true;\n }\n var isDraggableEqual = first.draggable.id === second.draggable.id && first.draggable.droppableId === second.draggable.droppableId && first.draggable.type === second.draggable.type && first.draggable.index === second.draggable.index;\n var isDroppableEqual = first.droppable.id === second.droppable.id && first.droppable.type === second.droppable.type;\n return isDraggableEqual && isDroppableEqual;\n};\nvar withTimings = function withTimings(key, fn) {\n start(key);\n fn();\n finish(key);\n};\nvar getDragStart = function getDragStart(critical, mode) {\n return {\n draggableId: critical.draggable.id,\n type: critical.droppable.type,\n source: {\n droppableId: critical.droppable.id,\n index: critical.draggable.index\n },\n mode: mode\n };\n};\nvar execute = function execute(responder, data, announce, getDefaultMessage) {\n if (!responder) {\n announce(getDefaultMessage(data));\n return;\n }\n var willExpire = getExpiringAnnounce(announce);\n var provided = {\n announce: willExpire\n };\n responder(data, provided);\n if (!willExpire.wasCalled()) {\n announce(getDefaultMessage(data));\n }\n};\nvar getPublisher = function (getResponders, announce) {\n var asyncMarshal = getAsyncMarshal();\n var dragging = null;\n var beforeStart = function beforeStart(critical, mode) {\n !!dragging ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot fire onBeforeDragStart as a drag start has already been published') : invariant(false) : void 0;\n withTimings('onBeforeDragStart', function () {\n var fn = getResponders().onBeforeDragStart;\n if (fn) {\n fn(getDragStart(critical, mode));\n }\n });\n };\n var start = function start(critical, mode) {\n !!dragging ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot fire onBeforeDragStart as a drag start has already been published') : invariant(false) : void 0;\n var data = getDragStart(critical, mode);\n dragging = {\n mode: mode,\n lastCritical: critical,\n lastLocation: data.source,\n lastCombine: null\n };\n asyncMarshal.add(function () {\n withTimings('onDragStart', function () {\n return execute(getResponders().onDragStart, data, announce, preset.onDragStart);\n });\n });\n };\n var update = function update(critical, impact) {\n var location = impact.destination;\n var combine = impact.merge ? impact.merge.combine : null;\n !dragging ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot fire onDragMove when onDragStart has not been called') : invariant(false) : void 0;\n var hasCriticalChanged = !isCriticalEqual(critical, dragging.lastCritical);\n if (hasCriticalChanged) {\n dragging.lastCritical = critical;\n }\n var hasLocationChanged = !areLocationsEqual(dragging.lastLocation, location);\n if (hasLocationChanged) {\n dragging.lastLocation = location;\n }\n var hasGroupingChanged = !isCombineEqual(dragging.lastCombine, combine);\n if (hasGroupingChanged) {\n dragging.lastCombine = combine;\n }\n if (!hasCriticalChanged && !hasLocationChanged && !hasGroupingChanged) {\n return;\n }\n var data = _extends({}, getDragStart(critical, dragging.mode), {\n combine: combine,\n destination: location\n });\n asyncMarshal.add(function () {\n withTimings('onDragUpdate', function () {\n return execute(getResponders().onDragUpdate, data, announce, preset.onDragUpdate);\n });\n });\n };\n var flush = function flush() {\n !dragging ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Can only flush responders while dragging') : invariant(false) : void 0;\n asyncMarshal.flush();\n };\n var drop = function drop(result) {\n !dragging ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot fire onDragEnd when there is no matching onDragStart') : invariant(false) : void 0;\n dragging = null;\n withTimings('onDragEnd', function () {\n return execute(getResponders().onDragEnd, result, announce, preset.onDragEnd);\n });\n };\n var abort = function abort() {\n if (!dragging) {\n return;\n }\n var result = _extends({}, getDragStart(dragging.lastCritical, dragging.mode), {\n combine: null,\n destination: null,\n reason: 'CANCEL'\n });\n drop(result);\n };\n return {\n beforeStart: beforeStart,\n start: start,\n update: update,\n flush: flush,\n drop: drop,\n abort: abort\n };\n};\nvar responders = function (getResponders, announce) {\n var publisher = getPublisher(getResponders, announce);\n return function (store) {\n return function (next) {\n return function (action) {\n if (action.type === 'INITIAL_PUBLISH') {\n var critical = action.payload.critical;\n publisher.beforeStart(critical, action.payload.movementMode);\n next(action);\n publisher.start(critical, action.payload.movementMode);\n return;\n }\n if (action.type === 'DROP_COMPLETE') {\n var result = action.payload.completed.result;\n publisher.flush();\n next(action);\n publisher.drop(result);\n return;\n }\n next(action);\n if (action.type === 'CLEAN') {\n publisher.abort();\n return;\n }\n var state = store.getState();\n if (state.phase === 'DRAGGING') {\n publisher.update(state.critical, state.impact);\n }\n };\n };\n };\n};\nvar dropAnimationFinish = function (store) {\n return function (next) {\n return function (action) {\n if (action.type !== 'DROP_ANIMATION_FINISHED') {\n next(action);\n return;\n }\n var state = store.getState();\n !(state.phase === 'DROP_ANIMATING') ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot finish a drop animating when no drop is occurring') : invariant(false) : void 0;\n store.dispatch(completeDrop({\n completed: state.completed,\n shouldFlush: false\n }));\n };\n };\n};\nvar dimensionMarshalStopper = function (marshal) {\n return function () {\n return function (next) {\n return function (action) {\n if (action.type === 'DROP_COMPLETE' || action.type === 'CLEAN' || action.type === 'DROP_ANIMATE') {\n marshal.stopPublishing();\n }\n next(action);\n };\n };\n };\n};\nvar shouldEnd = function shouldEnd(action) {\n return action.type === 'DROP_COMPLETE' || action.type === 'DROP_ANIMATE' || action.type === 'CLEAN';\n};\nvar shouldCancelPending = function shouldCancelPending(action) {\n return action.type === 'COLLECTION_STARTING';\n};\nvar autoScroll = function (autoScroller) {\n return function (store) {\n return function (next) {\n return function (action) {\n if (shouldEnd(action)) {\n autoScroller.stop();\n next(action);\n return;\n }\n if (shouldCancelPending(action)) {\n autoScroller.cancelPending();\n next(action);\n return;\n }\n if (action.type === 'INITIAL_PUBLISH') {\n next(action);\n var state = store.getState();\n !(state.phase === 'DRAGGING') ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Expected phase to be DRAGGING after INITIAL_PUBLISH') : invariant(false) : void 0;\n autoScroller.start(state);\n return;\n }\n next(action);\n autoScroller.scroll(store.getState());\n };\n };\n };\n};\nvar pendingDrop = function (store) {\n return function (next) {\n return function (action) {\n next(action);\n if (action.type !== 'PUBLISH_WHILE_DRAGGING') {\n return;\n }\n var postActionState = store.getState();\n if (postActionState.phase !== 'DROP_PENDING') {\n return;\n }\n if (postActionState.isWaiting) {\n return;\n }\n store.dispatch(drop({\n reason: postActionState.reason\n }));\n };\n };\n};\nvar composeEnhancers = process.env.NODE_ENV !== 'production' && typeof window !== 'undefined' && window.__REDUX_DEVTOOLS_EXTENSION_COMPOSE__ ? window.__REDUX_DEVTOOLS_EXTENSION_COMPOSE__ : compose;\nvar createStore = function (_ref) {\n var dimensionMarshal = _ref.dimensionMarshal,\n styleMarshal = _ref.styleMarshal,\n getResponders = _ref.getResponders,\n announce = _ref.announce,\n autoScroller = _ref.autoScroller;\n return createStore$1(reducer, composeEnhancers(applyMiddleware(style(styleMarshal), dimensionMarshalStopper(dimensionMarshal), lift$1(dimensionMarshal), drop$1, dropAnimationFinish, pendingDrop, autoScroll(autoScroller), responders(getResponders, announce))));\n};\nvar clean$2 = function clean() {\n return {\n additions: {},\n removals: {},\n modified: {}\n };\n};\nvar timingKey = 'Publish collection from DOM';\nvar createPublisher = function (_ref) {\n var getEntries = _ref.getEntries,\n callbacks = _ref.callbacks;\n var advancedUsageWarning = function () {\n if (process.env.NODE_ENV === 'production') {\n return function () {};\n }\n var hasAnnounced = false;\n return function () {\n if (hasAnnounced) {\n return;\n }\n hasAnnounced = true;\n process.env.NODE_ENV !== \"production\" ? warning(\"\\n Advanced usage warning: you are adding or removing a dimension during a drag\\n This an advanced feature.\\n\\n More information: https://github.com/atlassian/react-beautiful-dnd/blob/master/docs/guides/changes-while-dragging.md\\n \") : void 0;\n };\n }();\n var staging = clean$2();\n var frameId = null;\n var collect = function collect() {\n advancedUsageWarning();\n if (frameId) {\n return;\n }\n frameId = requestAnimationFrame(function () {\n frameId = null;\n callbacks.collectionStarting();\n var critical = callbacks.getCritical();\n start(timingKey);\n var entries = getEntries();\n var _staging = staging,\n additions = _staging.additions,\n removals = _staging.removals,\n modified = _staging.modified;\n var added = _Object$keys(additions).map(function (id) {\n return entries.draggables[id].getDimension(origin);\n }).sort(function (a, b) {\n return a.descriptor.index - b.descriptor.index;\n });\n var updated = _Object$keys(modified).map(function (id) {\n var entry = entries.droppables[id];\n !entry ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot find dynamically added droppable in cache') : invariant(false) : void 0;\n var isHome = entry.descriptor.id === critical.droppable.id;\n var options = {\n withoutPlaceholder: !isHome\n };\n return entry.callbacks.recollect(options);\n });\n var result = {\n additions: added,\n removals: _Object$keys(removals),\n modified: updated\n };\n staging = clean$2();\n finish(timingKey);\n callbacks.publish(result);\n });\n };\n var add = function add(descriptor) {\n staging.additions[descriptor.id] = descriptor;\n staging.modified[descriptor.droppableId] = true;\n if (staging.removals[descriptor.id]) {\n delete staging.removals[descriptor.id];\n }\n collect();\n };\n var remove = function remove(descriptor) {\n staging.removals[descriptor.id] = descriptor;\n staging.modified[descriptor.droppableId] = true;\n if (staging.additions[descriptor.id]) {\n delete staging.additions[descriptor.id];\n }\n collect();\n };\n var stop = function stop() {\n if (!frameId) {\n return;\n }\n cancelAnimationFrame(frameId);\n frameId = null;\n staging = clean$2();\n };\n return {\n add: add,\n remove: remove,\n stop: stop\n };\n};\nvar getWindowScroll = function () {\n return {\n x: window.pageXOffset,\n y: window.pageYOffset\n };\n};\nvar getDocumentElement = function () {\n var doc = document.documentElement;\n !doc ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot find document.documentElement') : invariant(false) : void 0;\n return doc;\n};\nvar getMaxWindowScroll = function () {\n var doc = getDocumentElement();\n var maxScroll = getMaxScroll({\n scrollHeight: doc.scrollHeight,\n scrollWidth: doc.scrollWidth,\n width: doc.clientWidth,\n height: doc.clientHeight\n });\n return maxScroll;\n};\nvar getViewport = function () {\n var scroll = getWindowScroll();\n var maxScroll = getMaxWindowScroll();\n var top = scroll.y;\n var left = scroll.x;\n var doc = getDocumentElement();\n var width = doc.clientWidth;\n var height = doc.clientHeight;\n var right = left + width;\n var bottom = top + height;\n var frame = getRect({\n top: top,\n left: left,\n right: right,\n bottom: bottom\n });\n var viewport = {\n frame: frame,\n scroll: {\n initial: scroll,\n current: scroll,\n max: maxScroll,\n diff: {\n value: origin,\n displacement: origin\n }\n }\n };\n return viewport;\n};\nvar getInitialPublish = function (_ref) {\n var critical = _ref.critical,\n scrollOptions = _ref.scrollOptions,\n entries = _ref.entries;\n var timingKey = 'Initial collection from DOM';\n start(timingKey);\n var viewport = getViewport();\n var windowScroll = viewport.scroll.current;\n var home = critical.droppable;\n var droppables = values(entries.droppables).filter(function (entry) {\n return entry.descriptor.type === home.type;\n }).map(function (entry) {\n return entry.callbacks.getDimensionAndWatchScroll(windowScroll, scrollOptions);\n });\n var draggables = values(entries.draggables).filter(function (entry) {\n return entry.descriptor.type === critical.draggable.type;\n }).map(function (entry) {\n return entry.getDimension(windowScroll);\n });\n var dimensions = {\n draggables: toDraggableMap(draggables),\n droppables: toDroppableMap(droppables)\n };\n finish(timingKey);\n var result = {\n dimensions: dimensions,\n critical: critical,\n viewport: viewport\n };\n return result;\n};\nvar throwIfAddOrRemoveOfWrongType = function throwIfAddOrRemoveOfWrongType(collection, descriptor) {\n !(collection.critical.draggable.type === descriptor.type) ? process.env.NODE_ENV !== \"production\" ? invariant(false, \"We have detected that you have added a Draggable during a drag.\\n This is not of the same type as the dragging item\\n\\n Dragging type: \" + collection.critical.draggable.type + \".\\n Added type: \" + descriptor.type + \"\\n\\n We are not allowing this as you can run into problems if your change\\n has shifted the positioning of other Droppables, or has changed the size of the page\") : invariant(false) : void 0;\n};\nvar createDimensionMarshal = function (callbacks) {\n var entries = {\n droppables: {},\n draggables: {}\n };\n var collection = null;\n var publisher = createPublisher({\n callbacks: {\n publish: callbacks.publishWhileDragging,\n collectionStarting: callbacks.collectionStarting,\n getCritical: function getCritical() {\n !collection ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot get critical when there is no collection') : invariant(false) : void 0;\n return collection.critical;\n }\n },\n getEntries: function getEntries() {\n return entries;\n }\n });\n var registerDraggable = function registerDraggable(descriptor, getDimension) {\n var entry = {\n descriptor: descriptor,\n getDimension: getDimension\n };\n entries.draggables[descriptor.id] = entry;\n if (!collection) {\n return;\n }\n throwIfAddOrRemoveOfWrongType(collection, descriptor);\n publisher.add(descriptor);\n };\n var updateDraggable = function updateDraggable(published, descriptor, getDimension) {\n var existing = entries.draggables[published.id];\n !existing ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Cannot update draggable registration as no published registration was found') : invariant(false) : void 0;\n if (existing.descriptor === published) {\n delete entries.draggables[published.id];\n } else {\n process.env.NODE_ENV !== \"production\" ? warning(\"\\n Detected incorrect usage of 'key' on '\n {content}\n
\n 0 ? upColor : color\n }}>\n {removeDataStr + \" = \" + this.numberToCurrency(currentTotal)}\n
\n }\n\n getFormattedDataLabel(data_label, withoutRange = false) {\n let { legendData } = this.state\n if (this.props.isRange.toString() === \"true\" && !withoutRange) {\n return legendData[data_label]?.replace(\"-range\", \"\") + \"-range\"\n } else {\n return legendData[data_label]?.replace(\"-range\", \"\")\n }\n }\n\n getChartData(fr_id, data_label, number_format = \"money\") {\n let { chartData } = this.props;\n let { legendData } = this.state\n let legended_data_label = this.getFormattedDataLabel(data_label)\n\n if (number_format == \"money\" || number_format == null) {\n return this.numberToCurrency(chartData[`[\"${fr_id}\", \"${legended_data_label}\"]`])\n } else {\n return this.integerFormat(chartData[`[\"${fr_id}\", \"${legended_data_label}\"]`])\n }\n\n }\n\n getCostCenterLineData(reports, data_label, formula, key, lines = false) {\n\n let { isRange, startDate, endDate } = this.props;\n let { legendData } = this.state;\n let linesByMonth = {\n \"janeiro\": 0,\n \"fevereiro\": 0,\n \"março\": 0,\n \"abril\": 0,\n \"maio\": 0,\n \"junho\": 0,\n \"julho\": 0,\n \"agosto\": 0,\n \"setembro\": 0,\n \"outubro\": 0,\n \"novembro\": 0,\n \"dezembro\": 0\n }\n if (lines) {\n const { balanceRows } = this.state\n\n linesByMonth = balanceRows[[data_label, this.getCurrentYear(data_label), key]]?.sum_of_lines || {}\n console.log(\"LINES_BY_MONTH\", linesByMonth)\n // rows.map((line) => {\n // Object.entries(line).map(([month, value]) => {\n // linesByMonth[month] += value\n // })\n // })\n\n }\n\n if (isRange.toString() === \"true\") {\n let legend = legendData[data_label]\n\n let firstMonth = moment(startDate[legend]).toDate().getMonth() + 1\n let endMonth = moment(endDate[legend]).toDate().getMonth() + 1\n\n let result = 0\n range(firstMonth, endMonth + 1).map((month_i) => {\n\n try {\n if (lines) {\n result += linesByMonth[monthsDict[month_i]] || 0\n } else {\n result += parseFloat(reports[`${data_label},${formula.id}`][\"report\"][formula.label][formula.label].params[key][monthsDict[month_i]].difference * -1) || 0\n }\n\n } catch (e) {\n\n }\n\n })\n return this.numberToCurrency(result)\n } else {\n try {\n if (lines) {\n return this.numberToCurrency(linesByMonth[monthsDict[this.getCurrentMonth(data_label)]])\n } else {\n return this.numberToCurrency(reports[`${data_label},${formula.id}`][\"report\"][formula.label][formula.label].params?.[key]?.[monthsDict[this.getCurrentMonth(data_label)]].difference * -1)\n }\n\n } catch (e) {\n return 0\n }\n\n\n }\n\n }\n\n\n getCostCenterDetailMonths(cost_center, data_label) {\n let { isRange, startDate, endDate } = this.props;\n let { legendData } = this.state;\n\n try {\n if (isRange.toString() === \"true\") {\n let legend = legendData[data_label]\n\n let firstMonth = moment(startDate[legend]).toDate().getMonth() + 1\n let endMonth = moment(endDate[legend]).toDate().getMonth() + 1\n let result = 0\n range(firstMonth, endMonth + 1).map((month_i) => {\n result += this.convertIntoNumber(cost_center.months[month_i])\n })\n return result\n } else {\n return cost_center.months[this.getCurrentMonth(data_label)]\n }\n } catch (e) {\n return 0\n }\n }\n integerFormat(number, title) {\n if (title) {\n return new Intl.NumberFormat('decimal', { minimumFractionDigits: 2 }).format(parseFloat(number).toFixed(2))\n } else {\n return new Intl.NumberFormat('decimal', { minimumFractionDigits: 2 }).format(parseFloat(number).toFixed(2) * -1)\n }\n\n }\n\n differenceBetweenData(data1=\"0\", data2=\"0\", type = \"money\") {\n // Não me pergunte porque fiz isso, pra mim isso não tem lógica, foi o cliente que pediu assim\n // Ultima alteração 19/02 e o céu está aberto, com algumas nuvens, acho que chove hoje\n\n let difference = 0\n try {\n if (data1.toString().search(',') == -1) {\n data1 = parseFloat(data1.toString().split(\"R$\").join(\"\").replace(/ /g, '').split(\" \").join(''))\n } else {\n data1 = parseFloat(data1.toString().split(\".\").join(\"\").split(\"R$\").join(\"\").split(\",\").join(\".\").replace(/ /g, '').split(\" \").join(''))\n }\n\n if (data2.toString().search(',') == -1) {\n data2 = parseFloat(data2.toString().split(\"R$\").join(\"\").replace(/ /g, '').split(\" \").join(''))\n } else {\n data2 = parseFloat(data2.toString().split(\".\").join(\"\").split(\"R$\").join(\"\").split(\",\").join(\".\").replace(/ /g, '').split(\" \").join(''))\n }\n\n if (data1 < 0 && data2 < 0) {\n difference = (data2 - data1)\n } else if (data1 == 0) {\n if (Math.sign(data2) == 1) {\n difference = data2 * -1\n } else {\n difference = data2\n }\n\n } else if (data2 == 0) {\n if (Math.sign(data1) == -1) {\n difference = data1 * -1\n } else {\n difference = data1\n }\n } else {\n difference = (data1 - data2)\n }\n\n\n\n\n\n if (type == null || type == \"money\") {\n return parseFloat(difference).toLocaleString(\"pt-BR\", {\n style: \"currency\",\n currency: \"BRL\"\n });\n\n } else if (type == \"integer\") {\n return this.integerFormat(difference, true)\n }\n\n\n } catch (e) {\n console.log(\"ERRO_DIF\", e)\n return 0\n }\n }\n\n otherDataLabel(data_label) {\n if (data_label == \"data1\") {\n return \"data2\"\n }\n if (data_label == \"data2\") {\n return \"data1\"\n }\n }\n\n monthsRangeForLedger(data_label) {\n const {principalDataLabel, startDate, endDate} = this.props\n let {legendData} = this.state;\n\n let legend = legendData[data_label]\n let startMonth = 0\n let endMonth = 0\n if (principalDataLabel.search(\"range\") >= 0) {\n let legend_str = legend.replace(\"-range\", \"\")\n\n startMonth = moment(startDate[legend_str]).month() + 1\n endMonth = moment(endDate[legend_str]).month() + 1\n }\n return [startMonth, endMonth]\n }\n\n renderCostCenterDetail(level, data_label, label, x) {\n const { currentFormulaData, costCentersFetched } = this.state;\n \n try {\n let costCenterKeys = {}\n Object.keys(currentFormulaData).map((key) => {\n Object.entries(costCentersFetched?.[key]?.[label]?.[x[0].area.id]?.[x[0].is_fixed ? `fixed` : `not_fixed`] || {}).map(([cc_key, value]) => {\n costCenterKeys[cc_key] = value?.label\n })\n })\n \n return \n \n
}\n \n \n \n
}\n \n \n {!this.props.withoutDownloadButton && \n \n \n }\n {(this.state.currentColumnId && !this.props.ebitda_formula_id) &&
\n }\n generatePopUp() {\n let self = this\n // this.requestsCounter += 1;\n axios.post(`/borboleta_chart_popups.json`, {\n props: self.props\n }).then(function (result) {\n self.requestsCounter -= 1;\n popupCenter({ url: `/borboleta_chart_popups/${result.data.popup_id}`, title: 'Gráfico', w: window.innerWidth * 0.8, h: window.innerHeight * 0.8 })\n });\n\n }\n\n exportAllUrl() {\n let data_label = \"data1\"\n let { startDate, endDate } = this.props;\n let { legendData } = this.state;\n let data_label_2 = this.otherDataLabel(data_label)\n let m1 = \"month_1=\" + this.getCurrentMonth(data_label)\n let m2 = \"month_2=\" + this.getCurrentMonth(data_label_2)\n let y1 = \"year_1=\" + this.getCurrentYear(data_label)\n let y2 = \"year_2=\" + this.getCurrentYear(data_label_2)\n let le1 = \"label_1=\" + legendData[data_label]\n let le2 = \"label_2=\" + legendData[data_label_2]\n let urlSafeParams = new URLSearchParams({\n \"title_1\": this.props.title['data1'],\n \"title_2\": this.props.title['data2'],\n })\n console.log(this.props)\n let months = {}\n if (this.props.principalDataLabel.search(\"range\") != -1) {\n\n\n [data_label, data_label_2].map((dl) => {\n [startDate, endDate].map((date) => {\n months[dl] ||= []\n months[dl].push(moment(date[legendData[dl]]).toDate().getMonth() + 1)\n })\n\n })\n\n\n m1 = \"month_1=\" + months[data_label]\n m2 = \"month_2=\" + months[data_label_2]\n\n }\n\n let export_url = `/export/borboleta.xlsx?${y1}&${m1}&${y2}&${m2}&${le1}&${le2}&${urlSafeParams.toString()}`\n\n return export_url\n\n\n }\n\n render() {\n\n let { open, handleClose, chartData } = this.props\n\n if (this.props.popup) {\n return (\n
\n {this.state.currentColumnId && !this.props.withoutDownloadButton && {this.props.chartTitle}
\n {this.state.chartIsVisible && this.renderHighChart()}\n\n \n
\n \n {/* \n {formulas && formulas.map((formula) => {\n let alreadLoaded = loadedFormulas[formula.id] ? true : false\n loadedFormulas[formula.id] = true\n return !alreadLoaded && this.renderFormula(formula, data_label, alreadLoaded)\n })}\n
\n })}\n\n\n
}\n {this.props.ebitda_formula_id && {this.getFormatedFormula()}
*/}\n {Object.entries(currentFormulaData).map(([data_label, formulas]) => {\n data_label = \"data1\" //inverção do analisado e comparado\n return\n {/* \n \n
\n\n
}\n\n {this.getFormatedFormula()}
*/}\n| \n | {this.props.title['data1']} | \n{this.props.title['data2']} | \nDiferença | \n
|---|
\n {this.renderContent()}\n
)\n }\n else {\n return (\n \n \n \n \n this.generatePopUp()}\n style={{\n backgroundColor: '#F5F5F5',\n width: 40,\n height: 40,\n borderRadius: 6,\n display: 'flex',\n justifyContent: 'center',\n alignItems: 'center',\n cursor: 'pointer'\n }}>\n 
\n
\n {this.props.can_download && \n \n this.closeTable()}\n >\n \n \n\n
\n\n\n\n \n \n
\n \n \n
}\n \n \n
}\n \n
\n \n \n \n { collapsed && \n ({label}
\n{!collapsed && label}
\n \n \n {submenuLinks && validLinks.map((item, index)=>\n {item.label} \n )}\n
}\n \n \n );\n }\n}\n\nexport default ColapsedItem\n","var isBrowser = \"object\" !== 'undefined';\nfunction getRegisteredStyles(registered, registeredStyles, classNames) {\n var rawClassName = '';\n classNames.split(' ').forEach(function (className) {\n if (registered[className] !== undefined) {\n registeredStyles.push(registered[className] + \";\");\n } else {\n rawClassName += className + \" \";\n }\n });\n return rawClassName;\n}\nvar registerStyles = function registerStyles(cache, serialized, isStringTag) {\n var className = cache.key + \"-\" + serialized.name;\n if (\n // we only need to add the styles to the registered cache if the\n // class name could be used further down\n // the tree but if it's a string tag, we know it won't\n // so we don't have to add it to registered cache.\n // this improves memory usage since we can avoid storing the whole style string\n (isStringTag === false ||\n // we need to always store it if we're in compat mode and\n // in node since emotion-server relies on whether a style is in\n // the registered cache to know whether a style is global or not\n // also, note that this check will be dead code eliminated in the browser\n isBrowser === false) && cache.registered[className] === undefined) {\n cache.registered[className] = serialized.styles;\n }\n};\nvar insertStyles = function insertStyles(cache, serialized, isStringTag) {\n registerStyles(cache, serialized, isStringTag);\n var className = cache.key + \"-\" + serialized.name;\n if (cache.inserted[serialized.name] === undefined) {\n var current = serialized;\n do {\n cache.insert(serialized === current ? \".\" + className : '', current, cache.sheet, true);\n current = current.next;\n } while (current !== undefined);\n }\n};\nexport { getRegisteredStyles, insertStyles, registerStyles };","/**\n * Days in 1 week.\n *\n * @name daysInWeek\n * @constant\n * @type {number}\n * @default\n */\nexport var daysInWeek = 7;\n\n/**\n * Days in 1 year\n * One years equals 365.2425 days according to the formula:\n *\n * > Leap year occures every 4 years, except for years that are divisable by 100 and not divisable by 400.\n * > 1 mean year = (365+1/4-1/100+1/400) days = 365.2425 days\n *\n * @name daysInYear\n * @constant\n * @type {number}\n * @default\n */\nexport var daysInYear = 365.2425;\n\n/**\n * Maximum allowed time.\n *\n * @name maxTime\n * @constant\n * @type {number}\n * @default\n */\nexport var maxTime = Math.pow(10, 8) * 24 * 60 * 60 * 1000;\n\n/**\n * Milliseconds in 1 minute\n *\n * @name millisecondsInMinute\n * @constant\n * @type {number}\n * @default\n */\nexport var millisecondsInMinute = 60000;\n\n/**\n * Milliseconds in 1 hour\n *\n * @name millisecondsInHour\n * @constant\n * @type {number}\n * @default\n */\nexport var millisecondsInHour = 3600000;\n\n/**\n * Milliseconds in 1 second\n *\n * @name millisecondsInSecond\n * @constant\n * @type {number}\n * @default\n */\nexport var millisecondsInSecond = 1000;\n\n/**\n * Minimum allowed time.\n *\n * @name minTime\n * @constant\n * @type {number}\n * @default\n */\nexport var minTime = -maxTime;\n\n/**\n * Minutes in 1 hour\n *\n * @name minutesInHour\n * @constant\n * @type {number}\n * @default\n */\nexport var minutesInHour = 60;\n\n/**\n * Months in 1 quarter\n *\n * @name monthsInQuarter\n * @constant\n * @type {number}\n * @default\n */\nexport var monthsInQuarter = 3;\n\n/**\n * Months in 1 year\n *\n * @name monthsInYear\n * @constant\n * @type {number}\n * @default\n */\nexport var monthsInYear = 12;\n\n/**\n * Quarters in 1 year\n *\n * @name quartersInYear\n * @constant\n * @type {number}\n * @default\n */\nexport var quartersInYear = 4;\n\n/**\n * Seconds in 1 hour\n *\n * @name secondsInHour\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInHour = 3600;\n\n/**\n * Seconds in 1 minute\n *\n * @name secondsInMinute\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInMinute = 60;\n\n/**\n * Seconds in 1 day\n *\n * @name secondsInDay\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInDay = secondsInHour * 24;\n\n/**\n * Seconds in 1 week\n *\n * @name secondsInWeek\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInWeek = secondsInDay * 7;\n\n/**\n * Seconds in 1 year\n *\n * @name secondsInYear\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInYear = secondsInDay * daysInYear;\n\n/**\n * Seconds in 1 month\n *\n * @name secondsInMonth\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInMonth = secondsInYear / 12;\n\n/**\n * Seconds in 1 quarter\n *\n * @name secondsInQuarter\n * @constant\n * @type {number}\n * @default\n */\nexport var secondsInQuarter = secondsInMonth * 3;","import arrayWithoutHoles from \"./arrayWithoutHoles\";\nimport iterableToArray from \"./iterableToArray\";\nimport nonIterableSpread from \"./nonIterableSpread\";\nexport default function _toConsumableArray(arr) {\n return arrayWithoutHoles(arr) || iterableToArray(arr) || nonIterableSpread();\n}","export default function _arrayWithoutHoles(arr) {\n if (Array.isArray(arr)) {\n for (var i = 0, arr2 = new Array(arr.length); i < arr.length; i++) {\n arr2[i] = arr[i];\n }\n\n return arr2;\n }\n}","export default function _iterableToArray(iter) {\n if (Symbol.iterator in Object(iter) || Object.prototype.toString.call(iter) === \"[object Arguments]\") return Array.from(iter);\n}","export default function _nonIterableSpread() {\n throw new TypeError(\"Invalid attempt to spread non-iterable instance\");\n}","export default function _extends() {\n _extends = Object.assign || function (target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i];\n\n for (var key in source) {\n if (Object.prototype.hasOwnProperty.call(source, key)) {\n target[key] = source[key];\n }\n }\n }\n\n return target;\n };\n\n return _extends.apply(this, arguments);\n}","function _defineProperties(target, props) {\n for (var i = 0; i < props.length; i++) {\n var descriptor = props[i];\n descriptor.enumerable = descriptor.enumerable || false;\n descriptor.configurable = true;\n if (\"value\" in descriptor) descriptor.writable = true;\n Object.defineProperty(target, descriptor.key, descriptor);\n }\n}\n\nexport default function _createClass(Constructor, protoProps, staticProps) {\n if (protoProps) _defineProperties(Constructor.prototype, protoProps);\n if (staticProps) _defineProperties(Constructor, staticProps);\n return Constructor;\n}","export default function _assertThisInitialized(self) {\n if (self === void 0) {\n throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\");\n }\n\n return self;\n}","export default function _setPrototypeOf(o, p) {\n _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) {\n o.__proto__ = p;\n return o;\n };\n\n return _setPrototypeOf(o, p);\n}","function _typeof2(obj) { if (typeof Symbol === \"function\" && typeof Symbol.iterator === \"symbol\") { _typeof2 = function _typeof2(obj) { return typeof obj; }; } else { _typeof2 = function _typeof2(obj) { return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : typeof obj; }; } return _typeof2(obj); }\n\nexport default function _typeof(obj) {\n if (typeof Symbol === \"function\" && _typeof2(Symbol.iterator) === \"symbol\") {\n _typeof = function _typeof(obj) {\n return _typeof2(obj);\n };\n } else {\n _typeof = function _typeof(obj) {\n return obj && typeof Symbol === \"function\" && obj.constructor === Symbol && obj !== Symbol.prototype ? \"symbol\" : _typeof2(obj);\n };\n }\n\n return _typeof(obj);\n}","import _typeof from \"../../helpers/esm/typeof\";\nimport assertThisInitialized from \"./assertThisInitialized\";\nexport default function _possibleConstructorReturn(self, call) {\n if (call && (_typeof(call) === \"object\" || typeof call === \"function\")) {\n return call;\n }\n\n return assertThisInitialized(self);\n}","export default function _getPrototypeOf(o) {\n _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) {\n return o.__proto__ || Object.getPrototypeOf(o);\n };\n return _getPrototypeOf(o);\n}","export default function _defineProperty(obj, key, value) {\n if (key in obj) {\n Object.defineProperty(obj, key, {\n value: value,\n enumerable: true,\n configurable: true,\n writable: true\n });\n } else {\n obj[key] = value;\n }\n\n return obj;\n}","import arrayWithHoles from \"./arrayWithHoles\";\nimport iterableToArrayLimit from \"./iterableToArrayLimit\";\nimport nonIterableRest from \"./nonIterableRest\";\nexport default function _slicedToArray(arr, i) {\n return arrayWithHoles(arr) || iterableToArrayLimit(arr, i) || nonIterableRest();\n}","export default function _arrayWithHoles(arr) {\n if (Array.isArray(arr)) return arr;\n}","export default function _iterableToArrayLimit(arr, i) {\n var _arr = [];\n var _n = true;\n var _d = false;\n var _e = undefined;\n\n try {\n for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) {\n _arr.push(_s.value);\n\n if (i && _arr.length === i) break;\n }\n } catch (err) {\n _d = true;\n _e = err;\n } finally {\n try {\n if (!_n && _i[\"return\"] != null) _i[\"return\"]();\n } finally {\n if (_d) throw _e;\n }\n }\n\n return _arr;\n}","export default function _nonIterableRest() {\n throw new TypeError(\"Invalid attempt to destructure non-iterable instance\");\n}","import objectWithoutPropertiesLoose from \"./objectWithoutPropertiesLoose\";\nexport default function _objectWithoutProperties(source, excluded) {\n if (source == null) return {};\n var target = objectWithoutPropertiesLoose(source, excluded);\n var key, i;\n\n if (Object.getOwnPropertySymbols) {\n var sourceSymbolKeys = Object.getOwnPropertySymbols(source);\n\n for (i = 0; i < sourceSymbolKeys.length; i++) {\n key = sourceSymbolKeys[i];\n if (excluded.indexOf(key) >= 0) continue;\n if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue;\n target[key] = source[key];\n }\n }\n\n return target;\n}","export default function _objectWithoutPropertiesLoose(source, excluded) {\n if (source == null) return {};\n var target = {};\n var sourceKeys = Object.keys(source);\n var key, i;\n\n for (i = 0; i < sourceKeys.length; i++) {\n key = sourceKeys[i];\n if (excluded.indexOf(key) >= 0) continue;\n target[key] = source[key];\n }\n\n return target;\n}","import _defineProperty from \"@babel/runtime/helpers/defineProperty\";\nexport var keys = function keys(obj) {\n return obj === Object(obj) ? Object.keys(obj) : [];\n};\nexport var values = function values(obj) {\n return obj === Object(obj) ? Object.values(obj) : [];\n};\nfunction mergeDeep(target, source) {\n var output = Object.assign({}, target);\n if (isPlainObject(target) && isPlainObject(source)) {\n keys(source).forEach(function (key) {\n if (isPlainObject(source[key])) {\n if (!(key in target)) Object.assign(output, _defineProperty({}, key, source[key]));else output[key] = mergeDeep(target[key], source[key]);\n } else {\n Object.assign(output, _defineProperty({}, key, source[key]));\n }\n });\n }\n return output;\n}\nexport var merge = function merge(target) {\n for (var _len = arguments.length, sources = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {\n sources[_key - 1] = arguments[_key];\n }\n return sources.reduce(function (t, s) {\n return mergeDeep(t, s);\n }, target);\n};\nexport var identity = function identity(value) {\n return value;\n};\nexport var omit = function omit(obj, keys) {\n var other = Object.assign({}, obj);\n if (keys) {\n for (var i = 0; i < keys.length; i++) {\n delete other[keys[i]];\n }\n }\n return other;\n};\nexport var isPlainObject = function isPlainObject(obj) {\n return obj === Object(obj) && !(obj instanceof Date) && !Array.isArray(obj);\n};\nexport var compact = function compact(arr) {\n return (arr || []).filter(Boolean);\n};","export var isModifier = function isModifier(key) {\n return key[0] === '&';\n};\nexport var isElement = function isElement(key) {\n return !isModifier(key);\n};","import _toConsumableArray from \"@babel/runtime/helpers/toConsumableArray\";\nimport { keys, merge, omit, values } from './utils';\nimport { isModifier } from './filterKeys';\nvar camelize = function camelize(key) {\n return key.replace(/-(\\w)/g, function (m, c) {\n return c.toUpperCase();\n });\n};\nexport var pickDirectStyles = function pickDirectStyles(style) {\n var objectPropertiesWhitelist = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : [];\n var styleKeys = keys(style);\n var result = {};\n for (var i = 0, l = styleKeys.length; i < l; i += 1) {\n var key = styleKeys[i];\n var isDirect = Object.prototype.toString.call(style[key]) !== '[object Object]' ||\n // style defs\n key[0] === ':' ||\n // pseudo selectors\n key[0] === '@' ||\n // @media / @keyframes / @supports / @font-face\n objectPropertiesWhitelist.indexOf(key) >= 0; // whitelisted object-type properties\n\n if (isDirect) {\n result[key] = style[key];\n }\n }\n return result;\n};\nexport var pickNestedStyles = function pickNestedStyles(style, keysToPick) {\n var camelizedKeysToPick = keysToPick.map(camelize);\n var styleKeys = keys(style);\n var result = {};\n for (var i = 0, l = styleKeys.length; i < l; i += 1) {\n var key = styleKeys[i];\n if (keysToPick.indexOf(key) >= 0 || camelizedKeysToPick.indexOf(camelize(key)) >= 0) {\n result[key] = style[key];\n }\n }\n return result;\n}; // breadth-first hoisting of selected modifier style subtrees\n// does not traverse into element, :pseudo-selector or @directive subtrees\n\nexport var hoistModifierStylesRecursive = function hoistModifierStylesRecursive(style, modifierKeysToPick) {\n // hoist styles for selected modifiers on current level\n var result = merge.apply(void 0, [{}, omit(style, modifierKeysToPick)].concat(_toConsumableArray(values(pickNestedStyles(style, modifierKeysToPick))))); // traverse nested styled for ALL modifiers\n\n var modifierKeys = keys(result).filter(isModifier);\n for (var i = 0, l = modifierKeys.length; i < l; i += 1) {\n var key = modifierKeys[i];\n var subresult = hoistModifierStylesRecursive(result[key], modifierKeysToPick);\n if (modifierKeysToPick.indexOf(key) >= 0) {\n // selected modifier: hoist subresult\n delete result[key];\n result = merge({}, result, subresult);\n } else {\n // non-selected modifier: replace with subresult\n result[key] = subresult;\n }\n }\n return result;\n};","import _defineProperty from \"@babel/runtime/helpers/defineProperty\";\nfunction ownKeys(object, enumerableOnly) {\n var keys = Object.keys(object);\n if (Object.getOwnPropertySymbols) {\n var symbols = Object.getOwnPropertySymbols(object);\n if (enumerableOnly) {\n symbols = symbols.filter(function (sym) {\n return Object.getOwnPropertyDescriptor(object, sym).enumerable;\n });\n }\n keys.push.apply(keys, symbols);\n }\n return keys;\n}\nfunction _objectSpread(target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i] != null ? arguments[i] : {};\n if (i % 2) {\n ownKeys(Object(source), true).forEach(function (key) {\n _defineProperty(target, key, source[key]);\n });\n } else if (Object.getOwnPropertyDescriptors) {\n Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));\n } else {\n ownKeys(Object(source)).forEach(function (key) {\n Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));\n });\n }\n }\n return target;\n}\nimport { pickDirectStyles } from './pickStyles';\n// many css-in-js libs process keyframes objects as the value for `animationName`\nvar defaultObjectPropsWhitelist = ['animationName'];\nvar defaultPropsDecorator = function defaultPropsDecorator(_ref) {\n var style = _ref.style,\n className = _ref.className;\n return _objectSpread(_objectSpread({}, style ? {\n style: pickDirectStyles(style, defaultObjectPropsWhitelist)\n } : {}), className ? {\n className: className\n } : {});\n};\nexport default defaultPropsDecorator;","import { createContext } from 'react';\nimport defaultPropsDecorator from './defaultPropsDecorator';\nexport var PropsDecoratorContext = /*#__PURE__*/createContext(defaultPropsDecorator);\nexport default PropsDecoratorContext.Provider;","import { keys } from './utils';\nvar coerceSelection = function coerceSelection(select) {\n if (!select) {\n return [];\n } else if (typeof select === 'string') {\n return [select];\n } else if (!Array.isArray(select)) {\n var objSelect = select; // workaround for https://github.com/facebook/flow/issues/5781\n\n return keys(select).reduce(function (acc, key) {\n return acc.concat(objSelect[key] ? [key] : []);\n }, []);\n }\n return select;\n};\nexport default coerceSelection;","import coerceSelection from './coerceSelection';\nvar EMPTY = {};\nvar memoize = function memoize(substyle) {\n return function (select, defaultStyle) {\n var cacheKey = defaultStyle || EMPTY;\n substyle.memoize = substyle.memoize || new WeakMap();\n var mapEntry;\n if (!substyle.memoize.has(cacheKey)) {\n mapEntry = {};\n substyle.memoize.set(cacheKey, mapEntry);\n } else {\n mapEntry = substyle.memoize.get(cacheKey);\n }\n var selectHash = coerceSelection(select).join(' ');\n return selectHash in mapEntry ? mapEntry[selectHash] : mapEntry[selectHash] = substyle(select || [], defaultStyle);\n };\n};\nexport default memoize;","import _defineProperty from \"@babel/runtime/helpers/defineProperty\";\nimport _toConsumableArray from \"@babel/runtime/helpers/toConsumableArray\";\nfunction ownKeys(object, enumerableOnly) {\n var keys = Object.keys(object);\n if (Object.getOwnPropertySymbols) {\n var symbols = Object.getOwnPropertySymbols(object);\n if (enumerableOnly) {\n symbols = symbols.filter(function (sym) {\n return Object.getOwnPropertyDescriptor(object, sym).enumerable;\n });\n }\n keys.push.apply(keys, symbols);\n }\n return keys;\n}\nfunction _objectSpread(target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i] != null ? arguments[i] : {};\n if (i % 2) {\n ownKeys(Object(source), true).forEach(function (key) {\n _defineProperty(target, key, source[key]);\n });\n } else if (Object.getOwnPropertyDescriptors) {\n Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));\n } else {\n ownKeys(Object(source)).forEach(function (key) {\n Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));\n });\n }\n }\n return target;\n}\nimport invariant from 'invariant';\nimport coerceSelection from './coerceSelection';\nimport defaultPropsDecorator from './defaultPropsDecorator';\nimport { isElement, isModifier } from './filterKeys';\nimport memoize from './memoize';\nimport { hoistModifierStylesRecursive, pickNestedStyles } from './pickStyles';\nimport { compact, isPlainObject, keys, merge, values } from './utils';\nvar guessBaseClassName = function guessBaseClassName(classNames) {\n // all class names must start with the same prefix: the component's base class name\n // which will finally go to the container element\n var firstKey = classNames && keys(classNames)[0];\n return firstKey && firstKey.split('__')[0].split('--')[0];\n};\nvar deriveClassNames = function deriveClassNames(className, elementKeys, modifierKeys) {\n // do not derive class names, if the user did not specify any class name\n if (!className) {\n return undefined;\n } // derive class names based using the passed modifier/element keys\n\n var firstClassName = className.split(' ')[0];\n var derivedClassNames = [].concat(_toConsumableArray(elementKeys.length === 0 ? modifierKeys.map(function (key) {\n return \"\".concat(firstClassName, \"--\").concat(key.substring(1));\n }) : []), _toConsumableArray(elementKeys.map(function (key) {\n return \"\".concat(firstClassName, \"__\").concat(key);\n }))); // also use the provided `className` if there is no sub-element selection\n\n return elementKeys.length === 0 ? [className].concat(_toConsumableArray(derivedClassNames)) : derivedClassNames;\n};\nfunction createSubstyle(_ref) {\n var style = _ref.style,\n className = _ref.className,\n classNames = _ref.classNames;\n var propsDecorator = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : defaultPropsDecorator;\n var baseClassName = className || guessBaseClassName(classNames) || (style === null || style === void 0 ? void 0 : style.className);\n var substyle = typeof style === 'function' ? style : memoize(function (select, defaultStyle) {\n var selectedKeys = coerceSelection(select);\n invariant(Array.isArray(selectedKeys), 'First parameter must be a string, an array of strings, ' + 'a plain object with boolean values, or a falsy value.');\n invariant(!defaultStyle || isPlainObject(defaultStyle), 'Optional second parameter must be a plain object.');\n var modifierKeys = selectedKeys.filter(isModifier);\n var elementKeys = selectedKeys.filter(isElement);\n var collectElementStyles = elementKeys.length > 0 ? function (fromStyle) {\n return values(pickNestedStyles(fromStyle, elementKeys));\n } : function (fromStyle) {\n return [fromStyle];\n };\n var collectSelectedStyles = function collectSelectedStyles() {\n var fromStyle = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};\n return collectElementStyles(hoistModifierStylesRecursive(fromStyle, modifierKeys));\n };\n var derivedClassNames = deriveClassNames(baseClassName, elementKeys, modifierKeys);\n return createSubstyle(_objectSpread(_objectSpread(_objectSpread({}, (style || defaultStyle) && {\n style: merge.apply(void 0, [{}].concat(_toConsumableArray(collectSelectedStyles(defaultStyle)), _toConsumableArray(collectSelectedStyles(style))))\n }), derivedClassNames && {\n className: derivedClassNames.join(' ')\n }), classNames && {\n classNames: classNames\n }), propsDecorator);\n });\n var styleProps = _objectSpread({}, typeof style === 'function' ? style : {\n style: style\n });\n var classNameSplit = _toConsumableArray(new Set([].concat(_toConsumableArray(styleProps.className ? styleProps.className.split(' ') : []), _toConsumableArray(baseClassName ? baseClassName.split(' ') : []))));\n var mappedClassNames = classNames ? compact(classNameSplit.map(function (singleClassName) {\n return classNames[singleClassName];\n })) : classNameSplit;\n var propsForSpread = propsDecorator(_objectSpread(_objectSpread({}, styleProps), mappedClassNames.length > 0 ? {\n className: mappedClassNames.join(' ')\n } : {})); // assign `style`, `className`, and/or any props added by the decorator to the return function object\n\n Object.assign(substyle, propsForSpread);\n return substyle;\n}\nexport default createSubstyle;","import PropsDecoratorProvider, { PropsDecoratorContext } from './PropsDecoratorProvider';\nimport createSubstyle from './createSubstyle';\nimport defaultPropsDecorator from './defaultPropsDecorator';\nimport inline from './inline';\nimport useStyles from './useStyles';\nexport { createSubstyle, PropsDecoratorProvider, PropsDecoratorContext, defaultPropsDecorator, inline };\nexport default useStyles;","import { useContext, useMemo } from 'react';\nimport { PropsDecoratorContext } from './PropsDecoratorProvider';\nimport createSubstyle from './createSubstyle';\nvar useStyles = function useStyles(defaultStyle, _ref, modifiers) {\n var style = _ref.style,\n className = _ref.className,\n classNames = _ref.classNames;\n var propsDecorator = useContext(PropsDecoratorContext);\n var substyle = useMemo(function () {\n return createSubstyle({\n style: style,\n className: className,\n classNames: classNames\n }, propsDecorator);\n }, [style, className, classNames, propsDecorator]);\n return substyle(modifiers, defaultStyle);\n};\nexport default useStyles;","import _defineProperty from \"@babel/runtime/helpers/defineProperty\";\nfunction ownKeys(object, enumerableOnly) {\n var keys = Object.keys(object);\n if (Object.getOwnPropertySymbols) {\n var symbols = Object.getOwnPropertySymbols(object);\n if (enumerableOnly) {\n symbols = symbols.filter(function (sym) {\n return Object.getOwnPropertyDescriptor(object, sym).enumerable;\n });\n }\n keys.push.apply(keys, symbols);\n }\n return keys;\n}\nfunction _objectSpread(target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i] != null ? arguments[i] : {};\n if (i % 2) {\n ownKeys(Object(source), true).forEach(function (key) {\n _defineProperty(target, key, source[key]);\n });\n } else if (Object.getOwnPropertyDescriptors) {\n Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));\n } else {\n ownKeys(Object(source)).forEach(function (key) {\n Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));\n });\n }\n }\n return target;\n}\nvar inline = function inline() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n return args.reduce(function (result, arg) {\n return _objectSpread(_objectSpread(_objectSpread({}, result), typeof arg === 'function' ? arg : {}), {}, {\n style: _objectSpread(_objectSpread({}, result.style), typeof arg === 'function' ? arg.style : arg)\n });\n }, {});\n};\nexport default inline;","import _toConsumableArray from '@babel/runtime/helpers/esm/toConsumableArray';\nimport _extends from '@babel/runtime/helpers/esm/extends';\nimport _classCallCheck from '@babel/runtime/helpers/esm/classCallCheck';\nimport _createClass from '@babel/runtime/helpers/esm/createClass';\nimport _assertThisInitialized from '@babel/runtime/helpers/esm/assertThisInitialized';\nimport _inherits from '@babel/runtime/helpers/esm/inherits';\nimport _possibleConstructorReturn from '@babel/runtime/helpers/esm/possibleConstructorReturn';\nimport _getPrototypeOf from '@babel/runtime/helpers/esm/getPrototypeOf';\nimport _defineProperty from '@babel/runtime/helpers/esm/defineProperty';\nimport React, { Children, useState, useEffect } from 'react';\nimport invariant from 'invariant';\nimport _slicedToArray from '@babel/runtime/helpers/esm/slicedToArray';\nimport _objectWithoutProperties from '@babel/runtime/helpers/esm/objectWithoutProperties';\nimport useStyles, { inline } from 'substyle';\nimport PropTypes from 'prop-types';\nimport ReactDOM from 'react-dom';\n\n// escape RegExp special characters https://stackoverflow.com/a/9310752/5142490\nvar escapeRegex = function escapeRegex(str) {\n return str.replace(/[-[\\]{}()*+?.,\\\\^$|#\\s]/g, '\\\\$&');\n};\nvar PLACEHOLDERS = {\n id: '__id__',\n display: '__display__'\n};\nvar findPositionOfCapturingGroup = function findPositionOfCapturingGroup(markup, parameterName) {\n invariant(parameterName === 'id' || parameterName === 'display', \"Second arg must be either \\\"id\\\" or \\\"display\\\", got: \\\"\".concat(parameterName, \"\\\"\")); // find positions of placeholders in the markup\n\n var indexDisplay = markup.indexOf(PLACEHOLDERS.display);\n var indexId = markup.indexOf(PLACEHOLDERS.id); // set indices to null if not found\n\n if (indexDisplay < 0) indexDisplay = null;\n if (indexId < 0) indexId = null; // markup must contain one of the mandatory placeholders\n\n invariant(indexDisplay !== null || indexId !== null, \"The markup '\".concat(markup, \"' does not contain either of the placeholders '__id__' or '__display__'\"));\n if (indexDisplay !== null && indexId !== null) {\n // both placeholders are used, return 0 or 1 depending on the position of the requested parameter\n return parameterName === 'id' && indexId <= indexDisplay || parameterName === 'display' && indexDisplay <= indexId ? 0 : 1;\n } // just one placeholder is being used, we'll use the captured string for both parameters\n\n return 0;\n};\nvar combineRegExps = function combineRegExps(regExps) {\n var serializedRegexParser = /^\\/(.+)\\/(\\w+)?$/;\n return new RegExp(regExps.map(function (regex) {\n var _serializedRegexParse = serializedRegexParser.exec(regex.toString()),\n _serializedRegexParse2 = _slicedToArray(_serializedRegexParse, 3),\n regexString = _serializedRegexParse2[1],\n regexFlags = _serializedRegexParse2[2];\n invariant(!regexFlags, \"RegExp flags are not supported. Change /\".concat(regexString, \"/\").concat(regexFlags, \" into /\").concat(regexString, \"/\"));\n return \"(\".concat(regexString, \")\");\n }).join('|'), 'g');\n};\nvar countPlaceholders = function countPlaceholders(markup) {\n var count = 0;\n if (markup.indexOf('__id__') >= 0) count++;\n if (markup.indexOf('__display__') >= 0) count++;\n return count;\n};\nvar emptyFn = function emptyFn() {}; // Finds all occurrences of the markup in the value and calls the `markupIteratee` callback for each of them.\n// The optional `textIteratee` callback is called for each plain text ranges in between these markup occurrences.\n\nvar iterateMentionsMarkup = function iterateMentionsMarkup(value, config, markupIteratee) {\n var textIteratee = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : emptyFn;\n var regex = combineRegExps(config.map(function (c) {\n return c.regex;\n }));\n var accOffset = 2; // first is whole match, second is the for the capturing group of first regexp component\n\n var captureGroupOffsets = config.map(function (_ref) {\n var markup = _ref.markup;\n var result = accOffset; // + 1 is for the capturing group we add around each regexp component in combineRegExps\n\n accOffset += countPlaceholders(markup) + 1;\n return result;\n });\n var match;\n var start = 0;\n var currentPlainTextIndex = 0; // detect all mention markup occurrences in the value and iterate the matches\n\n while ((match = regex.exec(value)) !== null) {\n var offset = captureGroupOffsets.find(function (o) {\n return !!match[o];\n }); // eslint-disable-line no-loop-func\n\n var mentionChildIndex = captureGroupOffsets.indexOf(offset);\n var _config$mentionChildI = config[mentionChildIndex],\n markup = _config$mentionChildI.markup,\n displayTransform = _config$mentionChildI.displayTransform;\n var idPos = offset + findPositionOfCapturingGroup(markup, 'id');\n var displayPos = offset + findPositionOfCapturingGroup(markup, 'display');\n var id = match[idPos];\n var display = displayTransform(id, match[displayPos]);\n var substr = value.substring(start, match.index);\n textIteratee(substr, start, currentPlainTextIndex);\n currentPlainTextIndex += substr.length;\n markupIteratee(match[0], match.index, currentPlainTextIndex, id, display, mentionChildIndex, start);\n currentPlainTextIndex += display.length;\n start = regex.lastIndex;\n }\n if (start < value.length) {\n textIteratee(value.substring(start), start, currentPlainTextIndex);\n }\n};\nvar getPlainText = function getPlainText(value, config) {\n var result = '';\n iterateMentionsMarkup(value, config, function (match, index, plainTextIndex, id, display) {\n result += display;\n }, function (plainText) {\n result += plainText;\n });\n return result;\n};\n\n// in the marked up value string.\n// If the passed character index lies inside a mention, the value of `inMarkupCorrection` defines the\n// correction to apply:\n// - 'START' to return the index of the mention markup's first char (default)\n// - 'END' to return the index after its last char\n// - 'NULL' to return null\n\nvar mapPlainTextIndex = function mapPlainTextIndex(value, config, indexInPlainText) {\n var inMarkupCorrection = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : 'START';\n if (typeof indexInPlainText !== 'number') {\n return indexInPlainText;\n }\n var result;\n var textIteratee = function textIteratee(substr, index, substrPlainTextIndex) {\n if (result !== undefined) return;\n if (substrPlainTextIndex + substr.length >= indexInPlainText) {\n // found the corresponding position in the current plain text range\n result = index + indexInPlainText - substrPlainTextIndex;\n }\n };\n var markupIteratee = function markupIteratee(markup, index, mentionPlainTextIndex, id, display, childIndex, lastMentionEndIndex) {\n if (result !== undefined) return;\n if (mentionPlainTextIndex + display.length > indexInPlainText) {\n // found the corresponding position inside current match,\n // return the index of the first or after the last char of the matching markup\n // depending on whether the `inMarkupCorrection`\n if (inMarkupCorrection === 'NULL') {\n result = null;\n } else {\n result = index + (inMarkupCorrection === 'END' ? markup.length : 0);\n }\n }\n };\n iterateMentionsMarkup(value, config, markupIteratee, textIteratee); // when a mention is at the end of the value and we want to get the caret position\n // at the end of the string, result is undefined\n\n return result === undefined ? value.length : result;\n};\nvar spliceString = function spliceString(str, start, end, insert) {\n return str.substring(0, start) + insert + str.substring(end);\n};\n\n// guided by the textarea text selection ranges before and after the change\n\nvar applyChangeToValue = function applyChangeToValue(value, plainTextValue, _ref, config) {\n var selectionStartBefore = _ref.selectionStartBefore,\n selectionEndBefore = _ref.selectionEndBefore,\n selectionEndAfter = _ref.selectionEndAfter;\n var oldPlainTextValue = getPlainText(value, config);\n var lengthDelta = oldPlainTextValue.length - plainTextValue.length;\n if (selectionStartBefore === 'undefined') {\n selectionStartBefore = selectionEndAfter + lengthDelta;\n }\n if (selectionEndBefore === 'undefined') {\n selectionEndBefore = selectionStartBefore;\n } // Fixes an issue with replacing combined characters for complex input. Eg like acented letters on OSX\n\n if (selectionStartBefore === selectionEndBefore && selectionEndBefore === selectionEndAfter && oldPlainTextValue.length === plainTextValue.length) {\n selectionStartBefore = selectionStartBefore - 1;\n } // extract the insertion from the new plain text value\n\n var insert = plainTextValue.slice(selectionStartBefore, selectionEndAfter); // handling for Backspace key with no range selection\n\n var spliceStart = Math.min(selectionStartBefore, selectionEndAfter);\n var spliceEnd = selectionEndBefore;\n if (selectionStartBefore === selectionEndAfter) {\n // handling for Delete key with no range selection\n spliceEnd = Math.max(selectionEndBefore, selectionStartBefore + lengthDelta);\n }\n var mappedSpliceStart = mapPlainTextIndex(value, config, spliceStart, 'START');\n var mappedSpliceEnd = mapPlainTextIndex(value, config, spliceEnd, 'END');\n var controlSpliceStart = mapPlainTextIndex(value, config, spliceStart, 'NULL');\n var controlSpliceEnd = mapPlainTextIndex(value, config, spliceEnd, 'NULL');\n var willRemoveMention = controlSpliceStart === null || controlSpliceEnd === null;\n var newValue = spliceString(value, mappedSpliceStart, mappedSpliceEnd, insert);\n if (!willRemoveMention) {\n // test for auto-completion changes\n var controlPlainTextValue = getPlainText(newValue, config);\n if (controlPlainTextValue !== plainTextValue) {\n // some auto-correction is going on\n // find start of diff\n spliceStart = 0;\n while (plainTextValue[spliceStart] === controlPlainTextValue[spliceStart]) {\n spliceStart++;\n } // extract auto-corrected insertion\n\n insert = plainTextValue.slice(spliceStart, selectionEndAfter); // find index of the unchanged remainder\n\n spliceEnd = oldPlainTextValue.lastIndexOf(plainTextValue.substring(selectionEndAfter)); // re-map the corrected indices\n\n mappedSpliceStart = mapPlainTextIndex(value, config, spliceStart, 'START');\n mappedSpliceEnd = mapPlainTextIndex(value, config, spliceEnd, 'END');\n newValue = spliceString(value, mappedSpliceStart, mappedSpliceEnd, insert);\n }\n }\n return newValue;\n};\n\n// returns a the index of of the first char of the mention in the plain text.\n// If indexInPlainText does not lie inside a mention, returns indexInPlainText.\n\nvar findStartOfMentionInPlainText = function findStartOfMentionInPlainText(value, config, indexInPlainText) {\n var result = indexInPlainText;\n var foundMention = false;\n var markupIteratee = function markupIteratee(markup, index, mentionPlainTextIndex, id, display, childIndex, lastMentionEndIndex) {\n if (mentionPlainTextIndex <= indexInPlainText && mentionPlainTextIndex + display.length > indexInPlainText) {\n result = mentionPlainTextIndex;\n foundMention = true;\n }\n };\n iterateMentionsMarkup(value, config, markupIteratee);\n if (foundMention) {\n return result;\n }\n};\nvar getMentions = function getMentions(value, config) {\n var mentions = [];\n iterateMentionsMarkup(value, config, function (match, index, plainTextIndex, id, display, childIndex, start) {\n mentions.push({\n id: id,\n display: display,\n childIndex: childIndex,\n index: index,\n plainTextIndex: plainTextIndex\n });\n });\n return mentions;\n};\nvar getSuggestionHtmlId = function getSuggestionHtmlId(prefix, id) {\n return \"\".concat(prefix, \"-\").concat(id);\n};\nvar countSuggestions = function countSuggestions(suggestions) {\n return Object.values(suggestions).reduce(function (acc, _ref) {\n var results = _ref.results;\n return acc + results.length;\n }, 0);\n};\nvar getEndOfLastMention = function getEndOfLastMention(value, config) {\n var mentions = getMentions(value, config);\n var lastMention = mentions[mentions.length - 1];\n return lastMention ? lastMention.plainTextIndex + lastMention.display.length : 0;\n};\nvar markupToRegex = function markupToRegex(markup) {\n var escapedMarkup = escapeRegex(markup);\n var charAfterDisplay = markup[markup.indexOf(PLACEHOLDERS.display) + PLACEHOLDERS.display.length];\n var charAfterId = markup[markup.indexOf(PLACEHOLDERS.id) + PLACEHOLDERS.id.length];\n return new RegExp(escapedMarkup.replace(PLACEHOLDERS.display, \"([^\".concat(escapeRegex(charAfterDisplay || ''), \"]+?)\")).replace(PLACEHOLDERS.id, \"([^\".concat(escapeRegex(charAfterId || ''), \"]+?)\")));\n};\nvar readConfigFromChildren = function readConfigFromChildren(children) {\n return Children.toArray(children).map(function (_ref) {\n var _ref$props = _ref.props,\n markup = _ref$props.markup,\n regex = _ref$props.regex,\n displayTransform = _ref$props.displayTransform;\n return {\n markup: markup,\n regex: regex ? coerceCapturingGroups(regex, markup) : markupToRegex(markup),\n displayTransform: displayTransform || function (id, display) {\n return display || id;\n }\n };\n });\n}; // make sure that the custom regex defines the correct number of capturing groups\n\nvar coerceCapturingGroups = function coerceCapturingGroups(regex, markup) {\n var numberOfGroups = new RegExp(regex.toString() + '|').exec('').length - 1;\n var numberOfPlaceholders = countPlaceholders(markup);\n invariant(numberOfGroups === numberOfPlaceholders, \"Number of capturing groups in RegExp \".concat(regex.toString(), \" (\").concat(numberOfGroups, \") does not match the number of placeholders in the markup '\").concat(markup, \"' (\").concat(numberOfPlaceholders, \")\"));\n return regex;\n};\nvar makeMentionsMarkup = function makeMentionsMarkup(markup, id, display) {\n return markup.replace(PLACEHOLDERS.id, id).replace(PLACEHOLDERS.display, display);\n};\n\n// This contains all the latin letters and the regex that match these letters with diacritics\n// https://stackoverflow.com/questions/990904/remove-accents-diacritics-in-a-string-in-javascript\nvar lettersDiacritics = [{\n base: 'A',\n letters: /(A|Ⓐ|Ａ|À|Á|Â|Ầ|Ấ|Ẫ|Ẩ|Ã|Ā|Ă|Ằ|Ắ|Ẵ|Ẳ|Ȧ|Ǡ|Ä|Ǟ|Ả|Å|Ǻ|Ǎ|Ȁ|Ȃ|Ạ|Ậ|Ặ|Ḁ|Ą|Ⱥ|Ɐ|[\\u0041\\u24B6\\uFF21\\u00C0\\u00C1\\u00C2\\u1EA6\\u1EA4\\u1EAA\\u1EA8\\u00C3\\u0100\\u0102\\u1EB0\\u1EAE\\u1EB4\\u1EB2\\u0226\\u01E0\\u00C4\\u01DE\\u1EA2\\u00C5\\u01FA\\u01CD\\u0200\\u0202\\u1EA0\\u1EAC\\u1EB6\\u1E00\\u0104\\u023A\\u2C6F])/g\n}, {\n base: 'AA',\n letters: /(Ꜳ|[\\uA732])/g\n}, {\n base: 'AE',\n letters: /(Æ|Ǽ|Ǣ|[\\u00C6\\u01FC\\u01E2])/g\n}, {\n base: 'AO',\n letters: /(Ꜵ|[\\uA734])/g\n}, {\n base: 'AU',\n letters: /(Ꜷ|[\\uA736])/g\n}, {\n base: 'AV',\n letters: /(Ꜹ|Ꜻ|[\\uA738\\uA73A])/g\n}, {\n base: 'AY',\n letters: /(Ꜽ|[\\uA73C])/g\n}, {\n base: 'B',\n letters: /(B|Ⓑ|Ｂ|Ḃ|Ḅ|Ḇ|Ƀ|Ƃ|Ɓ|[\\u0042\\u24B7\\uFF22\\u1E02\\u1E04\\u1E06\\u0243\\u0182\\u0181])/g\n}, {\n base: 'C',\n letters: /(C|Ⓒ|Ｃ|Ć|Ĉ|Ċ|Č|Ç|Ḉ|Ƈ|Ȼ|Ꜿ|[\\u0043\\u24B8\\uFF23\\u0106\\u0108\\u010A\\u010C\\u00C7\\u1E08\\u0187\\u023B\\uA73E])/g\n}, {\n base: 'D',\n letters: /(D|Ⓓ|Ｄ|Ḋ|Ď|Ḍ|Ḑ|Ḓ|Ḏ|Đ|Ƌ|Ɗ|Ɖ|Ꝺ|Ð|[\\u0044\\u24B9\\uFF24\\u1E0A\\u010E\\u1E0C\\u1E10\\u1E12\\u1E0E\\u0110\\u018B\\u018A\\u0189\\uA779\\u00D0])/g\n}, {\n base: 'DZ',\n letters: /(DZ|DŽ|[\\u01F1\\u01C4])/g\n}, {\n base: 'Dz',\n letters: /(Dz|Dž|[\\u01F2\\u01C5])/g\n}, {\n base: 'E',\n letters: /(E|Ⓔ|Ｅ|È|É|Ê|Ề|Ế|Ễ|Ể|Ẽ|Ē|Ḕ|Ḗ|Ĕ|Ė|Ë|Ẻ|Ě|Ȅ|Ȇ|Ẹ|Ệ|Ȩ|Ḝ|Ę|Ḙ|Ḛ|Ɛ|Ǝ|[\\u0045\\u24BA\\uFF25\\u00C8\\u00C9\\u00CA\\u1EC0\\u1EBE\\u1EC4\\u1EC2\\u1EBC\\u0112\\u1E14\\u1E16\\u0114\\u0116\\u00CB\\u1EBA\\u011A\\u0204\\u0206\\u1EB8\\u1EC6\\u0228\\u1E1C\\u0118\\u1E18\\u1E1A\\u0190\\u018E])/g\n}, {\n base: 'F',\n letters: /(F|Ⓕ|Ｆ|Ḟ|Ƒ|Ꝼ|[\\u0046\\u24BB\\uFF26\\u1E1E\\u0191\\uA77B])/g\n}, {\n base: 'G',\n letters: /(G|Ⓖ|Ｇ|Ǵ|Ĝ|Ḡ|Ğ|Ġ|Ǧ|Ģ|Ǥ|Ɠ|Ꞡ|Ᵹ|Ꝿ|[\\u0047\\u24BC\\uFF27\\u01F4\\u011C\\u1E20\\u011E\\u0120\\u01E6\\u0122\\u01E4\\u0193\\uA7A0\\uA77D\\uA77E])/g\n}, {\n base: 'H',\n letters: /(H|Ⓗ|Ｈ|Ĥ|Ḣ|Ḧ|Ȟ|Ḥ|Ḩ|Ḫ|Ħ|Ⱨ|Ⱶ|Ɥ|[\\u0048\\u24BD\\uFF28\\u0124\\u1E22\\u1E26\\u021E\\u1E24\\u1E28\\u1E2A\\u0126\\u2C67\\u2C75\\uA78D])/g\n}, {\n base: 'I',\n letters: /(I|Ⓘ|Ｉ|Ì|Í|Î|Ĩ|Ī|Ĭ|İ|Ï|Ḯ|Ỉ|Ǐ|Ȉ|Ȋ|Ị|Į|Ḭ|Ɨ|[\\u0049\\u24BE\\uFF29\\u00CC\\u00CD\\u00CE\\u0128\\u012A\\u012C\\u0130\\u00CF\\u1E2E\\u1EC8\\u01CF\\u0208\\u020A\\u1ECA\\u012E\\u1E2C\\u0197])/g\n}, {\n base: 'J',\n letters: /(J|Ⓙ|Ｊ|Ĵ|Ɉ|[\\u004A\\u24BF\\uFF2A\\u0134\\u0248])/g\n}, {\n base: 'K',\n letters: /(K|Ⓚ|Ｋ|Ḱ|Ǩ|Ḳ|Ķ|Ḵ|Ƙ|Ⱪ|Ꝁ|Ꝃ|Ꝅ|Ꞣ|[\\u004B\\u24C0\\uFF2B\\u1E30\\u01E8\\u1E32\\u0136\\u1E34\\u0198\\u2C69\\uA740\\uA742\\uA744\\uA7A2])/g\n}, {\n base: 'L',\n letters: /(L|Ⓛ|Ｌ|Ŀ|Ĺ|Ľ|Ḷ|Ḹ|Ļ|Ḽ|Ḻ|Ł|Ƚ|Ɫ|Ⱡ|Ꝉ|Ꝇ|Ꞁ|[\\u004C\\u24C1\\uFF2C\\u013F\\u0139\\u013D\\u1E36\\u1E38\\u013B\\u1E3C\\u1E3A\\u0141\\u023D\\u2C62\\u2C60\\uA748\\uA746\\uA780])/g\n}, {\n base: 'LJ',\n letters: /(LJ|[\\u01C7])/g\n}, {\n base: 'Lj',\n letters: /(Lj|[\\u01C8])/g\n}, {\n base: 'M',\n letters: /(M|Ⓜ|Ｍ|Ḿ|Ṁ|Ṃ|Ɱ|Ɯ|[\\u004D\\u24C2\\uFF2D\\u1E3E\\u1E40\\u1E42\\u2C6E\\u019C])/g\n}, {\n base: 'N',\n letters: /(N|Ⓝ|Ｎ|Ǹ|Ń|Ñ|Ṅ|Ň|Ṇ|Ņ|Ṋ|Ṉ|Ƞ|Ɲ|Ꞑ|Ꞥ|Ŋ|[\\u004E\\u24C3\\uFF2E\\u01F8\\u0143\\u00D1\\u1E44\\u0147\\u1E46\\u0145\\u1E4A\\u1E48\\u0220\\u019D\\uA790\\uA7A4\\u014A])/g\n}, {\n base: 'NJ',\n letters: /(NJ|[\\u01CA])/g\n}, {\n base: 'Nj',\n letters: /(Nj|[\\u01CB])/g\n}, {\n base: 'O',\n letters: /(O|Ⓞ|Ｏ|Ò|Ó|Ô|Ồ|Ố|Ỗ|Ổ|Õ|Ṍ|Ȭ|Ṏ|Ō|Ṑ|Ṓ|Ŏ|Ȯ|Ȱ|Ö|Ȫ|Ỏ|Ő|Ǒ|Ȍ|Ȏ|Ơ|Ờ|Ớ|Ỡ|Ở|Ợ|Ọ|Ộ|Ǫ|Ǭ|Ø|Ǿ|Ɔ|Ɵ|Ꝋ|Ꝍ|[\\u004F\\u24C4\\uFF2F\\u00D2\\u00D3\\u00D4\\u1ED2\\u1ED0\\u1ED6\\u1ED4\\u00D5\\u1E4C\\u022C\\u1E4E\\u014C\\u1E50\\u1E52\\u014E\\u022E\\u0230\\u00D6\\u022A\\u1ECE\\u0150\\u01D1\\u020C\\u020E\\u01A0\\u1EDC\\u1EDA\\u1EE0\\u1EDE\\u1EE2\\u1ECC\\u1ED8\\u01EA\\u01EC\\u00D8\\u01FE\\u0186\\u019F\\uA74A\\uA74C])/g\n}, {\n base: 'OE',\n letters: /(Œ|[\\u0152])/g\n}, {\n base: 'OI',\n letters: /(Ƣ|[\\u01A2])/g\n}, {\n base: 'OO',\n letters: /(Ꝏ|[\\uA74E])/g\n}, {\n base: 'OU',\n letters: /(Ȣ|[\\u0222])/g\n}, {\n base: 'P',\n letters: /(P|Ⓟ|Ｐ|Ṕ|Ṗ|Ƥ|Ᵽ|Ꝑ|Ꝓ|Ꝕ|[\\u0050\\u24C5\\uFF30\\u1E54\\u1E56\\u01A4\\u2C63\\uA750\\uA752\\uA754])/g\n}, {\n base: 'Q',\n letters: /(Q|Ⓠ|Ｑ|Ꝗ|Ꝙ|Ɋ|[\\u0051\\u24C6\\uFF31\\uA756\\uA758\\u024A])/g\n}, {\n base: 'R',\n letters: /(R|Ⓡ|Ｒ|Ŕ|Ṙ|Ř|Ȑ|Ȓ|Ṛ|Ṝ|Ŗ|Ṟ|Ɍ|Ɽ|Ꝛ|Ꞧ|Ꞃ|[\\u0052\\u24C7\\uFF32\\u0154\\u1E58\\u0158\\u0210\\u0212\\u1E5A\\u1E5C\\u0156\\u1E5E\\u024C\\u2C64\\uA75A\\uA7A6\\uA782])/g\n}, {\n base: 'S',\n letters: /(S|Ⓢ|Ｓ|ẞ|Ś|Ṥ|Ŝ|Ṡ|Š|Ṧ|Ṣ|Ṩ|Ș|Ş|Ȿ|Ꞩ|Ꞅ|[\\u0053\\u24C8\\uFF33\\u1E9E\\u015A\\u1E64\\u015C\\u1E60\\u0160\\u1E66\\u1E62\\u1E68\\u0218\\u015E\\u2C7E\\uA7A8\\uA784])/g\n}, {\n base: 'T',\n letters: /(T|Ⓣ|Ｔ|Ṫ|Ť|Ṭ|Ț|Ţ|Ṱ|Ṯ|Ŧ|Ƭ|Ʈ|Ⱦ|Ꞇ|[\\u0054\\u24C9\\uFF34\\u1E6A\\u0164\\u1E6C\\u021A\\u0162\\u1E70\\u1E6E\\u0166\\u01AC\\u01AE\\u023E\\uA786])/g\n}, {\n base: 'TH',\n letters: /(Þ|[\\u00DE])/g\n}, {\n base: 'TZ',\n letters: /(Ꜩ|[\\uA728])/g\n}, {\n base: 'U',\n letters: /(U|Ⓤ|Ｕ|Ù|Ú|Û|Ũ|Ṹ|Ū|Ṻ|Ŭ|Ü|Ǜ|Ǘ|Ǖ|Ǚ|Ủ|Ů|Ű|Ǔ|Ȕ|Ȗ|Ư|Ừ|Ứ|Ữ|Ử|Ự|Ụ|Ṳ|Ų|Ṷ|Ṵ|Ʉ|[\\u0055\\u24CA\\uFF35\\u00D9\\u00DA\\u00DB\\u0168\\u1E78\\u016A\\u1E7A\\u016C\\u00DC\\u01DB\\u01D7\\u01D5\\u01D9\\u1EE6\\u016E\\u0170\\u01D3\\u0214\\u0216\\u01AF\\u1EEA\\u1EE8\\u1EEE\\u1EEC\\u1EF0\\u1EE4\\u1E72\\u0172\\u1E76\\u1E74\\u0244])/g\n}, {\n base: 'V',\n letters: /(V|Ⓥ|Ｖ|Ṽ|Ṿ|Ʋ|Ꝟ|Ʌ|[\\u0056\\u24CB\\uFF36\\u1E7C\\u1E7E\\u01B2\\uA75E\\u0245])/g\n}, {\n base: 'VY',\n letters: /(Ꝡ|[\\uA760])/g\n}, {\n base: 'W',\n letters: /(W|Ⓦ|Ｗ|Ẁ|Ẃ|Ŵ|Ẇ|Ẅ|Ẉ|Ⱳ|[\\u0057\\u24CC\\uFF37\\u1E80\\u1E82\\u0174\\u1E86\\u1E84\\u1E88\\u2C72])/g\n}, {\n base: 'X',\n letters: /(X|Ⓧ|Ｘ|Ẋ|Ẍ|[\\u0058\\u24CD\\uFF38\\u1E8A\\u1E8C])/g\n}, {\n base: 'Y',\n letters: /(Y|Ⓨ|Ｙ|Ỳ|Ý|Ŷ|Ỹ|Ȳ|Ẏ|Ÿ|Ỷ|Ỵ|Ƴ|Ɏ|Ỿ|[\\u0059\\u24CE\\uFF39\\u1EF2\\u00DD\\u0176\\u1EF8\\u0232\\u1E8E\\u0178\\u1EF6\\u1EF4\\u01B3\\u024E\\u1EFE])/g\n}, {\n base: 'Z',\n letters: /(Z|Ⓩ|Ｚ|Ź|Ẑ|Ż|Ž|Ẓ|Ẕ|Ƶ|Ȥ|Ɀ|Ⱬ|Ꝣ|[\\u005A\\u24CF\\uFF3A\\u0179\\u1E90\\u017B\\u017D\\u1E92\\u1E94\\u01B5\\u0224\\u2C7F\\u2C6B\\uA762])/g\n}, {\n base: 'a',\n letters: /(a|ⓐ|ａ|ẚ|à|á|â|ầ|ấ|ẫ|ẩ|ã|ā|ă|ằ|ắ|ẵ|ẳ|ȧ|ǡ|ä|ǟ|ả|å|ǻ|ǎ|ȁ|ȃ|ạ|ậ|ặ|ḁ|ą|ⱥ|ɐ|[\\u0061\\u24D0\\uFF41\\u1E9A\\u00E0\\u00E1\\u00E2\\u1EA7\\u1EA5\\u1EAB\\u1EA9\\u00E3\\u0101\\u0103\\u1EB1\\u1EAF\\u1EB5\\u1EB3\\u0227\\u01E1\\u00E4\\u01DF\\u1EA3\\u00E5\\u01FB\\u01CE\\u0201\\u0203\\u1EA1\\u1EAD\\u1EB7\\u1E01\\u0105\\u2C65\\u0250])/g\n}, {\n base: 'aa',\n letters: /(ꜳ|[\\uA733])/g\n}, {\n base: 'ae',\n letters: /(æ|ǽ|ǣ|[\\u00E6\\u01FD\\u01E3])/g\n}, {\n base: 'ao',\n letters: /(ꜵ|[\\uA735])/g\n}, {\n base: 'au',\n letters: /(ꜷ|[\\uA737])/g\n}, {\n base: 'av',\n letters: /(ꜹ|ꜻ|[\\uA739\\uA73B])/g\n}, {\n base: 'ay',\n letters: /(ꜽ|[\\uA73D])/g\n}, {\n base: 'b',\n letters: /(b|ⓑ|ｂ|ḃ|ḅ|ḇ|ƀ|ƃ|ɓ|[\\u0062\\u24D1\\uFF42\\u1E03\\u1E05\\u1E07\\u0180\\u0183\\u0253])/g\n}, {\n base: 'c',\n letters: /(c|ⓒ|ｃ|ć|ĉ|ċ|č|ç|ḉ|ƈ|ȼ|ꜿ|ↄ|[\\u0063\\u24D2\\uFF43\\u0107\\u0109\\u010B\\u010D\\u00E7\\u1E09\\u0188\\u023C\\uA73F\\u2184])/g\n}, {\n base: 'd',\n letters: /(d|ⓓ|ｄ|ḋ|ď|ḍ|ḑ|ḓ|ḏ|đ|ƌ|ɖ|ɗ|ꝺ|ð|[\\u0064\\u24D3\\uFF44\\u1E0B\\u010F\\u1E0D\\u1E11\\u1E13\\u1E0F\\u0111\\u018C\\u0256\\u0257\\uA77A\\u00F0])/g\n}, {\n base: 'dz',\n letters: /(dz|dž|[\\u01F3\\u01C6])/g\n}, {\n base: 'e',\n letters: /(e|ⓔ|ｅ|è|é|ê|ề|ế|ễ|ể|ẽ|ē|ḕ|ḗ|ĕ|ė|ë|ẻ|ě|ȅ|ȇ|ẹ|ệ|ȩ|ḝ|ę|ḙ|ḛ|ɇ|ɛ|ǝ|[\\u0065\\u24D4\\uFF45\\u00E8\\u00E9\\u00EA\\u1EC1\\u1EBF\\u1EC5\\u1EC3\\u1EBD\\u0113\\u1E15\\u1E17\\u0115\\u0117\\u00EB\\u1EBB\\u011B\\u0205\\u0207\\u1EB9\\u1EC7\\u0229\\u1E1D\\u0119\\u1E19\\u1E1B\\u0247\\u025B\\u01DD])/g\n}, {\n base: 'f',\n letters: /(f|ⓕ|ｆ|ḟ|ƒ|ꝼ|[\\u0066\\u24D5\\uFF46\\u1E1F\\u0192\\uA77C])/g\n}, {\n base: 'g',\n letters: /(g|ⓖ|ｇ|ǵ|ĝ|ḡ|ğ|ġ|ǧ|ģ|ǥ|ɠ|ꞡ|ᵹ|ꝿ|[\\u0067\\u24D6\\uFF47\\u01F5\\u011D\\u1E21\\u011F\\u0121\\u01E7\\u0123\\u01E5\\u0260\\uA7A1\\u1D79\\uA77F])/g\n}, {\n base: 'h',\n letters: /(h|ⓗ|ｈ|ĥ|ḣ|ḧ|ȟ|ḥ|ḩ|ḫ|ẖ|ħ|ⱨ|ⱶ|ɥ|[\\u0068\\u24D7\\uFF48\\u0125\\u1E23\\u1E27\\u021F\\u1E25\\u1E29\\u1E2B\\u1E96\\u0127\\u2C68\\u2C76\\u0265])/g\n}, {\n base: 'hv',\n letters: /(ƕ|[\\u0195])/g\n}, {\n base: 'i',\n letters: /(i|ⓘ|ｉ|ì|í|î|ĩ|ī|ĭ|ï|ḯ|ỉ|ǐ|ȉ|ȋ|ị|į|ḭ|ɨ|ı|[\\u0069\\u24D8\\uFF49\\u00EC\\u00ED\\u00EE\\u0129\\u012B\\u012D\\u00EF\\u1E2F\\u1EC9\\u01D0\\u0209\\u020B\\u1ECB\\u012F\\u1E2D\\u0268\\u0131])/g\n}, {\n base: 'ij',\n letters: /(ij|[\\u0133])/g\n}, {\n base: 'j',\n letters: /(j|ⓙ|ｊ|ĵ|ǰ|ɉ|[\\u006A\\u24D9\\uFF4A\\u0135\\u01F0\\u0249])/g\n}, {\n base: 'k',\n letters: /(k|ⓚ|ｋ|ḱ|ǩ|ḳ|ķ|ḵ|ƙ|ⱪ|ꝁ|ꝃ|ꝅ|ꞣ|[\\u006B\\u24DA\\uFF4B\\u1E31\\u01E9\\u1E33\\u0137\\u1E35\\u0199\\u2C6A\\uA741\\uA743\\uA745\\uA7A3])/g\n}, {\n base: 'l',\n letters: /(l|ⓛ|ｌ|ŀ|ĺ|ľ|ḷ|ḹ|ļ|ḽ|ḻ|ł|ƚ|ɫ|ⱡ|ꝉ|ꞁ|ꝇ|[\\u006C\\u24DB\\uFF4C\\u0140\\u013A\\u013E\\u1E37\\u1E39\\u013C\\u1E3D\\u1E3B\\u0142\\u019A\\u026B\\u2C61\\uA749\\uA781\\uA747])/g\n}, {\n base: 'lj',\n letters: /(lj|[\\u01C9])/g\n}, {\n base: 'm',\n letters: /(m|ⓜ|ｍ|ḿ|ṁ|ṃ|ɱ|ɯ|[\\u006D\\u24DC\\uFF4D\\u1E3F\\u1E41\\u1E43\\u0271\\u026F])/g\n}, {\n base: 'n',\n letters: /(n|ⓝ|ｎ|ǹ|ń|ñ|ṅ|ň|ṇ|ņ|ṋ|ṉ|ƞ|ɲ|ʼn|ꞑ|ꞥ|ŋ|[\\u006E\\u24DD\\uFF4E\\u01F9\\u0144\\u00F1\\u1E45\\u0148\\u1E47\\u0146\\u1E4B\\u1E49\\u019E\\u0272\\u0149\\uA791\\uA7A5\\u014B])/g\n}, {\n base: 'nj',\n letters: /(nj|[\\u01CC])/g\n}, {\n base: 'o',\n letters: /(o|ⓞ|ｏ|ò|ó|ô|ồ|ố|ỗ|ổ|õ|ṍ|ȭ|ṏ|ō|ṑ|ṓ|ŏ|ȯ|ȱ|ö|ȫ|ỏ|ő|ǒ|ȍ|ȏ|ơ|ờ|ớ|ỡ|ở|ợ|ọ|ộ|ǫ|ǭ|ø|ǿ|ɔ|ꝋ|ꝍ|ɵ|[\\u006F\\u24DE\\uFF4F\\u00F2\\u00F3\\u00F4\\u1ED3\\u1ED1\\u1ED7\\u1ED5\\u00F5\\u1E4D\\u022D\\u1E4F\\u014D\\u1E51\\u1E53\\u014F\\u022F\\u0231\\u00F6\\u022B\\u1ECF\\u0151\\u01D2\\u020D\\u020F\\u01A1\\u1EDD\\u1EDB\\u1EE1\\u1EDF\\u1EE3\\u1ECD\\u1ED9\\u01EB\\u01ED\\u00F8\\u01FF\\u0254\\uA74B\\uA74D\\u0275])/g\n}, {\n base: 'oe',\n letters: /(œ|[\\u0153])/g\n}, {\n base: 'oi',\n letters: /(ƣ|[\\u01A3])/g\n}, {\n base: 'ou',\n letters: /(ȣ|[\\u0223])/g\n}, {\n base: 'oo',\n letters: /(ꝏ|[\\uA74F])/g\n}, {\n base: 'p',\n letters: /(p|ⓟ|ｐ|ṕ|ṗ|ƥ|ᵽ|ꝑ|ꝓ|ꝕ|[\\u0070\\u24DF\\uFF50\\u1E55\\u1E57\\u01A5\\u1D7D\\uA751\\uA753\\uA755])/g\n}, {\n base: 'q',\n letters: /(q|ⓠ|ｑ|ɋ|ꝗ|ꝙ|[\\u0071\\u24E0\\uFF51\\u024B\\uA757\\uA759])/g\n}, {\n base: 'r',\n letters: /(r|ⓡ|ｒ|ŕ|ṙ|ř|ȑ|ȓ|ṛ|ṝ|ŗ|ṟ|ɍ|ɽ|ꝛ|ꞧ|ꞃ|[\\u0072\\u24E1\\uFF52\\u0155\\u1E59\\u0159\\u0211\\u0213\\u1E5B\\u1E5D\\u0157\\u1E5F\\u024D\\u027D\\uA75B\\uA7A7\\uA783])/g\n}, {\n base: 's',\n letters: /(s|ⓢ|ｓ|ś|ṥ|ŝ|ṡ|š|ṧ|ṣ|ṩ|ș|ş|ȿ|ꞩ|ꞅ|ẛ|ſ|[\\u0073\\u24E2\\uFF53\\u015B\\u1E65\\u015D\\u1E61\\u0161\\u1E67\\u1E63\\u1E69\\u0219\\u015F\\u023F\\uA7A9\\uA785\\u1E9B\\u017F])/g\n}, {\n base: 'ss',\n letters: /(ß|[\\u00DF])/g\n}, {\n base: 't',\n letters: /(t|ⓣ|ｔ|ṫ|ẗ|ť|ṭ|ț|ţ|ṱ|ṯ|ŧ|ƭ|ʈ|ⱦ|ꞇ|[\\u0074\\u24E3\\uFF54\\u1E6B\\u1E97\\u0165\\u1E6D\\u021B\\u0163\\u1E71\\u1E6F\\u0167\\u01AD\\u0288\\u2C66\\uA787])/g\n}, {\n base: 'th',\n letters: /(þ|[\\u00FE])/g\n}, {\n base: 'tz',\n letters: /(ꜩ|[\\uA729])/g\n}, {\n base: 'u',\n letters: /(u|ⓤ|ｕ|ù|ú|û|ũ|ṹ|ū|ṻ|ŭ|ü|ǜ|ǘ|ǖ|ǚ|ủ|ů|ű|ǔ|ȕ|ȗ|ư|ừ|ứ|ữ|ử|ự|ụ|ṳ|ų|ṷ|ṵ|ʉ|[\\u0075\\u24E4\\uFF55\\u00F9\\u00FA\\u00FB\\u0169\\u1E79\\u016B\\u1E7B\\u016D\\u00FC\\u01DC\\u01D8\\u01D6\\u01DA\\u1EE7\\u016F\\u0171\\u01D4\\u0215\\u0217\\u01B0\\u1EEB\\u1EE9\\u1EEF\\u1EED\\u1EF1\\u1EE5\\u1E73\\u0173\\u1E77\\u1E75\\u0289])/g\n}, {\n base: 'v',\n letters: /(v|ⓥ|ｖ|ṽ|ṿ|ʋ|ꝟ|ʌ|[\\u0076\\u24E5\\uFF56\\u1E7D\\u1E7F\\u028B\\uA75F\\u028C])/g\n}, {\n base: 'vy',\n letters: /(ꝡ|[\\uA761])/g\n}, {\n base: 'w',\n letters: /(w|ⓦ|ｗ|ẁ|ẃ|ŵ|ẇ|ẅ|ẘ|ẉ|ⱳ|[\\u0077\\u24E6\\uFF57\\u1E81\\u1E83\\u0175\\u1E87\\u1E85\\u1E98\\u1E89\\u2C73])/g\n}, {\n base: 'x',\n letters: /(x|ⓧ|ｘ|ẋ|ẍ|[\\u0078\\u24E7\\uFF58\\u1E8B\\u1E8D])/g\n}, {\n base: 'y',\n letters: /(y|ⓨ|ｙ|ỳ|ý|ŷ|ỹ|ȳ|ẏ|ÿ|ỷ|ẙ|ỵ|ƴ|ɏ|ỿ|[\\u0079\\u24E8\\uFF59\\u1EF3\\u00FD\\u0177\\u1EF9\\u0233\\u1E8F\\u00FF\\u1EF7\\u1E99\\u1EF5\\u01B4\\u024F\\u1EFF])/g\n}, {\n base: 'z',\n letters: /(z|ⓩ|ｚ|ź|ẑ|ż|ž|ẓ|ẕ|ƶ|ȥ|ɀ|ⱬ|ꝣ|[\\u007A\\u24E9\\uFF5A\\u017A\\u1E91\\u017C\\u017E\\u1E93\\u1E95\\u01B6\\u0225\\u0240\\u2C6C\\uA763])/g\n}];\nvar removeAccents = function removeAccents(str) {\n var formattedStr = str;\n lettersDiacritics.forEach(function (letterDiacritics) {\n formattedStr = formattedStr.replace(letterDiacritics.letters, letterDiacritics.base);\n });\n return formattedStr;\n};\nvar normalizeString = function normalizeString(str) {\n return removeAccents(str).toLowerCase();\n};\nvar getSubstringIndex = function getSubstringIndex(str, substr, ignoreAccents) {\n if (!ignoreAccents) {\n return str.toLowerCase().indexOf(substr.toLowerCase());\n }\n return normalizeString(str).indexOf(normalizeString(substr));\n};\nvar isIE = function isIE() {\n return !!document.documentMode;\n};\nvar isNumber = function isNumber(val) {\n return typeof val === 'number';\n};\nvar keys = function keys(obj) {\n return obj === Object(obj) ? Object.keys(obj) : [];\n};\nvar omit = function omit(obj) {\n var _ref;\n for (var _len = arguments.length, rest = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {\n rest[_key - 1] = arguments[_key];\n }\n var keys = (_ref = []).concat.apply(_ref, rest);\n return Object.keys(obj).reduce(function (acc, k) {\n if (obj.hasOwnProperty(k) && !keys.includes(k) && obj[k] !== undefined) {\n acc[k] = obj[k];\n }\n return acc;\n }, {});\n};\nvar _excluded = [\"style\", \"className\", \"classNames\"];\nfunction ownKeys(object, enumerableOnly) {\n var keys = Object.keys(object);\n if (Object.getOwnPropertySymbols) {\n var symbols = Object.getOwnPropertySymbols(object);\n enumerableOnly && (symbols = symbols.filter(function (sym) {\n return Object.getOwnPropertyDescriptor(object, sym).enumerable;\n })), keys.push.apply(keys, symbols);\n }\n return keys;\n}\nfunction _objectSpread(target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = null != arguments[i] ? arguments[i] : {};\n i % 2 ? ownKeys(Object(source), !0).forEach(function (key) {\n _defineProperty(target, key, source[key]);\n }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys(Object(source)).forEach(function (key) {\n Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));\n });\n }\n return target;\n}\nfunction createDefaultStyle(defaultStyle, getModifiers) {\n var enhance = function enhance(ComponentToWrap) {\n var DefaultStyleEnhancer = function DefaultStyleEnhancer(_ref) {\n var style = _ref.style,\n className = _ref.className,\n classNames = _ref.classNames,\n rest = _objectWithoutProperties(_ref, _excluded);\n var modifiers = getModifiers ? getModifiers(rest) : undefined;\n var styles = useStyles(defaultStyle, {\n style: style,\n className: className,\n classNames: classNames\n }, modifiers);\n return /*#__PURE__*/React.createElement(ComponentToWrap, _extends({}, rest, {\n style: styles\n }));\n };\n var displayName = ComponentToWrap.displayName || ComponentToWrap.name || 'Component';\n DefaultStyleEnhancer.displayName = \"defaultStyle(\".concat(displayName, \")\"); // return DefaultStyleEnhancer\n\n return /*#__PURE__*/React.forwardRef(function (props, ref) {\n return DefaultStyleEnhancer(_objectSpread(_objectSpread({}, props), {}, {\n ref: ref\n }));\n });\n };\n return enhance;\n}\nvar _generateComponentKey = function _generateComponentKey(usedKeys, id) {\n if (!usedKeys.hasOwnProperty(id)) {\n usedKeys[id] = 0;\n } else {\n usedKeys[id]++;\n }\n return id + '_' + usedKeys[id];\n};\nfunction Highlighter(_ref) {\n var selectionStart = _ref.selectionStart,\n selectionEnd = _ref.selectionEnd,\n _ref$value = _ref.value,\n value = _ref$value === void 0 ? '' : _ref$value,\n onCaretPositionChange = _ref.onCaretPositionChange,\n containerRef = _ref.containerRef,\n children = _ref.children,\n singleLine = _ref.singleLine,\n style = _ref.style;\n var _useState = useState({\n left: undefined,\n top: undefined\n }),\n _useState2 = _slicedToArray(_useState, 2),\n position = _useState2[0],\n setPosition = _useState2[1];\n var _useState3 = useState(),\n _useState4 = _slicedToArray(_useState3, 2),\n caretElement = _useState4[0],\n setCaretElement = _useState4[1];\n useEffect(function () {\n notifyCaretPosition();\n });\n var notifyCaretPosition = function notifyCaretPosition() {\n if (!caretElement) {\n return;\n }\n var offsetLeft = caretElement.offsetLeft,\n offsetTop = caretElement.offsetTop;\n if (position.left === offsetLeft && position.top === offsetTop) {\n return;\n }\n var newPosition = {\n left: offsetLeft,\n top: offsetTop\n };\n setPosition(newPosition);\n onCaretPositionChange(newPosition);\n };\n var config = readConfigFromChildren(children);\n var caretPositionInMarkup;\n if (selectionEnd === selectionStart) {\n caretPositionInMarkup = mapPlainTextIndex(value, config, selectionStart, 'START');\n }\n var resultComponents = [];\n var componentKeys = {};\n var components = resultComponents;\n var substringComponentKey = 0;\n var textIteratee = function textIteratee(substr, index, indexInPlainText) {\n // check whether the caret element has to be inserted inside the current plain substring\n if (isNumber(caretPositionInMarkup) && caretPositionInMarkup >= index && caretPositionInMarkup <= index + substr.length) {\n // if yes, split substr at the caret position and insert the caret component\n var splitIndex = caretPositionInMarkup - index;\n components.push(renderSubstring(substr.substring(0, splitIndex), substringComponentKey)); // add all following substrings and mention components as children of the caret component\n\n components = [renderSubstring(substr.substring(splitIndex), substringComponentKey)];\n } else {\n components.push(renderSubstring(substr, substringComponentKey));\n }\n substringComponentKey++;\n };\n var mentionIteratee = function mentionIteratee(markup, index, indexInPlainText, id, display, mentionChildIndex, lastMentionEndIndex) {\n var key = _generateComponentKey(componentKeys, id);\n components.push(getMentionComponentForMatch(id, display, mentionChildIndex, key));\n };\n var renderSubstring = function renderSubstring(string, key) {\n // set substring span to hidden, so that Emojis are not shown double in Mobile Safari\n return /*#__PURE__*/React.createElement(\"span\", _extends({}, style('substring'), {\n key: key\n }), string);\n };\n var getMentionComponentForMatch = function getMentionComponentForMatch(id, display, mentionChildIndex, key) {\n var props = {\n id: id,\n display: display,\n key: key\n };\n var child = Children.toArray(children)[mentionChildIndex];\n return /*#__PURE__*/React.cloneElement(child, props);\n };\n var renderHighlighterCaret = function renderHighlighterCaret(children) {\n return /*#__PURE__*/React.createElement(\"span\", _extends({}, style('caret'), {\n ref: setCaretElement,\n key: \"caret\"\n }), children);\n };\n iterateMentionsMarkup(value, config, mentionIteratee, textIteratee); // append a span containing a space, to ensure the last text line has the correct height\n\n components.push(' ');\n if (components !== resultComponents) {\n // if a caret component is to be rendered, add all components that followed as its children\n resultComponents.push(renderHighlighterCaret(components));\n }\n return /*#__PURE__*/React.createElement(\"div\", _extends({}, style, {\n ref: containerRef\n }), resultComponents);\n}\nvar styled = createDefaultStyle({\n position: 'relative',\n boxSizing: 'border-box',\n width: '100%',\n color: 'transparent',\n overflow: 'hidden',\n whiteSpace: 'pre-wrap',\n wordWrap: 'break-word',\n border: '1px solid transparent',\n textAlign: 'start',\n '&singleLine': {\n whiteSpace: 'pre',\n wordWrap: null\n },\n substring: {\n visibility: 'hidden'\n }\n}, function (props) {\n return {\n '&singleLine': props.singleLine\n };\n});\nvar Highlighter$1 = styled(Highlighter);\nfunction Suggestion(_ref) {\n var id = _ref.id,\n focused = _ref.focused,\n ignoreAccents = _ref.ignoreAccents,\n index = _ref.index,\n onClick = _ref.onClick,\n onMouseEnter = _ref.onMouseEnter,\n query = _ref.query,\n renderSuggestion = _ref.renderSuggestion,\n suggestion = _ref.suggestion,\n style = _ref.style,\n className = _ref.className,\n classNames = _ref.classNames;\n var rest = {\n onClick: onClick,\n onMouseEnter: onMouseEnter\n };\n var renderContent = function renderContent() {\n var display = getDisplay();\n var highlightedDisplay = renderHighlightedDisplay(display);\n if (renderSuggestion) {\n return renderSuggestion(suggestion, query, highlightedDisplay, index, focused);\n }\n return highlightedDisplay;\n };\n var getDisplay = function getDisplay() {\n if (typeof suggestion === 'string') {\n return suggestion;\n }\n var id = suggestion.id,\n display = suggestion.display;\n if (id === undefined || !display) {\n return id;\n }\n return display;\n };\n var renderHighlightedDisplay = function renderHighlightedDisplay(display) {\n var i = getSubstringIndex(display, query, ignoreAccents);\n if (i === -1) {\n return /*#__PURE__*/React.createElement(\"span\", style('display'), display);\n }\n return /*#__PURE__*/React.createElement(\"span\", style('display'), display.substring(0, i), /*#__PURE__*/React.createElement(\"b\", style('highlight'), display.substring(i, i + query.length)), display.substring(i + query.length));\n };\n return /*#__PURE__*/React.createElement(\"li\", _extends({\n id: id,\n role: \"option\",\n \"aria-selected\": focused\n }, rest, style), renderContent());\n}\nvar styled$1 = createDefaultStyle({\n cursor: 'pointer'\n}, function (props) {\n return {\n '&focused': props.focused\n };\n});\nvar Suggestion$1 = styled$1(Suggestion);\nfunction LoadingIndicator(_ref) {\n var style = _ref.style,\n className = _ref.className,\n classNames = _ref.classNames;\n var styles = useStyles(defaultstyle, {\n style: style,\n className: className,\n classNames: classNames\n });\n var spinnerStyles = styles('spinner');\n return /*#__PURE__*/React.createElement(\"div\", styles, /*#__PURE__*/React.createElement(\"div\", spinnerStyles, /*#__PURE__*/React.createElement(\"div\", spinnerStyles(['element', 'element1'])), /*#__PURE__*/React.createElement(\"div\", spinnerStyles(['element', 'element2'])), /*#__PURE__*/React.createElement(\"div\", spinnerStyles(['element', 'element3'])), /*#__PURE__*/React.createElement(\"div\", spinnerStyles(['element', 'element4'])), /*#__PURE__*/React.createElement(\"div\", spinnerStyles(['element', 'element5']))));\n}\nvar defaultstyle = {};\nfunction SuggestionsOverlay(_ref) {\n var id = _ref.id,\n _ref$suggestions = _ref.suggestions,\n suggestions = _ref$suggestions === void 0 ? {} : _ref$suggestions,\n a11ySuggestionsListLabel = _ref.a11ySuggestionsListLabel,\n focusIndex = _ref.focusIndex,\n position = _ref.position,\n left = _ref.left,\n right = _ref.right,\n top = _ref.top,\n scrollFocusedIntoView = _ref.scrollFocusedIntoView,\n isLoading = _ref.isLoading,\n isOpened = _ref.isOpened,\n _ref$onSelect = _ref.onSelect,\n onSelect = _ref$onSelect === void 0 ? function () {\n return null;\n } : _ref$onSelect,\n ignoreAccents = _ref.ignoreAccents,\n containerRef = _ref.containerRef,\n children = _ref.children,\n style = _ref.style,\n customSuggestionsContainer = _ref.customSuggestionsContainer,\n onMouseDown = _ref.onMouseDown,\n onMouseEnter = _ref.onMouseEnter;\n var _useState = useState(undefined),\n _useState2 = _slicedToArray(_useState, 2),\n ulElement = _useState2[0],\n setUlElement = _useState2[1];\n useEffect(function () {\n if (!ulElement || ulElement.offsetHeight >= ulElement.scrollHeight || !scrollFocusedIntoView) {\n return;\n }\n var scrollTop = ulElement.scrollTop;\n var _ulElement$children$f = ulElement.children[focusIndex].getBoundingClientRect(),\n top = _ulElement$children$f.top,\n bottom = _ulElement$children$f.bottom;\n var _ulElement$getBoundin = ulElement.getBoundingClientRect(),\n topContainer = _ulElement$getBoundin.top;\n top = top - topContainer + scrollTop;\n bottom = bottom - topContainer + scrollTop;\n if (top < scrollTop) {\n ulElement.scrollTop = top;\n } else if (bottom > ulElement.offsetHeight) {\n ulElement.scrollTop = bottom - ulElement.offsetHeight;\n }\n }, [focusIndex, scrollFocusedIntoView, ulElement]);\n var renderSuggestions = function renderSuggestions() {\n var suggestionsToRender = /*#__PURE__*/React.createElement(\"ul\", _extends({\n ref: setUlElement,\n id: id,\n role: \"listbox\",\n \"aria-label\": a11ySuggestionsListLabel\n }, style('list')), Object.values(suggestions).reduce(function (accResults, _ref2) {\n var results = _ref2.results,\n queryInfo = _ref2.queryInfo;\n return [].concat(_toConsumableArray(accResults), _toConsumableArray(results.map(function (result, index) {\n return renderSuggestion(result, queryInfo, accResults.length + index);\n })));\n }, []));\n if (customSuggestionsContainer) return customSuggestionsContainer(suggestionsToRender);\n return suggestionsToRender;\n };\n var renderSuggestion = function renderSuggestion(result, queryInfo, index) {\n var isFocused = index === focusIndex;\n var childIndex = queryInfo.childIndex,\n query = queryInfo.query;\n var renderSuggestion = Children.toArray(children)[childIndex].props.renderSuggestion;\n return /*#__PURE__*/React.createElement(Suggestion$1, {\n style: style('item'),\n key: \"\".concat(childIndex, \"-\").concat(getID(result)),\n id: getSuggestionHtmlId(id, index),\n query: query,\n index: index,\n ignoreAccents: ignoreAccents,\n renderSuggestion: renderSuggestion,\n suggestion: result,\n focused: isFocused,\n onClick: function onClick() {\n return select(result, queryInfo);\n },\n onMouseEnter: function onMouseEnter() {\n return handleMouseEnter(index);\n }\n });\n };\n var renderLoadingIndicator = function renderLoadingIndicator() {\n if (!isLoading) {\n return;\n }\n return /*#__PURE__*/React.createElement(LoadingIndicator, {\n style: style('loadingIndicator')\n });\n };\n var handleMouseEnter = function handleMouseEnter(index, ev) {\n if (onMouseEnter) {\n onMouseEnter(index);\n }\n };\n var select = function select(suggestion, queryInfo) {\n onSelect(suggestion, queryInfo);\n };\n var getID = function getID(suggestion) {\n if (typeof suggestion === 'string') {\n return suggestion;\n }\n return suggestion.id;\n };\n if (!isOpened) {\n return null;\n }\n return /*#__PURE__*/React.createElement(\"div\", _extends({}, inline({\n position: position || 'absolute',\n left: left,\n right: right,\n top: top\n }, style), {\n onMouseDown: onMouseDown,\n ref: containerRef\n }), renderSuggestions(), renderLoadingIndicator());\n}\nvar styled$2 = createDefaultStyle({\n zIndex: 1,\n backgroundColor: 'white',\n marginTop: 14,\n minWidth: 100,\n list: {\n margin: 0,\n padding: 0,\n listStyleType: 'none'\n }\n});\nvar SuggestionsOverlay$1 = styled$2(SuggestionsOverlay);\nfunction ownKeys$1(object, enumerableOnly) {\n var keys = Object.keys(object);\n if (Object.getOwnPropertySymbols) {\n var symbols = Object.getOwnPropertySymbols(object);\n enumerableOnly && (symbols = symbols.filter(function (sym) {\n return Object.getOwnPropertyDescriptor(object, sym).enumerable;\n })), keys.push.apply(keys, symbols);\n }\n return keys;\n}\nfunction _objectSpread$1(target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = null != arguments[i] ? arguments[i] : {};\n i % 2 ? ownKeys$1(Object(source), !0).forEach(function (key) {\n _defineProperty(target, key, source[key]);\n }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys$1(Object(source)).forEach(function (key) {\n Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));\n });\n }\n return target;\n}\nfunction _createSuper(Derived) {\n var hasNativeReflectConstruct = _isNativeReflectConstruct();\n return function _createSuperInternal() {\n var Super = _getPrototypeOf(Derived),\n result;\n if (hasNativeReflectConstruct) {\n var NewTarget = _getPrototypeOf(this).constructor;\n result = Reflect.construct(Super, arguments, NewTarget);\n } else {\n result = Super.apply(this, arguments);\n }\n return _possibleConstructorReturn(this, result);\n };\n}\nfunction _isNativeReflectConstruct() {\n if (typeof Reflect === \"undefined\" || !Reflect.construct) return false;\n if (Reflect.construct.sham) return false;\n if (typeof Proxy === \"function\") return true;\n try {\n Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {}));\n return true;\n } catch (e) {\n return false;\n }\n}\nvar makeTriggerRegex = function makeTriggerRegex(trigger) {\n var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};\n if (trigger instanceof RegExp) {\n return trigger;\n } else {\n var allowSpaceInQuery = options.allowSpaceInQuery;\n var escapedTriggerChar = escapeRegex(trigger); // first capture group is the part to be replaced on completion\n // second capture group is for extracting the search query\n\n return new RegExp(\"(?:^|\\\\s)(\".concat(escapedTriggerChar, \"([^\").concat(allowSpaceInQuery ? '' : '\\\\s').concat(escapedTriggerChar, \"]*))$\"));\n }\n};\nvar getDataProvider = function getDataProvider(data, ignoreAccents) {\n if (data instanceof Array) {\n // if data is an array, create a function to query that\n return function (query, callback) {\n var results = [];\n for (var i = 0, l = data.length; i < l; ++i) {\n var display = data[i].display || data[i].id;\n if (getSubstringIndex(display, query, ignoreAccents) >= 0) {\n results.push(data[i]);\n }\n }\n return results;\n };\n } else {\n // expect data to be a query function\n return data;\n }\n};\nvar KEY = {\n TAB: 9,\n RETURN: 13,\n ESC: 27,\n UP: 38,\n DOWN: 40\n};\nvar isComposing = false;\nvar propTypes = {\n /**\n * If set to `true` a regular text input element will be rendered\n * instead of a textarea\n */\n singleLine: PropTypes.bool,\n allowSpaceInQuery: PropTypes.bool,\n allowSuggestionsAboveCursor: PropTypes.bool,\n forceSuggestionsAboveCursor: PropTypes.bool,\n ignoreAccents: PropTypes.bool,\n a11ySuggestionsListLabel: PropTypes.string,\n value: PropTypes.string,\n onKeyDown: PropTypes.func,\n customSuggestionsContainer: PropTypes.func,\n onSelect: PropTypes.func,\n onBlur: PropTypes.func,\n onChange: PropTypes.func,\n suggestionsPortalHost: typeof Element === 'undefined' ? PropTypes.any : PropTypes.PropTypes.instanceOf(Element),\n inputRef: PropTypes.oneOfType([PropTypes.func, PropTypes.shape({\n current: typeof Element === 'undefined' ? PropTypes.any : PropTypes.instanceOf(Element)\n })]),\n children: PropTypes.oneOfType([PropTypes.element, PropTypes.arrayOf(PropTypes.element)]).isRequired\n};\nvar MentionsInput = /*#__PURE__*/function (_React$Component) {\n _inherits(MentionsInput, _React$Component);\n var _super = _createSuper(MentionsInput);\n function MentionsInput(_props) {\n var _this;\n _classCallCheck(this, MentionsInput);\n _this = _super.call(this, _props);\n _defineProperty(_assertThisInitialized(_this), \"setContainerElement\", function (el) {\n _this.containerElement = el;\n });\n _defineProperty(_assertThisInitialized(_this), \"getInputProps\", function () {\n var _this$props = _this.props,\n readOnly = _this$props.readOnly,\n disabled = _this$props.disabled,\n style = _this$props.style; // pass all props that neither we, nor substyle, consume through to the input control\n\n var props = omit(_this.props, ['style', 'classNames', 'className'],\n // substyle props\n keys(propTypes));\n return _objectSpread$1(_objectSpread$1(_objectSpread$1(_objectSpread$1({}, props), style('input')), {}, {\n value: _this.getPlainText(),\n onScroll: _this.updateHighlighterScroll\n }, !readOnly && !disabled && {\n onChange: _this.handleChange,\n onSelect: _this.handleSelect,\n onKeyDown: _this.handleKeyDown,\n onBlur: _this.handleBlur,\n onCompositionStart: _this.handleCompositionStart,\n onCompositionEnd: _this.handleCompositionEnd\n }), _this.isOpened() && {\n role: 'combobox',\n 'aria-controls': _this.uuidSuggestionsOverlay,\n 'aria-expanded': true,\n 'aria-autocomplete': 'list',\n 'aria-haspopup': 'listbox',\n 'aria-activedescendant': getSuggestionHtmlId(_this.uuidSuggestionsOverlay, _this.state.focusIndex)\n });\n });\n _defineProperty(_assertThisInitialized(_this), \"renderControl\", function () {\n var _this$props2 = _this.props,\n singleLine = _this$props2.singleLine,\n style = _this$props2.style;\n var inputProps = _this.getInputProps();\n return /*#__PURE__*/React.createElement(\"div\", style('control'), _this.renderHighlighter(), singleLine ? _this.renderInput(inputProps) : _this.renderTextarea(inputProps));\n });\n _defineProperty(_assertThisInitialized(_this), \"renderInput\", function (props) {\n return /*#__PURE__*/React.createElement(\"input\", _extends({\n type: \"text\",\n ref: _this.setInputRef\n }, props));\n });\n _defineProperty(_assertThisInitialized(_this), \"renderTextarea\", function (props) {\n return /*#__PURE__*/React.createElement(\"textarea\", _extends({\n ref: _this.setInputRef\n }, props));\n });\n _defineProperty(_assertThisInitialized(_this), \"setInputRef\", function (el) {\n _this.inputElement = el;\n var inputRef = _this.props.inputRef;\n if (typeof inputRef === 'function') {\n inputRef(el);\n } else if (inputRef) {\n inputRef.current = el;\n }\n });\n _defineProperty(_assertThisInitialized(_this), \"setSuggestionsElement\", function (el) {\n _this.suggestionsElement = el;\n });\n _defineProperty(_assertThisInitialized(_this), \"renderSuggestionsOverlay\", function () {\n if (!isNumber(_this.state.selectionStart)) {\n // do not show suggestions when the input does not have the focus\n return null;\n }\n var _this$state$suggestio = _this.state.suggestionsPosition,\n position = _this$state$suggestio.position,\n left = _this$state$suggestio.left,\n top = _this$state$suggestio.top,\n right = _this$state$suggestio.right;\n var suggestionsNode = /*#__PURE__*/React.createElement(SuggestionsOverlay$1, {\n id: _this.uuidSuggestionsOverlay,\n style: _this.props.style('suggestions'),\n position: position,\n left: left,\n top: top,\n right: right,\n focusIndex: _this.state.focusIndex,\n scrollFocusedIntoView: _this.state.scrollFocusedIntoView,\n containerRef: _this.setSuggestionsElement,\n suggestions: _this.state.suggestions,\n customSuggestionsContainer: _this.props.customSuggestionsContainer,\n onSelect: _this.addMention,\n onMouseDown: _this.handleSuggestionsMouseDown,\n onMouseEnter: _this.handleSuggestionsMouseEnter,\n isLoading: _this.isLoading(),\n isOpened: _this.isOpened(),\n ignoreAccents: _this.props.ignoreAccents,\n a11ySuggestionsListLabel: _this.props.a11ySuggestionsListLabel\n }, _this.props.children);\n if (_this.props.suggestionsPortalHost) {\n return /*#__PURE__*/ReactDOM.createPortal(suggestionsNode, _this.props.suggestionsPortalHost);\n } else {\n return suggestionsNode;\n }\n });\n _defineProperty(_assertThisInitialized(_this), \"renderHighlighter\", function () {\n var _this$state = _this.state,\n selectionStart = _this$state.selectionStart,\n selectionEnd = _this$state.selectionEnd;\n var _this$props3 = _this.props,\n singleLine = _this$props3.singleLine,\n children = _this$props3.children,\n value = _this$props3.value,\n style = _this$props3.style;\n return /*#__PURE__*/React.createElement(Highlighter$1, {\n containerRef: _this.setHighlighterElement,\n style: style('highlighter'),\n value: value,\n singleLine: singleLine,\n selectionStart: selectionStart,\n selectionEnd: selectionEnd,\n onCaretPositionChange: _this.handleCaretPositionChange\n }, children);\n });\n _defineProperty(_assertThisInitialized(_this), \"setHighlighterElement\", function (el) {\n _this.highlighterElement = el;\n });\n _defineProperty(_assertThisInitialized(_this), \"handleCaretPositionChange\", function (position) {\n _this.setState({\n caretPosition: position\n });\n });\n _defineProperty(_assertThisInitialized(_this), \"getPlainText\", function () {\n return getPlainText(_this.props.value || '', readConfigFromChildren(_this.props.children));\n });\n _defineProperty(_assertThisInitialized(_this), \"executeOnChange\", function (event) {\n for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {\n args[_key - 1] = arguments[_key];\n }\n if (_this.props.onChange) {\n var _this$props4;\n return (_this$props4 = _this.props).onChange.apply(_this$props4, [event].concat(args));\n }\n if (_this.props.valueLink) {\n var _this$props$valueLink;\n return (_this$props$valueLink = _this.props.valueLink).requestChange.apply(_this$props$valueLink, [event.target.value].concat(args));\n }\n });\n _defineProperty(_assertThisInitialized(_this), \"handleChange\", function (ev) {\n isComposing = false;\n if (isIE()) {\n // if we are inside iframe, we need to find activeElement within its contentDocument\n var currentDocument = document.activeElement && document.activeElement.contentDocument || document;\n if (currentDocument.activeElement !== ev.target) {\n // fix an IE bug (blur from empty input element with placeholder attribute trigger \"input\" event)\n return;\n }\n }\n var value = _this.props.value || '';\n var config = readConfigFromChildren(_this.props.children);\n var newPlainTextValue = ev.target.value;\n var selectionStartBefore = _this.state.selectionStart;\n if (selectionStartBefore == null) {\n selectionStartBefore = ev.target.selectionStart;\n }\n var selectionEndBefore = _this.state.selectionEnd;\n if (selectionEndBefore == null) {\n selectionEndBefore = ev.target.selectionEnd;\n } // Derive the new value to set by applying the local change in the textarea's plain text\n\n var newValue = applyChangeToValue(value, newPlainTextValue, {\n selectionStartBefore: selectionStartBefore,\n selectionEndBefore: selectionEndBefore,\n selectionEndAfter: ev.target.selectionEnd\n }, config); // In case a mention is deleted, also adjust the new plain text value\n\n newPlainTextValue = getPlainText(newValue, config); // Save current selection after change to be able to restore caret position after rerendering\n\n var selectionStart = ev.target.selectionStart;\n var selectionEnd = ev.target.selectionEnd;\n var setSelectionAfterMentionChange = false; // Adjust selection range in case a mention will be deleted by the characters outside of the\n // selection range that are automatically deleted\n\n var startOfMention = findStartOfMentionInPlainText(value, config, selectionStart);\n if (startOfMention !== undefined && _this.state.selectionEnd > startOfMention) {\n // only if a deletion has taken place\n selectionStart = startOfMention + (ev.nativeEvent.data ? ev.nativeEvent.data.length : 0);\n selectionEnd = selectionStart;\n setSelectionAfterMentionChange = true;\n }\n _this.setState({\n selectionStart: selectionStart,\n selectionEnd: selectionEnd,\n setSelectionAfterMentionChange: setSelectionAfterMentionChange\n });\n var mentions = getMentions(newValue, config);\n if (ev.nativeEvent.isComposing && selectionStart === selectionEnd) {\n _this.updateMentionsQueries(_this.inputElement.value, selectionStart);\n } // Propagate change\n // let handleChange = this.getOnChange(this.props) || emptyFunction;\n\n var eventMock = {\n target: {\n value: newValue\n }\n }; // this.props.onChange.call(this, eventMock, newValue, newPlainTextValue, mentions);\n\n _this.executeOnChange(eventMock, newValue, newPlainTextValue, mentions);\n });\n _defineProperty(_assertThisInitialized(_this), \"handleSelect\", function (ev) {\n // keep track of selection range / caret position\n _this.setState({\n selectionStart: ev.target.selectionStart,\n selectionEnd: ev.target.selectionEnd\n }); // do nothing while a IME composition session is active\n\n if (isComposing) return; // refresh suggestions queries\n\n var el = _this.inputElement;\n if (ev.target.selectionStart === ev.target.selectionEnd) {\n _this.updateMentionsQueries(el.value, ev.target.selectionStart);\n } else {\n _this.clearSuggestions();\n } // sync highlighters scroll position\n\n _this.updateHighlighterScroll();\n _this.props.onSelect(ev);\n });\n _defineProperty(_assertThisInitialized(_this), \"handleKeyDown\", function (ev) {\n // do not intercept key events if the suggestions overlay is not shown\n var suggestionsCount = countSuggestions(_this.state.suggestions);\n if (suggestionsCount === 0 || !_this.suggestionsElement) {\n _this.props.onKeyDown(ev);\n return;\n }\n if (Object.values(KEY).indexOf(ev.keyCode) >= 0) {\n ev.preventDefault();\n ev.stopPropagation();\n }\n switch (ev.keyCode) {\n case KEY.ESC:\n {\n _this.clearSuggestions();\n return;\n }\n case KEY.DOWN:\n {\n _this.shiftFocus(+1);\n return;\n }\n case KEY.UP:\n {\n _this.shiftFocus(-1);\n return;\n }\n case KEY.RETURN:\n {\n _this.selectFocused();\n return;\n }\n case KEY.TAB:\n {\n _this.selectFocused();\n return;\n }\n default:\n {\n return;\n }\n }\n });\n _defineProperty(_assertThisInitialized(_this), \"shiftFocus\", function (delta) {\n var suggestionsCount = countSuggestions(_this.state.suggestions);\n _this.setState({\n focusIndex: (suggestionsCount + _this.state.focusIndex + delta) % suggestionsCount,\n scrollFocusedIntoView: true\n });\n });\n _defineProperty(_assertThisInitialized(_this), \"selectFocused\", function () {\n var _this$state2 = _this.state,\n suggestions = _this$state2.suggestions,\n focusIndex = _this$state2.focusIndex;\n var _Object$values$reduce = Object.values(suggestions).reduce(function (acc, _ref) {\n var results = _ref.results,\n queryInfo = _ref.queryInfo;\n return [].concat(_toConsumableArray(acc), _toConsumableArray(results.map(function (result) {\n return {\n result: result,\n queryInfo: queryInfo\n };\n })));\n }, [])[focusIndex],\n result = _Object$values$reduce.result,\n queryInfo = _Object$values$reduce.queryInfo;\n _this.addMention(result, queryInfo);\n _this.setState({\n focusIndex: 0\n });\n });\n _defineProperty(_assertThisInitialized(_this), \"handleBlur\", function (ev) {\n var clickedSuggestion = _this._suggestionsMouseDown;\n _this._suggestionsMouseDown = false; // only reset selection if the mousedown happened on an element\n // other than the suggestions overlay\n\n if (!clickedSuggestion) {\n _this.setState({\n selectionStart: null,\n selectionEnd: null\n });\n }\n window.setTimeout(function () {\n _this.updateHighlighterScroll();\n }, 1);\n _this.props.onBlur(ev, clickedSuggestion);\n });\n _defineProperty(_assertThisInitialized(_this), \"handleSuggestionsMouseDown\", function (ev) {\n _this._suggestionsMouseDown = true;\n });\n _defineProperty(_assertThisInitialized(_this), \"handleSuggestionsMouseEnter\", function (focusIndex) {\n _this.setState({\n focusIndex: focusIndex,\n scrollFocusedIntoView: false\n });\n });\n _defineProperty(_assertThisInitialized(_this), \"updateSuggestionsPosition\", function () {\n var caretPosition = _this.state.caretPosition;\n var _this$props5 = _this.props,\n suggestionsPortalHost = _this$props5.suggestionsPortalHost,\n allowSuggestionsAboveCursor = _this$props5.allowSuggestionsAboveCursor,\n forceSuggestionsAboveCursor = _this$props5.forceSuggestionsAboveCursor;\n if (!caretPosition || !_this.suggestionsElement) {\n return;\n }\n var suggestions = _this.suggestionsElement;\n var highlighter = _this.highlighterElement; // first get viewport-relative position (highlighter is offsetParent of caret):\n\n var caretOffsetParentRect = highlighter.getBoundingClientRect();\n var caretHeight = getComputedStyleLengthProp(highlighter, 'font-size');\n var viewportRelative = {\n left: caretOffsetParentRect.left + caretPosition.left,\n top: caretOffsetParentRect.top + caretPosition.top + caretHeight\n };\n var viewportHeight = Math.max(document.documentElement.clientHeight, window.innerHeight || 0);\n if (!suggestions) {\n return;\n }\n var position = {}; // if suggestions menu is in a portal, update position to be releative to its portal node\n\n if (suggestionsPortalHost) {\n position.position = 'fixed';\n var left = viewportRelative.left;\n var top = viewportRelative.top; // absolute/fixed positioned elements are positioned according to their entire box including margins; so we remove margins here:\n\n left -= getComputedStyleLengthProp(suggestions, 'margin-left');\n top -= getComputedStyleLengthProp(suggestions, 'margin-top'); // take into account highlighter/textinput scrolling:\n\n left -= highlighter.scrollLeft;\n top -= highlighter.scrollTop; // guard for mentions suggestions list clipped by right edge of window\n\n var viewportWidth = Math.max(document.documentElement.clientWidth, window.innerWidth || 0);\n if (left + suggestions.offsetWidth > viewportWidth) {\n position.left = Math.max(0, viewportWidth - suggestions.offsetWidth);\n } else {\n position.left = left;\n } // guard for mentions suggestions list clipped by bottom edge of window if allowSuggestionsAboveCursor set to true.\n // Move the list up above the caret if it's getting cut off by the bottom of the window, provided that the list height\n // is small enough to NOT cover up the caret\n\n if (allowSuggestionsAboveCursor && top + suggestions.offsetHeight > viewportHeight && suggestions.offsetHeight < top - caretHeight || forceSuggestionsAboveCursor) {\n position.top = Math.max(0, top - suggestions.offsetHeight - caretHeight);\n } else {\n position.top = top;\n }\n } else {\n var _left = caretPosition.left - highlighter.scrollLeft;\n var _top = caretPosition.top - highlighter.scrollTop; // guard for mentions suggestions list clipped by right edge of window\n\n if (_left + suggestions.offsetWidth > _this.containerElement.offsetWidth) {\n position.right = 0;\n } else {\n position.left = _left;\n } // guard for mentions suggestions list clipped by bottom edge of window if allowSuggestionsAboveCursor set to true.\n // move the list up above the caret if it's getting cut off by the bottom of the window, provided that the list height\n // is small enough to NOT cover up the caret\n\n if (allowSuggestionsAboveCursor && viewportRelative.top - highlighter.scrollTop + suggestions.offsetHeight > viewportHeight && suggestions.offsetHeight < caretOffsetParentRect.top - caretHeight - highlighter.scrollTop || forceSuggestionsAboveCursor) {\n position.top = _top - suggestions.offsetHeight - caretHeight;\n } else {\n position.top = _top;\n }\n }\n if (position.left === _this.state.suggestionsPosition.left && position.top === _this.state.suggestionsPosition.top && position.position === _this.state.suggestionsPosition.position) {\n return;\n }\n _this.setState({\n suggestionsPosition: position\n });\n });\n _defineProperty(_assertThisInitialized(_this), \"updateHighlighterScroll\", function () {\n var input = _this.inputElement;\n var highlighter = _this.highlighterElement;\n if (!input || !highlighter) {\n // since the invocation of this function is deferred,\n // the whole component may have been unmounted in the meanwhile\n return;\n }\n highlighter.scrollLeft = input.scrollLeft;\n highlighter.scrollTop = input.scrollTop;\n highlighter.height = input.height;\n });\n _defineProperty(_assertThisInitialized(_this), \"handleCompositionStart\", function () {\n isComposing = true;\n });\n _defineProperty(_assertThisInitialized(_this), \"handleCompositionEnd\", function () {\n isComposing = false;\n });\n _defineProperty(_assertThisInitialized(_this), \"setSelection\", function (selectionStart, selectionEnd) {\n if (selectionStart === null || selectionEnd === null) return;\n var el = _this.inputElement;\n if (el.setSelectionRange) {\n el.setSelectionRange(selectionStart, selectionEnd);\n } else if (el.createTextRange) {\n var range = el.createTextRange();\n range.collapse(true);\n range.moveEnd('character', selectionEnd);\n range.moveStart('character', selectionStart);\n range.select();\n }\n });\n _defineProperty(_assertThisInitialized(_this), \"updateMentionsQueries\", function (plainTextValue, caretPosition) {\n // Invalidate previous queries. Async results for previous queries will be neglected.\n _this._queryId++;\n _this.suggestions = {};\n _this.setState({\n suggestions: {}\n });\n var value = _this.props.value || '';\n var children = _this.props.children;\n var config = readConfigFromChildren(children);\n var positionInValue = mapPlainTextIndex(value, config, caretPosition, 'NULL'); // If caret is inside of mention, do not query\n\n if (positionInValue === null) {\n return;\n } // Extract substring in between the end of the previous mention and the caret\n\n var substringStartIndex = getEndOfLastMention(value.substring(0, positionInValue), config);\n var substring = plainTextValue.substring(substringStartIndex, caretPosition); // Check if suggestions have to be shown:\n // Match the trigger patterns of all Mention children on the extracted substring\n\n React.Children.forEach(children, function (child, childIndex) {\n if (!child) {\n return;\n }\n var regex = makeTriggerRegex(child.props.trigger, _this.props);\n var match = substring.match(regex);\n if (match) {\n var querySequenceStart = substringStartIndex + substring.indexOf(match[1], match.index);\n _this.queryData(match[2], childIndex, querySequenceStart, querySequenceStart + match[1].length, plainTextValue);\n }\n });\n });\n _defineProperty(_assertThisInitialized(_this), \"clearSuggestions\", function () {\n // Invalidate previous queries. Async results for previous queries will be neglected.\n _this._queryId++;\n _this.suggestions = {};\n _this.setState({\n suggestions: {},\n focusIndex: 0\n });\n });\n _defineProperty(_assertThisInitialized(_this), \"queryData\", function (query, childIndex, querySequenceStart, querySequenceEnd, plainTextValue) {\n var _this$props6 = _this.props,\n children = _this$props6.children,\n ignoreAccents = _this$props6.ignoreAccents;\n var mentionChild = Children.toArray(children)[childIndex];\n var provideData = getDataProvider(mentionChild.props.data, ignoreAccents);\n var syncResult = provideData(query, _this.updateSuggestions.bind(null, _this._queryId, childIndex, query, querySequenceStart, querySequenceEnd, plainTextValue));\n if (syncResult instanceof Array) {\n _this.updateSuggestions(_this._queryId, childIndex, query, querySequenceStart, querySequenceEnd, plainTextValue, syncResult);\n }\n });\n _defineProperty(_assertThisInitialized(_this), \"updateSuggestions\", function (queryId, childIndex, query, querySequenceStart, querySequenceEnd, plainTextValue, results) {\n // neglect async results from previous queries\n if (queryId !== _this._queryId) return; // save in property so that multiple sync state updates from different mentions sources\n // won't overwrite each other\n\n _this.suggestions = _objectSpread$1(_objectSpread$1({}, _this.suggestions), {}, _defineProperty({}, childIndex, {\n queryInfo: {\n childIndex: childIndex,\n query: query,\n querySequenceStart: querySequenceStart,\n querySequenceEnd: querySequenceEnd,\n plainTextValue: plainTextValue\n },\n results: results\n }));\n var focusIndex = _this.state.focusIndex;\n var suggestionsCount = countSuggestions(_this.suggestions);\n _this.setState({\n suggestions: _this.suggestions,\n focusIndex: focusIndex >= suggestionsCount ? Math.max(suggestionsCount - 1, 0) : focusIndex\n });\n });\n _defineProperty(_assertThisInitialized(_this), \"addMention\", function (_ref2, _ref3) {\n var id = _ref2.id,\n display = _ref2.display;\n var childIndex = _ref3.childIndex,\n querySequenceStart = _ref3.querySequenceStart,\n querySequenceEnd = _ref3.querySequenceEnd,\n plainTextValue = _ref3.plainTextValue;\n // Insert mention in the marked up value at the correct position\n var value = _this.props.value || '';\n var config = readConfigFromChildren(_this.props.children);\n var mentionsChild = Children.toArray(_this.props.children)[childIndex];\n var _mentionsChild$props = mentionsChild.props,\n markup = _mentionsChild$props.markup,\n displayTransform = _mentionsChild$props.displayTransform,\n appendSpaceOnAdd = _mentionsChild$props.appendSpaceOnAdd,\n onAdd = _mentionsChild$props.onAdd;\n var start = mapPlainTextIndex(value, config, querySequenceStart, 'START');\n var end = start + querySequenceEnd - querySequenceStart;\n var insert = makeMentionsMarkup(markup, id, display);\n if (appendSpaceOnAdd) {\n insert += ' ';\n }\n var newValue = spliceString(value, start, end, insert); // Refocus input and set caret position to end of mention\n\n _this.inputElement.focus();\n var displayValue = displayTransform(id, display);\n if (appendSpaceOnAdd) {\n displayValue += ' ';\n }\n var newCaretPosition = querySequenceStart + displayValue.length;\n _this.setState({\n selectionStart: newCaretPosition,\n selectionEnd: newCaretPosition,\n setSelectionAfterMentionChange: true\n }); // Propagate change\n\n var eventMock = {\n target: {\n value: newValue\n }\n };\n var mentions = getMentions(newValue, config);\n var newPlainTextValue = spliceString(plainTextValue, querySequenceStart, querySequenceEnd, displayValue);\n _this.executeOnChange(eventMock, newValue, newPlainTextValue, mentions);\n if (onAdd) {\n onAdd(id, display, start, end);\n } // Make sure the suggestions overlay is closed\n\n _this.clearSuggestions();\n });\n _defineProperty(_assertThisInitialized(_this), \"isLoading\", function () {\n var isLoading = false;\n React.Children.forEach(_this.props.children, function (child) {\n isLoading = isLoading || child && child.props.isLoading;\n });\n return isLoading;\n });\n _defineProperty(_assertThisInitialized(_this), \"isOpened\", function () {\n return isNumber(_this.state.selectionStart) && (countSuggestions(_this.state.suggestions) !== 0 || _this.isLoading());\n });\n _defineProperty(_assertThisInitialized(_this), \"_queryId\", 0);\n _this.suggestions = {};\n _this.uuidSuggestionsOverlay = Math.random().toString(16).substring(2);\n _this.handleCopy = _this.handleCopy.bind(_assertThisInitialized(_this));\n _this.handleCut = _this.handleCut.bind(_assertThisInitialized(_this));\n _this.handlePaste = _this.handlePaste.bind(_assertThisInitialized(_this));\n _this.state = {\n focusIndex: 0,\n selectionStart: null,\n selectionEnd: null,\n suggestions: {},\n caretPosition: null,\n suggestionsPosition: {},\n setSelectionAfterHandlePaste: false\n };\n return _this;\n }\n _createClass(MentionsInput, [{\n key: \"componentDidMount\",\n value: function componentDidMount() {\n document.addEventListener('copy', this.handleCopy);\n document.addEventListener('cut', this.handleCut);\n document.addEventListener('paste', this.handlePaste);\n this.updateSuggestionsPosition();\n }\n }, {\n key: \"componentDidUpdate\",\n value: function componentDidUpdate(prevProps, prevState) {\n // Update position of suggestions unless this componentDidUpdate was\n // triggered by an update to suggestionsPosition.\n if (prevState.suggestionsPosition === this.state.suggestionsPosition) {\n this.updateSuggestionsPosition();\n } // maintain selection in case a mention is added/removed causing\n // the cursor to jump to the end\n\n if (this.state.setSelectionAfterMentionChange) {\n this.setState({\n setSelectionAfterMentionChange: false\n });\n this.setSelection(this.state.selectionStart, this.state.selectionEnd);\n }\n if (this.state.setSelectionAfterHandlePaste) {\n this.setState({\n setSelectionAfterHandlePaste: false\n });\n this.setSelection(this.state.selectionStart, this.state.selectionEnd);\n }\n }\n }, {\n key: \"componentWillUnmount\",\n value: function componentWillUnmount() {\n document.removeEventListener('copy', this.handleCopy);\n document.removeEventListener('cut', this.handleCut);\n document.removeEventListener('paste', this.handlePaste);\n }\n }, {\n key: \"render\",\n value: function render() {\n return /*#__PURE__*/React.createElement(\"div\", _extends({\n ref: this.setContainerElement\n }, this.props.style), this.renderControl(), this.renderSuggestionsOverlay());\n }\n }, {\n key: \"handlePaste\",\n value: function handlePaste(event) {\n if (event.target !== this.inputElement) {\n return;\n }\n if (!this.supportsClipboardActions(event)) {\n return;\n }\n event.preventDefault();\n var _this$state3 = this.state,\n selectionStart = _this$state3.selectionStart,\n selectionEnd = _this$state3.selectionEnd;\n var _this$props7 = this.props,\n value = _this$props7.value,\n children = _this$props7.children;\n var config = readConfigFromChildren(children);\n var markupStartIndex = mapPlainTextIndex(value, config, selectionStart, 'START');\n var markupEndIndex = mapPlainTextIndex(value, config, selectionEnd, 'END');\n var pastedMentions = event.clipboardData.getData('text/react-mentions');\n var pastedData = event.clipboardData.getData('text/plain');\n var newValue = spliceString(value, markupStartIndex, markupEndIndex, pastedMentions || pastedData).replace(/\\r/g, '');\n var newPlainTextValue = getPlainText(newValue, config);\n var eventMock = {\n target: _objectSpread$1(_objectSpread$1({}, event.target), {}, {\n value: newValue\n })\n };\n this.executeOnChange(eventMock, newValue, newPlainTextValue, getMentions(newValue, config)); // Move the cursor position to the end of the pasted data\n\n var startOfMention = findStartOfMentionInPlainText(value, config, selectionStart);\n var nextPos = (startOfMention || selectionStart) + getPlainText(pastedMentions || pastedData, config).length;\n this.setState({\n selectionStart: nextPos,\n selectionEnd: nextPos,\n setSelectionAfterHandlePaste: true\n });\n }\n }, {\n key: \"saveSelectionToClipboard\",\n value: function saveSelectionToClipboard(event) {\n // use the actual selectionStart & selectionEnd instead of the one stored\n // in state to ensure copy & paste also works on disabled inputs & textareas\n var selectionStart = this.inputElement.selectionStart;\n var selectionEnd = this.inputElement.selectionEnd;\n var _this$props8 = this.props,\n children = _this$props8.children,\n value = _this$props8.value;\n var config = readConfigFromChildren(children);\n var markupStartIndex = mapPlainTextIndex(value, config, selectionStart, 'START');\n var markupEndIndex = mapPlainTextIndex(value, config, selectionEnd, 'END');\n event.clipboardData.setData('text/plain', event.target.value.slice(selectionStart, selectionEnd));\n event.clipboardData.setData('text/react-mentions', value.slice(markupStartIndex, markupEndIndex));\n }\n }, {\n key: \"supportsClipboardActions\",\n value: function supportsClipboardActions(event) {\n return !!event.clipboardData;\n }\n }, {\n key: \"handleCopy\",\n value: function handleCopy(event) {\n if (event.target !== this.inputElement) {\n return;\n }\n if (!this.supportsClipboardActions(event)) {\n return;\n }\n event.preventDefault();\n this.saveSelectionToClipboard(event);\n }\n }, {\n key: \"handleCut\",\n value: function handleCut(event) {\n if (event.target !== this.inputElement) {\n return;\n }\n if (!this.supportsClipboardActions(event)) {\n return;\n }\n event.preventDefault();\n this.saveSelectionToClipboard(event);\n var _this$state4 = this.state,\n selectionStart = _this$state4.selectionStart,\n selectionEnd = _this$state4.selectionEnd;\n var _this$props9 = this.props,\n children = _this$props9.children,\n value = _this$props9.value;\n var config = readConfigFromChildren(children);\n var markupStartIndex = mapPlainTextIndex(value, config, selectionStart, 'START');\n var markupEndIndex = mapPlainTextIndex(value, config, selectionEnd, 'END');\n var newValue = [value.slice(0, markupStartIndex), value.slice(markupEndIndex)].join('');\n var newPlainTextValue = getPlainText(newValue, config);\n var eventMock = {\n target: _objectSpread$1(_objectSpread$1({}, event.target), {}, {\n value: newPlainTextValue\n })\n };\n this.executeOnChange(eventMock, newValue, newPlainTextValue, getMentions(value, config));\n } // Handle input element's change event\n }]);\n\n return MentionsInput;\n}(React.Component);\n/**\n * Returns the computed length property value for the provided element.\n * Note: According to spec and testing, can count on length values coming back in pixels. See https://developer.mozilla.org/en-US/docs/Web/CSS/used_value#Difference_from_computed_value\n */\n\n_defineProperty(MentionsInput, \"propTypes\", propTypes);\n_defineProperty(MentionsInput, \"defaultProps\", {\n ignoreAccents: false,\n singleLine: false,\n allowSuggestionsAboveCursor: false,\n onKeyDown: function onKeyDown() {\n return null;\n },\n onSelect: function onSelect() {\n return null;\n },\n onBlur: function onBlur() {\n return null;\n }\n});\nvar getComputedStyleLengthProp = function getComputedStyleLengthProp(forElement, propertyName) {\n var length = parseFloat(window.getComputedStyle(forElement, null).getPropertyValue(propertyName));\n return isFinite(length) ? length : 0;\n};\nvar isMobileSafari = typeof navigator !== 'undefined' && /iPhone|iPad|iPod/i.test(navigator.userAgent);\nvar styled$3 = createDefaultStyle({\n position: 'relative',\n overflowY: 'visible',\n input: {\n display: 'block',\n width: '100%',\n position: 'absolute',\n margin: 0,\n top: 0,\n left: 0,\n boxSizing: 'border-box',\n backgroundColor: 'transparent',\n fontFamily: 'inherit',\n fontSize: 'inherit',\n letterSpacing: 'inherit'\n },\n '&multiLine': {\n input: _objectSpread$1({\n height: '100%',\n bottom: 0,\n overflow: 'hidden',\n resize: 'none'\n }, isMobileSafari ? {\n marginTop: 1,\n marginLeft: -3\n } : null)\n }\n}, function (_ref4) {\n var singleLine = _ref4.singleLine;\n return {\n '&singleLine': singleLine,\n '&multiLine': !singleLine\n };\n});\nvar MentionsInput$1 = styled$3(MentionsInput);\nvar defaultStyle = {\n fontWeight: 'inherit'\n};\nvar Mention = function Mention(_ref) {\n var display = _ref.display,\n style = _ref.style,\n className = _ref.className,\n classNames = _ref.classNames;\n var styles = useStyles(defaultStyle, {\n style: style,\n className: className,\n classNames: classNames\n });\n return /*#__PURE__*/React.createElement(\"strong\", styles, display);\n};\nMention.defaultProps = {\n trigger: '@',\n markup: '@[__display__](__id__)',\n displayTransform: function displayTransform(id, display) {\n return display || id;\n },\n onAdd: function onAdd() {\n return null;\n },\n onRemove: function onRemove() {\n return null;\n },\n renderSuggestion: null,\n isLoading: false,\n appendSpaceOnAdd: false\n};\nexport { Mention, MentionsInput$1 as MentionsInput };","import setPrototypeOf from \"./setPrototypeOf\";\nexport default function _inherits(subClass, superClass) {\n if (typeof superClass !== \"function\" && superClass !== null) {\n throw new TypeError(\"Super expression must either be null or a function\");\n }\n\n subClass.prototype = Object.create(superClass && superClass.prototype, {\n constructor: {\n value: subClass,\n writable: true,\n configurable: true\n }\n });\n if (superClass) setPrototypeOf(subClass, superClass);\n}","export default function _classCallCheck(instance, Constructor) {\n if (!(instance instanceof Constructor)) {\n throw new TypeError(\"Cannot call a class as a function\");\n }\n}","import _extends from \"@babel/runtime/helpers/esm/extends\";\nimport _objectWithoutProperties from \"@babel/runtime/helpers/esm/objectWithoutProperties\";\nimport * as React from 'react';\nimport clsx from 'clsx';\nimport { refType } from '@material-ui/utils';\nimport { useFormControl } from '../FormControl';\nimport withStyles from '../styles/withStyles';\nimport Typography from '../Typography';\nimport capitalize from '../utils/capitalize';\nexport var styles = function styles(theme) {\n return {\n /* Styles applied to the root element. */\n root: {\n display: 'inline-flex',\n alignItems: 'center',\n cursor: 'pointer',\n // For correct alignment with the text.\n verticalAlign: 'middle',\n WebkitTapHighlightColor: 'transparent',\n marginLeft: -11,\n marginRight: 16,\n // used for row presentation of radio/checkbox\n '&$disabled': {\n cursor: 'default'\n }\n },\n /* Styles applied to the root element if `labelPlacement=\"start\"`. */\n labelPlacementStart: {\n flexDirection: 'row-reverse',\n marginLeft: 16,\n // used for row presentation of radio/checkbox\n marginRight: -11\n },\n /* Styles applied to the root element if `labelPlacement=\"top\"`. */\n labelPlacementTop: {\n flexDirection: 'column-reverse',\n marginLeft: 16\n },\n /* Styles applied to the root element if `labelPlacement=\"bottom\"`. */\n labelPlacementBottom: {\n flexDirection: 'column',\n marginLeft: 16\n },\n /* Pseudo-class applied to the root element if `disabled={true}`. */\n disabled: {},\n /* Styles applied to the label's Typography component. */\n label: {\n '&$disabled': {\n color: theme.palette.text.disabled\n }\n }\n };\n};\n/**\n * Drop in replacement of the `Radio`, `Switch` and `Checkbox` component.\n * Use this component if you want to display an extra label.\n */\n\nvar FormControlLabel = /*#__PURE__*/React.forwardRef(function FormControlLabel(props, ref) {\n var checked = props.checked,\n classes = props.classes,\n className = props.className,\n control = props.control,\n disabledProp = props.disabled,\n inputRef = props.inputRef,\n label = props.label,\n _props$labelPlacement = props.labelPlacement,\n labelPlacement = _props$labelPlacement === void 0 ? 'end' : _props$labelPlacement,\n name = props.name,\n onChange = props.onChange,\n value = props.value,\n other = _objectWithoutProperties(props, [\"checked\", \"classes\", \"className\", \"control\", \"disabled\", \"inputRef\", \"label\", \"labelPlacement\", \"name\", \"onChange\", \"value\"]);\n var muiFormControl = useFormControl();\n var disabled = disabledProp;\n if (typeof disabled === 'undefined' && typeof control.props.disabled !== 'undefined') {\n disabled = control.props.disabled;\n }\n if (typeof disabled === 'undefined' && muiFormControl) {\n disabled = muiFormControl.disabled;\n }\n var controlProps = {\n disabled: disabled\n };\n ['checked', 'name', 'onChange', 'value', 'inputRef'].forEach(function (key) {\n if (typeof control.props[key] === 'undefined' && typeof props[key] !== 'undefined') {\n controlProps[key] = props[key];\n }\n });\n return /*#__PURE__*/React.createElement(\"label\", _extends({\n className: clsx(classes.root, className, labelPlacement !== 'end' && classes[\"labelPlacement\".concat(capitalize(labelPlacement))], disabled && classes.disabled),\n ref: ref\n }, other), /*#__PURE__*/React.cloneElement(control, controlProps), /*#__PURE__*/React.createElement(Typography, {\n component: \"span\",\n className: clsx(classes.label, disabled && classes.disabled)\n }, label));\n});\nprocess.env.NODE_ENV !== \"production\" ? void 0 : void 0;\nexport default withStyles(styles, {\n name: 'MuiFormControlLabel'\n})(FormControlLabel);","\"use strict\";\n\n/*\n MIT License http://www.opensource.org/licenses/mit-license.php\n Author Tobias Koppers @sokra\n*/\n// css base code, injected by the css-loader\n// eslint-disable-next-line func-names\nmodule.exports = function (useSourceMap) {\n var list = []; // return the list of modules as css string\n\n list.toString = function toString() {\n return this.map(function (item) {\n var content = cssWithMappingToString(item, useSourceMap);\n if (item[2]) {\n return \"@media \".concat(item[2], \"{\").concat(content, \"}\");\n }\n return content;\n }).join('');\n }; // import a list of modules into the list\n // eslint-disable-next-line func-names\n\n list.i = function (modules, mediaQuery) {\n if (typeof modules === 'string') {\n // eslint-disable-next-line no-param-reassign\n modules = [[null, modules, '']];\n }\n var alreadyImportedModules = {};\n for (var i = 0; i < this.length; i++) {\n // eslint-disable-next-line prefer-destructuring\n var id = this[i][0];\n if (id != null) {\n alreadyImportedModules[id] = true;\n }\n }\n for (var _i = 0; _i < modules.length; _i++) {\n var item = modules[_i]; // skip already imported module\n // this implementation is not 100% perfect for weird media query combinations\n // when a module is imported multiple times with different media queries.\n // I hope this will never occur (Hey this way we have smaller bundles)\n\n if (item[0] == null || !alreadyImportedModules[item[0]]) {\n if (mediaQuery && !item[2]) {\n item[2] = mediaQuery;\n } else if (mediaQuery) {\n item[2] = \"(\".concat(item[2], \") and (\").concat(mediaQuery, \")\");\n }\n list.push(item);\n }\n }\n };\n return list;\n};\nfunction cssWithMappingToString(item, useSourceMap) {\n var content = item[1] || ''; // eslint-disable-next-line prefer-destructuring\n\n var cssMapping = item[3];\n if (!cssMapping) {\n return content;\n }\n if (useSourceMap && typeof btoa === 'function') {\n var sourceMapping = toComment(cssMapping);\n var sourceURLs = cssMapping.sources.map(function (source) {\n return \"/*# sourceURL=\".concat(cssMapping.sourceRoot).concat(source, \" */\");\n });\n return [content].concat(sourceURLs).concat([sourceMapping]).join('\\n');\n }\n return [content].join('\\n');\n} // Adapted from convert-source-map (MIT)\n\nfunction toComment(sourceMap) {\n // eslint-disable-next-line no-undef\n var base64 = btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap))));\n var data = \"sourceMappingURL=data:application/json;charset=utf-8;base64,\".concat(base64);\n return \"/*# \".concat(data, \" */\");\n}","\"use strict\";\n\nvar stylesInDom = {};\n\nvar isOldIE = function isOldIE() {\n var memo;\n return function memorize() {\n if (typeof memo === 'undefined') {\n // Test for IE <= 9 as proposed by Browserhacks\n // @see http://browserhacks.com/#hack-e71d8692f65334173fee715c222cb805\n // Tests for existence of standard globals is to allow style-loader\n // to operate correctly into non-standard environments\n // @see https://github.com/webpack-contrib/style-loader/issues/177\n memo = Boolean(window && document && document.all && !window.atob);\n }\n\n return memo;\n };\n}();\n\nvar getTarget = function getTarget() {\n var memo = {};\n return function memorize(target) {\n if (typeof memo[target] === 'undefined') {\n var styleTarget = document.querySelector(target); // Special case to return head of iframe instead of iframe itself\n\n if (window.HTMLIFrameElement && styleTarget instanceof window.HTMLIFrameElement) {\n try {\n // This will throw an exception if access to iframe is blocked\n // due to cross-origin restrictions\n styleTarget = styleTarget.contentDocument.head;\n } catch (e) {\n // istanbul ignore next\n styleTarget = null;\n }\n }\n\n memo[target] = styleTarget;\n }\n\n return memo[target];\n };\n}();\n\nfunction listToStyles(list, options) {\n var styles = [];\n var newStyles = {};\n\n for (var i = 0; i < list.length; i++) {\n var item = list[i];\n var id = options.base ? item[0] + options.base : item[0];\n var css = item[1];\n var media = item[2];\n var sourceMap = item[3];\n var part = {\n css: css,\n media: media,\n sourceMap: sourceMap\n };\n\n if (!newStyles[id]) {\n styles.push(newStyles[id] = {\n id: id,\n parts: [part]\n });\n } else {\n newStyles[id].parts.push(part);\n }\n }\n\n return styles;\n}\n\nfunction addStylesToDom(styles, options) {\n for (var i = 0; i < styles.length; i++) {\n var item = styles[i];\n var domStyle = stylesInDom[item.id];\n var j = 0;\n\n if (domStyle) {\n domStyle.refs++;\n\n for (; j < domStyle.parts.length; j++) {\n domStyle.parts[j](item.parts[j]);\n }\n\n for (; j < item.parts.length; j++) {\n domStyle.parts.push(addStyle(item.parts[j], options));\n }\n } else {\n var parts = [];\n\n for (; j < item.parts.length; j++) {\n parts.push(addStyle(item.parts[j], options));\n }\n\n stylesInDom[item.id] = {\n id: item.id,\n refs: 1,\n parts: parts\n };\n }\n }\n}\n\nfunction insertStyleElement(options) {\n var style = document.createElement('style');\n\n if (typeof options.attributes.nonce === 'undefined') {\n var nonce = typeof __webpack_nonce__ !== 'undefined' ? __webpack_nonce__ : null;\n\n if (nonce) {\n options.attributes.nonce = nonce;\n }\n }\n\n Object.keys(options.attributes).forEach(function (key) {\n style.setAttribute(key, options.attributes[key]);\n });\n\n if (typeof options.insert === 'function') {\n options.insert(style);\n } else {\n var target = getTarget(options.insert || 'head');\n\n if (!target) {\n throw new Error(\"Couldn't find a style target. This probably means that the value for the 'insert' parameter is invalid.\");\n }\n\n target.appendChild(style);\n }\n\n return style;\n}\n\nfunction removeStyleElement(style) {\n // istanbul ignore if\n if (style.parentNode === null) {\n return false;\n }\n\n style.parentNode.removeChild(style);\n}\n/* istanbul ignore next */\n\n\nvar replaceText = function replaceText() {\n var textStore = [];\n return function replace(index, replacement) {\n textStore[index] = replacement;\n return textStore.filter(Boolean).join('\\n');\n };\n}();\n\nfunction applyToSingletonTag(style, index, remove, obj) {\n var css = remove ? '' : obj.css; // For old IE\n\n /* istanbul ignore if */\n\n if (style.styleSheet) {\n style.styleSheet.cssText = replaceText(index, css);\n } else {\n var cssNode = document.createTextNode(css);\n var childNodes = style.childNodes;\n\n if (childNodes[index]) {\n style.removeChild(childNodes[index]);\n }\n\n if (childNodes.length) {\n style.insertBefore(cssNode, childNodes[index]);\n } else {\n style.appendChild(cssNode);\n }\n }\n}\n\nfunction applyToTag(style, options, obj) {\n var css = obj.css;\n var media = obj.media;\n var sourceMap = obj.sourceMap;\n\n if (media) {\n style.setAttribute('media', media);\n }\n\n if (sourceMap && btoa) {\n css += \"\\n/*# sourceMappingURL=data:application/json;base64,\".concat(btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap)))), \" */\");\n } // For old IE\n\n /* istanbul ignore if */\n\n\n if (style.styleSheet) {\n style.styleSheet.cssText = css;\n } else {\n while (style.firstChild) {\n style.removeChild(style.firstChild);\n }\n\n style.appendChild(document.createTextNode(css));\n }\n}\n\nvar singleton = null;\nvar singletonCounter = 0;\n\nfunction addStyle(obj, options) {\n var style;\n var update;\n var remove;\n\n if (options.singleton) {\n var styleIndex = singletonCounter++;\n style = singleton || (singleton = insertStyleElement(options));\n update = applyToSingletonTag.bind(null, style, styleIndex, false);\n remove = applyToSingletonTag.bind(null, style, styleIndex, true);\n } else {\n style = insertStyleElement(options);\n update = applyToTag.bind(null, style, options);\n\n remove = function remove() {\n removeStyleElement(style);\n };\n }\n\n update(obj);\n return function updateStyle(newObj) {\n if (newObj) {\n if (newObj.css === obj.css && newObj.media === obj.media && newObj.sourceMap === obj.sourceMap) {\n return;\n }\n\n update(obj = newObj);\n } else {\n remove();\n }\n };\n}\n\nmodule.exports = function (list, options) {\n options = options || {};\n options.attributes = typeof options.attributes === 'object' ? options.attributes : {}; // Force single-tag solution on IE6-9, which has a hard limit on the # of \") : '');\n return /*#__PURE__*/React.createElement(Wrapper, _extends({\n className: \"\".concat(wrapperClassName),\n id: this.props.id || uuid,\n ref: function ref(_ref) {\n return _this9.tooltipRef = _ref;\n }\n }, ariaProps, {\n \"data-id\": \"tooltip\",\n dangerouslySetInnerHTML: {\n __html: htmlContent\n }\n }));\n } else {\n return /*#__PURE__*/React.createElement(Wrapper, _extends({\n className: \"\".concat(wrapperClassName),\n id: this.props.id || uuid\n }, ariaProps, {\n ref: function ref(_ref2) {\n return _this9.tooltipRef = _ref2;\n },\n \"data-id\": \"tooltip\"\n }), style && /*#__PURE__*/React.createElement(\"style\", {\n dangerouslySetInnerHTML: {\n __html: style\n },\n \"aria-hidden\": \"true\"\n }), content);\n }\n }\n }], [{\n key: \"propTypes\",\n get: function get() {\n return {\n uuid: PropTypes.string,\n children: PropTypes.any,\n place: PropTypes.string,\n type: PropTypes.string,\n effect: PropTypes.string,\n offset: PropTypes.object,\n padding: PropTypes.string,\n multiline: PropTypes.bool,\n border: PropTypes.bool,\n borderClass: PropTypes.string,\n textColor: PropTypes.string,\n backgroundColor: PropTypes.string,\n borderColor: PropTypes.string,\n arrowColor: PropTypes.string,\n arrowRadius: PropTypes.string,\n tooltipRadius: PropTypes.string,\n insecure: PropTypes.bool,\n \"class\": PropTypes.string,\n className: PropTypes.string,\n id: PropTypes.string,\n html: PropTypes.bool,\n delayHide: PropTypes.number,\n delayUpdate: PropTypes.number,\n delayShow: PropTypes.number,\n event: PropTypes.string,\n eventOff: PropTypes.string,\n isCapture: PropTypes.bool,\n globalEventOff: PropTypes.string,\n getContent: PropTypes.any,\n afterShow: PropTypes.func,\n afterHide: PropTypes.func,\n overridePosition: PropTypes.func,\n disable: PropTypes.bool,\n scrollHide: PropTypes.bool,\n resizeHide: PropTypes.bool,\n wrapper: PropTypes.string,\n bodyMode: PropTypes.bool,\n possibleCustomEvents: PropTypes.string,\n possibleCustomEventsOff: PropTypes.string,\n clickable: PropTypes.bool,\n disableInternalStyle: PropTypes.bool\n };\n }\n }, {\n key: \"getDerivedStateFromProps\",\n value: function getDerivedStateFromProps(nextProps, prevState) {\n var ariaProps = prevState.ariaProps;\n var newAriaProps = parseAria(nextProps);\n var isChanged = Object.keys(newAriaProps).some(function (props) {\n return newAriaProps[props] !== ariaProps[props];\n });\n if (!isChanged) {\n return null;\n }\n return _objectSpread2(_objectSpread2({}, prevState), {}, {\n ariaProps: newAriaProps\n });\n }\n }]);\n return ReactTooltip;\n}(React.Component), _defineProperty(_class2, \"defaultProps\", {\n insecure: true,\n resizeHide: true,\n wrapper: 'div',\n clickable: false\n}), _defineProperty(_class2, \"supportedWrappers\", ['div', 'span']), _defineProperty(_class2, \"displayName\", 'ReactTooltip'), _class2)) || _class) || _class) || _class) || _class) || _class) || _class) || _class;\nexport { ReactTooltip as default };","import React from 'react';\nimport Fuse from \"fuse.js\";\nimport styles from \"./styles/FormulasLayoutStyles\";\nimport Button from \"@material-ui/core/Button\";\nimport ReactDOM from \"react-dom\";\nimport {BlueButton} from \"../styled_components/default\";\nimport {\n overlayStyle,\n modalStyle,\n modalContentStyle,\n modalTitleStyle,\n modalDescriptionStyle,\n closeButtonStyle\n} from './styles/ModalStyles';\n\n\nclass FormulasExistentesSearch extends React.Component {\n constructor(props) {\n super(props);\n this.state = {\n paramsQueryFormulas: \"\",\n anchorEl: null,\n activeRowId: null,\n dropdownVisible: false,\n dropdownTimeout: null,\n openModal: false,\n months: \"\",\n selectedRow: null,\n activeButton: null,\n };\n this.dropdownContainer = document.createElement('div');\n document.body.appendChild(this.dropdownContainer);\n this.modalContainer = null;\n }\n\n componentDidMount() {\n this.modalContainer = document.createElement('div');\n document.body.appendChild(this.modalContainer);\n }\n\n componentDidUpdate(prevProps, prevState) {\n if (this.modalContainer && !prevState.openModal && this.state.openModal) {\n this.forceUpdate();\n }\n }\n\n handleOpenModal = (row) => {\n this.setState({ openModal: true, selectedRow: row });\n }\n\n handleCloseModal = () => {\n this.setState({ openModal: false });\n this.refreshModalParams();\n }\n\n componentWillUnmount() {\n document.body.removeChild(this.dropdownContainer);\n if (this.state.dropdownTimeout) {\n clearTimeout(this.state.dropdownTimeout);\n }\n if (this.modalContainer) {\n document.body.removeChild(this.modalContainer);\n }\n }\n\n handleAddButtonClick = (row) => {\n if (this.props.onAddItem) {\n this.props.onAddItem(row);\n }\n }\n\n textPeriod = () => {\n const operationType = this.state.tabActive;\n const months = this.state.months;\n return `.${operationType}_${months}`;\n }\n\n refreshModalParams = () => {\n this.setState({\n selectedRow: null,\n openModal: false,\n months: \"\",\n tabActive: null\n });\n }\n\n showDropdown = (rowId, row, event) => {\n this.setState({ dropdownVisible: true, activeRowId: rowId, anchorEl: event.currentTarget, selectedRow: row });\n };\n\n attemptHideDropdown = () => {\n const timeoutId = setTimeout(() => {\n if (!this.isMouseOverDropdown) {\n this.setState({ dropdownVisible: false });\n }\n }, 300);\n this.setState({ dropdownTimeout: timeoutId });\n };\n\n handleMouseEnterDropdown = () => {\n this.isMouseOverDropdown = true;\n };\n\n handleMouseLeaveDropdown = () => {\n this.isMouseOverDropdown = false;\n this.attemptHideDropdown();\n };\n\n handleOverlayClick = (e) => {\n if (e.target === e.currentTarget) {\n this.handleCloseModal();\n this.refreshModalParams();\n }\n }\n\n renderParams(formulas) {\n let filtered = {};\n\n var combinedData = formulas.map(item => ({\n title: \"FÓRMULA\",\n display: item.display || \"\",\n group: item.group || \"\",\n id: item.id || \"\"\n }));\n\n if (this.state.paramsQueryFormulas.length < 1) {\n filtered.formulas = combinedData;\n } else {\n var options = {\n shouldSort: true,\n threshold: 0.3,\n distance: 1000,\n maxPatternLength: 1500,\n minMatchCharLength: 3,\n keys: [\"display\"]\n };\n\n var fuse = new Fuse(combinedData, options);\n filtered.formulas = fuse.search(this.state.paramsQueryFormulas);\n }\n\n const htmlRender = filtered.formulas.map((item, index) => (\n \n this.handleOpenModal(this.state.selectedRow)}\n >\n Adicionar Período\n \n
\n ,\n this.dropdownContainer\n )}\n\n {this.props.chartFormula && (\n \n this.setState({ activeButton: {buttonName: 'analisado', rowId: item.id} })}\n onMouseLeave={() => this.setState({ activeButton: null })}\n style={{\n backgroundColor: '#03AB79',\n color: 'white',\n borderRadius: '15px',\n padding: '2px 15px',\n margin: '0 5px',\n border: 'none',\n fontSize: '10px'\n }}\n onClick={() => this.props.onAddTextAndRowToFormula(\".data1\", item)}\n >\n Analisado +\n \n {this.state.activeButton && this.state.activeButton.buttonName === 'analisado' && this.state.activeButton.rowId === item.id && this.setState({ activeButton: {buttonName: 'comparado', rowId: item.id} })}\n onMouseLeave={() => this.setState({ activeButton: null })}\n style={{\n backgroundColor: '#0099D8',\n color: 'white',\n borderRadius: '15px',\n padding: '2px 15px',\n margin: '0 5px',\n border: 'none',\n fontSize: '10px'\n }}\n onClick={() => this.props.onAddTextAndRowToFormula(\".data2\", item)}>\n Comparado +\n \n {this.state.activeButton && this.state.activeButton.buttonName === 'comparado' && this.state.activeButton.rowId === item.id &&
\n )}\n \n ));\n\n return htmlRender;\n }\n\n render() {\n const { formulas } = this.props;\n\n return (\n \n
}\n \n
\n Utiliza o valor do período do ANO ATUAL (de janeiro até o mês do último upload de balanço)
\n\n
}\n \n
\n Utiliza o valor do período do ANO ANTERIOR (de janeiro até o mês referência - que é do último upload de balanço do ano)\n
\n\n
\n )}\n\n \n );\n }\n}\n\nexport default FormulasExistentesSearch;\n","import React, {useRef} from \"react\";\n\nimport { MentionsInput, Mention } from \"react-mentions\";\n\nimport provideExampleValue from \"./provideExampleValue\";\n\nimport defaultStyle from \"./styles/defaultStyle\";\nimport defaultMentionStyle from \"./styles/defaultMentionStyle\";\nimport hashtagMentionStyle from \"./styles/hashtagMentionStyle\";\n\nfunction SingleLine({\n value,\n data,\n hashtagData,\n customData,\n titleData,\n onChange,\n onAdd,\n inputRef,\n onMudado,\n costCenterAreaData,\n label\n}) {\n console.log(\"FORMULA_INPUT DATA\", data)\n return (\n \n
\n \n # FÓRMULAS EXISTENTES\n
\n \n {\n let newValue = e.target.value;\n this.setState({ paramsQueryFormulas: newValue });\n }}\n />\n
\n \n {formulas ? this.renderParams(formulas) :
\n\n {this.state.openModal && (\n Carregando...
}\n \n
\n \n \n
\n \n
\n Adicionar Período
\n \n Você pode visualizar a SOMA ou a MÉDIA dos últimos meses que desejar. Ex: A média dos últimos 6 meses (informe o “tipo de operação: média” e a “quantidade: 6”\n
\n\n \n
\n\n Fórmula:
\n {this.state.selectedRow.display}
\n \n \n
\n \n {['soma', 'media'].map((format) => (\n this.setState({ tabActive: format })}\n style={{ ...styles.tab, ...(this.state.tabActive === format ? styles.tabActive : {}) }}\n >\n {format === 'soma' ? 'SOMA' : 'MÉDIA'}\n
\n ))}\n \n \n this.setState({ months: x.currentTarget.value })}\n />\n
\n \n {\n this.props.onAddTextAndRowToFormula(this.textPeriod(), this.state.selectedRow);\n this.handleCloseModal();\n this.refreshModalParams();\n }}>\n Aplicar\n \n
\n \n\n \n {\n\n return {\n\n return
\n );\n}\n\nexport default SingleLine;\n","import React from \"react\";\nimport LoadingDialog from './../LoadingDialog'\nimport Comment from './../Comment'\nimport MonthFilter from './../MonthFilter'\nimport axios from '../utils/axiosConfig';\n\nclass BalanceSegmentado extends React.Component {\n\n constructor(props){\n \tsuper(props)\n \tthis.requestsCounter = 0\n \tthis.state ={\n showZeroLines: false,\n paramDetails: {},\n paramLines: {},\n \t\tyear: this.props.defaultYear,\n \t\tactiveBranches: {},\n \t\tloading: false,\n \t\tdata: [],\n \t\tyears: [],\n \t\tresultIds: [],\n \t\tcash_flow_formula_ids: {},\n activeRows: {},\n companiesData: {},\n visibleMonths: {\n janeiro: true,\n fevereiro: true,\n março: true,\n abril: true,\n maio: true,\n junho: true,\n julho: true,\n agosto: true,\n setembro: true,\n outubro: true,\n novembro: true,\n dezembro: true,\n },\n months: props.months\n \t}\n }\n\n componentDidUpdate(){\n if(this.state.year && (this.state.year != this.props.defaultYear)){\n this.changeYear(this.props.defaultYear)\n }\n }\n \n async fetchInitialParams(year=null){\n let {companies} = this.props;\n \tthis.setState({loading: true})\n \tlet self = this\n Object.values(companies).map((company_id)=>{\n \n self.requestsCounter += 1\n axios.get('/results/balances.json', {params: {\n year: year,\n company_id: company_id,\n }}).then((result)=>{\n self.requestsCounter -= 1\n \n self.setState((oldState)=>{\n oldState.companiesData[company_id] = {}\n oldState.companiesData[company_id]['cash_flow_formula_ids'] = result.data.cash_flow_formula_ids\n oldState.companiesData[company_id]['data'] = result.data.params\n oldState.companiesData[company_id]['result'] = result.data.result\n oldState.companiesData[company_id]['resultIds'] = result.data.result.result_ids\n oldState['cash_flow_formula_ids'] = result.data.cash_flow_formula_ids\n oldState['data'] = result.data.params\n oldState['result'] = result.data.result\n oldState['resultIds'] = result.data.result.result_ids\n return {...oldState}\n })\n \n })\n \n })\n\t\n \n \n \n\t\n }\n\n async setComments(){\n \n let comments = await axios.get('/comments.json', {params:{\n year: [this.state.year, 0]\n }}) \n \n \n this.setState({comments: comments.data})\n }\n\n async setYears(){\n \tthis.requestsCounter += 1\n \tlet years = await axios.get('/balance_sheets/years.json')\n \tthis.requestsCounter -= 1\n \tthis.setState({years: years.data})\n this.setComments()\n }\n\n componentDidMount(){\n \tthis.setYears()\n this.setComments()\n \tthis.fetchInitialParams(this.state.year)\n }\n\n numberToCurrency(number){\n \tif(number == 0 || number){\n \t\treturn parseFloat(number).toLocaleString('pt-BR', { style: 'currency', currency: 'BRL' })\t\n \t}\n \treturn \"-\"\n\t\n }\n removeAllChildren(row, rows){\n if(row.childreen_attributes.length > 0){\n rows[row.id] = false\n row.childreen_attributes.map((child)=>(this.removeAllChildren(child, rows)))\n \n }else{\n rows[row.id] = false\n }\n }\n\n toggleRow(parent, row){\n \n \tlet rows = this.state.activeBranches\n \trows[row.id] = !rows[row.id]\n if(!rows[row.id]){\n this.removeAllChildren(row, rows) \n }else{\n if(row.is_tail){\n this.fetchDetailsForRow(row)\n }\n }\n \n \tthis.setState({activeBranches: rows})\n\n }\n\n async fetchDetailsForRow(row){\n this.requestsCounter += 1\n \tlet details = await axios.get(`/results/${row.fr_id}/detail.json?year=${this.state.year}&value_param=f_saldo_atual&segmented=true`)\n \tthis.requestsCounter -= 1\n\n let lines = {}\n \tObject.entries(details?.data?.companies).map(([company_id, hash])=>{\n console.log(hash)\n let hashLines = Object.values(hash)[0].lines\n Object.entries(hashLines).map(([key, entry])=>{\n lines[key] = entry\n })\n \n })\n this.setState({\n paramLines: {\n ...this.state.paramLines,\n [row.id]: lines\n },\n paramDetails:{\n ...this.state.paramDetails,\n [row.id]: details.data\n }\n })\n \n }\n\n\n branchIsActive(row){\n \treturn this.state.activeBranches[row.id]\n }\n\n sumResults(values){\n \tlet result = Object.values(Object.values(values)).reduce((a,b)=> parseFloat(a)+ parseFloat(b), 0)\n \treturn this.numberToCurrency(result)\n \t// return 0\n }\n\n renderChildreen(contabilParam, childreen_attributes=[], level=0){\n const {currentMonth, companies} = this.props;\n \tconst {months, paramDetails} = this.state;\n \tconst {result, resultIds, cash_flow_formula_ids, companiesData} = this.state;\n \tlet childreen = null\n \t\n\t childreen = childreen_attributes.map((child)=> {\n let total = 0\n\t\treturn ({label !== 'undefined' ? label : \"Formula\"}
\n\n {titleData[entry.id] ? (titleData[entry.id] + \" -> \") : \"\"}\n {entry.display}\n
\n }}\n trigger=\"@\"\n appendSpaceOnAdd={true}\n style={{ backgroundColor: \"#3f12\" }}\n />\n \n {entry.group} - \n {entry.display}\n
\n }}\n trigger=\"#\"\n data={hashtagData}\n style={{ backgroundColor: \"#2B7DE999\" }}\n appendSpaceOnAdd={true}\n />\n \n\t \t\t\t\t\t\t\n\t \t\t\t\t\t
\n\t\t\t\t\t\t\t{child.label} {cash_flow_formula_ids[child.fr_id] ? : \"\"}\n\t\t\t\t\t\t\n\t \t\t
\t\t\n\t\t \n\t\t \n\t\t \n\t\t
\n\t\t
\n\t\t | \n\t\t Nome\n\t\t | \n\t\t {Object.entries(companies).map(([name, numero]) => (\n{name} | \n ))}\n\t\tTotal | \n\t\t \n\t\t
|---|---|---|
| \n {this.state.comments && | \n {Object.values(companies).map((company_id) => (\n\t\t\t\t \t\t\t\t Object.entries(months).map(([name, number])=>{\n if(this.props.current_company_id != company_id && currentMonth == name && this.state.companiesData?.[company_id]?.result){\n total += this.numerize(this.state.companiesData?.[company_id]?.result.params[contabilParam.id][name])\n }\n \n\t\t\t\t\t\t \treturn (currentMonth == name) && \n {this.state.companiesData?.[company_id]?.result && this.numberToCurrency(this.state.companiesData?.[company_id]?.result.params[contabilParam.id][name])}\n | \n })\n ))\n }\n\t\t\t\t\t\t{this.numberToCurrency(total)} | \n\t\t\t\t\t\t
| Checagem | \n {Object.values(companies).map((company_id) => (\n \t\t \tObject.entries(months).map(([name, number])=>(\n \t\t \t(currentMonth == name) &&\n \t\t\t {this.state.companiesData?.[company_id]?.result && this.checkMonth(name, company_id)}\n \t\t\t | \n \t\t ))\n ))}\n\t\t \n\t\t
\n \n \n \n {numberToCurrency(comment())}\n {\n comment() && \n }\n \n
\n );\n}","'use strict';\n// 21.2.5.3 get RegExp.prototype.flags\nvar anObject = require('./_an-object');\nmodule.exports = function () {\n var that = anObject(this);\n var result = '';\n if (that.global) result += 'g';\n if (that.ignoreCase) result += 'i';\n if (that.multiline) result += 'm';\n if (that.unicode) result += 'u';\n if (that.sticky) result += 'y';\n return result;\n};\n","// 7.3.20 SpeciesConstructor(O, defaultConstructor)\nvar anObject = require('./_an-object');\nvar aFunction = require('./_a-function');\nvar SPECIES = require('./_wks')('species');\nmodule.exports = function (O, D) {\n var C = anObject(O).constructor;\n var S;\n return C === undefined || (S = anObject(C)[SPECIES]) == undefined ? D : aFunction(S);\n};\n","'use strict';\n\nvar inherits = require('inherits');\nvar MD5 = require('md5.js');\nvar RIPEMD160 = require('ripemd160');\nvar sha = require('sha.js');\nvar Base = require('cipher-base');\nfunction Hash(hash) {\n Base.call(this, 'digest');\n this._hash = hash;\n}\ninherits(Hash, Base);\nHash.prototype._update = function (data) {\n this._hash.update(data);\n};\nHash.prototype._final = function () {\n return this._hash.digest();\n};\nmodule.exports = function createHash(alg) {\n alg = alg.toLowerCase();\n if (alg === 'md5') return new MD5();\n if (alg === 'rmd160' || alg === 'ripemd160') return new RIPEMD160();\n return new Hash(sha(alg));\n};","module.exports = function xor(a, b) {\n var length = Math.min(a.length, b.length);\n var buffer = new Buffer(length);\n for (var i = 0; i < length; ++i) {\n buffer[i] = a[i] ^ b[i];\n }\n return buffer;\n};","'use strict';\n\nvar utils = require('./utils');\nvar assert = require('minimalistic-assert');\nfunction BlockHash() {\n this.pending = null;\n this.pendingTotal = 0;\n this.blockSize = this.constructor.blockSize;\n this.outSize = this.constructor.outSize;\n this.hmacStrength = this.constructor.hmacStrength;\n this.padLength = this.constructor.padLength / 8;\n this.endian = 'big';\n this._delta8 = this.blockSize / 8;\n this._delta32 = this.blockSize / 32;\n}\nexports.BlockHash = BlockHash;\nBlockHash.prototype.update = function update(msg, enc) {\n // Convert message to array, pad it, and join into 32bit blocks\n msg = utils.toArray(msg, enc);\n if (!this.pending) this.pending = msg;else this.pending = this.pending.concat(msg);\n this.pendingTotal += msg.length;\n\n // Enough data, try updating\n if (this.pending.length >= this._delta8) {\n msg = this.pending;\n\n // Process pending data in blocks\n var r = msg.length % this._delta8;\n this.pending = msg.slice(msg.length - r, msg.length);\n if (this.pending.length === 0) this.pending = null;\n msg = utils.join32(msg, 0, msg.length - r, this.endian);\n for (var i = 0; i < msg.length; i += this._delta32) this._update(msg, i, i + this._delta32);\n }\n return this;\n};\nBlockHash.prototype.digest = function digest(enc) {\n this.update(this._pad());\n assert(this.pending === null);\n return this._digest(enc);\n};\nBlockHash.prototype._pad = function pad() {\n var len = this.pendingTotal;\n var bytes = this._delta8;\n var k = bytes - (len + this.padLength) % bytes;\n var res = new Array(k + this.padLength);\n res[0] = 0x80;\n for (var i = 1; i < k; i++) res[i] = 0;\n\n // Append length\n len <<= 3;\n if (this.endian === 'big') {\n for (var t = 8; t < this.padLength; t++) res[i++] = 0;\n res[i++] = 0;\n res[i++] = 0;\n res[i++] = 0;\n res[i++] = 0;\n res[i++] = len >>> 24 & 0xff;\n res[i++] = len >>> 16 & 0xff;\n res[i++] = len >>> 8 & 0xff;\n res[i++] = len & 0xff;\n } else {\n res[i++] = len & 0xff;\n res[i++] = len >>> 8 & 0xff;\n res[i++] = len >>> 16 & 0xff;\n res[i++] = len >>> 24 & 0xff;\n res[i++] = 0;\n res[i++] = 0;\n res[i++] = 0;\n res[i++] = 0;\n for (t = 8; t < this.padLength; t++) res[i++] = 0;\n }\n return res;\n};","'use strict';\n\nconst inherits = require('inherits');\nconst Reporter = require('../base/reporter').Reporter;\nconst Buffer = require('safer-buffer').Buffer;\nfunction DecoderBuffer(base, options) {\n Reporter.call(this, options);\n if (!Buffer.isBuffer(base)) {\n this.error('Input not Buffer');\n return;\n }\n this.base = base;\n this.offset = 0;\n this.length = base.length;\n}\ninherits(DecoderBuffer, Reporter);\nexports.DecoderBuffer = DecoderBuffer;\nDecoderBuffer.isDecoderBuffer = function isDecoderBuffer(data) {\n if (data instanceof DecoderBuffer) {\n return true;\n }\n\n // Or accept compatible API\n const isCompatible = typeof data === 'object' && Buffer.isBuffer(data.base) && data.constructor.name === 'DecoderBuffer' && typeof data.offset === 'number' && typeof data.length === 'number' && typeof data.save === 'function' && typeof data.restore === 'function' && typeof data.isEmpty === 'function' && typeof data.readUInt8 === 'function' && typeof data.skip === 'function' && typeof data.raw === 'function';\n return isCompatible;\n};\nDecoderBuffer.prototype.save = function save() {\n return {\n offset: this.offset,\n reporter: Reporter.prototype.save.call(this)\n };\n};\nDecoderBuffer.prototype.restore = function restore(save) {\n // Return skipped data\n const res = new DecoderBuffer(this.base);\n res.offset = save.offset;\n res.length = this.offset;\n this.offset = save.offset;\n Reporter.prototype.restore.call(this, save.reporter);\n return res;\n};\nDecoderBuffer.prototype.isEmpty = function isEmpty() {\n return this.offset === this.length;\n};\nDecoderBuffer.prototype.readUInt8 = function readUInt8(fail) {\n if (this.offset + 1 <= this.length) return this.base.readUInt8(this.offset++, true);else return this.error(fail || 'DecoderBuffer overrun');\n};\nDecoderBuffer.prototype.skip = function skip(bytes, fail) {\n if (!(this.offset + bytes <= this.length)) return this.error(fail || 'DecoderBuffer overrun');\n const res = new DecoderBuffer(this.base);\n\n // Share reporter state\n res._reporterState = this._reporterState;\n res.offset = this.offset;\n res.length = this.offset + bytes;\n this.offset += bytes;\n return res;\n};\nDecoderBuffer.prototype.raw = function raw(save) {\n return this.base.slice(save ? save.offset : this.offset, this.length);\n};\nfunction EncoderBuffer(value, reporter) {\n if (Array.isArray(value)) {\n this.length = 0;\n this.value = value.map(function (item) {\n if (!EncoderBuffer.isEncoderBuffer(item)) item = new EncoderBuffer(item, reporter);\n this.length += item.length;\n return item;\n }, this);\n } else if (typeof value === 'number') {\n if (!(0 <= value && value <= 0xff)) return reporter.error('non-byte EncoderBuffer value');\n this.value = value;\n this.length = 1;\n } else if (typeof value === 'string') {\n this.value = value;\n this.length = Buffer.byteLength(value);\n } else if (Buffer.isBuffer(value)) {\n this.value = value;\n this.length = value.length;\n } else {\n return reporter.error('Unsupported type: ' + typeof value);\n }\n}\nexports.EncoderBuffer = EncoderBuffer;\nEncoderBuffer.isEncoderBuffer = function isEncoderBuffer(data) {\n if (data instanceof EncoderBuffer) {\n return true;\n }\n\n // Or accept compatible API\n const isCompatible = typeof data === 'object' && data.constructor.name === 'EncoderBuffer' && typeof data.length === 'number' && typeof data.join === 'function';\n return isCompatible;\n};\nEncoderBuffer.prototype.join = function join(out, offset) {\n if (!out) out = Buffer.alloc(this.length);\n if (!offset) offset = 0;\n if (this.length === 0) return out;\n if (Array.isArray(this.value)) {\n this.value.forEach(function (item) {\n item.join(out, offset);\n offset += item.length;\n });\n } else {\n if (typeof this.value === 'number') out[offset] = this.value;else if (typeof this.value === 'string') out.write(this.value, offset);else if (Buffer.isBuffer(this.value)) this.value.copy(out, offset);\n offset += this.length;\n }\n return out;\n};","import React from \"react\";\nimport LoadingDialog from './../LoadingDialog'\nimport Comment from './../Comment'\nimport MonthFilter from './../MonthFilter'\nimport popupIco from 'popup-ico.svg';\nimport { popupCenter } from './../popup/popupCenter'\nimport olhoOn from 'bt_olho_on.svg'\nimport olhoOff from 'bt_olho_off.svg'\nimport ResultChart from \"../ResultChart\";\nimport downloadIco from 'bt_download.svg';\n//import styled\nimport styled from 'styled-components'\nimport { ViewerButton } from \"../../styled_components/default\";\nimport EyeOff from \"../svg-icons/EyeOff\";\nimport { EyeOn } from \"../svg-icons/EyeOn\";\nimport axios from '../utils/axiosConfig';\n\nclass Balance extends React.Component {\n\n constructor(props) {\n super(props)\n this.requestsCounter = 0\n\n let months = {}\n\n Object.entries(props.months).map(([key, value]) => {\n if (Object.keys(props.visible_months?.[props.defaultYear] || {}).includes(key)) {\n months[key] = value\n }\n if (props.is_budget) {\n months[key] = value\n }\n })\n\n this.state = {\n recordsFetchedByYear: {},\n liquidProfitFormula: {},\n allYearsData: {},\n showZeroLines: false,\n year: this.props.defaultYear,\n activeBranches: {},\n recordsFetched: {},\n activeKeys: {},\n loading: false,\n data: [],\n years: [],\n resultIds: [],\n cash_flow_formula_ids: {},\n activeRows: {},\n periods: {},\n visibleMonths: props.visible_months[props.defaultYear] || {\n janeiro: true,\n fevereiro: true,\n março: true,\n abril: true,\n maio: true,\n junho: true,\n julho: true,\n agosto: true,\n setembro: true,\n outubro: true,\n novembro: true,\n dezembro: true,\n },\n months: months\n }\n }\n\n async fetchInitialParams(year = null, changeData = true) {\n this.setState({ loading: true })\n this.requestsCounter += 1\n let result = await axios.get('/results/balances.json', {\n params: {\n year: year\n }\n })\n this.requestsCounter -= 1\n this.setState({ loading: false })\n if (changeData) {\n this.setState({ cash_flow_formula_ids: result.data.cash_flow_formula_ids })\n this.setState({ data: result.data.params })\n this.setState({ result: result.data.result })\n this.setState({ resultIds: result.data.result.result_ids })\n }\n this.setState({\n allYearsData: {\n ...this.state.allYearsData,\n [year]: result.data.result\n }\n })\n\n }\n\n // fetch company liquid profit formula\n fetchCompanyLiquidProfitFormula(year = this.state.year) {\n this.requestsCounter += 1\n axios.get('/results/liquid_profit_formula.json', {\n params: {\n year\n }\n })\n .then(response => {\n this.requestsCounter -= 1\n this.setState({ liquidProfitFormula: Object.values(response.data.values)[0] })\n console.log(Object.values(response.data.values)[0])\n })\n .catch(error => {\n this.requestsCounter -= 1\n console.log(error)\n })\n }\n\n async fetchDetail(key, year = this.state.year, hide = true, updateLocal = true) {\n const { recordsFetched } = this.state;\n const { cost_center_heads, is_budget } = this.props;\n\n if (recordsFetched[key] && hide) {\n this.setState((oldState) => {\n oldState.activeKeys[key] = {}\n oldState.recordsFetched[key] = null\n return { ...oldState }\n })\n } else {\n let details = await axios.get(`/results/${key}/detail.json`, {\n params: {\n year: year,\n value_param: 'f_saldo_atual',\n tail: true\n\n }\n })\n\n this.setState((oldState) => {\n let dataFetched = {}\n if (Object.values(Object.values(details.data)[0].childreen).length > 0) {\n dataFetched = Object.values(details.data)[0].childreen\n } else {\n dataFetched = Object.values(details.data)[0].lines\n }\n\n if (updateLocal) {\n oldState.recordsFetched[key] = dataFetched\n }\n\n oldState.recordsFetchedByYear[year] ||= {}\n oldState.recordsFetchedByYear[year][key] = dataFetched\n return { ...oldState }\n })\n }\n\n }\n\n async setComments() {\n\n let comments = await axios.get('/comments.json', {\n params: {\n year: [this.state.year, 0]\n }\n })\n\n\n this.setState({ comments: comments.data })\n }\n\n async setYears() {\n this.requestsCounter += 1\n let years = await axios.get('/balance_sheets/years.json')\n this.requestsCounter -= 1\n this.setState({ years: years.data })\n this.setComments()\n }\n\n componentDidMount() {\n this.setYears()\n this.setComments()\n this.fetchConflicts()\n this.fetchInitialParams(this.state.year)\n this.fetchCompanyLiquidProfitFormula()\n this.fetchGetPeriods()\n }\n\n numberToCurrency(number) {\n if (number == 0 || number) {\n return parseFloat(number).toLocaleString('pt-BR', { style: 'currency', currency: 'BRL' })\n }\n return \"-\"\n\n }\n removeAllChildren(row, rows) {\n if (row.childreen_attributes.length > 0) {\n rows[row.id] = false\n row.childreen_attributes.map((child) => (this.removeAllChildren(child, rows)))\n\n } else {\n rows[row.id] = false\n }\n }\n\n toggleRow(parent, row) {\n\n let rows = this.state.activeBranches\n rows[row.id] = !rows[row.id]\n if (!rows[row.id]) {\n this.removeAllChildren(row, rows)\n }\n\n this.setState({ activeBranches: rows })\n }\n\n branchIsActive(row) {\n return this.state.activeBranches[row.id]\n }\n\n sumResults(values) {\n let result = Object.values(Object.values(values)).reduce((a, b) => parseFloat(a) + parseFloat(b), 0)\n return this.numberToCurrency(result)\n // return 0\n }\n\n renderChildreenFor(key = null, level) {\n\n let data = this.state.recordsFetched[key]\n if (data) {\n return (\n Valor Removido \n \n \n
\n \n \n \n \n \n \n changeValue(e)}\n className={'currency-input'}\n />\n
\n {line.label}
\n \n\n {!child.is_tail && }\n {child.is_tail && }\n
\n {child.label} {cash_flow_formula_ids[child.fr_id] ? : \"\"}\n \n \n \n \n \n \n \n
\n }\n\n render() {\n\n\n const { state } = this.props;\n const { data, result, year, years, resultIds, cash_flow_formula_ids, showZeroLines, months, conflicts } = this.state;\n\n\n\n return (\n Conflitos
\n- \n {conflicts?.map(([company, code, parametro, descriptions]) => {\n let differentCode = lastCode != code;\n lastCode = code;\n return
- {code} {descriptions[0]} }\n
- {parametro} na empresa {company} \n
}\n {differentCode &&
\n this.setState({ hideConflicts: true })}>\n Fechar\n \n
\n \n this.changeVisibleMonths(e)} visibleMonths={this.state.visibleMonths} months={this.props.months}> \n\n this.setState({ showZeroLines: !showZeroLines })}>\n {showZeroLines ? \n
\n \n\t \n * Você está visualizando números no formato n/{this.props.divisor}\n \n {this.renderConflicts()}\n \n\t \n popupCenter({ url: `/popups/balance`, title: 'Editar', w: window.innerWidth * 0.8, h: window.innerHeight * 0.8 })}\n style={{\n backgroundColor: '#F5F5F5',\n width: 36,\n height: 36,\n borderRadius: 4,\n display: 'flex',\n justifyContent: 'center',\n alignItems: 'center',\n cursor: 'pointer'\n }}>\n \n
\n BALANÇO
\n \n\t \t\t
\t\t\n\t\t \n\t\t \n\t\t \n\t\t
\n\t\t
\n\t\t | \n\t\t Nome\n\t\t | \n\t\t {Object.values(months).map((month)=>(\n\t\t \t\n\t\t\t {monthDict[`${month}`.padStart(2, '0')]}/{year}\n\t\t\t | \n\t\t ))}\n\t\t \n\t\t \n\t\t
|---|---|
| \n {this.state.comments && | \n\t\t\t\t \t\t\t\t{Object.entries(months).map(([name, number])=>(\n\t\t\t\t\t\t \t\n {this.state.comments && | \n\t\t\t\t\t\t ))}\n \n\t\t\t\t\t\t \n\t\t\t\t\t\t
| Checagem | \n\t\t \t{Object.entries(months).map(([name, number])=>(\n\t\t \t\n\t\t\t {result && this.checkMonth(name)}\n\t\t\t | \n\t\t ))}\n\t\t \n\t\t
| Lucro Líquido | \n {\n \n Object.entries(months).map(([name, number])=>{\n let beforeSum = this.getBeforeMonthsSum(number)\n let currentValue = 0\n try{\n currentValue = parseFloat(eval(\"(\" +this.state.liquidProfitFormula?.result?.[name] + \") * -1\")) || 0\n }catch(e){}\n \n return <>\n{currentValue ? this.numberToCurrency( beforeSum + currentValue) : \"-\"} | \n \n \n })\n }\n
{line.label}
\n \n {(totalLine * -1).toLocaleString(\"pt-BR\", {\n style: \"currency\",\n currency: \"BRL\"\n })}\n
\n{this.numberToCurrency(sum)}
\n{value} {label}
\n return {value}
\n }\n\n percentFormat(number) {\n return `${parseFloat(number).toFixed(2)}%`\n }\n\n changeVisibleMonths(event) {\n // event.target.name]: event.target.checked\n let { name, checked } = event.target\n let props = this.props;\n this.setState((oldState) => {\n oldState.visibleMonths[name] = checked\n oldState.months = {}\n Object.entries(this.props.months_dict).map(([number, month_name]) => {\n if (oldState.visibleMonths[month_name]) {\n oldState.months[month_name] = number\n }\n })\n\n return { ...oldState }\n });\n }\n\n getFloat(number) {\n if (parseFloat(number).toLocaleString() == \"NaN\") {\n return 0\n } else {\n return parseFloat(number)\n }\n }\n\n isParamZero(p_value, param) {\n if (this.state.showZeroLines) {\n return false\n }\n\n const { months } = this.props;\n let isZero = true\n Object.entries(months).map(([name, number]) => {\n\n if (this.getFloat(p_value[name][param]) != 0) {\n isZero = false\n }\n })\n return isZero\n\n }\n\n async fetchDataForRange(year, label, loadUniqueData = true) {\n this.loading += 1\n axios.get('/formulas/borboleta.json', {\n params: {\n scope: \"cash_flow\",\n range: {\n start_at: (new Date(`01/01/${year}`)),\n end_at: (new Date(`12/12/${year}`))\n },\n\t\t is_budget: label == \"budget\" ? true : null\n }\n }).then((report)=>{\n this.loading -= 1\n if (loadUniqueData) {\n this.setState({\n formulasTotal: report.data\n })\n }else{\n this.setState((oldState) => {\n oldState.formulasTotalByYear[year] = {\n ...oldState.formulasTotalByYear[year],\n [label]: report.data\n }\n return { ...oldState }\n })\n }\n })\n \n if(!loadUniqueData && label){\n this.fetchYTD(year, label)\n }\n \n \n }\n\n fetchYTD(year, label){\n axios.get('/formulas/borboleta.json', {\n params: {\n scope: \"cash_flow\",\n range: {\n start_at: (new Date(`01/01/${year}`)),\n end_at: (new Date(`${this.props.month}/12/${year}`))\n },\n\t\t is_budget: label == \"budget\" ? true : null\n }\n }).then((report)=>{\n this.setState((oldState) => {\n oldState.formulasTotalByYearYTD[year] = {\n ...oldState.formulasTotalByYearYTD[year],\n [label]: report.data\n }\n return { ...oldState }\n })\n })\n\n }\n\n handleClose(open) {\n this.setState({ modalIsOpen: false })\n }\n\n openChartModal(month) {\n this.setupChartData();\n let self = this\n setTimeout(() => {\n let chartProps = {\n title: \"caregando...\",\n currentMonth: month,\n chartTitle: this.state.chart_title,\n chart: this.state.chart_formulas,\n titles: this.state.chart_titles,\n comparedLabel: this.state.comparedLabel,\n chartData: this.state.chartData,\n open: true,\n year: this.state.year\n }\n\n axios.post(`/flow_chart_popups.json`, {\n props: chartProps\n }).then(function (result) {\n //check if browser is mobile\n let isMobile = /iPhone|iPad|iPod|Android/i.test(navigator.userAgent);\n if (isMobile) {\n self.setState({ currentMonth: month, modalIsOpen: true })\n } else {\n popupCenter({ url: `/flow_chart_popups/${result.data.popup_id}`, title: 'Gráfico' })\n }\n\n\n });\n }, 100)\n\n\n }\n\n\n log(c, f) {\n debugger\n console.log(\"CURRENT_COMPANY\", c)\n console.log(\"CURRENT_FORMULA\", f)\n return \"-\"\n }\n\n renderFormula(key, value, formulaID) {\n const { report, labels, formulas, year, years, recordsFetched, cost_center_mode, formulasTotal, showZeroLines, formulaOpened, months } = this.state;\n let { indicatorsMap } = this.props\n\n let numberToCurrency = function (number) {\n return parseFloat(number).toLocaleString(\"pt-BR\", {\n style: \"currency\",\n currency: \"BRL\"\n });\n };\n\n let className = `formula-${formulas[key].formula_type} formula-${formulas[key].formula_type}-${formulas[key].layout} format-${formulas[key].number_format} formula-${formulas[key].is_only_index ? \"only-index\" : \"more-than-index\"}`\n let idName = \"principal\"\n if (formulaID) {\n className = \"\"\n idName = \"\"\n }\n\n\n return <>\n\n {!formulaID && formulas[key].formula_type != \"formula\" && Object.entries(value?.[key]?.[\"formulas\"])?.map(([f_key, f_data]) => {\n return this.renderFormula(f_data?.label, report[f_data?.label], true)\n })}\n {!formulaID && ((formulas[key].layout != \"grupo_especial\") || formulaOpened[key]) && {\n (p_value &&\n Object.entries(p_value)\n .map(([k, v]) => k != \"total\" && v[param])\n .reduce(\n (a, b) => parseFloat(a || 0) + parseFloat(b || 0),\n 0\n )\n .toLocaleString(\"pt-BR\", {\n style: \"currency\",\n currency: \"BRL\"\n }))\n }
\n\n {this.state.comments && this.setComments(this.state.year)}\n comments={this.state.comments}\n model_reference={'indicator-line'}\n month={'total'}\n monthName={'total'}\n year={this.state.year}\n model_reference_id={p_key}>\n }\n {\n numberToCurrency(total_indicators)\n }\n
\n {this.state.formulas[key].description}
{this.props.formulas[key]}
\n\n \n }>\n {key}\n \n \n this.changeVisibleMonths(e)} visibleMonths={this.state.visibleMonths} months={this.props.months}> \n\n this.setState({ showZeroLines: !showZeroLines })}>\n {showZeroLines ? \n
\n \n \n * Você está visualizando números no formato n/{this.props.divisor}\n \n popupCenter({ url: `/popups/flow`, title: 'Editar', w: window.innerWidth * 0.8, h: window.innerHeight * 0.8 })}\n style={{\n backgroundColor: '#F5F5F5',\n width: 36,\n height: 36,\n borderRadius: 4,\n display: 'flex',\n justifyContent: 'center',\n alignItems: 'center',\n cursor: 'pointer'\n }}>\n \n
\n FLUXO DE CAIXA
\n \n
\n \n \n \n
\n
\n | Nome | \n {modalIsOpen && this.openChartModal(name)}>\n {monthDict[`${month}`.padStart(2, \"0\")]}/{year} | \n ))}\n\n this.openChartModal(\"total\")}>\n Acumulado | \n
|---|---|---|
| this.fetchDetail(p_key)}>\n {\n this.paramLabel(labels[p_key], param)\n }\n | \n {Object.entries(months).map(([name, number]) => {\n return (\n\n {this.state.comments && | \n );\n })}\n \n {this.state.comments && {\n (p_value &&\n Object.entries(p_value)\n .map(([k, v]) => k != \"total\" && v[param])\n .reduce(\n (a, b) => parseFloat(a || 0) + parseFloat(b || 0),\n 0\n )\n .toLocaleString(\"pt-BR\", {\n style: \"currency\",\n currency: \"BRL\"\n }))\n } \n | \n
| \n \n {p_key}\n | \n {Object.entries(months).map(([name, number]) => {\n\n total_indicators += p_value?.[name] ? parseFloat(p_value?.[name]) : 0\n return (\n\n {this.state.comments && | \n );\n })}\n \n {this.state.comments && {\n numberToCurrency(total_indicators)\n } \n | \n
| \n {this.state.formulas[key].description} {this.props.formulas[key]} \n\n \n }>\n {key}\n \n | \n {Object.entries(months).map(([name, number]) => {\n\n return (\n \n {\n formulas[key].number_format == \"percentage\" ?\n (value[key][\"result\"][name] &&\n this.percentFormat(this.tryEval(value[key][\"result\"][name]))\n )\n :\n (value[key][\"result\"][name] &&\n numberToCurrency(\n this.tryEval(value[key][\"result\"][name])\n )\n )\n }\n {this.state.comments && | \n );\n })}\n\n \n\n {!formulasTotal[formulas[key].fr_id] && \"carregando...\"}\n {formulasTotal[formulas[key].fr_id] &&\n | \n
| \n {Object.entries(months).map(() => | )}\n | \n |
\n \n\t \n \n \n \n \n \n \n \n
\n );\n}\n\n\n\n","import React, {useEffect, useRef} from 'react'\nimport Button from '@material-ui/core/Button';\nimport Dialog from '@material-ui/core/Dialog';\nimport { makeStyles } from '@material-ui/core/styles';\nimport DialogActions from '@material-ui/core/DialogActions';\nimport DialogContent from '@material-ui/core/DialogContent';\nimport DialogContentText from '@material-ui/core/DialogContentText';\nimport DialogTitle from '@material-ui/core/DialogTitle';\nimport Highcharts from 'highcharts'\nimport HighchartsExporting from 'highcharts/modules/exporting'\nimport HighchartsReact from 'highcharts-react-official'\nimport Grid from '@material-ui/core/Grid';\nimport Divider from '@material-ui/core/Divider';\nimport BarChartIcon from '@material-ui/icons/BarChart';\nimport TimeLineIcon from '@material-ui/icons/Timeline';\nimport TableChart from '@material-ui/icons/TableChartTwoTone';\nimport chartIco from 'graph-svg.svg';\nimport greyIco from 'icon_finallinhacinza.svg';\nimport { findKey } from 'core-js/core/dict';\n\n\nif (typeof Highcharts === 'object') {\n HighchartsExporting(Highcharts)\n}\nHighcharts.setOptions({\n colors: [\"#65BCFF\", \"#F7999C\", \"#4AB796\", \"#F4CF98\", \"#37BAC0\", \"#6C899E\"]\n});\nvar formatter = new Intl.NumberFormat(\"pt-BR\", {\n style: \"currency\",\n currency: \"BRL\"\n});\n\nconst useStyles = makeStyles((theme) => ({\n root: {\n width: 'fit-content',\n border: `1px solid ${theme.palette.divider}`,\n borderRadius: theme.shape.borderRadius,\n backgroundColor: theme.palette.background.paper,\n color: theme.palette.text.secondary,\n '& svg': {\n margin: theme.spacing(1.5),\n },\n '& hr': {\n margin: theme.spacing(0, 0.5),\n },\n },\n}));\n\nconst numberToCurrency = function(number) {\n return parseFloat(number).toLocaleString(\"pt-BR\", {\n style: \"currency\",\n currency: \"BRL\"\n });\n};\n\n\n\nexport default function ResultChart(props) {\n const [open, setOpen] = React.useState(false);\n const [chartStyle, setChartStyle] = React.useState(props.chartStyle || \"line\");\n const [lineResults, setLineResults] = React.useState({});\n const [fetched, setFetched] = React.useState({});\n const [costCentersFetchedByYear, setCostCentersFetchedByYear] = React.useState({});\n const [chartVisible, setChartVisible] = React.useState(true)\n const [alreadySetup, setAlreadySetup] = React.useState(false)\n const [isFetchingCostCenter, setIsFetchingCostCenter] = React.useState(false);\n const chartComponentRef = useRef(null);\n\n const classes = useStyles();\n let monthsArray = ['Jan', 'Fev', 'Mar', 'Abr', 'Mai', \"Jun\", \"Jul\", \"Ago\", 'Set', 'Out', 'Nov', 'Dez']\n let options = {}\n\n \n\n const formatYear = (year)=>{\n if(props.dataKey == \"result_dashboard\"){\n //switch case year\n switch(year){\n case \"budget\":\n return \"Orçamento \" + props.year\n case \"current_year\":\n return props.year\n case \"last_year\":\n return props.year - 1\n //end switch case year\n\n default: return year\n }\n }else{\n return year\n }\n }\n \n const fetchAreaData = async (key, fixed, type_id, type_label, year)=>{\n const {cost_center_heads, is_budget} = props;\n let fixed_label = Boolean(fixed) ? \"fixed\" : \"not_fixed\"\n if (isFetchingCostCenter) {\n return false\n }else{\n setIsFetchingCostCenter(true)\n }\n \n if(newCostCentersFetchedByYear?.[year]?.[type_label]?.[key]){\n return false\n }\n let details = await axios.get(`/results/${key}/cost_center_detail.json`, {params: {\n year: year,\n fixed: Boolean(fixed),\n type: type_id,\n is_budget,\n }})\n \n let newCostCentersFetchedByYear = costCentersFetchedByYear\n\n \n newCostCentersFetchedByYear[year] ||= {}\n newCostCentersFetchedByYear[year][type_label] ||= {}\n newCostCentersFetchedByYear[year][type_label][key] ||= {}\n \n newCostCentersFetchedByYear[year][type_label][key][Object.keys(details.data)[0]] = Object.values(details.data)[0]\n setCostCentersFetchedByYear({...costCentersFetchedByYear, ...newCostCentersFetchedByYear})\n setIsFetchingCostCenter(false)\n \n \n }\n const fetchParamLines=(year)=>{\n setFetched({...fetched, [year]: true})\n // if(fetched[year]){\n // return false\n // }\n setChartVisible(false)\n \n axios.get(`/results/${props.p_key}/detail.json`, {params: {\n year: year,\n cost_center_mode: false,\n is_budget: false\n }}).then((result)=>{\n setLineResults({...lineResults, [year]: result.data})\n setTimeout(() =>{\n setChartVisible(true)\n }, 10) \n })\n }\n useEffect(()=>{\n try{\n setTimeout(\n ()=>{\n // props.setSVG(chartComponentRef.current.chart.getSVG())\n },\n 2000\n )\n \n }catch(e){\n console.log(e)\n }\n })\n\n React.useEffect(() => {\n if ([\"param-lines\", \"param-head\"].includes(props.dataKey)) {\n if(!alreadySetup){\n fetchParamLines(props.year)\n setAlreadySetup(true)\n }\n }\n if((props.dataKey == \"cost_center_type\") ||( props.dataKey == \"cost_center_type_line\")){\n let {area_id,\n is_fixed,\n despesa_type_id,\n year,\n label} = props;\n if(!alreadySetup){\n \n fetchAreaData(area_id, is_fixed, despesa_type_id, label, year)\n setAlreadySetup(true)\n }\n \n \n }\n \n \n });\n const getNumerFormatted = (value, format)=>{\n \n let result = value\n if(format == \"percentage\"){\n result = `${parseFloat(value).toFixed(2)}%`\n }\n if(format == \"integer\"){\n result = new Intl.NumberFormat('decimal', {minimumFractionDigits: 2}).format(parseFloat(value))\n }\n if(!format || format == \"money\"){\n result = numberToCurrency(value) \n }\n \n return result\n }\n\n let getChartStyle = () =>{\n let response = chartStyle == \"table\" ? \"column\" : chartStyle \n \n \n return response\n }\n\n let loadedData = (year, formula=null)=>{\n \n let {area_id, is_fixed, months} = props;\n \n if (props.dataKey== \"area_header\") {\n\n let result = Object.values(months).map((month)=>{\n return parseFloat(props.allYearsData?.[year]?.costCenterGroupedByMonth?.[is_fixed ? \"fixed\" : \"not_fixed\"]?.[`[${area_id}, ${month}]`]) * -1\n })\n\n return result\n }\n if(props.dataKey == \"cost_center_type\"){\n let fixed_label = props.is_fixed ? \"fixed\" : \"not_fixed\"\n let cc_by_code = {}\n try{\n cc_by_code = Object.values(costCentersFetchedByYear[year][props.label][props.area_id][fixed_label])\n }catch(e){\n\n }\n \n let allMonths = {}\n Object.entries(monthDict).map(([month, value])=> {\n Object.values(cc_by_code).map((entry)=>{\n Object.entries(entry.months).map(([entryMonth, amountValue])=>{\n if(value == entryMonth){\n allMonths[month] ||= 0\n allMonths[month] += amountValue * -1\n }\n })\n })\n })\n return dataForFormula(allMonths)\n }\n if(props.dataKey == \"cost_center_type_line\"){\n let fixed_label = props.is_fixed ? \"fixed\" : \"not_fixed\"\n let cc_by_code = {}\n \n try{\n cc_by_code = Object.entries(costCentersFetchedByYear[year][props.label][props.area_id][fixed_label])\n \n }catch(e){\n \n }\n \n \n let allMonths = {}\n Object.entries(monthDict).map(([month, value])=> {\n Object.values(cc_by_code).map(([code, entry])=>{\n \n Object.entries(entry.months).map(([entryMonth, amountValue])=>{\n if(value == entryMonth && code == props.cc_key){\n allMonths[month] ||= 0\n allMonths[month] += amountValue * -1\n }\n })\n })\n })\n return dataForFormula(allMonths)\n }\n\n if(props.dataKey == \"indicators\"){\n return data(dataForFormula(props.allYearsData?.[year]?.report?.[props.formula_id]?.[props.formula_id]?.[props.dataKey]?.[props.p_key])) \n }\n\n if(props.dataKey == \"balance-params\"){\n return dataForFormula(props?.allYearsData?.[year]?.params?.[props.parameter_id] || {})\n }\n if(props.dataKey == \"balance-detail-line\"){\n \n let lineValues = Object.values(props?.allYearsData?.[year] || {}).reduce((a, b)=> {return {...a, ...b}}, {})?.[props.line.id]\n \n return dataForFormula(lineValues?.months || {})\n }\n\n if (props.dataKey == \"params\") {\n let param = props.allYearsData?.[year]?.report?.[props.formula_id]?.[props.formula_id]?.[\"lines\"]?.[props.p_key]?.[0]\n \n let paramsData = props.allYearsData?.[year]?.report?.[props.formula_id]?.[props.formula_id]?.[props.dataKey]?.[props.p_key]\n let mappedParamsDataHash = {}\n \n Object.entries(paramsData || {}).map(([key, value])=> {\n // mappedParamsDataHash[key]= value?.[param] || (typeof(value) == \"object\" ? 0 : value)\n mappedParamsDataHash[key]= value?.[param] || (typeof(value) == \"object\" ? 0 : value)\n })\n \n return dataForFormula(mappedParamsDataHash)\n }\n if(props.dataKey == \"attachment_params\"){\n let allYearsHash = props.allYearsData?.[props.first_level_key]?.[year]\n let mappedParamsDataHash = {}\n Object.entries(allYearsHash?.[props.title]?.sum_of_lines || {}).map(([key, value])=>{\n mappedParamsDataHash[key] = value * -1\n })\n return dataForFormula(mappedParamsDataHash || {}, year)\n \n }\n \n if (props.dataKey == \"param-lines\") {\n let getParam = (node, key=props.line_key)=>{\n if(node?.lines?.[key]){\n return node?.lines?.[key]?.months\n }else{\n let result = Object.values(node.childreen).map((child)=>{\n return getParam(child, key)\n })\n try{\n return result.filter((x)=> Object.keys(x || {}).length > 0)[0]\n }catch(e){\n console.log(\"ERRO NO PARAM-LINES\", e)\n }\n \n }\n }\n \n if (Object.values(Object.values(lineResults?.[year] || {})?.[0]?.childreen || {} ).length > 0){\n let allMonths = getParam(Object.values(lineResults?.[year])[0])\n \n let invertedMonths = {}\n Object.entries(allMonths || {}).map(([month, value])=> {\n let f_value = parseFloat(value) || 0\n invertedMonths[month] = f_value * -1\n })\n \n return dataForFormula(invertedMonths)\n }else{\n \n return dataForFormula(Object.values(lineResults?.[year] || {})?.[0]?.lines?.[props.line_key]?.months || {}, year, true)\n }\n \n \n \n }\n\n if (props.dataKey == \"param-head\") {\n let findInChildreen = (param)=>{\n \n }\n try{\n if (Object.values(Object.values(lineResults?.[year])[0].childreen).length > 0){\n \n let extractLines = (node, param)=>{\n let response = \"morudanga\"\n if(node.childreen[param]){\n response = node.childreen[param].sum_of_lines\n }else{\n response = Object.values(node.childreen).map((child)=>{\n return extractLines(child, param)\n }).filter((x)=>x)[0]\n }\n \n return response\n }\n \n return dataForFormula(extractLines(Object.values(Object.values(lineResults?.[year]))[0], props.title))\n }else{\n \n return dataForFormula(Object.values(lineResults?.[year])?.[0]?.lines?.[props.line_key]?.months)\n }\n \n }catch(e){\n \n }\n dataForFormula([])\n \n }\n\n if(props.dataKey == \"result\"){\n if(props.formulaArray){\n return data(dataForFormula(props.allYearsData?.[year]?.report?.[formula?.label]?.[formula?.label]?.[props.dataKey], year)) \n }else{\n return data(dataForFormula(props.allYearsData?.[year]?.report?.[props.formula_id]?.[props.formula_id]?.[props.dataKey], year)) \n }\n \n } \n\n if(props.dataKey == \"line_graph\"){\n if(props.formulaArray){\n return data(dataForFormula(props.allYearsData?.[year]?.report?.[formula?.label]?.[formula?.label]?.[\"result\"], year)) \n }else{\n return data(dataForFormula(props.allYearsData?.[year]?.report?.[props.formula_id]?.[props.formula_id]?.[\"result\"], year)) \n }\n \n }\n\n\n if(props.dataKey == \"result_dashboard\"){\n return data(dataForDashboardFormula(props.allYearsData, year)) // na verdade year não é year, mas a label do dashboard\n }\n if(props.dataKey == \"result-segmentado\"){\n let returnArray = Object.entries(props.allYearsData[year]).map(([month, data])=> tryEval(data[props.formula_id]))\n returnArray.splice(-1,1)\n return data(returnArray)\n // return data(dataForFormula(props.allYearsData?.[year]?.report?.[props.formula_id]?.[props.formula_id]?.[props.dataKey], year)) \n } \n \n if(props.dataKey == \"indicators-segmentado\"){\n //companyData?.[company_id]?.['report']?.[key]?.[key]?.[\"params\"]?.[p_key]?.[monthName]?.[param]\n let array = []\n let monthsData = Object.values(props.allYearsData[year]).map((x)=> x.report?.[props.formula_key]?.[props.formula_key]?.[\"indicators\"]?.[props.param_key] || {})\n \n Object.entries(props.months).map(([month_name, month_number])=>{\n array[month_number - 1] ||= 0\n \n monthsData.map((companyData)=>{\n array[month_number - 1] ||= 0\n \n if(companyData?.[month_name]){\n array[month_number - 1] += (parseFloat(companyData?.[month_name]) * - 1)\n }else{\n array[month_number - 1] += 0\n }\n })\n })\n \n return array\n // return data(dataForFormula(props.allYearsData?.[year]?.report?.[props.formula_id]?.[props.formula_id]?.[props.dataKey], year)) \n } \n\n if(props.dataKey == \"line-segmentado\"){\n //companyData?.[company_id]?.['report']?.[key]?.[key]?.[\"params\"]?.[p_key]?.[monthName]?.[param]\n \n let array = []\n let monthsData = Object.values(props.allYearsData[year]).map((x)=> x.report?.[props.formula_key]?.[props.formula_key]?.[\"params\"]?.[props.param_key] || {})\n \n Object.entries(props.months).map(([month_name, month_number])=>{\n array[month_number - 1] ||= 0\n \n monthsData.map((companyData)=>{\n array[month_number - 1] ||= 0\n \n if(companyData?.[month_name]?.[props.param]){\n array[month_number - 1] += companyData?.[month_name]?.[props.param]\n }else{\n array[month_number - 1] += 0\n }\n })\n })\n\n \n \n return array\n // return data(dataForFormula(props.allYearsData?.[year]?.report?.[props.formula_id]?.[props.formula_id]?.[props.dataKey], year)) \n } \n\n if(props.dataKey == \"cost-center-area-segmentado\"){\n \n let areaByMonth = (monthName)=>{\n let {fixed, despesa_id} = props;\n try{\n let value = Object.values(props.allYearsData[year]).map((company)=> company?.costCenterGroupedByMonth[fixed ? \"fixed\" : \"not_fixed\"][`[${despesa_id}, ${monthDict[monthName]}]`]).filter((x)=> x).reduce((a,b)=> a + b, 0)\n return value\n }catch(e){\n return 0\n }\n }\n let array = []\n Object.entries(props.months).map(([month_name, month_number])=>{\n array.push(areaByMonth(month_name) * -1)\n })\n return array\n }\n }\n const getCategories = () =>{\n const {rangeMonths} = props\n if(rangeMonths){\n let monthLabels = []\n Object.entries(rangeMonths).map(([year_month, name]) => {\n let [iYear, number] = year_month.split(\",\")\n monthLabels.push(`${name.substring(0,3)}/${iYear}`)\n })\n return monthLabels\n }else{\n return monthsArray\n }\n }\n\n if(props.allYearsData){\n const getSeries = ()=>{\n if(props.onlyLineData){\n const {startYear, endYear} = props;\n let maxNum = Object.keys(props.rangeMonths).length\n let intervalData = range(startYear, endYear).map((year)=> loadedData(year)).reduce((a,b)=> [...a, ...b], [])\n \n // delete intervalData bigger than maxNum\n intervalData.splice(maxNum, intervalData.length - maxNum)\n return [{\n name: \"Intervalo\",\n data: intervalData,\n type: getChartStyle(),\n dataLabels: {\n enabled: true,\n formatter: function () {\n return getNumerFormatted(this.y, props.numberFormat)\n },\n style: {\n fontWeight: 'bold'\n }\n }\n }]\n }else if((props.dataKey == \"cost_center_type\") ||( props.dataKey == \"cost_center_type_line\")){\n \n return Object.keys(costCentersFetchedByYear).map((year)=>{\n return {\n type: getChartStyle(),\n name: year,\n data: loadedData(year),\n showInLegend: true,\n states: {\n borderColor: '#ff0000',\n hover: {\n enabled: false\n }\n },\n dataLabels: {\n enabled: true,\n formatter: function () {\n return getNumerFormatted(this.y, props.numberFormat)\n },\n style: {\n fontWeight: 'bold'\n }\n }\n }\n })\n }else if(props.formulaArray){\n \n\n let dataToLoad = props.formulaArray.map((formula, index)=>{\n let {id, type} = formula\n if(type == \"formula\"){\n return {\n type: formula.format,\n name: formula?.label && formula?.year ? `${formula?.label}-${formula.year}` : \"\" ,\n data: loadedData(formula.year, formula),\n yAxis: formula.number_format == \"money\" ? 0 : 1,\n showInLegend: true,\n states: {\n borderColor: '#ff0000',\n hover: {\n enabled: false\n }\n },\n dataLabels: {\n enabled: true,\n formatter: function () {\n return getNumerFormatted(this.y, formula.number_format)\n },\n style: {\n fontWeight: 'bold'\n }\n }\n }\n }\n if(type == \"parameter\"){\n let data = dataForFormula(props?.allYearsDataForParameters?.[formula.year]?.params?.[id] || {})\n \n return {\n type: formula.format,\n name: formula?.label && formula?.year ? `${formula?.label}-${formula.year}` : \"\" ,\n data: data,\n yAxis: 0,\n showInLegend: true,\n states: {\n borderColor: '#ff0000',\n hover: {\n enabled: false\n }\n },\n dataLabels: {\n enabled: true,\n formatter: function(){\n return getNumerFormatted(this.y, \"money\")\n },\n style: {\n fontWeight: 'bold'\n }\n }\n }\n }\n \n })\n \n return dataToLoad\n }\n \n else{\n let dataToLoad = Object.entries(props.allYearsData).map(([year, x])=>{\n return {\n type: getChartStyle(),\n name: formatYear(year),\n data: loadedData(year),\n showInLegend: true,\n states: {\n borderColor: '#ff0000',\n hover: {\n enabled: false\n }\n },\n dataLabels: {\n enabled: true,\n formatter: function () {\n return getNumerFormatted(this.y, props.numberFormat)\n },\n style: {\n fontWeight: 'bold'\n }\n }\n }\n })\n \n return dataToLoad\n }\n }\n \n \n options = {\n exporting: {\n enabled: !props.withoutExporting\n },\n title: {\n text: props.title\n },\n yAxis: [{\n title: {\n text: 'Eixo primário'\n }\n }, {\n title: {\n text: 'Eixo secundário'\n },\n opposite: true\n }],\n\n xAxis: {\n categories: getCategories()\n },\n series: getSeries()\n }\n \n }else{\n options = {\n title: {\n text: props.title\n },\n xAxis: {\n categories: getCategories()\n },\n series: [{\n type: getChartStyle(),\n data: data()\n }]\n }\n }\n function tryEval(str) {\n try {\n let formulaSolved = eval(str)\n return formulaSolved ? formulaSolved : 0;\n } catch (e) {\n return 0\n }\n }\n\n function dataForDashboardFormula(result, label){\n // budget, current_year, last_year\n const { months} = props;\n let data = []\n let i = 1\n \n Object.entries(months).map(([name, number]) => {\n if(i < 13){\n data.push(tryEval(result?.[label]?.[name])) \n }\n i += 1\n })\n \n \n return data\n }\n\n function dataForFormula(result, year=null, inverse=false){\n const { months, rangeMonths, onlyLineData} = props;\n let data = []\n let i = 1\n \n if(year && onlyLineData){\n Object.entries(rangeMonths).map(([year_month, name]) => {\n let [iYear, number] = year_month.split(\",\")\n \n if(iYear == year){\n data.push(tryEval(result?.[name]) * (inverse ? -1 : 1)) \n }\n \n })\n }else{\n Object.entries(months).map(([name, number]) => {\n if(i < 13){\n data.push(tryEval(result?.[name]) * (inverse ? -1 : 1)) \n }\n i += 1\n })\n }\n \n return data\n }\n \n\n function data(desordenedMonthData=props.data){\n \n let getNumber=(value)=>{\n \n if(props.inversedSignal){\n return parseFloat(value) * -1\n }else{\n return parseFloat(value)\n }\n }\n \n let result = []\n let {title, is_fixed, months, costCenterRecordsGrouped} = props;\n if(props.areas){\n result = Object.values(months).map((month)=>{\n return getNumber(costCenterRecordsGrouped[`[\"${title}\", ${is_fixed}, ${month}]`])\n })\n \n }else if(props.param){\n result = desordenedMonthData.map((entry)=>{ \n try{\n return getNumber(entry[props.param])\n }catch(e){\n return 0\n }\n \n })\n }else{\n try{\n result = desordenedMonthData?.map((x)=> getNumber(x))\n }catch(e){\n console.log(\"erro data\", e)\n }\n \n }\n return result\n }\n\n function handleClickOpen() {\n setOpen(true);\n \n if(props.loadYear && props.dataKey != \"balance-params\"){\n props.loadYear(props.year)\n }\n \n }\n\n function handleClose() {\n setOpen(false);\n }\n\n function toNumber(number=0){\n \n return parseFloat(number || 0)\n \n\n }\n\n function tryEval(str) {\n try {\n let formulaSolved = parseFloat(eval(str))\n return formulaSolved ? formulaSolved : 0;\n } catch (e) {\n return 0\n }\n }\n const getColorForButton = (year)=>{\n if((props.dataKey == \"cost_center_type\") ||( props.dataKey == \"cost_center_type_line\")){\n return costCentersFetchedByYear[year] ? 'rgb(113,172,233)' : 'rgba(0, 0, 0, 0.54)'\n }else if(props.dataKey == \"param-lines\"){\n return (props?.allYearsData?.[year] && lineResults[year]) ? 'rgb(113,172,233)' : 'rgba(0, 0, 0, 0.54)'\n }else{\n return props?.allYearsData?.[year] ? 'rgb(113,172,233)' : 'rgba(0, 0, 0, 0.54)'\n }\n }\n const loadYear = (year)=>{\n if ([\"param-lines\", \"param-head\"].includes(props.dataKey)) {\n fetchParamLines(year)\n props.loadYear(year)\n }else if((props.dataKey == \"cost_center_type\") ||( props.dataKey == \"cost_center_type_line\")){\n let {area_id,\n is_fixed,\n despesa_type_id,\n label} = props;\n fetchAreaData(area_id, is_fixed, despesa_type_id, label, year)\n\n }else{\n props.loadYear(year)\n }\n \n }\n\n const loadAllYears = ()=>{\n if((props.dataKey == \"cost_center_type\") ||( props.dataKey == \"cost_center_type_line\") || (props.dataKey == \"param-lines\")){\n props.years.map((year)=>{\n loadYear(year)\n })\n }else{\n props.loadAllYears()\n }\n }\n\n const renderHighChart = ()=>{\n try{\n let chartOptions = {\n ...options,\n chart: {...options.chart, height: props.height || 400},\n exporting: { enabled: !props.printing }\n };\n\n return \n\t \t \n\t
\n \n \n \n {/* setChartStyle(\"pie\")} />*/}\n \n \n {props?.years?.map((year)=>{\n return \n \n })}\n \n \n
\n {open && props.loadYear(year)}\n style={{\n height: 24 + 10.5,\n width: 24 + 10.5,\n display: 'flex',\n alignItems: 'center',\n justifyContent: 'center',\n cursor: 'pointer',\n color: props?.allYearsData?.[year] ? 'rgb(113,172,233)' : 'rgba(0, 0, 0, 0.54)'\n }}>{year}
\n {JSON.stringify(options)}
\n }catch(e){\n return ERROOO
\n }\n }\n \n const getTotal = (year) =>{\n return tryEval(props.allYearsData?.[year]?.[\"total\"] || props.allYearsData?.[year]?.[\"range\"])\n }\n if(props.withoutModal){\n \n return (\n \n \n {renderHighChart()}\n
\n )\n }else{\n return (\n \n \n \n \n \n \n \n \n :\n chartVisible ? : }\n \n \n \n \n \n
\n );\n }\n}\n\n\n\nconst range = (min, max) => [...Array(max - min + 1).keys()].map(i => i + min);\nconst monthDict = {\n \"janeiro\": 1,\n \"fevereiro\": 2,\n \"março\": 3,\n \"abril\": 4,\n \"maio\": 5,\n \"junho\": 6,\n \"julho\": 7,\n \"agosto\": 8,\n \"setembro\": 9,\n \"outubro\": 10,\n \"novembro\": 11,\n \"dezembro\": 12,\n \"total\": 13\n}","\"use strict\";\n\nvar _interopRequireDefault = require(\"@babel/runtime/helpers/interopRequireDefault\");\nvar _interopRequireWildcard = require(\"@babel/runtime/helpers/interopRequireWildcard\");\nObject.defineProperty(exports, \"__esModule\", {\n value: true\n});\nexports.default = void 0;\nvar React = _interopRequireWildcard(require(\"react\"));\nvar _createSvgIcon = _interopRequireDefault(require(\"./utils/createSvgIcon\"));\nvar _default = (0, _createSvgIcon.default)( /*#__PURE__*/React.createElement(\"path\", {\n d: \"M23 8c0 1.1-.9 2-2 2-.18 0-.35-.02-.51-.07l-3.56 3.55c.05.16.07.34.07.52 0 1.1-.9 2-2 2s-2-.9-2-2c0-.18.02-.36.07-.52l-2.55-2.55c-.16.05-.34.07-.52.07s-.36-.02-.52-.07l-4.55 4.56c.05.16.07.33.07.51 0 1.1-.9 2-2 2s-2-.9-2-2 .9-2 2-2c.18 0 .35.02.51.07l4.56-4.55C8.02 9.36 8 9.18 8 9c0-1.1.9-2 2-2s2 .9 2 2c0 .18-.02.36-.07.52l2.55 2.55c.16-.05.34-.07.52-.07s.36.02.52.07l3.55-3.56C19.02 8.35 19 8.18 19 8c0-1.1.9-2 2-2s2 .9 2 2z\"\n}), 'Timeline');\nexports.default = _default;","var weakMemoize = function weakMemoize(func) {\n // $FlowFixMe flow doesn't include all non-primitive types as allowed for weakmaps\n var cache = new WeakMap();\n return function (arg) {\n if (cache.has(arg)) {\n // $FlowFixMe\n return cache.get(arg);\n }\n var ret = func(arg);\n cache.set(arg, ret);\n return ret;\n };\n};\nexport { weakMemoize as default };","import toInteger from \"../_lib/toInteger/index.js\";\nimport toDate from \"../toDate/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name addDays\n * @category Day Helpers\n * @summary Add the specified number of days to the given date.\n *\n * @description\n * Add the specified number of days to the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} amount - the amount of days to be added. Positive decimals will be rounded using `Math.floor`, decimals less than zero will be rounded using `Math.ceil`.\n * @returns {Date} - the new date with the days added\n * @throws {TypeError} - 2 arguments required\n *\n * @example\n * // Add 10 days to 1 September 2014:\n * const result = addDays(new Date(2014, 8, 1), 10)\n * //=> Thu Sep 11 2014 00:00:00\n */\nexport default function addDays(dirtyDate, dirtyAmount) {\n requiredArgs(2, arguments);\n var date = toDate(dirtyDate);\n var amount = toInteger(dirtyAmount);\n if (isNaN(amount)) {\n return new Date(NaN);\n }\n if (!amount) {\n // If 0 days, no-op to avoid changing times in the hour before end of DST\n return date;\n }\n date.setDate(date.getDate() + amount);\n return date;\n}","import toInteger from \"../_lib/toInteger/index.js\";\nimport toDate from \"../toDate/index.js\";\nimport requiredArgs from \"../_lib/requiredArgs/index.js\";\n/**\n * @name addMonths\n * @category Month Helpers\n * @summary Add the specified number of months to the given date.\n *\n * @description\n * Add the specified number of months to the given date.\n *\n * @param {Date|Number} date - the date to be changed\n * @param {Number} amount - the amount of months to be added. Positive decimals will be rounded using `Math.floor`, decimals less than zero will be rounded using `Math.ceil`.\n * @returns {Date} the new date with the months added\n * @throws {TypeError} 2 arguments required\n *\n * @example\n * // Add 5 months to 1 September 2014:\n * const result = addMonths(new Date(2014, 8, 1), 5)\n * //=> Sun Feb 01 2015 00:00:00\n */\nexport default function addMonths(dirtyDate, dirtyAmount) {\n requiredArgs(2, arguments);\n var date = toDate(dirtyDate);\n var amount = toInteger(dirtyAmount);\n if (isNaN(amount)) {\n return new Date(NaN);\n }\n if (!amount) {\n // If 0 months, no-op to avoid changing times in the hour before end of DST\n return date;\n }\n var dayOfMonth = date.getDate();\n\n // The JS Date object supports date math by accepting out-of-bounds values for\n // month, day, etc. For example, new Date(2020, 0, 0) returns 31 Dec 2019 and\n // new Date(2020, 13, 1) returns 1 Feb 2021. This is *almost* the behavior we\n // want except that dates will wrap around the end of a month, meaning that\n // new Date(2020, 13, 31) will return 3 Mar 2021 not 28 Feb 2021 as desired. So\n // we'll default to the end of the desired month by adding 1 to the desired\n // month and using a date of 0 to back up one day to the end of the desired\n // month.\n var endOfDesiredMonth = new Date(date.getTime());\n endOfDesiredMonth.setMonth(date.getMonth() + amount + 1, 0);\n var daysInMonth = endOfDesiredMonth.getDate();\n if (dayOfMonth >= daysInMonth) {\n // If we're already at the end of the month, then this is the correct date\n // and we're done.\n return endOfDesiredMonth;\n } else {\n // Otherwise, we now know that setting the original day-of-month value won't\n // cause an overflow, so set the desired day-of-month. Note that we can't\n // just set the date of `endOfDesiredMonth` because that object may have had\n // its time changed in the unusual case where where a DST transition was on\n // the last day of the month and its local time was in the hour skipped or\n // repeated next to a DST transition. So we use `date` instead which is\n // guaranteed to still have the original time.\n date.setFullYear(endOfDesiredMonth.getFullYear(), endOfDesiredMonth.getMonth(), dayOfMonth);\n return date;\n }\n}","require('../../modules/es6.object.assign');\nmodule.exports = require('../../modules/_core').Object.assign;\n","import * as React from 'react';\nimport Dialog from '@material-ui/core/Dialog';\nimport Button from '@material-ui/core/Button';\nimport DialogActions from '@material-ui/core/DialogActions';\nimport DialogContent from '@material-ui/core/DialogContent';\nimport DialogContentText from '@material-ui/core/DialogContentText';\nimport DialogTitle from '@material-ui/core/DialogTitle';\nimport TextField from '@material-ui/core/TextField';\nimport InputLabel from '@material-ui/core/InputLabel';\nimport OutlinedInput from '@material-ui/core/OutlinedInput';\nimport styled from \"styled-components\";\nimport FormGroup from '@material-ui/core/FormGroup';\nimport FormControlLabel from '@material-ui/core/FormControlLabel';\nimport Checkbox from '@material-ui/core/Checkbox';\nimport BrlCurrencyComponent from '../utils/BrlCurrencyComponent';\n\nexport default function BudgetRowReplaceModal(props) {\n const [open, setOpen] = React.useState(false);\n const [modifiedValue, setModifiedValue] = React.useState(props.currentAmount);\n\n const handleClickOpen = () => {\n setOpen(true);\n };\n\n const handleClose = () => {\n props.onConfirm(modifiedValue)\n setOpen(false);\n };\n\n return (\n \n {/**/}\n \n
\n \n \n \n setChartStyle(\"column\")} />\n setChartStyle(\"line\")} />\n {!props.attachment && \n setChartStyle(\"table\")} />\n }\n \n \n {!props.onlyLineData && \n {props.dataKey != \"result_dashboard\" && props?.years?.map((year)=>{\n return \n \n })}\n {props.loadAllYears && props.dataKey != \"result_dashboard\" && }\n
\n {open && \n chartStyle == \"table\" ?\n loadYear(year)}\n style={{\n height: 24 + 10.5,\n width: 24 + 10.5,\n display: 'flex',\n alignItems: 'center',\n justifyContent: 'center',\n cursor: 'pointer',\n color: getColorForButton(year)\n }}>{year}
\n loadAllYears()}>carregar todos os anos
}\n {props.title}
\n\n \n
\n
\n | \n {monthsArray.map((month)=>{\n return | {month} | \n })}\n { !props.dataKey.includes(\"balance\") &&Total | }\n|
| {formatYear(year)} | \n {loadedData(year)?.map((monthData)=>{\n return{getNumerFormatted(toNumber(monthData), props.numberFormat)} | \n })}\n {!props.dataKey.includes(\"balance\") && (props.formulasTotalByYear ?\n\n\n {getNumerFormatted(tryEval(props.formulasTotalByYear?.[year]?.[props.formula_fr_id]) * -1, props.numberFormat)}\n | \n : \n{\n props.dataKey == \"result_dashboard\" ?\n getNumerFormatted(getTotal(year), props.numberFormat)\n :\n getNumerFormatted(loadedData(year)?.reduce((a,b)=>{\n return toNumber(a) + toNumber(b)\n }, 0), props.numberFormat)} | \n )}\n \n
{\n console.log(chartComponentRef.current.chart)\n }}> SVG
{renderHighChart()}\n \n {/* \n {`Conta: ${props.account}`}
\n {`Mês: ${props.month}`}\n */}\n \n ALTERAR VALOR Você pode inputar um novo valor ou criar um cálculo utilizando indicadores e premissas que você, de antemão, criou no sistema. (?) \n \n \n \n {/*
\n
*/}\n\n \n \n \n Novo valor({props.month}/{props.year}) \n setModifiedValue(value)} \n label={\"Novo valor\"} \n defaultValue={props.currentAmount}\n />\n \n \n Valor atual({props.month}/{props.year}) \n \n \n \n Compor novo valor (Crie uma fórmula) \n \n \n \n\n \n \n Distribuir Diferença nas contas filhas baseado em: \n \n \n \n \n Criar justificativa \n \n \n \n \n {/* setModifiedValue(e.target.value)} label={\"Novo valor\"} defaultValue={props.currentAmount} /> */}\n \n \n \n Nome \n \n \n {month}/{props.year} \n })}\n \n \n {props.formula.label} \n {Object.keys(monthDict).map((month)=>{\n return {props.tryEval(props.valueForMonth(month))} \n })}\n \n {props.mapping?.map((param)=>{\n return \n {param} \n {Object.values(partialMonthDict).map((month)=>{\n return {props.tryEval(props.currentRows?.[param]?.[month])} \n })}\n \n \n })}\n \n \n \n {/* */}\n \n \n \n
\n );\n}\nconst monthDict = {\n \"janeiro\": \"1\" ,\n \"fevereiro\": \"2\" ,\n \"março\": \"3\" ,\n \"abril\": \"4\" ,\n \"maio\": \"5\" ,\n \"junho\": \"6\" ,\n \"julho\": \"7\" ,\n \"agosto\": \"8\" ,\n \"setembro\": \"9\" ,\n \"outubro\": \"10\", \n \"novembro\": \"11\", \n \"dezembro\": \"12\", \n}\nconst partialMonthDict = {\n \"jan\": \"1\" ,\n \"fev\": \"2\" ,\n \"mar\": \"3\" ,\n \"abr\": \"4\" ,\n \"mai\": \"5\" ,\n \"jun\": \"6\" ,\n \"jul\": \"7\" ,\n \"ago\": \"8\" ,\n \"set\": \"9\" ,\n \"out\": \"10\", \n \"nov\": \"11\", \n \"dez\": \"12\", \n}\n\nexport const GreenText = styled.div`\n font-family: Roboto;\n font-size: 16px;\n font-weight: 500;\n letter-spacing: 0.8px;\n text-align: left;\n color: #31b7bc;\n`\nexport const FlexTop = styled.div`\n display: flex;\n`\nexport const FlexColumn = styled.div`\n padding: 16px;\n flex: 1;\n`\nexport const InputArea = styled.div`\n padding: 8px;\n`\n\nexport const CurrentTable = styled.table`\n background-color: #e5e5e5;\n max-width: 100%;\n display: block;\n overflow-y: hidden;\n overflow-x: scroll;\n`\n\nexport const ParamTr = styled.tr`\n td{\n color: #617e94;\n padding: 8px;\n }\n` \nexport const MonthTr = styled.tr`\n td{\n color: #2a3170;\n padding: 8px 8px 24px;\n font-size: 14px;\n text-transform: capitalize;\n }\n` \n\n\nexport const FormulaTr = styled.tr`\n background-color: #e5e5e5;\n td{\n color: #31b7bc;\n padding: 8px;\n }\n`\n\nconst BorderedTd = styled.td`\n border-right: 1px solid #acacac;\n`\n\nconst TopTd = styled.td`\n color: #2a3170;\n font-size: 14px;\n font-weight: bold;\n padding: 13px 22px !important;\n`","import React, { useEffect, useState, useContext } from \"react\";\nimport styled from \"styled-components\";\nimport { PresentationsContext } from \"../contexts\";\nimport DropdownTreeSelect from 'react-dropdown-tree-select';\nimport { DragDropContext, Droppable, Draggable } from \"react-beautiful-dnd\";\nimport 'react-dropdown-tree-select/dist/styles.css';\nimport \"./style.css\";\n\nconst SCOPE_LABEL={ \"dre\": \"DRE\", \"dre_cc\": \"DRE Gerencial\"}\nconst InputFormulas = (props) => {\n const { state, dispatch } = useContext(PresentationsContext);\n const { defaultFormulas, title, kind, presentationKind } = props;\n\n //local states\n const [formulas, setFormulas] = useState(defaultFormulas || []);\n\n useEffect(() => {\n if (formulas.length > 0) {\n setParameters(formulas);\n }\n }, [formulas]);\n\n const getRandomUUID = () => {\n return (\n Math.random().toString(36).substring(2, 15) +\n Math.random().toString(36).substring(2, 15)\n );\n };\n\n const handleOnDragEnd = (result) => {\n if (!result.destination) return;\n const items = Array.from(formulas);\n const [reorderedItem] = items.splice(result.source.index, 1);\n items.splice(result.destination.index, 0, reorderedItem);\n setFormulas(items);\n };\n\n const changeValueForFormula = (index, value, label) => {\n let newFormulas = [...formulas];\n newFormulas[index].value = value;\n newFormulas[index].label = label;\n setFormulas(newFormulas);\n };\n\n const handleRemoveItem = (key) => {\n if (window.confirm(\"Tem certeza?\")) {\n setFormulas(formulas.filter((item) => item.key !== key));\n }\n };\n\n //dispacth events\n const setParameters = (formulas) => {\n dispatch({\n type: \"SET_PARAMETERS\",\n payload: { ...state.parameters, [\"formulas\"]: formulas },\n });\n };\n\n let options = state?.[kind]\n\n if(kind == \"dashboard_formulas\"){\n options = Object.values(state?.[kind] || {})\n }\n \n\n return (\n <>\n \n \n {props.tryEval(props.currentAmount)}\n
\n \n {`Mês: ${props.month}`}\n
\n
*/}\n
\n {formulas.map((formula, index) => (\n \n {(provided) => (\n \n \n \n {presentationKind != \"formula_table_balance\" && {\n if (e.target.value !== \"\") {\n changeValueForFormula(index, e.target.value);\n }\n }}\n >\n \n {presentationKind == \"formula_table\" && Object.entries(options).map(([scope, formulas]) => {\n return [\"dre\", \"dre_cc\"].includes(scope) && \n })}\n {presentationKind == \"formula_table_balance\" && Object.entries(state.patternParams || {}).map(([head, params]) => {\n return \n })}\n {props.kind == \"dashboard_formulas\" && options.map((option, index) => (\n \n ))}\n \n }\n \n {\n presentationKind == \"formula_table_balance\" && <>\n handleRemoveItem(formula.key)}>\n \n \n \n )}\n \n ))}\n {provided.placeholder}\n
\n )}\n \n \n {\n changeValueForFormula(index, currentNode?.value, currentNode?.label)}\n }\n data={state?.inheritParams|| {}} />\n
\n \n }\n \n \t\t
\n {modalIsOpen && \n \t\t\t
\n \t\t\t\n \t\t\t\t\n \t\t\t
\t\n \t\t\n \t\t\t 0} />\n \n\n
\n\n \n \t\t\t \n \t\t\t \n
\n \n
\n \n \n {!isMobile() && popupCenter({url: '/popups/borboleta',title: 'Editar', w: window.innerWidth * 0.8, h: window.innerHeight * 0.8})} \n style={{backgroundColor: '#F5F5F5', \n width: 36, \n height: 36,\n borderRadius: 4,\n display: 'flex',\n justifyContent: 'center',\n alignItems: 'center'}}>\n \n
}\n VISÃO COMPARATIVA
\n \n * Você está visualizando números no formato n/{this.props.divisor}\n
\n \n\n
\n\t\t\t \n
\n \n
\n \n \n \n
\n
\n MÊS CORRENTE
\n| \n \n \n\n {/* \n | \n \n \n \n\n {budgetDate &&\n \n | \n \n \n \n\n {comparadoDate &&\n \n | \n \n \n | \n\n \n | \n
|---|---|---|---|---|
| \n {this.state.comments && | \n \n {this.state.comments && | \n \n {this.state.comments && | \n {this.orcadoVsAnalisado(formula.fr_id, formula.number_format)} | \n{this.analisadoVsComparado(formula.fr_id, formula.number_format)} | \n\n
\n \n \n {formulas.map((formula) => {\n return (\n
\n
\n \n \n \n
\n
\n\n YTD
\n| \n \n \n \n \n {/* \n | \n \n \n \n \n \n {startDate['budget'] &&\n \n | \n \n \n \n \n \n {startDate['comparado'] &&\n \n | \n \n \n | \n\n \n | \n
|---|---|---|---|---|
| {this.state.rangeReport['analisado'][formula.fr_id] ? this.tryEval(this.state.rangeReport['analisado'][formula.fr_id], formula.number_format) : 0} | \n{this.state.rangeReport['budget'][formula.fr_id] ? this.tryEval(this.state.rangeReport['budget'][formula.fr_id], formula.number_format) : 0} | \n{this.state.rangeReport['comparado'][formula.fr_id] ? this.tryEval(this.state.rangeReport['comparado'][formula.fr_id], formula.number_format) : 0} | \n{this.rangeOrcadoVsAnalisado(formula.fr_id, formula.number_format)} | \n{this.rangeAnalisadoVsComparado(formula.fr_id, formula.number_format)} | \n
\n\t\t {props.dataKey === 'result' ? (\n\t\t\t
\n\t );\n\t}\n\n function renderTableTR(year, isBudget=false){\n let label = isBudget ? `Orçamento ${year}` : formatYear(year)\n let kind = isBudget ? \"budget_total\" : \"analisado_total\"\n return \n\t\t\t
\n\t\t\t
\n\t\t ) : (\n\t\t\t\n\t\t\t
\n\t\t\t
\n\t\t )}\n\t\t\n\n \n\n \n \n \n\t : renderHighcharts()}\n \n \n \n \n \n 0} />\n
\n );\n}\n\n\n","import React from 'react'\n\nexport function ChartIcon(props) {\n return (\n \n )\n}","import React from 'react';\nimport {\n BlockTitle,\n SearchField,\n WhiteBox\n} from \"../styled_components/balance_sheets\";\nimport Fuse from \"fuse.js\";\nimport styles from \"./styles/FormulasLayoutStyles\";\nimport Button from \"@material-ui/core/Button\";\n\nclass CentroDeCustoFormulasSearch extends React.Component {\n constructor(props) {\n super(props);\n this.state = {\n paramsQueryCentroDeCusto: \"\",\n };\n }\n\n handleAddButtonClick = (row) => {\n if (this.props.onAddItem) {\n this.props.onAddItem(row);\n }\n }\n\n renderParams(contas) {\n let filtered = {};\n var combinedData = contas.map(item => ({\n display: item.display || \"\",\n id: item.id\n }));\n\n if (this.state.paramsQueryCentroDeCusto.length < 1) {\n filtered.contas = combinedData;\n } else {\n var options = {\n shouldSort: true,\n threshold: 0.3,\n distance: 1000,\n maxPatternLength: 1500,\n minMatchCharLength: 3,\n keys: [\"display\"]\n };\n var fuse = new Fuse(combinedData, options);\n filtered.contas = fuse.search(this.state.paramsQueryCentroDeCusto);\n }\n\n const htmlRender = filtered.contas.map((item, index) => (\n \n {/**/}\n
\n\n \n \n \n setChartStyle(\"column\")}>\n \n setChartStyle(\"line\")}>\n \n\t\t setChartStyle(\"table\")}>\n\t\t \n \n \n \n {props.years && (\n \n {props.dataKey == \"result\" && props?.years?.map((year) => (\n {\n loadYear(year)\n setLoadedYears({...loadedYears, [year]: true})\n }}>{year} \n ))}\n \n )}\n \n
\n {open && chartStyle == \"table\" ?\n {props.title}
\n\n \n
\n
\n | \n {monthsArray.map((month) => {\n return | {month} | \n })}\nYTD | \nTotal | \n
\n
\n );\n }\n}\n\nexport default CentroDeCustoFormulasSearch;\n","import React, {useRef} from \"react\";\n\nimport { MentionsInput, Mention } from \"react-mentions\";\n\nimport provideExampleValue from \"./provideExampleValue\";\n\nimport defaultStyle from \"./styles/defaultStyle\";\nimport defaultMentionStyle from \"./styles/defaultMentionStyle\";\nimport hashtagMentionStyle from \"./styles/hashtagMentionStyle\";\n\nconst charFormulaMentionInputStyle = {\n ...defaultStyle,\n suggestions: {\n ...defaultStyle.suggestions,\n list: {\n position: 'fixed',\n top: '47%',\n left: '53%',\n transform: 'translate(-50%, -50%)',\n backgroundColor: \"#f5f5f5\",\n border: '1px solid rgba(0,0,0,0.15)',\n fontSize: 14,\n maxHeight: '600px',\n overflowY: 'auto',\n width: '1000px'\n }\n }\n};\n\n\nfunction SingleLine({\n value,\n data,\n hashtagData,\n customData,\n titleData,\n onChange,\n onAdd,\n inputRef,\n onMudado,\n costCenterAreaData\n}) {\n return (\n \n
\n \n ? CONTAS POR CENTRO DE CUSTO E TIPO DE DESPESA (FIXO/VARIÁVEL)\n
\n \n {\n let newValue = e.target.value;\n this.setState({ paramsQueryCentroDeCusto: newValue });\n }}\n />\n
\n \n {contas ? this.renderParams(contas) :
\n Carregando...
}\n \n \n\n {\n\n return
\n );\n}\n\nexport default SingleLine;\n","import React from \"react\"\nimport abinbev from \"abinbev.png\";\nclass CompanySelect extends React.Component {\n state = {}\n\n toggleOppened(){\n this.setState({opened: !this.state.opened})\n }\n\n componentWillMount(){\n const {all_options, currentCompanyId} = this.props;\n this.setState({currentCompany: all_options.filter((opt)=>opt.id == currentCompanyId)[0] || {} })\n }\n\n renderCompany(company, level=0){\n return \n {entry.group} - \n {entry.display}\n
\n }}\n trigger=\"#\"\n data={hashtagData}\n style={{ backgroundColor: \"#2B7DE999\" }}\n appendSpaceOnAdd={true}\n />\n \n this.props.onChange(company.id)}\n className={'company-select-button'}\n style={{\n borderBottom: '1px solid #e5e5e5', \n width: 310,\n backgroundColor: level > 0 ? 'rgb(230,230,230)' : `#f1f1f1`,\n height: 70,\n display: 'flex',\n position: 'relative',\n alignItems: 'center',\n cursor: 'pointer',\n paddingLeft: 16\n \n }}>\n 
\n {company.label}\n
\n {company.childreen.map((child)=> this.renderCompany(child, level + 1))}\n \n {level > 0 ? \" L \" : \"\"} \n
\n \n this.closeSelect()}>\n
\n \n );\n }\n}\n\nexport default CompanySelect\n","import React from 'react';\nimport ReactDOM from 'react-dom';\nimport Button from '@material-ui/core/Button';\nimport Fuse from \"fuse.js\";\nimport styles from \"./styles/FormulasLayoutStyles\";\nimport {\n InterrogationIcon\n} from \"./styles/svgIcons\";\nimport {\n closeButtonStyle,\n modalContentStyle,\n modalDescriptionStyle,\n modalStyle,\n modalTitleStyle,\n overlayStyle\n} from \"./styles/ModalStyles\";\nimport {BlueButton} from \"../styled_components/default\";\n\nclass ContasContabeisSearch extends React.Component {\n constructor(props) {\n super(props);\n this.state = {\n tabActive: \"ativos\",\n paramsQueryContas: \"\",\n anchorEl: null,\n activeRowId: null,\n dropdownVisible: false,\n dropdownTimeout: null,\n selectedRow: null\n };\n this.dropdownContainer = document.createElement('div');\n document.body.appendChild(this.dropdownContainer);\n }\n\n componentWillUnmount() {\n document.body.removeChild(this.dropdownContainer);\n if (this.state.dropdownTimeout) {\n clearTimeout(this.state.dropdownTimeout);\n }\n }\n\n handleAddButtonClick = (row) => {\n if (this.props.onAddItem) {\n this.props.onAddItem(row);\n }\n }\n\n showDropdown = (rowId, event) => {\n this.setState({ dropdownVisible: true, activeRowId: rowId, anchorEl: event.currentTarget });\n };\n\n attemptHideDropdown = () => {\n const timeoutId = setTimeout(() => {\n if (!this.isMouseOverDropdown) {\n this.setState({ dropdownVisible: false });\n }\n }, 300);\n this.setState({ dropdownTimeout: timeoutId });\n };\n\n handleOpenModal = (row) => {\n this.setState({ openModal: true, selectedRow: row });\n };\n\n handleCloseModal = () => {\n this.setState({ openModal: false });\n this.refreshModalParams();\n }\n\n textPeriod = () => {\n const operationType = this.state.tabActivePeriod;\n const months = this.state.months;\n return `.${operationType}_${months}`;\n };\n\n refreshModalParams = () => {\n this.setState({\n selectedRow: null,\n openModal: false,\n months: \"\",\n tabActivePeriod: null\n });\n };\n\n handleMouseEnterDropdown = () => {\n this.isMouseOverDropdown = true;\n };\n\n handleMouseLeaveDropdown = () => {\n this.isMouseOverDropdown = false;\n this.attemptHideDropdown();\n };\n\n renderParams(data, titleData) {\n let filtered = {};\n const tabActiveUpperCase = this.state.tabActive.toUpperCase();\n\n data = data.filter((row) => {\n const title = titleData[row.id].toUpperCase();\n return title.startsWith(tabActiveUpperCase + \" •\") || title === tabActiveUpperCase;\n });\n\n if (this.state.paramsQueryContas.length < 1) {\n filtered = { data };\n } else {\n var options = {\n shouldSort: true,\n threshold: 0.4,\n distance: 1000,\n maxPatternLength: 1500,\n minMatchCharLength: 3,\n keys: [\"display\", \"title\"]\n };\n var combinedData = data.map(item => ({\n ...item,\n title: titleData[item.id] || \"\",\n display: item.display || \"\"\n }));\n var fuse = new Fuse(combinedData, options);\n filtered.data = fuse.search(this.state.paramsQueryContas);\n }\n\n return filtered.data.map((item, index) => (\n this.toggleOppened()}\n style={{\n borderBottom: '1px solid #e5e5e5', \n width: 260,\n backgroundColor: '#f1f1f1',\n height: 74,\n display: 'flex',\n position: 'relative',\n alignItems: 'center',\n cursor: 'pointer',\n paddingLeft: 8\n }}>\n 
\n {currentCompany.label}\n \n
\n \n {opened &&\n \n \t{options.map((company)=>(\n this.renderCompany(company)\n ))}\n
\n }\n \n this.props.onAddTextAndRowToFormulaInput(\".difference\", item)}\n >\n Diferença\n
\n\n \n this.setState({ showTooltip: `${item.id}-diferenca` })}\n onMouseLeave={() => this.setState({ showTooltip: null })}\n >\n
\n \n \n
\n )}\n \n Busca o valor das colunas débito+crédito para o cubo selecionado (caso não se use nenhuma sintaxe após a escolha do cubo, a coluna de Débito+Crédito é escolhida como padrão)\n
\n \n this.props.onAddTextAndRowToFormulaInput(\".f_saldo_anterior\", item)}\n >\n Saldo Anterior\n
\n \n this.setState({ showTooltip: `${item.id}-saldo-anterior` })}\n onMouseLeave={() => this.setState({ showTooltip: null })}\n >\n
\n \n \n
\n )}\n \n Busca o valor da coluna saldo anterior para o cubo selecionado.\n
\n \n this.props.onAddTextAndRowToFormulaInput(\".f_saldo_atual\", item)}\n >\n Saldo Atual\n
\n \n this.setState({ showTooltip: `${item.id}-saldo-atual` })}\n onMouseLeave={() => this.setState({ showTooltip: null })}\n >\n
\n \n \n
\n )}\n \n Busca o valor da coluna saldo atual para o cubo selecionado.\n
\n \n \n \n
\n \n ,\n this.dropdownContainer\n )}\n \n ));\n }\n\n render() {\n const { data, titleData } = this.props;\n const { tabActive, tabActivePeriod } = this.state;\n\n return (\n \n
\n )}\n \n\n );\n }\n}\n\nexport default ContasContabeisSearch;\n","import React from 'react'\nimport PropTypes from 'prop-types'\nimport MaskedInput from 'react-text-mask'\nimport createNumberMask from 'text-mask-addons/dist/createNumberMask'\n\nconst defaultMaskOptions = {\n prefix: 'R$',\n suffix: '',\n includeThousandsSeparator: true,\n thousandsSeparatorSymbol: '.',\n allowDecimal: true,\n decimalSymbol: ',',\n decimalLimit: 2, // how many digits allowed after the decimal\n allowNegative: true,\n allowLeadingZeroes: false,\n}\n\nconst CurrencyInput = ({ maskOptions, ...inputProps }) => {\n const currencyMask = createNumberMask({\n ...defaultMaskOptions,\n ...maskOptions,\n })\n\n return \n
\n \n @CONTAS CONTÁBEIS\n
\n \n {\n let newValue = e.target.value;\n this.setState({ paramsQueryContas: newValue });\n }}\n />\n
\n \n
\n this.setState({ tabActive: \"ativos\" })}\n style={{ ...styles.tab, ...(tabActive === \"ativos\" ? styles.tabActive : {}) }}>\n Ativos\n
\n this.setState({ tabActive: \"passivos\" })}\n style={{ ...styles.tab, ...(tabActive === \"passivos\" ? styles.tabActive : {}) }}>\n Passivos\n
\n this.setState({ tabActive: \"resultados\" })}\n style={{ ...styles.tab, ...(tabActive === \"resultados\" ? styles.tabActive : {}) }}>\n Resultados\n
\n \n {data ? this.renderParams(data, titleData) :
\n\n {this.state.openModal && (\n Carregando...
}\n \n
\n \n \n
\n \n
\n Adicionar Período
\n \n Você pode visualizar a SOMA ou a MÉDIA dos últimos meses que desejar. Ex: A média dos últimos 6 meses (informe o “tipo de operação: média” e a “quantidade: 6”\n
\n\n \n
\n\n Conta:
\n {this.state.selectedRow.display}
\n \n \n
\n \n {['soma', 'media'].map((format) => (\n this.setState({ tabActivePeriod: format })}\n style={{ ...styles.tab, ...(this.state.tabActivePeriod === format ? styles.tabActive : {}) }}\n >\n {format === 'soma' ? 'SOMA' : 'MÉDIA'}\n
\n ))}\n \n \n this.setState({ months: x.currentTarget.value })}\n />\n
\n \n {\n this.props.onAddTextAndRowToFormulaInput(this.textPeriod(), this.state.selectedRow);\n this.handleCloseModal();\n this.refreshModalParams();\n }}>\n Aplicar\n \n
\n \n
\n \n \n\n );\n }\n}\n","import React from 'react';\nimport PropTypes from 'prop-types';\nimport { makeStyles } from '@material-ui/core/styles';\nimport Button from '@material-ui/core/Button';\nimport Avatar from '@material-ui/core/Avatar';\nimport List from '@material-ui/core/List';\nimport ListItem from '@material-ui/core/ListItem';\nimport TextField from '@material-ui/core/TextField';\nimport ListItemAvatar from '@material-ui/core/ListItemAvatar';\nimport ListItemText from '@material-ui/core/ListItemText';\nimport DialogTitle from '@material-ui/core/DialogTitle';\nimport Dialog from '@material-ui/core/Dialog';\n\n\nimport Typography from '@material-ui/core/Typography';\nimport { blue } from '@material-ui/core/colors';\n\nconst emails = ['username@gmail.com', 'user02@gmail.com'];\nconst useStyles = makeStyles({\n avatar: {\n backgroundColor: blue[100],\n color: blue[600],\n },\n});\n\nexport default function SimpleDialog(props) {\n const classes = useStyles();\n const { onClose, selectedValue, open, balanceSheet } = props;\n const [description, setDescription] = React.useState(false);\n const [justifying, setJustifying] = React.useState(false);\n const handleClose = () => {\n onClose(selectedValue);\n };\n\n const handleListItemClick = value => {\n onClose(value);\n };\n\n const saveJustificatory = async () =>{\n let result = await axios.post(`/balance_sheets/${balanceSheet.id}/inconsistence_justificatories.json`, {\n chart_formula: { description }\n });\n onClose(result.data)\n }\n\n let changeDescription= function(e){\n setDescription(e.target.value)\n }\n\n let justificatoryAction = function(e){\n if(justifying){\n saveJustificatory()\n }else{\n setJustifying(true)\n }\n }\n\n return (\n \n );\n}","import React from 'react';\nimport Fuse from \"fuse.js\";\nimport styles from \"./styles/FormulasLayoutStyles\";\nimport Button from \"@material-ui/core/Button\";\n\nclass IndicadoresFormulasSearch extends React.Component {\n constructor(props) {\n super(props);\n this.state = {\n paramsQueryIndicadores: \"\",\n };\n }\n\n handleAddButtonClick = (row) => {\n if (this.props.onAddItem) {\n this.props.onAddItem(row);\n }\n }\n\n renderParams(indicadores) {\n let filtered = {};\n\n var combinedData = indicadores.map(item => ({\n title: \"INPUT\",\n id: item.id,\n display: item.display || \"\"\n }));\n\n if (this.state.paramsQueryIndicadores.length < 1) {\n filtered.indicadores = combinedData;\n } else {\n var options = {\n shouldSort: true,\n threshold: 0.3,\n distance: 1000,\n maxPatternLength: 1500,\n minMatchCharLength: 3,\n keys: [\"display\"]\n };\n\n var fuse = new Fuse(combinedData, options);\n filtered.indicadores = fuse.search(this.state.paramsQueryIndicadores);\n }\n\n const htmlRender = filtered.indicadores.map((item, index) => (\n \n
\n \n
\n \n {title}\n \n
\n {this.tryEvalFormatted(this.CurrentAmount(scope))}
\n \n
\n \n
\n \n {this.arrowRules('budget_rule') === 'positive' &&\n 
\n }\n {this.arrowRules('budget_rule') !== 'positive' &&\n 
\n }\n
\n \n \n
\n \n \n {this.tryEvalFormatted(budget)}\n {this.difference(budget, this.getDifferenceColor(this.arrowRules('budget_rule')))}\n
\n \n
\n \n {this.arrowRules('last_amount_rule') === 'positive' &&\n \n }\n {this.arrowRules('last_amount_rule') !== 'positive' &&\n \n }\n
\n \n \n
\n \n \n {this.tryEvalFormatted(last_amount)}\n {this.difference(last_amount, this.getDifferenceColor(this.arrowRules('last_amount_rule')))}\n
\n \n
\n );\n }\n}\n\nexport default IndicadoresFormulasSearch;\n","import React from 'react'\n\nexport function FileIcon(props) {\n return (\n \n );\n}\n","import React from 'react';\nimport PropTypes from 'prop-types';\nimport { makeStyles } from '@material-ui/core/styles';\nimport Button from '@material-ui/core/Button';\nimport Avatar from '@material-ui/core/Avatar';\nimport List from '@material-ui/core/List';\nimport ListItem from '@material-ui/core/ListItem';\nimport ListItemAvatar from '@material-ui/core/ListItemAvatar';\nimport ListItemText from '@material-ui/core/ListItemText';\nimport DialogTitle from '@material-ui/core/DialogTitle';\nimport Dialog from '@material-ui/core/Dialog';\n\n\nimport Typography from '@material-ui/core/Typography';\nimport { blue } from '@material-ui/core/colors';\n\nconst emails = ['username@gmail.com', 'user02@gmail.com'];\nconst useStyles = makeStyles({\n avatar: {\n backgroundColor: blue[100],\n color: blue[600],\n },\n});\n\nexport default function SimpleDialog(props) {\n const classes = useStyles();\n const { onClose, selectedValue, open, balanceSheet } = props;\n\n const handleClose = () => {\n onClose(selectedValue);\n };\n\n const handleListItemClick = value => {\n onClose(value);\n };\n\n return (\n \n );\n}","import React from 'react';\nimport { Page, Text, View, Document, StyleSheet, PDFViewer } from '@react-pdf/renderer';\n\n// Create styles\nconst styles = StyleSheet.create({\n page: {\n flexDirection: 'row',\n backgroundColor: '#E4E4E4'\n },\n section: {\n margin: 10,\n padding: 10,\n flexGrow: 1\n }\n});\n\n// Create Document Component\nconst PdfPage = () => (\n \n
\n \n ! INPUTS (INDICADORES)\n
\n \n {\n let newValue = e.target.value;\n this.setState({ paramsQueryIndicadores: newValue });\n }}\n />\n
\n \n {indicadores ? this.renderParams(indicadores) :
\n Carregando...
}\n \n \n\t \n Contas removidas \n \n \n \n \n \n \n \n
\n );\n}\n\n\n\n","import React from \"react\";\nimport LoadingDialog from './../LoadingDialog'\nimport Comment from './../Comment'\nimport ResultChart from './../ResultChart'\nimport MonthFilter from './../MonthFilter'\nimport { BlueLink, ViewerButton } from '../../styled_components/default';\nimport PopHover from './../PopHover'\nimport MonthRangeInput from './../MonthRangeInput'\nimport popupIco from 'popup-ico.svg';\nimport { popupCenter } from './../popup/popupCenter'\nimport downloadIco from 'bt_download.svg';\nimport olhoOn from 'bt_olho_on.svg'\nimport olhoOff from 'bt_olho_off.svg'\nimport EyeOff from \"../svg-icons/EyeOff\";\nimport { EyeOn } from \"../svg-icons/EyeOn\";\nimport axios from '../utils/axiosConfig';\nimport gif_image from \"Lupa.gif\";\n\nclass Attachment extends React.Component {\n\n constructor(props) {\n super(props)\n\n var startDate = new Date(Date.UTC(props.year - 1, props.month + 1))\n var endDate = new Date(Date.UTC(props.year, props.month))\n\n this.loading = 0\n this.state = {\n fetchedFormulas: {},\n allBalances: {},\n allFormulas: {},\n areasDict: {},\n rangeMonths: {},\n allYearsData: {},\n showZeroLines: false,\n formulas: [],\n report: [],\n labels: [],\n years: [],\n comments: {},\n startDate,\n endDate: endDate,\n startYear: startDate.getFullYear(),\n endYear: endDate.getFullYear(),\n year: this.props.defaultYear,\n recordsFetched: {},\n cost_center_mode: false,\n costCentersFetched: {},\n costCenterAreas: [],\n despesasType: {},\n costCenterRecordsGrouped: {},\n activeAreaType: {},\n activeKeys: {},\n formulasTotal: {},\n loading: 0,\n dreFormulas: {},\n visibleMonths: {\n janeiro: true,\n fevereiro: true,\n março: true,\n abril: true,\n maio: true,\n junho: true,\n julho: true,\n agosto: true,\n setembro: true,\n outubro: true,\n novembro: true,\n dezembro: true,\n },\n months: props.months\n\n\n }\n }\n\n tryEval(str) {\n try {\n let formulaSolved = eval(str)\n return formulaSolved ? formulaSolved : 0;\n } catch (e) {\n return 0\n }\n }\n async setComments(year) {\n\n let comments = await axios.get('/comments.json', {\n params: {\n year\n }\n })\n\n\n this.setState({\n comments: {\n ...this.state.comments,\n [year]: comments.data\n }\n })\n }\n\n async fetchBalanceData(year) {\n let balances = await axios.get('/results/balances.json', {\n params: {\n year\n }\n })\n this.setState((oldState) => {\n oldState.allBalances[year] = oldState.allBalances[year] ? oldState.allBalances[year] : {}\n oldState.allBalances[year] = balances.data.result.params\n })\n\n }\n\n async getDreFormulas() {\n let dreFormulas = await axios.get('/formulas/list.json', {\n params: {\n scope: [\"dre\", \"dre_cc\", \"cash_flow\"]\n }\n })\n let hashResult = {}\n\n dreFormulas.data.map((id) => {\n hashResult[id] = true\n })\n\n this.setState({ dreFormulas: hashResult })\n }\n async getDreParams() {\n let dreFormulas = await axios.get('/contabil_pattern_params/result.json')\n\n this.setState({ dreFormulas: hashResult.data })\n }\n\n async setYears() {\n const { year } = this.state;\n let years = {}\n if (this.props.is_budget) {\n years = await axios.get('/budgets/years.json')\n } else {\n years = await axios.get('/balance_sheets/years.json')\n }\n\n this.setState({ years: years.data, year: (year || years.data[years.data.length - 1]) })\n }\n\n async fetchCostCenterData(year = null) {\n const { is_budget } = this.props;\n let { startYear, endYear } = this.state;\n this.loading += 1\n let result = await axios.get('/results/cost_centers.json', {\n params: {\n year: range(startYear, endYear),\n is_budget\n }\n })\n\n const { data } = result\n this.loading -= 1\n this.setState({\n costCenterRecordsGrouped: data\n })\n }\n\n async fetchData(year = null, loadUniqueData = true) {\n const { costCenterMode, is_budget, scope } = this.props;\n this.loading += 1\n let url = `/results/attachments/${scope}.json`\n let result = await axios.get(url, {\n params: {\n year,\n is_budget\n }\n })\n const { formulas, report, labels, areas, cost_center_grouped_by_month } = result.data\n let internalFormulaIds = {}\n Object.values(report).map((x) => internalFormulaIds = { ...internalFormulaIds, ...Object.values(x)[0].formulas })\n\n Object.keys(internalFormulaIds).map((formula_id) => {\n this.fetchInternalFormulaData(year, formula_id)\n })\n if (loadUniqueData) {\n this.setState({\n formulas,\n report,\n labels,\n costCenterAreas: areas,\n recordsFetched: {},\n costCenterGroupedByMonth: cost_center_grouped_by_month\n })\n }\n\n this.loading -= 1\n\n this.setState((oldState) => {\n oldState.allYearsData[year] = {\n formulas,\n report,\n labels,\n costCenterAreas: areas,\n recordsFetched: {},\n costCenterGroupedByMonth: cost_center_grouped_by_month\n }\n return { ...oldState }\n })\n }\n\n isFetchingFormulas(formula_ids){\n let isLoading = false\n Object.keys(formula_ids).map((formula_id)=>{\n if(this.state[`fetchingFormula${formula_id}`]){\n isLoading = true\n }\n })\n \n return isLoading\n }\n\n async fetchInternalFormulaData(year = null, formula_id) {\n const { costCenterMode, is_budget, scope } = this.props;\n let self = this;\n if (this.state.fetchedFormulas?.[year]?.[formula_id] == true) {\n return false\n }\n\n this.setState(\n {\n [`fetchingFormula${formula_id}`]: true\n }\n )\n\n this.setState((oldState) => {\n oldState.fetchedFormulas[year] = oldState.fetchedFormulas[year] ? oldState.fetchedFormulas[year] : {}\n oldState.fetchedFormulas[year][formula_id] = true\n return { ...oldState }\n })\n\n // this.loading += 1\n let url = `/results/formulas/${formula_id}.json`\n axios.get(url, {\n params: {\n year,\n is_budget\n }\n }).then((result)=>{\n let { formulas, report, labels, areas, cost_center_grouped_by_month } = result.data\n let internalFormulaIds = {}\n Object.values(report).map((x) => internalFormulaIds = { ...internalFormulaIds, ...Object.values(x)[0].formulas })\n\n // buscar dados internos de outras formulas\n //Object.keys(internalFormulaIds).map((formula_id)=>{\n // this.fetchInternalFormulaData(year, formula_id)\n //})\n self.setState({\n formulas: { ...self.state.formulas, ...formulas }\n })\n\n // self.loading -= 1\n\n self.setState((oldState) => {\n oldState.allFormulas[year] = oldState.allFormulas[year] ? oldState.allFormulas[year] : {}\n\n oldState.allFormulas[year][formula_id] = {\n formulas,\n report,\n labels,\n costCenterAreas: areas,\n recordsFetched: {},\n costCenterGroupedByMonth: cost_center_grouped_by_month\n }\n return { ...oldState }\n })\n\n setTimeout(()=>{\n self.setState(\n {\n [`fetchingFormula${formula_id}`]: false\n }\n )\n }, 2000)\n \n })\n \n \n }\n\n async componentDidMount() {\n let { startYear, endYear } = this.state;\n let x = await this.setYears()\n this.getDreFormulas()\n this.getDreParams();\n\n\n this.fetchCostCenterData()\n this.fetchData(this.state.year)\n // this.fetchDataForRange(this.state.year)\n this.setRangeDate(this.state.startDate, this.state.endDate)\n this.fetchAreas()\n range(startYear, endYear).map((year) => {\n this.setComments(year);\n })\n }\n\n async fetchAreaData(key, fixed, type_id, type_label) {\n\n const { year, costCentersFetched, startYear, endYear } = this.state;\n const { cost_center_heads, is_budget } = this.props;\n let fixed_label = Boolean(fixed) ? \"fixed\" : \"not_fixed\"\n\n Object.entries(cost_center_heads).map(([id, label]) => {\n if (!costCentersFetched[label]) {\n costCentersFetched[label] = {}\n }\n })\n\n if (costCentersFetched[type_label][key] && costCentersFetched[type_label][key][fixed_label]) {\n this.setState((oldState) => {\n oldState.costCentersFetched[type_label][key][fixed_label] = null\n return { ...oldState }\n })\n } else {\n let details = await axios.get(`results/formulas/${key}/cost_center_detail.json`, {\n params: {\n year: range(startYear, endYear),\n fixed: Boolean(fixed),\n type: type_id,\n is_budget,\n }\n })\n\n this.setState((oldState) => {\n if (!oldState.costCentersFetched[type_label][key]) { oldState.costCentersFetched[type_label][key] = {} }\n Object.keys(details.data).map((year) => {\n oldState.costCentersFetched[type_label][key][year] = details.data[year]\n })\n\n return { ...oldState }\n })\n }\n\n }\n\n async toggleAreaType(key, fixed, type_id, type_label) {\n\n this.setState((oldState) => {\n oldState.activeAreaType[`${key},${fixed}`] = oldState.activeAreaType[`${key},${fixed}`] ? oldState.activeAreaType[`${key},${fixed}`] : {}\n oldState.activeAreaType[`${key},${fixed}`][`${type_id}-${type_label}`] = !oldState.activeAreaType[`${key},${fixed}`][`${type_id}-${type_label}`]\n return { ...oldState }\n })\n\n }\n\n formulaIsGrouped(key) {\n const { formulas } = this.state\n\n return formulas[key]?.formula_type == \"grouped\"\n\n }\n\n setupAllYearsData() {\n let { years } = this.state;\n years.map((year) => {\n this.fetchData(year, false)\n })\n }\n\n loadYear(year) {\n this.fetchData(year, false)\n }\n\n changeYear(year) {\n this.setState({ year })\n this.props.changeYear(year)\n this.fetchData(year)\n this.fetchCostCenterData()\n\n this.setState({\n costCentersFetched: {},\n despesasType: {}\n })\n\n range(startYear, endYear).map((year) => {\n this.setComments(year);\n })\n // this.fetchDataForRange(year)\n }\n\n \n\n renderLine(rowDataByYear, line, level = 1, key) {\n try {\n\n\n let [lineKey, lineData] = line;\n let graphData = []\n \n let lineByYear = this.state.recordsFetched[key]\n const { rangeMonths } = this.state;\n let totalLine = 0\n let isInvertedNumber = this.state.resultKeys?.[key] ? 1 : -1\n return \n\t \t \n Ver contas removidas\n \n\t
\n \n {lineData.label}
\n {this.numberToCurrency(monthValue)}
\n\n\n this.toggleDespesasType([despesa_id, b_fixed])} >\n \n {value.label}
{numberToCurrency(total)}
\n\n {this.isFetchingFormulas(value[key].formulas) && 
}\n \n {this.state?.formulas?.[key]?.description &&
\n {this.state.formulas[key].description}
{this.props.formulas[key]}
\n\n \n }>\n {key}\n \n {\n (p_value &&\n Object.entries(p_value)\n .map(([k, v])=> k != \"total\" && v[param])\n .reduce(\n (a, b) => parseFloat(a || 0) + parseFloat(b || 0),\n 0\n )\n .toLocaleString(\"pt-BR\", {\n style: \"currency\",\n currency: \"BRL\"\n }))\n }
\n{\n numberToCurrency(total_indicators)\n }\n
\n \n this.changeVisibleMonths(e)} visibleMonths={this.state.visibleMonths} months={this.props.months}> \n\n this.setState({ showZeroLines: !showZeroLines })}>\n {showZeroLines ? \n
\n \n \n \n popupCenter({ url: `/popups/attachment_table`, title: 'Editar', w: window.innerWidth * 0.8, h: window.innerHeight * 0.8 })}\n style={{\n backgroundColor: '#F5F5F5',\n width: 36,\n height: 36,\n borderRadius: 4,\n display: 'flex',\n justifyContent: 'center',\n alignItems: 'center',\n cursor: 'pointer'\n }}>\n \n
\n INDICADORES FINANCEIROS
\n \n * Você está visualizando números no formato n/{this.props.divisor}\n
\n \n
\n \n \n \n
\n
\n | Nome | \n {Object.entries(rangeMonths).map(([key, month]) => (\n{month.substring(0, 3)}/{key.split(',')[0]} | \n ))}\n\n\n |
|---|
{line.label}
\n // {value}
\n }\n\n toggleDespesasType(key) {\n let { cost_center_heads } = this.props;\n let [area_id, is_fixed] = key\n\n Object.entries(cost_center_heads).map(([despesa_type_id, label]) => {\n this.fetchAreaData(area_id, is_fixed, despesa_type_id, label)\n })\n\n this.setState((oldState) => {\n oldState.despesasType[key] = !oldState.despesasType[key]\n if (!oldState.despesasType[key]) {\n this.state.activeAreaType[`${key}`] = {}\n }\n\n return { ...oldState }\n })\n }\n\n\n percentFormat(number) {\n return `${parseFloat(number).toFixed(2)}%`\n }\n\n renderCostCenterParams(formulaId, report, cc_format = \"money\") {\n let { despesasType, companies, months, currentMonth } = this.state;\n let { cost_center_heads, is_budget } = this.props;\n \n let numberToCurrency = function (number = 0, number_format = cc_format) {\n if (String(parseFloat(number)) == \"NaN\" || parseFloat(number) == undefined) {\n number = 0;\n }\n if (number_format == \"percentage\") {\n this.percentFormat(parseFloat(number * -1));\n }\n if (number_format == \"integer\") {\n return new Intl.NumberFormat('decimal', { minimumFractionDigits: 2 }).format(parseFloat(number * -1));\n }\n if (!number_format || number_format == \"money\") {\n return parseFloat(number * -1).toLocaleString(\"pt-BR\", {\n style: \"currency\",\n currency: \"BRL\"\n });\n }\n };\n \n const monthToNumber = (monthName) => {\n const months = {\n \"janeiro\": 1, \"fevereiro\": 2, \"março\": 3, \"abril\": 4,\n \"maio\": 5, \"junho\": 6, \"julho\": 7, \"agosto\": 8,\n \"setembro\": 9, \"outubro\": 10, \"novembro\": 11, \"dezembro\": 12\n };\n return months[monthName.toLowerCase()] || 0;\n };\n \n const sumValuesForTotal = (company_id, area_id, is_fixed) => {\n return Object.entries(costCenterRecordsGrouped?.[company_id] || {}).reduce((acc, [key, value]) => {\n if (key.startsWith(`[\"${areasDict[area_id]}\", ${is_fixed},`)) {\n return acc + parseFloat(value);\n }\n return acc;\n }, 0);\n };\n \n \n const { costCenterRecordsGrouped, costCenterGroupedByMonth, areasDict, formulas, currentCompany, showZeroLines } = this.state;\n \n let costCenterArray = Object.keys(report?.[formulaId]?.self_cost_centers);\n \n let idValuesCostCenter = costCenterArray.map(function (element) {\n let fixed = element.replace(/=>/g, ':').replace(/\\\\\"/g, '\"');\n let parsed = JSON.parse(fixed);\n return parsed[0].area.id;\n });\n \n return \n
\n {currentModality == \"balance_sheet\" ? (\n \n this.setState({ showZeroLines: !showZeroLines })}>\n {showZeroLines ? \n
\n\n \n RESUMO EXECUTIVO
\n\n \n
\n }\n\n \n \n \n
\n
\n | Nome | \n {Object.entries(companies).map(([name, numero]) => (\n (numero != this.props.current_company_id) &&{name} | \n ))}\n {/*Movimentações | */}\n\n {this.cable_counting > 0 ?\n \n \n :\n (Recarregando {this.cable_counting} formulas) \n Acumulado \n Acumulado \n }\n\n\n | \n {Object.entries(companies).map(([name, numero]) => (\n (numero == this.props.current_company_id) && \n this.toggleLastColumn()} className={`fa fa-chevron-${this.state.lastColumnHide ? 'left' : 'right'}`} />\n {!this.state.lastColumnHide && {name} }\n | \n ))}\n
|---|---|---|---|---|
| { this.setState({ formulaOpened: { ...formulaOpened, [key]: !formulaOpened[key] } }) }}>\n {formulas[key].layout == \"grupo_especial\" && }\n | \n {Object.entries(companies).map(([name, company_id]) => {\n if (company_id != this.props.current_company_id) {\n formulaTotal += this.tryEval(companyData?.[company_id]?.[\"report\"]?.[key]?.[key]?.[\"result\"]?.[this.monthForFormula(currentMonth, formulas[key].id)])\n }\n\n return (\n (company_id != this.props.current_company_id) && \n {this.getNumerFormatted(this.tryEval(companyData?.[company_id]?.[\"report\"]?.[key]?.[key]?.[\"result\"]?.[this.monthForFormula(currentMonth, formulas[key].id)]), formulas[key]?.number_format)}\n | \n );\n })}\n {/*\n | */}\n \n {\n \n\n }\n | \n {Object.entries(companies).map(([name, company_id]) => {\n if (company_id != this.props.current_company_id) {\n formulaTotal += this.tryEval(companyData?.[company_id]?.[\"report\"]?.[key]?.[key]?.[\"result\"]?.[currentMonth])\n }\n\n return (\n (company_id == this.props.current_company_id) &&\n {this.getNumerFormatted(this.tryEval(companyData?.[company_id]?.[\"report\"]?.[key]?.[key]?.[\"result\"]?.[this.monthForFormula(currentMonth, formulas[key].id)]), formulas[key]?.number_format)}\n\n | \n );\n })}\n
| \n | \n {Object.entries(companies).map(() => | )}\n |
{line.label}
\n // {\n \n this.setState((oldState)=>{\n if(row.label){\n \n oldState.activeKeys[key] = oldState.activeKeys[key] ? oldState.activeKeys[key] : {}\n oldState.activeKeys[key][row.label] = oldState.activeKeys[key][row.label] ? null : {}\n }else{\n oldState.activeKeys[key] = oldState.activeKeys[key] ? null : {} \n }\n \n return {...oldState}\n })\n }}\n style={{paddingLeft: level * 10}}>\n {row.label}\n
\n {value} {label}
\n }\n\n toggleDespesasType(key){\n let {cost_center_heads} = this.props;\n let [area_id, is_fixed] = key\n\n Object.entries(cost_center_heads).map(([despesa_type_id, label])=>{\n this.fetchAreaData(area_id, is_fixed, despesa_type_id, label) \n })\n \n this.setState((oldState)=>{\n oldState.despesasType[key] = !oldState.despesasType[key]\n if(!oldState.despesasType[key]){\n this.state.activeAreaType[`${key}`] = {} \n }\n \n return {...oldState}\n })\n }\n\n\n renderCostCenterAreas(form_key, value, number_format=\"money\"){\n const { months, cost_center_heads} = this.props;\n const {costCentersFetched,\n costCenterAreas,\n despesasType,\n costCenterGroupedByMonth,\n companyData,\n currentMonth, \n companies, \n allYearCompanyData,\n dataModel} = this.state;\n \n let areaByMonth = (b_fixed, despesa_id, number, monthName)=>{\n\n try{\n let value = companyData[number]?.costCenterGroupedByMonth[b_fixed ? \"fixed\" : \"not_fixed\"][`[${despesa_id}, ${this.monthDict()[monthName]}]`]\n if(monthName == \"total\"){\n value = 0\n Object.values(this.monthDict()).map((month)=>{\n let monthValue = parseFloat(companyData[number]?.costCenterGroupedByMonth[b_fixed ? \"fixed\" : \"not_fixed\"][`[${despesa_id}, ${month}]`])\n if (monthValue) {\n value += monthValue\n }\n })\n }\n \n \n return value\n \n }catch(e){\n return 0\n }\n \n }\n let permittedAreas = {}\n \n \n dataModel?.[form_key]?.[form_key]?.cost_center_params?.ids?.map((id)=>{\n permittedAreas[`${id[0].area.id}-${id[0].is_fixed}`] = true\n })\n \n \n \n\n let lines = Object.entries(costCenterAreas || {}).map(([key, value])=>{\n const [fixed, despesa_id] = JSON.parse(key);\n let b_fixed = Boolean(fixed)\n\n \n\n \n //this.fetchAreaData(id, fixed)\n if (permittedAreas?.[`${despesa_id}-${fixed}`]) {\n \n return this.toggleDespesasType([despesa_id, b_fixed])} >\n \n {value.label}
{value} {label}
\n }\n \n\n getFloat(number){\n if (parseFloat(number).toLocaleString() == \"NaN\"){\n return 0\n }else{\n return parseFloat(number)\n }\n }\n\n isParamZero(p_value, param){\n if(this.state.showZeroLines){\n return false\n }\n\n let { months} = this.state;\n let isZero = true\n Object.entries(months).map(([name, number]) => {\n \n if(this.getFloat(p_value[name][param]) != 0){\n isZero = false\n }\n })\n return isZero\n\n }\n \n\n renderLine(key, value){\n const { report, \n labels, \n formulas, \n year, \n years, \n recordsFetched, \n cost_center_mode, \n formulasTotal, \n companies, \n dataModel, \n companyData, \n month, \n currentMonth,\n allYearCompanyData,\n modalities,\n currentModality } = this.state;\n let { months} = this.state;\n \n return (!formulas[key]?.cost_center_demonstration || !Boolean(cost_center_mode)) && this.formulaIsGrouped(key) && Object.entries(value[key][\"params\"]).map(\n ([p_key, p_value]) => {\n let total = 0\n \n return (\n \n
\n {currentModality == \"balance_sheet\" ? (\n \n
\n \n RESUMO EXECUTIVO
\n \n \n
\n }\n \n \n \n \n \n
\n
\n | Nome | \n {Object.entries(months).map(([name, number]) => {\n return{name} | \n })}\nTotal | \n {/*Movimentações | */}\n {Object.values(months).map(month => {\n\n {this.cable_counting > 0 ? \n \n \n :\n (Recarregando {this.cable_counting} formulas) \n Acumulado \n Acumulado \n }\n \n \n | \n })}\n \n {false && Object.entries(companies).map(([name, numero]) => (\n (numero == this.props.current_company_id) && {name} | \n ))}\n
|---|---|---|---|---|---|
| \n | \n \n\n {/*\n | */}\n {Object.entries(this.monthDict()).map(([name, number]) => {\n return \n \n {\n \n }\n {number == 13 && <>\n \n | \n })}\n \n {false && Object.entries(companies).map(([name, company_id]) => {\n if(company_id != this.props.current_company_id){\n formulaTotal += this.tryEval(companyData?.[company_id]?.[\"report\"]?.[key]?.[key]?.[\"result\"]?.[currentMonth])\n }\n \n return (\n (company_id == this.props.current_company_id) && \n {this.getNumerFormatted(this.tryEval(companyData?.[company_id]?.[\"report\"]?.[key]?.[key]?.[\"result\"]?.[currentMonth]), formulas[key]?.number_format)}\n \n | \n );\n })}\n||
| \n <>\n {Object.entries(this.monthDict()).map(()=> | )}\n \n |
\n\n\t \t\t\t\t\t\t{!child.is_tail && }\n\t \t\t\t\t\t
\n\t\t\t\t\t\t\t{child.label} {cash_flow_formula_ids[child.fr_id] ? : \"\"}\n\t\t\t\t\t\t\n\t \t\t
\t\t\n\t\t \n\t\t \n\t\t \n\t\t
\n\t\t
\n\t\t | \n\t\t Nome\n\t\t | \n {Object.entries(this.monthDict()).map(([name, numero]) => (\n{name} | \n ))}\n\t\t \n\t\t
|---|---|
| \n {this.state.comments && | \n {Object.entries(this.monthDict()).map(([monthName, monthNumber])=>{\n let total = 0\n Object.values(companies).map((company_id) => {\n if(companiesData?.[company_id]?.result){\n total += this.numerize(companiesData?.[company_id]?.result.params[contabilParam.id][monthName])\n } \n })\n \n return \n {this.numberToCurrency(total)}\n | \n })}\n\t\t\t\t\t\t \n\t\t\t\t\t\t
| Checagem | \n \n {\n Object.entries(this.monthDict()).map(([monthName, monthNumber])=>{\n let total = 0\n Object.values(companies).map((company_id) => {\t\n total += this.numerize(this.state.companiesData?.[company_id]?.result ? this.checkMonth(monthName, company_id) : 0)\n })\n return\n {this.numberToCurrency(total)}\n | \n })\n }\n\t\t \n\t\t
{line.label}
\n \n {(totalLine * -1).toLocaleString(\"pt-BR\", {\n style: \"currency\",\n currency: \"BRL\"\n })}\n
\n{this.numberToCurrency(sum)}
\n {value} {label}
\n return {value}
\n }\n\n toggleDespesasType(key) {\n let { cost_center_heads } = this.props;\n let [area_id, is_fixed] = key\n\n Object.entries(cost_center_heads).map(([despesa_type_id, label]) => {\n this.fetchAreaData(area_id, is_fixed, despesa_type_id, label)\n })\n\n this.setState((oldState) => {\n oldState.despesasType[key] = !oldState.despesasType[key]\n if (!oldState.despesasType[key]) {\n this.state.activeAreaType[`${key}`] = {}\n }\n\n return { ...oldState }\n })\n }\n\n\n renderCostCenterAreas(number_format = \"money\") {\n const { months, cost_center_heads } = this.props;\n const { costCentersFetched, costCenterAreas, despesasType, costCenterGroupedByMonth } = this.state;\n\n let areaByMonth = (b_fixed, despesa_id, number) => {\n\n try {\n let value = costCenterGroupedByMonth[b_fixed ? \"fixed\" : \"not_fixed\"][`[${despesa_id}, ${number}]`]\n\n return value\n\n } catch (e) {\n\n }\n\n }\n\n\n let lines = Object.entries(costCenterAreas).map(([key, value]) => {\n const [fixed, despesa_id] = JSON.parse(key);\n let b_fixed = Boolean(fixed)\n //this.fetchAreaData(id, fixed)\n return this.toggleDespesasType([despesa_id, b_fixed])} >\n \n {value.label}
{numberToCurrency(total)}
\n\n this.changeVisibleMonths(e)} visibleMonths={this.state.visibleMonths} months={this.props.months}> \n\n this.setState({ showZeroLines: !showZeroLines })}>\n {showZeroLines ? \n
\n \n \n \n popupCenter({ url: `/popups/${this.props.activeTab(\"dre\") ? \"dre\" : \"dre_cc\"}`, title: 'Editar', w: window.innerWidth * 0.8, h: window.innerHeight * 0.8 })}\n style={{\n backgroundColor: '#F5F5F5',\n width: 36,\n height: 36,\n borderRadius: 4,\n display: 'flex',\n justifyContent: 'center',\n alignItems: 'center',\n cursor: 'pointer'\n }}>\n \n
\n RESULTADO MENSAL
\n\n\n \n * Você está visualizando números no formato n/{this.props.divisor}\n
\n \n
\n \n \n \n
\n
\n | Nome | \n {Object.values(months).map(month => (\n{monthDict[`${month}`.padStart(2, \"0\")]}/{year} | \n ))}\n\nAcumulado | \n
|---|
\n \n {name}\n
\n ))}\n \n \n \n \n {option === 'FormulaGrupoEspecial' ? : null}\n {label}\n
\n \n \n \n );\n }\n return null;\n };\n\n checkOperations = (pattern) => {\n const operations = ['+', '-', '*', '/'];\n let totalCount = 0;\n\n let cleanedPattern = pattern.replace(/#\\[[^\\]]+\\]\\(\\$\\[\\d+\\]\\)/g, '');\n cleanedPattern = cleanedPattern.replace(/\\{.*?\\}/g, '');\n cleanedPattern = cleanedPattern.replace(/\\(.*?\\)/g, '');\n cleanedPattern = cleanedPattern.replace(/!\\[[^\\]]+\\]/g, '');\n\n cleanedPattern = cleanedPattern.replace(/\\s+/g, ' ').trim();\n\n operations.forEach(op => {\n const count = (cleanedPattern.match(new RegExp(`\\\\s*\\\\${op}\\\\s*`, 'g')) || []).length;\n totalCount += count;\n });\n\n console.log(totalCount);\n\n this.setState({ showOperationWarning: totalCount === 2 });\n };\n\n closeWarning = () => {\n this.setState({ showOperationWarning: false });\n };\n\n render() {\n const { number_format, data, hashtagData, label, formula_type, scope, contabil_pattern_reference_id, position, customData, cost_center_demonstration, layout, description } = this.state;\n const {titleData, contabil_patterns, costCenterAreaData} = this.props;\n\n return (\n \n
\n\n { scope == \"dre\" && \n
\n\n \n
\n\n \n \n this.setState({ label: x.currentTarget.value })}\n />\n
\n \n \n this.setState({ description: x.currentTarget.value })}\n />\n
\n\n \n \n
\n \n {['grouped', 'formula'].map((type) => (\n this.setState({ formula_type: type })}\n style={{ ...styles.tab, ...(this.state.formula_type === type ? styles.tabActive : {}) }}\n >\n {type === 'grouped' ?\n <>
\n ))}\n \n \n
\n\n \n {['normal', 'especial', 'grupo_especial'].map((type) => (\n this.setState({ layout: type })}\n style={{ ...styles.tab, ...(this.state.layout === type ? styles.tabActive : {}) }}\n >\n \n {this.state.layout === type ?\n
\n ))}\n \n \n {this.scopes(scope)}\n
\n\n \n \n
\n \n {['integer', 'money', 'percentage'].map((format) => (\n this.setState({ number_format: format })}\n style={{ ...styles.tab, ...(this.state.number_format === format ? styles.tabActive : {}) }}\n >\n {format === 'integer' ? 'VALOR NUMÉRICO' : format === 'money' ? 'VALOR MONETÁRIO' : 'PORCENTAGEM'}\n
\n ))}\n \n this.addSelectedItemToFormula(item, '@')}\n onAddTextAndRowToFormulaInput={this.addTextAndRowToFormulaInput}\n />\n
\n\n \n this.addSelectedItemToFormula(item, '#')}\n onAddTextAndRowToFormula={this.addTextAndRowToFormula}\n isAttachment={this.props.is_attachment}\n />\n
\n\n \n\n \n
\n\n {this.state.showOperationWarning && (\n \n this.addSelectedItemToFormula(item, '!')}\n />\n
\n\n \n this.addSelectedItemToFormula(item, '?')}\n />\n
\n \n \n X fechar\n \n
\n )}\n\n \n Você adicionou duas operações: Verifique a necessidade de utilizar ”parênteses” para identificar as operações prioritárias.\n
\n \n
\n \n \n );\n }\n}\n\nexport default Formula;\n","import React from \"react\";\nimport formula_tutorial from \"formula_tutorial.jpeg\";\nimport FormulaMentionInput from \"./FormulaMentionInput\";\nimport {\n WhiteBox,\n Title,\n TextInput,\n Select,\n Label,\n Line,\n TextArea,\n GreenButton,\n EntryBox,\n BlueButton,\n FilterLabel,\n FilterSection\n} from \"../styled_components/default.js\";\nimport FormControlLabel from '@material-ui/core/FormControlLabel';\nimport Switch from '@material-ui/core/Switch';\n\nclass FrontDashboardFormula extends React.Component {\n constructor(props) {\n super(props);\n this.input = React.createRef();\n\n let custom_formula = this.props.custom_formula || {};\n\n this.state = {\n data: [],\n hashtagData: [],\n pattern: custom_formula.pattern || \"\",\n customData: this.props.customData\n };\n }\n\n componentDidMount() {\n try {\n\n this.setState({\n data: this.props.params.map(([display, id]) => ({ id, display })),\n hashtagData: this.props.formulas.map(([group, display, id]) => ({\n id,\n display,\n group\n }))\n });\n } catch (e) {\n console.log(e);\n }\n }\n\n render() {\n const { data, hashtagData, customData } = this.state;\n const {titleData, costCenterAreaData, customFormulaId} = this.props;\n return (\n \n Monte o Cálculo aqui: \n \n Você pode clicar nas opções acima, ou apenas digitar o tipo de operação (?) e a operação (?) desejada.\n \n
\n\n \n {\n this.setState({ pattern: n });\n this.checkOperations(n);\n }}\n style={{ flex: 1, border: 'none', alignSelf: 'center' }}\n />\n this.save()} style={{ border: 'none', height: '45px' }}>\n Salvar Formula\n \n
\n \n this.handleButtonClick('Soma')}\n style={{ flex: 1, backgroundColor: '#B6FDE8', height: '45px', border: 'none', cursor: 'pointer', borderRadius: '5px' }}\n onMouseOver={e => e.currentTarget.style.backgroundColor = '#D1FFEB'}\n onMouseOut={e => e.currentTarget.style.backgroundColor = '#B6FDE8'}\n >\n +\n \n this.handleButtonClick('Subtração')}\n style={{ flex: 1, backgroundColor: '#FFC9D6', height: '45px', border: 'none', cursor: 'pointer', borderRadius: '5px' }}\n onMouseOver={e => e.currentTarget.style.backgroundColor = '#FFDCE0'}\n onMouseOut={e => e.currentTarget.style.backgroundColor = '#FFC9D6'}\n >\n -\n \n this.handleButtonClick('Multiplicação')}\n style={{ flex: 1, backgroundColor: '#B7DCFD', height: '45px', border: 'none', cursor: 'pointer', borderRadius: '5px' }}\n onMouseOver={e => e.currentTarget.style.backgroundColor = '#8F9FFF'}\n onMouseOut={e => e.currentTarget.style.backgroundColor = '#B7DCFD'}\n >\n ×\n \n this.handleButtonClick('Divisão')}\n style={{ flex: 1, backgroundColor: '#FFD7A3', height: '45px', border: 'none', cursor: 'pointer', borderRadius: '5px' }}\n onMouseOver={e => e.currentTarget.style.backgroundColor = '#FFEBBE'}\n onMouseOut={e => e.currentTarget.style.backgroundColor = '#FFD7A3'}\n >\n ÷\n \n
\n\n \n \n \n { this.portalRef = node; }}\n style={{\n position: 'fixed',\n bottom: '105px',\n right: '0px',\n backgroundColor: 'white',\n border: 'none',\n borderRadius: '5px',\n zIndex: 1000,\n width: '600px',\n marginRight: '27px'\n }}>\n
,\n document.body\n )\n }\n \n
\n \n
\n \n VISUALIZE COMO SUA FÓRMULA APARECERÁ NO SISTEMA\n
\n \n { (this.state.formula_type === null || this.state.layout === null) && (\n \"Para visualizar como sua fórmula aparecerá no sistema é necessário selecionar o Tipo (Exibição em tela) e o Layout.\"\n ) }\n {this.showFormulas()}\n
\n \n \n AINDA TEM DÚVIDAS? CLIQUE AQUI E ACESSE NOSSA CENTRAL DE AJUDA\n \n
\n \n
\n \n \n \n {\n this.setState({ pattern: n });\n }}\n />\n
\n );\n }\n}\n\nexport default FrontDashboardFormula;\n","import React from \"react\";\nimport PropTypes from \"prop-types\";\nimport styled from \"styled-components\";\nimport { FlexCenter, ExpandButton } from \"../styled_components/default\";\nimport ColapsedItem from \"./ColapsedItem\";\n\nimport dashboardImage from 'menu-dashboard-icon.svg';\nimport menuResultIcon from 'menu-result-icon.svg';\nimport oramentoIcon from 'orcamento-icon.svg';\nimport menuUploadIcon from 'menu-upload-icon.svg';\nimport menuConsultingIcon from \"menu-consulting-icon.png\";\nimport menuParameterizationIcon from \"menu-parameterization-icon.svg\";\nimport LoadingDialog from './LoadingDialog'\nimport consultingIcon from 'consulting.svg';\nclass LateralMenu extends React.Component {\n state = {\n activeItem: 'dashboard',\n collapsed: true,\n customParamLinks: [],\n expandItemSelected: ''\n };\n\n componentDidMount() {\n this.setCustomParamLinks()\n }\n\n componentDidMount(){\n let {can_balance_sheets, can_cost_centers, can_budgets, can_contabil_patterns, can_formulas, can_charts, can_front_dashboard_formulas, can_indicators} = this.props.authorizations\n let {is_higher_parent_company, max_string_length_per_year} = this.props;\n \n this.setState({customParamLinks: [\n (can_contabil_patterns && is_higher_parent_company ? { label: \"Configurar Padrão\", href: \"/contabil_pattern/configure\" } : null),\n (can_balance_sheets ? { label: \"Parametrizar Balancete - De/Para\", href: \"/balance_sheets/new\" } : null),\n (can_balance_sheets ? { label: \"Parametrizar Centros de Custo\", href: \"/cost_centers/setup_params\" } : null),\n (can_indicators && is_higher_parent_company ? { label: \"Indicadores\", href: \"/indicators\" } : null ),\n (can_formulas && is_higher_parent_company? {label: \"Formulas\", href: \"/formulas\" } : null),\n (can_formulas ? {label: \"Formulas dos Anexos\", href: \"/attachments/formulas\" } : null),\n (can_front_dashboard_formulas && is_higher_parent_company ? { label: \"Formulas - Gráfico\", href: \"/charts\" } : null),\n (can_front_dashboard_formulas ? { label: \"Dashboard Widgets\", href: \"/front_dashboard_formulas\" } : null),\n (can_front_dashboard_formulas ? { label: \"Periodo de checagem\", href: \"/liquid_profits\" } : null),\n (max_string_length_per_year ? { label: \"Diferenciação da parametrização anual\", href: \"/company_yearly_restrictions\" } : null)\n ]})\n \n }\n\n setActiveItem = function (id) {\n this.setState({ activeItem: id });\n this.setState({ collapsed: false })\n };\n\n\n activeInclude(path) {\n const urlPath = window.location.pathname\n const uploadPaths = [\n '/balance_sheets',\n '/cost_centers',\n '/budgets/upload',\n '/ledgers'\n ]\n const parametrizationPaths = [\n '/contabil_pattern/configure',\n '/formulas',\n '/charts',\n '/front_dashboard_formulas',\n '/indicators',\n '/balance_sheets/new'\n ]\n\n if (urlPath === path) {\n return true\n }\n\n if (path === 'upload' && uploadPaths.includes(urlPath)) {\n return true\n }\n\n if (path === 'parametrization' && parametrizationPaths.includes(urlPath)) {\n return true\n }\n }\n\n expandItem(item) {\n this.setState({\n expandItemSelected: item,\n collapsed: false\n })\n }\n\n toggleCollapse() {\n if (!this.state.collapsed) {\n this.expandItem(null)\n }\n this.setState({ collapsed: !this.state.collapsed })\n }\n\n render() {\n let { collapsed, expandItemSelected } = this.state;\n\n const { can_balance_sheets,\n can_cost_centers,\n can_budgets,\n can_read_balance_sheets,\n can_parameters,\n can_upload,\n can_consulting } = this.props.authorizations\n \n const {max_string_length_per_year} = this.props\n\n return (\n \n this.onClick(\"dashboard\")}\n active={this.activeInclude(\"dashboard\")}\n href=\"/\"\n label=\"Dashboard\"\n icoSrc={dashboardImage}\n />\n\n {can_read_balance_sheets && this.expandItem(\"upload\")}\n active={this.activeInclude(\"upload\")}\n expanded={expandItemSelected === 'upload'}\n label=\"Upload\"\n icoSrc={menuUploadIcon}\n submenuLinks={[\n (can_balance_sheets ? { label: \"Balancete\", href: \"/balance_sheets\" } : null),\n (can_cost_centers ? { label: \"Centro de custo\", href: \"/cost_centers\" } : null),\n (can_cost_centers ? { label: \"Razão Contábil\", href: \"/ledgers\" } : null),\n (can_budgets ? { label: \"Orçamento\", href: \"/budgets/upload\" } : null),\n (can_parameters ? { label: \"Controle de uploads\", href: \"/upload_settings\" } : null)\n \n ]}\n />}\n\n { /* this.expandItem(\"consultoria\")}\n active={this.activeInclude(\"consultoria\")}\n expanded={expandItemSelected === 'consultoria'}\n label=\"Consultoria\"\n icoSrc={menuConsultingIcon}\n submenuLinks={[\n { label: \"bla\", href: \"consultoria/#\" },\n { label: \"bla\", href: \"consultoria/#\" },\n { label: \"bla\", href: \"consultoria/#\" }\n ]}\n />*/}\n\n {can_parameters && this.expandItem(\"parametrization\")}\n active={this.activeInclude(\"parametrization\")}\n expanded={expandItemSelected === 'parametrization'}\n label=\"Parametrização\"\n icoSrc={menuParameterizationIcon}\n submenuLinks={[\n\n ...this.state.customParamLinks\n // { label: \"Parametrizar Centro de custo\", href: \"/cost_centers/new\" }\n ]}\n />}\n\n this.toggleCollapse()} active={collapsed} />\n\n
\n );\n }\n}\n\nexport default LateralMenu;\n","import React from \"react\";\nimport PropTypes from 'prop-types'\n\nexport default class MonthBox extends React.Component {\n static propTypes = {\n value: PropTypes.string,\n onClick: PropTypes.func,\n }\n\n constructor(props, context) {\n super(props, context)\n\n this.state = {\n value: this.props.value || 'N/A',\n }\n }\n\n static getDerivedStateFromProps(props, state) {\n return {\n value: props.value || 'N/A',\n }\n }\n\n render() {\n\n return (\n \n \n
\n )\n }\n\n _handleClick = (e) => {\n this.props.onClick && this.props.onClick(e)\n }\n}","import React from 'react';\nimport ReportSituationDialog from './ReportSituationDialog'\nimport blocoIco from 'icon_bloconotas.svg';\n\nimport styled from \"styled-components\";\nimport { FileIcon } from './svg-icons/FileIcon';\nimport ReactTooltip from 'react-tooltip';\nexport default class NoticeButton extends React.Component {\n state = {\n edit: false,\n modalIsOpen: false,\n }\n componentDidMount() {\n this.fetchText()\n }\n\n async fetchText() {\n let result = await axios.get(`/companies/report_situation.json`);\n this.setState({ reportText: result.data.content })\n\n if (this.state.reportText && this.state.reportText.length > 0) {\n $(\"#report-text\").html(this.state.reportText)\n } else {\n $(\"#report-text\").html(\"O campo está vazio\")\n }\n\n }\n popupCenter = ({ url, title, w, h }) => {\n // Fixes dual-screen position Most browsers Firefox\n const dualScreenLeft = window.screenLeft !== undefined ? window.screenLeft : window.screenX;\n const dualScreenTop = window.screenTop !== undefined ? window.screenTop : window.screenY;\n\n const width = window.innerWidth ? window.innerWidth : document.documentElement.clientWidth ? document.documentElement.clientWidth : screen.width;\n const height = window.innerHeight ? window.innerHeight : document.documentElement.clientHeight ? document.documentElement.clientHeight : screen.height;\n\n const systemZoom = width / window.screen.availWidth;\n const left = (width - w) / 2 / systemZoom + dualScreenLeft\n const top = (height - h) / 2 / systemZoom + dualScreenTop\n const newWindow = window.open(url, title,\n `\n scrollbars=yes,\n width=${w / systemZoom}, \n height=${h / systemZoom}, \n top=${top}, \n left=${left}\n `\n )\n\n if (window.focus) newWindow.focus();\n }\n openPopup() {\n this.popupCenter({ url: '/report_situation', title: 'Editar', w: window.innerWidth * 0.8, h: window.innerHeight * 0.8 })\n }\n\n handleOpen() {\n this.setState({\n modalIsOpen: true\n })\n\n }\n handleClose(newText = this.state.reportText) {\n $(\"#report-text\").html(newText)\n this.setState({ modalIsOpen: false })\n }\n render() {\n let { isMobile } = this.props;\n return (\n\n \n );\n }\n}\nconst ButtonImg = styled.img`\n width: 26.2px;\n margin-right: 10px;\n \n`\n\nconst Button = styled.div`\n display: flex;\n align-items: center;\n justify-content: center;\n padding: 10px;\n border-radius: 6px;\n background-color: #31b7bc;\n color: white;\n margin: 3px;\n cursor: pointer;\n\n &:hover {\n transition: all 0.2s;\n filter: brightness(0.85);\n }\n`","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar ContentBlockNode = require(\"./ContentBlockNode\");\nvar generateRandomKey = require(\"./generateRandomKey\");\nvar Immutable = require(\"immutable\");\nvar OrderedMap = Immutable.OrderedMap;\nvar randomizeContentBlockNodeKeys = function randomizeContentBlockNodeKeys(blockMap) {\n var newKeysRef = {}; // we keep track of root blocks in order to update subsequent sibling links\n\n var lastRootBlock;\n return OrderedMap(blockMap.withMutations(function (blockMapState) {\n blockMapState.forEach(function (block, index) {\n var oldKey = block.getKey();\n var nextKey = block.getNextSiblingKey();\n var prevKey = block.getPrevSiblingKey();\n var childrenKeys = block.getChildKeys();\n var parentKey = block.getParentKey(); // new key that we will use to build linking\n\n var key = generateRandomKey(); // we will add it here to re-use it later\n\n newKeysRef[oldKey] = key;\n if (nextKey) {\n var nextBlock = blockMapState.get(nextKey);\n if (nextBlock) {\n blockMapState.setIn([nextKey, 'prevSibling'], key);\n } else {\n // this can happen when generating random keys for fragments\n blockMapState.setIn([oldKey, 'nextSibling'], null);\n }\n }\n if (prevKey) {\n var prevBlock = blockMapState.get(prevKey);\n if (prevBlock) {\n blockMapState.setIn([prevKey, 'nextSibling'], key);\n } else {\n // this can happen when generating random keys for fragments\n blockMapState.setIn([oldKey, 'prevSibling'], null);\n }\n }\n if (parentKey && blockMapState.get(parentKey)) {\n var parentBlock = blockMapState.get(parentKey);\n var parentChildrenList = parentBlock.getChildKeys();\n blockMapState.setIn([parentKey, 'children'], parentChildrenList.set(parentChildrenList.indexOf(block.getKey()), key));\n } else {\n // blocks will then be treated as root block nodes\n blockMapState.setIn([oldKey, 'parent'], null);\n if (lastRootBlock) {\n blockMapState.setIn([lastRootBlock.getKey(), 'nextSibling'], key);\n blockMapState.setIn([oldKey, 'prevSibling'], newKeysRef[lastRootBlock.getKey()]);\n }\n lastRootBlock = blockMapState.get(oldKey);\n }\n childrenKeys.forEach(function (childKey) {\n var childBlock = blockMapState.get(childKey);\n if (childBlock) {\n blockMapState.setIn([childKey, 'parent'], key);\n } else {\n blockMapState.setIn([oldKey, 'children'], block.getChildKeys().filter(function (child) {\n return child !== childKey;\n }));\n }\n });\n });\n }).toArray().map(function (block) {\n return [newKeysRef[block.getKey()], block.set('key', newKeysRef[block.getKey()])];\n }));\n};\nvar randomizeContentBlockKeys = function randomizeContentBlockKeys(blockMap) {\n return OrderedMap(blockMap.toArray().map(function (block) {\n var key = generateRandomKey();\n return [key, block.set('key', key)];\n }));\n};\nvar randomizeBlockMapKeys = function randomizeBlockMapKeys(blockMap) {\n var isTreeBasedBlockMap = blockMap.first() instanceof ContentBlockNode;\n if (!isTreeBasedBlockMap) {\n return randomizeContentBlockKeys(blockMap);\n }\n return randomizeContentBlockNodeKeys(blockMap);\n};\nmodule.exports = randomizeBlockMapKeys;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar CharacterMetadata = require(\"./CharacterMetadata\");\nvar findRangesImmutable = require(\"./findRangesImmutable\");\nvar invariant = require(\"fbjs/lib/invariant\");\nfunction removeEntitiesAtEdges(contentState, selectionState) {\n var blockMap = contentState.getBlockMap();\n var entityMap = contentState.getEntityMap();\n var updatedBlocks = {};\n var startKey = selectionState.getStartKey();\n var startOffset = selectionState.getStartOffset();\n var startBlock = blockMap.get(startKey);\n var updatedStart = removeForBlock(entityMap, startBlock, startOffset);\n if (updatedStart !== startBlock) {\n updatedBlocks[startKey] = updatedStart;\n }\n var endKey = selectionState.getEndKey();\n var endOffset = selectionState.getEndOffset();\n var endBlock = blockMap.get(endKey);\n if (startKey === endKey) {\n endBlock = updatedStart;\n }\n var updatedEnd = removeForBlock(entityMap, endBlock, endOffset);\n if (updatedEnd !== endBlock) {\n updatedBlocks[endKey] = updatedEnd;\n }\n if (!Object.keys(updatedBlocks).length) {\n return contentState.set('selectionAfter', selectionState);\n }\n return contentState.merge({\n blockMap: blockMap.merge(updatedBlocks),\n selectionAfter: selectionState\n });\n}\n/**\n * Given a list of characters and an offset that is in the middle of an entity,\n * returns the start and end of the entity that is overlapping the offset.\n * Note: This method requires that the offset be in an entity range.\n */\n\nfunction getRemovalRange(characters, entityKey, offset) {\n var removalRange; // Iterates through a list looking for ranges of matching items\n // based on the 'isEqual' callback.\n // Then instead of returning the result, call the 'found' callback\n // with each range.\n // Then filters those ranges based on the 'filter' callback\n //\n // Here we use it to find ranges of characters with the same entity key.\n\n findRangesImmutable(characters,\n // the list to iterate through\n function (a, b) {\n return a.getEntity() === b.getEntity();\n },\n // 'isEqual' callback\n function (element) {\n return element.getEntity() === entityKey;\n },\n // 'filter' callback\n function (start, end) {\n // 'found' callback\n if (start <= offset && end >= offset) {\n // this entity overlaps the offset index\n removalRange = {\n start: start,\n end: end\n };\n }\n });\n !(typeof removalRange === 'object') ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Removal range must exist within character list.') : invariant(false) : void 0;\n return removalRange;\n}\nfunction removeForBlock(entityMap, block, offset) {\n var chars = block.getCharacterList();\n var charBefore = offset > 0 ? chars.get(offset - 1) : undefined;\n var charAfter = offset < chars.count() ? chars.get(offset) : undefined;\n var entityBeforeCursor = charBefore ? charBefore.getEntity() : undefined;\n var entityAfterCursor = charAfter ? charAfter.getEntity() : undefined;\n if (entityAfterCursor && entityAfterCursor === entityBeforeCursor) {\n var entity = entityMap.__get(entityAfterCursor);\n if (entity.getMutability() !== 'MUTABLE') {\n var _getRemovalRange = getRemovalRange(chars, entityAfterCursor, offset),\n start = _getRemovalRange.start,\n end = _getRemovalRange.end;\n var current;\n while (start < end) {\n current = chars.get(start);\n chars = chars.set(start, CharacterMetadata.applyEntity(current, null));\n start++;\n }\n return block.set('characterList', chars);\n }\n }\n return block;\n}\nmodule.exports = removeEntitiesAtEdges;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\n/**\n * Maintain persistence for target list when appending and prepending.\n */\nfunction insertIntoList(targetListArg, toInsert, offset) {\n var targetList = targetListArg;\n if (offset === targetList.count()) {\n toInsert.forEach(function (c) {\n targetList = targetList.push(c);\n });\n } else if (offset === 0) {\n toInsert.reverse().forEach(function (c) {\n targetList = targetList.unshift(c);\n });\n } else {\n var head = targetList.slice(0, offset);\n var tail = targetList.slice(offset);\n targetList = head.concat(toInsert, tail).toList();\n }\n return targetList;\n}\nmodule.exports = insertIntoList;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar Immutable = require(\"immutable\");\nvar Map = Immutable.Map;\nfunction modifyBlockForContentState(contentState, selectionState, operation) {\n var startKey = selectionState.getStartKey();\n var endKey = selectionState.getEndKey();\n var blockMap = contentState.getBlockMap();\n var newBlocks = blockMap.toSeq().skipUntil(function (_, k) {\n return k === startKey;\n }).takeUntil(function (_, k) {\n return k === endKey;\n }).concat(Map([[endKey, blockMap.get(endKey)]])).map(operation);\n return contentState.merge({\n blockMap: blockMap.merge(newBlocks),\n selectionBefore: selectionState,\n selectionAfter: selectionState\n });\n}\nmodule.exports = modifyBlockForContentState;","\"use strict\";\n\n/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n *\n * This is unstable and not part of the public API and should not be used by\n * production systems. This file may be update/removed without notice.\n */\nvar ContentBlockNode = require(\"./ContentBlockNode\");\nvar getNextDelimiterBlockKey = function getNextDelimiterBlockKey(block, blockMap) {\n var isExperimentalTreeBlock = block instanceof ContentBlockNode;\n if (!isExperimentalTreeBlock) {\n return null;\n }\n var nextSiblingKey = block.getNextSiblingKey();\n if (nextSiblingKey) {\n return nextSiblingKey;\n }\n var parent = block.getParentKey();\n if (!parent) {\n return null;\n }\n var nextNonDescendantBlock = blockMap.get(parent);\n while (nextNonDescendantBlock && !nextNonDescendantBlock.getNextSiblingKey()) {\n var parentKey = nextNonDescendantBlock.getParentKey();\n nextNonDescendantBlock = parentKey ? blockMap.get(parentKey) : null;\n }\n if (!nextNonDescendantBlock) {\n return null;\n }\n return nextNonDescendantBlock.getNextSiblingKey();\n};\nmodule.exports = getNextDelimiterBlockKey;","\"use strict\";\n\n/**\n * Copyright 2004-present Facebook. All Rights Reserved.\n *\n * \n * @typechecks\n * @format\n */\n\n/**\n * Retrieve an object's own values as an array. If you want the values in the\n * protoype chain, too, use getObjectValuesIncludingPrototype.\n *\n * If you are looking for a function that creates an Array instance based\n * on an \"Array-like\" object, use createArrayFrom instead.\n *\n * @param {object} obj An object.\n * @return {array} The object's values.\n */\nfunction getOwnObjectValues(obj) {\n return Object.keys(obj).map(function (key) {\n return obj[key];\n });\n}\nmodule.exports = getOwnObjectValues;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @legacyServerCallableInstance\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nfunction _inheritsLoose(subClass, superClass) {\n subClass.prototype = Object.create(superClass.prototype);\n subClass.prototype.constructor = subClass;\n subClass.__proto__ = superClass;\n}\nvar Immutable = require(\"immutable\");\nvar Record = Immutable.Record;\nvar DraftEntityInstanceRecord = Record({\n type: 'TOKEN',\n mutability: 'IMMUTABLE',\n data: Object\n});\n/**\n * An instance of a document entity, consisting of a `type` and relevant\n * `data`, metadata about the entity.\n *\n * For instance, a \"link\" entity might provide a URI, and a \"mention\"\n * entity might provide the mentioned user's ID. These pieces of data\n * may be used when rendering the entity as part of a ContentBlock DOM\n * representation. For a link, the data would be used as an href for\n * the rendered anchor. For a mention, the ID could be used to retrieve\n * a hovercard.\n */\n\nvar DraftEntityInstance = /*#__PURE__*/function (_DraftEntityInstanceR) {\n _inheritsLoose(DraftEntityInstance, _DraftEntityInstanceR);\n function DraftEntityInstance() {\n return _DraftEntityInstanceR.apply(this, arguments) || this;\n }\n var _proto = DraftEntityInstance.prototype;\n _proto.getType = function getType() {\n return this.get('type');\n };\n _proto.getMutability = function getMutability() {\n return this.get('mutability');\n };\n _proto.getData = function getData() {\n return this.get('data');\n };\n return DraftEntityInstance;\n}(DraftEntityInstanceRecord);\nmodule.exports = DraftEntityInstance;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar REGEX_BLOCK_DELIMITER = new RegExp('\\r', 'g');\nfunction sanitizeDraftText(input) {\n return input.replace(REGEX_BLOCK_DELIMITER, '');\n}\nmodule.exports = sanitizeDraftText;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nmodule.exports = {\n BOLD: {\n fontWeight: 'bold'\n },\n CODE: {\n fontFamily: 'monospace',\n wordWrap: 'break-word'\n },\n ITALIC: {\n fontStyle: 'italic'\n },\n STRIKETHROUGH: {\n textDecoration: 'line-through'\n },\n UNDERLINE: {\n textDecoration: 'underline'\n }\n};","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\n/**\n * Get offset key from a node or it's child nodes. Return the first offset key\n * found on the DOM tree of given node.\n */\nvar isElement = require(\"./isElement\");\nfunction getSelectionOffsetKeyForNode(node) {\n if (isElement(node)) {\n var castedNode = node;\n var offsetKey = castedNode.getAttribute('data-offset-key');\n if (offsetKey) {\n return offsetKey;\n }\n for (var ii = 0; ii < castedNode.childNodes.length; ii++) {\n var childOffsetKey = getSelectionOffsetKeyForNode(castedNode.childNodes[ii]);\n if (childOffsetKey) {\n return childOffsetKey;\n }\n }\n }\n return null;\n}\nmodule.exports = getSelectionOffsetKeyForNode;","\"use strict\";\n\n/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\nfunction getWindowForNode(node) {\n if (!node || !node.ownerDocument || !node.ownerDocument.defaultView) {\n return window;\n }\n return node.ownerDocument.defaultView;\n}\nmodule.exports = getWindowForNode;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar DraftJsDebugLogging = require(\"./DraftJsDebugLogging\");\nvar EditorState = require(\"./EditorState\");\nvar getContentEditableContainer = require(\"./getContentEditableContainer\");\nvar getDraftEditorSelection = require(\"./getDraftEditorSelection\");\nfunction editOnSelect(editor) {\n if (editor._blockSelectEvents || editor._latestEditorState !== editor.props.editorState) {\n if (editor._blockSelectEvents) {\n var _editorState = editor.props.editorState;\n var selectionState = _editorState.getSelection();\n DraftJsDebugLogging.logBlockedSelectionEvent({\n // For now I don't think we need any other info\n anonymizedDom: 'N/A',\n extraParams: JSON.stringify({\n stacktrace: new Error().stack\n }),\n selectionState: JSON.stringify(selectionState.toJS())\n });\n }\n return;\n }\n var editorState = editor.props.editorState;\n var documentSelection = getDraftEditorSelection(editorState, getContentEditableContainer(editor));\n var updatedSelectionState = documentSelection.selectionState;\n if (updatedSelectionState !== editorState.getSelection()) {\n if (documentSelection.needsRecovery) {\n editorState = EditorState.forceSelection(editorState, updatedSelectionState);\n } else {\n editorState = EditorState.acceptSelection(editorState, updatedSelectionState);\n }\n editor.update(editorState);\n }\n}\nmodule.exports = editOnSelect;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n */\n'use strict';\n\nmodule.exports = {\n logBlockedSelectionEvent: function logBlockedSelectionEvent() {\n return null;\n },\n logSelectionStateFailure: function logSelectionStateFailure() {\n return null;\n }\n};","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar invariant = require(\"fbjs/lib/invariant\");\nvar isHTMLElement = require(\"./isHTMLElement\");\nfunction getContentEditableContainer(editor) {\n var editorNode = editor.editorContainer;\n !editorNode ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Missing editorNode') : invariant(false) : void 0;\n !isHTMLElement(editorNode.firstChild) ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'editorNode.firstChild is not an HTMLElement') : invariant(false) : void 0;\n var htmlElement = editorNode.firstChild;\n return htmlElement;\n}\nmodule.exports = getContentEditableContainer;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar getDraftEditorSelectionWithNodes = require(\"./getDraftEditorSelectionWithNodes\");\n/**\n * Convert the current selection range to an anchor/focus pair of offset keys\n * and values that can be interpreted by components.\n */\n\nfunction getDraftEditorSelection(editorState, root) {\n var selection = root.ownerDocument.defaultView.getSelection();\n var anchorNode = selection.anchorNode,\n anchorOffset = selection.anchorOffset,\n focusNode = selection.focusNode,\n focusOffset = selection.focusOffset,\n rangeCount = selection.rangeCount;\n if (\n // No active selection.\n rangeCount === 0 ||\n // No selection, ever. As in, the user hasn't selected anything since\n // opening the document.\n anchorNode == null || focusNode == null) {\n return {\n selectionState: editorState.getSelection().set('hasFocus', false),\n needsRecovery: false\n };\n }\n return getDraftEditorSelectionWithNodes(editorState, root, anchorNode, anchorOffset, focusNode, focusOffset);\n}\nmodule.exports = getDraftEditorSelection;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar findAncestorOffsetKey = require(\"./findAncestorOffsetKey\");\nvar getSelectionOffsetKeyForNode = require(\"./getSelectionOffsetKeyForNode\");\nvar getUpdatedSelectionState = require(\"./getUpdatedSelectionState\");\nvar invariant = require(\"fbjs/lib/invariant\");\nvar isElement = require(\"./isElement\");\nvar nullthrows = require(\"fbjs/lib/nullthrows\");\n\n/**\n * Convert the current selection range to an anchor/focus pair of offset keys\n * and values that can be interpreted by components.\n */\nfunction getDraftEditorSelectionWithNodes(editorState, root, anchorNode, anchorOffset, focusNode, focusOffset) {\n var anchorIsTextNode = anchorNode.nodeType === Node.TEXT_NODE;\n var focusIsTextNode = focusNode.nodeType === Node.TEXT_NODE; // If the selection range lies only on text nodes, the task is simple.\n // Find the nearest offset-aware elements and use the\n // offset values supplied by the selection range.\n\n if (anchorIsTextNode && focusIsTextNode) {\n return {\n selectionState: getUpdatedSelectionState(editorState, nullthrows(findAncestorOffsetKey(anchorNode)), anchorOffset, nullthrows(findAncestorOffsetKey(focusNode)), focusOffset),\n needsRecovery: false\n };\n }\n var anchorPoint = null;\n var focusPoint = null;\n var needsRecovery = true; // An element is selected. Convert this selection range into leaf offset\n // keys and offset values for consumption at the component level. This\n // is common in Firefox, where select-all and triple click behavior leads\n // to entire elements being selected.\n //\n // Note that we use the `needsRecovery` parameter in the callback here. This\n // is because when certain elements are selected, the behavior for subsequent\n // cursor movement (e.g. via arrow keys) is uncertain and may not match\n // expectations at the component level. For example, if an entire is\n // selected and the user presses the right arrow, Firefox keeps the selection\n // on the
. If we allow subsequent keypresses to insert characters\n // natively, they will be inserted into a browser-created text node to the\n // right of that
. This is obviously undesirable.\n //\n // With the `needsRecovery` flag, we inform the caller that it is responsible\n // for manually setting the selection state on the rendered document to\n // ensure proper selection state maintenance.\n\n if (anchorIsTextNode) {\n anchorPoint = {\n key: nullthrows(findAncestorOffsetKey(anchorNode)),\n offset: anchorOffset\n };\n focusPoint = getPointForNonTextNode(root, focusNode, focusOffset);\n } else if (focusIsTextNode) {\n focusPoint = {\n key: nullthrows(findAncestorOffsetKey(focusNode)),\n offset: focusOffset\n };\n anchorPoint = getPointForNonTextNode(root, anchorNode, anchorOffset);\n } else {\n anchorPoint = getPointForNonTextNode(root, anchorNode, anchorOffset);\n focusPoint = getPointForNonTextNode(root, focusNode, focusOffset); // If the selection is collapsed on an empty block, don't force recovery.\n // This way, on arrow key selection changes, the browser can move the\n // cursor from a non-zero offset on one block, through empty blocks,\n // to a matching non-zero offset on other text blocks.\n\n if (anchorNode === focusNode && anchorOffset === focusOffset) {\n needsRecovery = !!anchorNode.firstChild && anchorNode.firstChild.nodeName !== 'BR';\n }\n }\n return {\n selectionState: getUpdatedSelectionState(editorState, anchorPoint.key, anchorPoint.offset, focusPoint.key, focusPoint.offset),\n needsRecovery: needsRecovery\n };\n}\n/**\n * Identify the first leaf descendant for the given node.\n */\n\nfunction getFirstLeaf(node) {\n while (node.firstChild && (\n // data-blocks has no offset\n isElement(node.firstChild) && node.firstChild.getAttribute('data-blocks') === 'true' || getSelectionOffsetKeyForNode(node.firstChild))) {\n node = node.firstChild;\n }\n return node;\n}\n/**\n * Identify the last leaf descendant for the given node.\n */\n\nfunction getLastLeaf(node) {\n while (node.lastChild && (\n // data-blocks has no offset\n isElement(node.lastChild) && node.lastChild.getAttribute('data-blocks') === 'true' || getSelectionOffsetKeyForNode(node.lastChild))) {\n node = node.lastChild;\n }\n return node;\n}\nfunction getPointForNonTextNode(editorRoot, startNode, childOffset) {\n var node = startNode;\n var offsetKey = findAncestorOffsetKey(node);\n !(offsetKey != null || editorRoot && (editorRoot === node || editorRoot.firstChild === node)) ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Unknown node in selection range.') : invariant(false) : void 0; // If the editorRoot is the selection, step downward into the content\n // wrapper.\n\n if (editorRoot === node) {\n node = node.firstChild;\n !isElement(node) ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Invalid DraftEditorContents node.') : invariant(false) : void 0;\n var castedNode = node; // assignment only added for flow :/\n // otherwise it throws in line 200 saying that node can be null or undefined\n\n node = castedNode;\n !(node.getAttribute('data-contents') === 'true') ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Invalid DraftEditorContents structure.') : invariant(false) : void 0;\n if (childOffset > 0) {\n childOffset = node.childNodes.length;\n }\n } // If the child offset is zero and we have an offset key, we're done.\n // If there's no offset key because the entire editor is selected,\n // find the leftmost (\"first\") leaf in the tree and use that as the offset\n // key.\n\n if (childOffset === 0) {\n var key = null;\n if (offsetKey != null) {\n key = offsetKey;\n } else {\n var firstLeaf = getFirstLeaf(node);\n key = nullthrows(getSelectionOffsetKeyForNode(firstLeaf));\n }\n return {\n key: key,\n offset: 0\n };\n }\n var nodeBeforeCursor = node.childNodes[childOffset - 1];\n var leafKey = null;\n var textLength = null;\n if (!getSelectionOffsetKeyForNode(nodeBeforeCursor)) {\n // Our target node may be a leaf or a text node, in which case we're\n // already where we want to be and can just use the child's length as\n // our offset.\n leafKey = nullthrows(offsetKey);\n textLength = getTextContentLength(nodeBeforeCursor);\n } else {\n // Otherwise, we'll look at the child to the left of the cursor and find\n // the last leaf node in its subtree.\n var lastLeaf = getLastLeaf(nodeBeforeCursor);\n leafKey = nullthrows(getSelectionOffsetKeyForNode(lastLeaf));\n textLength = getTextContentLength(lastLeaf);\n }\n return {\n key: leafKey,\n offset: textLength\n };\n}\n/**\n * Return the length of a node's textContent, regarding single newline\n * characters as zero-length. This allows us to avoid problems with identifying\n * the correct selection offset for empty blocks in IE, in which we\n * render newlines instead of break tags.\n */\n\nfunction getTextContentLength(node) {\n var textContent = node.textContent;\n return textContent === '\\n' ? 0 : textContent.length;\n}\nmodule.exports = getDraftEditorSelectionWithNodes;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar DraftOffsetKey = require(\"./DraftOffsetKey\");\nvar nullthrows = require(\"fbjs/lib/nullthrows\");\nfunction getUpdatedSelectionState(editorState, anchorKey, anchorOffset, focusKey, focusOffset) {\n var selection = nullthrows(editorState.getSelection());\n if (!anchorKey || !focusKey) {\n // If we cannot make sense of the updated selection state, stick to the current one.\n if (process.env.NODE_ENV !== \"production\") {\n /* eslint-disable-next-line */\n console.warn('Invalid selection state.', arguments, editorState.toJS());\n }\n return selection;\n }\n var anchorPath = DraftOffsetKey.decode(anchorKey);\n var anchorBlockKey = anchorPath.blockKey;\n var anchorLeafBlockTree = editorState.getBlockTree(anchorBlockKey);\n var anchorLeaf = anchorLeafBlockTree && anchorLeafBlockTree.getIn([anchorPath.decoratorKey, 'leaves', anchorPath.leafKey]);\n var focusPath = DraftOffsetKey.decode(focusKey);\n var focusBlockKey = focusPath.blockKey;\n var focusLeafBlockTree = editorState.getBlockTree(focusBlockKey);\n var focusLeaf = focusLeafBlockTree && focusLeafBlockTree.getIn([focusPath.decoratorKey, 'leaves', focusPath.leafKey]);\n if (!anchorLeaf || !focusLeaf) {\n // If we cannot make sense of the updated selection state, stick to the current one.\n if (process.env.NODE_ENV !== \"production\") {\n /* eslint-disable-next-line */\n console.warn('Invalid selection state.', arguments, editorState.toJS());\n }\n return selection;\n }\n var anchorLeafStart = anchorLeaf.get('start');\n var focusLeafStart = focusLeaf.get('start');\n var anchorBlockOffset = anchorLeaf ? anchorLeafStart + anchorOffset : null;\n var focusBlockOffset = focusLeaf ? focusLeafStart + focusOffset : null;\n var areEqual = selection.getAnchorKey() === anchorBlockKey && selection.getAnchorOffset() === anchorBlockOffset && selection.getFocusKey() === focusBlockKey && selection.getFocusOffset() === focusBlockOffset;\n if (areEqual) {\n return selection;\n }\n var isBackward = false;\n if (anchorBlockKey === focusBlockKey) {\n var anchorLeafEnd = anchorLeaf.get('end');\n var focusLeafEnd = focusLeaf.get('end');\n if (focusLeafStart === anchorLeafStart && focusLeafEnd === anchorLeafEnd) {\n isBackward = focusOffset < anchorOffset;\n } else {\n isBackward = focusLeafStart < anchorLeafStart;\n }\n } else {\n var startKey = editorState.getCurrentContent().getBlockMap().keySeq().skipUntil(function (v) {\n return v === anchorBlockKey || v === focusBlockKey;\n }).first();\n isBackward = startKey === focusBlockKey;\n }\n return selection.merge({\n anchorKey: anchorBlockKey,\n anchorOffset: anchorBlockOffset,\n focusKey: focusBlockKey,\n focusOffset: focusBlockOffset,\n isBackward: isBackward\n });\n}\nmodule.exports = getUpdatedSelectionState;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * Provides utilities for handling draftjs keys.\n *\n * @emails oncall+draft_js\n * \n * @format\n */\n'use strict';\n\nfunction notEmptyKey(key) {\n return key != null && key != '';\n}\nmodule.exports = {\n notEmptyKey: notEmptyKey\n};","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar _assign = require(\"object-assign\");\nfunction _assertThisInitialized(self) {\n if (self === void 0) {\n throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\");\n }\n return self;\n}\nfunction _inheritsLoose(subClass, superClass) {\n subClass.prototype = Object.create(superClass.prototype);\n subClass.prototype.constructor = subClass;\n subClass.__proto__ = superClass;\n}\nfunction _defineProperty(obj, key, value) {\n if (key in obj) {\n Object.defineProperty(obj, key, {\n value: value,\n enumerable: true,\n configurable: true,\n writable: true\n });\n } else {\n obj[key] = value;\n }\n return obj;\n}\nvar DraftEditorTextNode = require(\"./DraftEditorTextNode.react\");\nvar React = require(\"react\");\nvar invariant = require(\"fbjs/lib/invariant\");\nvar isHTMLBRElement = require(\"./isHTMLBRElement\");\nvar setDraftEditorSelection = require(\"./setDraftEditorSelection\").setDraftEditorSelection;\n\n/**\n * All leaf nodes in the editor are spans with single text nodes. Leaf\n * elements are styled based on the merging of an optional custom style map\n * and a default style map.\n *\n * `DraftEditorLeaf` also provides a wrapper for calling into the imperative\n * DOM Selection API. In this way, top-level components can declaratively\n * maintain the selection state.\n */\nvar DraftEditorLeaf = /*#__PURE__*/function (_React$Component) {\n _inheritsLoose(DraftEditorLeaf, _React$Component);\n function DraftEditorLeaf() {\n var _this;\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n _this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this;\n _defineProperty(_assertThisInitialized(_this), \"leaf\", void 0);\n return _this;\n }\n var _proto = DraftEditorLeaf.prototype;\n _proto._setSelection = function _setSelection() {\n var selection = this.props.selection; // If selection state is irrelevant to the parent block, no-op.\n\n if (selection == null || !selection.getHasFocus()) {\n return;\n }\n var _this$props = this.props,\n block = _this$props.block,\n start = _this$props.start,\n text = _this$props.text;\n var blockKey = block.getKey();\n var end = start + text.length;\n if (!selection.hasEdgeWithin(blockKey, start, end)) {\n return;\n } // Determine the appropriate target node for selection. If the child\n // is not a text node, it is a
spacer. In this case, use the\n // itself as the selection target.\n\n var node = this.leaf;\n !node ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Missing node') : invariant(false) : void 0;\n var child = node.firstChild;\n !child ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Missing child') : invariant(false) : void 0;\n var targetNode;\n if (child.nodeType === Node.TEXT_NODE) {\n targetNode = child;\n } else if (isHTMLBRElement(child)) {\n targetNode = node;\n } else {\n targetNode = child.firstChild;\n !targetNode ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Missing targetNode') : invariant(false) : void 0;\n }\n setDraftEditorSelection(selection, targetNode, blockKey, start, end);\n };\n _proto.shouldComponentUpdate = function shouldComponentUpdate(nextProps) {\n var leafNode = this.leaf;\n !leafNode ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Missing leafNode') : invariant(false) : void 0;\n var shouldUpdate = leafNode.textContent !== nextProps.text || nextProps.styleSet !== this.props.styleSet || nextProps.forceSelection;\n return shouldUpdate;\n };\n _proto.componentDidUpdate = function componentDidUpdate() {\n this._setSelection();\n };\n _proto.componentDidMount = function componentDidMount() {\n this._setSelection();\n };\n _proto.render = function render() {\n var _this2 = this;\n var block = this.props.block;\n var text = this.props.text; // If the leaf is at the end of its block and ends in a soft newline, append\n // an extra line feed character. Browsers collapse trailing newline\n // characters, which leaves the cursor in the wrong place after a\n // shift+enter. The extra character repairs this.\n\n if (text.endsWith('\\n') && this.props.isLast) {\n text += '\\n';\n }\n var _this$props2 = this.props,\n customStyleMap = _this$props2.customStyleMap,\n customStyleFn = _this$props2.customStyleFn,\n offsetKey = _this$props2.offsetKey,\n styleSet = _this$props2.styleSet;\n var styleObj = styleSet.reduce(function (map, styleName) {\n var mergedStyles = {};\n var style = customStyleMap[styleName];\n if (style !== undefined && map.textDecoration !== style.textDecoration) {\n // .trim() is necessary for IE9/10/11 and Edge\n mergedStyles.textDecoration = [map.textDecoration, style.textDecoration].join(' ').trim();\n }\n return _assign(map, style, mergedStyles);\n }, {});\n if (customStyleFn) {\n var newStyles = customStyleFn(styleSet, block);\n styleObj = _assign(styleObj, newStyles);\n }\n return React.createElement(\"span\", {\n \"data-offset-key\": offsetKey,\n ref: function ref(_ref) {\n return _this2.leaf = _ref;\n },\n style: styleObj\n }, React.createElement(DraftEditorTextNode, null, text));\n };\n return DraftEditorLeaf;\n}(React.Component);\nmodule.exports = DraftEditorLeaf;","\"use strict\";\n\n/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\nvar isElement = require(\"./isElement\");\nfunction isHTMLBRElement(node) {\n if (!node || !node.ownerDocument) {\n return false;\n }\n return isElement(node) && node.nodeName === 'BR';\n}\nmodule.exports = isHTMLBRElement;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n */\n'use strict';\n\nmodule.exports = {\n initODS: function initODS() {},\n handleExtensionCausedError: function handleExtensionCausedError() {}\n};","\"use strict\";\n\n/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @typechecks\n */\n\n/* eslint-disable fb-www/typeof-undefined */\n\n/**\n * Same as document.activeElement but wraps in a try-catch block. In IE it is\n * not safe to call document.activeElement if there is nothing focused.\n *\n * The activeElement will be null only if the document or document body is not\n * yet defined.\n *\n * @param {?DOMDocument} doc Defaults to current document.\n * @return {?DOMElement}\n */\nfunction getActiveElement(doc) /*?DOMElement*/\n{\n doc = doc || (typeof document !== 'undefined' ? document : undefined);\n if (typeof doc === 'undefined') {\n return null;\n }\n try {\n return doc.activeElement || doc.body;\n } catch (e) {\n return doc.body;\n }\n}\nmodule.exports = getActiveElement;","\"use strict\";\n\n/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @typechecks\n */\nvar getElementRect = require(\"./getElementRect\");\n/**\n * Gets an element's position in pixels relative to the viewport. The returned\n * object represents the position of the element's top left corner.\n *\n * @param {DOMElement} element\n * @return {object}\n */\n\nfunction getElementPosition(element) {\n var rect = getElementRect(element);\n return {\n x: rect.left,\n y: rect.top,\n width: rect.right - rect.left,\n height: rect.bottom - rect.top\n };\n}\nmodule.exports = getElementPosition;","\"use strict\";\n\n/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * \n * @typechecks\n */\nfunction getViewportWidth() {\n var width;\n if (document.documentElement) {\n width = document.documentElement.clientWidth;\n }\n if (!width && document.body) {\n width = document.body.clientWidth;\n }\n return width || 0;\n}\nfunction getViewportHeight() {\n var height;\n if (document.documentElement) {\n height = document.documentElement.clientHeight;\n }\n if (!height && document.body) {\n height = document.body.clientHeight;\n }\n return height || 0;\n}\n/**\n * Gets the viewport dimensions including any scrollbars.\n */\n\nfunction getViewportDimensions() {\n return {\n width: window.innerWidth || getViewportWidth(),\n height: window.innerHeight || getViewportHeight()\n };\n}\n/**\n * Gets the viewport dimensions excluding any scrollbars.\n */\n\ngetViewportDimensions.withoutScrollbars = function () {\n return {\n width: getViewportWidth(),\n height: getViewportHeight()\n };\n};\nmodule.exports = getViewportDimensions;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar _assign = require(\"object-assign\");\nfunction _extends() {\n _extends = _assign || function (target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i];\n for (var key in source) {\n if (Object.prototype.hasOwnProperty.call(source, key)) {\n target[key] = source[key];\n }\n }\n }\n return target;\n };\n return _extends.apply(this, arguments);\n}\nfunction _assertThisInitialized(self) {\n if (self === void 0) {\n throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\");\n }\n return self;\n}\nfunction _inheritsLoose(subClass, superClass) {\n subClass.prototype = Object.create(superClass.prototype);\n subClass.prototype.constructor = subClass;\n subClass.__proto__ = superClass;\n}\nfunction _defineProperty(obj, key, value) {\n if (key in obj) {\n Object.defineProperty(obj, key, {\n value: value,\n enumerable: true,\n configurable: true,\n writable: true\n });\n } else {\n obj[key] = value;\n }\n return obj;\n}\nvar DraftEditorLeaf = require(\"./DraftEditorLeaf.react\");\nvar DraftOffsetKey = require(\"./DraftOffsetKey\");\nvar React = require(\"react\");\nvar Scroll = require(\"fbjs/lib/Scroll\");\nvar Style = require(\"fbjs/lib/Style\");\nvar UnicodeBidi = require(\"fbjs/lib/UnicodeBidi\");\nvar UnicodeBidiDirection = require(\"fbjs/lib/UnicodeBidiDirection\");\nvar cx = require(\"fbjs/lib/cx\");\nvar getElementPosition = require(\"fbjs/lib/getElementPosition\");\nvar getScrollPosition = require(\"fbjs/lib/getScrollPosition\");\nvar getViewportDimensions = require(\"fbjs/lib/getViewportDimensions\");\nvar invariant = require(\"fbjs/lib/invariant\");\nvar isHTMLElement = require(\"./isHTMLElement\");\nvar nullthrows = require(\"fbjs/lib/nullthrows\");\nvar SCROLL_BUFFER = 10;\n\n/**\n * Return whether a block overlaps with either edge of the `SelectionState`.\n */\nvar isBlockOnSelectionEdge = function isBlockOnSelectionEdge(selection, key) {\n return selection.getAnchorKey() === key || selection.getFocusKey() === key;\n};\n/**\n * The default block renderer for a `DraftEditor` component.\n *\n * A `DraftEditorBlock` is able to render a given `ContentBlock` to its\n * appropriate decorator and inline style components.\n */\n\nvar DraftEditorBlock = /*#__PURE__*/function (_React$Component) {\n _inheritsLoose(DraftEditorBlock, _React$Component);\n function DraftEditorBlock() {\n var _this;\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n _this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this;\n _defineProperty(_assertThisInitialized(_this), \"_node\", void 0);\n return _this;\n }\n var _proto = DraftEditorBlock.prototype;\n _proto.shouldComponentUpdate = function shouldComponentUpdate(nextProps) {\n return this.props.block !== nextProps.block || this.props.tree !== nextProps.tree || this.props.direction !== nextProps.direction || isBlockOnSelectionEdge(nextProps.selection, nextProps.block.getKey()) && nextProps.forceSelection;\n }\n /**\n * When a block is mounted and overlaps the selection state, we need to make\n * sure that the cursor is visible to match native behavior. This may not\n * be the case if the user has pressed `RETURN` or pasted some content, since\n * programmatically creating these new blocks and setting the DOM selection\n * will miss out on the browser natively scrolling to that position.\n *\n * To replicate native behavior, if the block overlaps the selection state\n * on mount, force the scroll position. Check the scroll state of the scroll\n * parent, and adjust it to align the entire block to the bottom of the\n * scroll parent.\n */;\n\n _proto.componentDidMount = function componentDidMount() {\n if (this.props.preventScroll) {\n return;\n }\n var selection = this.props.selection;\n var endKey = selection.getEndKey();\n if (!selection.getHasFocus() || endKey !== this.props.block.getKey()) {\n return;\n }\n var blockNode = this._node;\n if (blockNode == null) {\n return;\n }\n var scrollParent = Style.getScrollParent(blockNode);\n var scrollPosition = getScrollPosition(scrollParent);\n var scrollDelta;\n if (scrollParent === window) {\n var nodePosition = getElementPosition(blockNode);\n var nodeBottom = nodePosition.y + nodePosition.height;\n var viewportHeight = getViewportDimensions().height;\n scrollDelta = nodeBottom - viewportHeight;\n if (scrollDelta > 0) {\n window.scrollTo(scrollPosition.x, scrollPosition.y + scrollDelta + SCROLL_BUFFER);\n }\n } else {\n !isHTMLElement(blockNode) ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'blockNode is not an HTMLElement') : invariant(false) : void 0;\n var blockBottom = blockNode.offsetHeight + blockNode.offsetTop;\n var pOffset = scrollParent.offsetTop + scrollParent.offsetHeight;\n var scrollBottom = pOffset + scrollPosition.y;\n scrollDelta = blockBottom - scrollBottom;\n if (scrollDelta > 0) {\n Scroll.setTop(scrollParent, Scroll.getTop(scrollParent) + scrollDelta + SCROLL_BUFFER);\n }\n }\n };\n _proto._renderChildren = function _renderChildren() {\n var _this2 = this;\n var block = this.props.block;\n var blockKey = block.getKey();\n var text = block.getText();\n var lastLeafSet = this.props.tree.size - 1;\n var hasSelection = isBlockOnSelectionEdge(this.props.selection, blockKey);\n return this.props.tree.map(function (leafSet, ii) {\n var leavesForLeafSet = leafSet.get('leaves'); // T44088704\n\n if (leavesForLeafSet.size === 0) {\n return null;\n }\n var lastLeaf = leavesForLeafSet.size - 1;\n var leaves = leavesForLeafSet.map(function (leaf, jj) {\n var offsetKey = DraftOffsetKey.encode(blockKey, ii, jj);\n var start = leaf.get('start');\n var end = leaf.get('end');\n return React.createElement(DraftEditorLeaf, {\n key: offsetKey,\n offsetKey: offsetKey,\n block: block,\n start: start,\n selection: hasSelection ? _this2.props.selection : null,\n forceSelection: _this2.props.forceSelection,\n text: text.slice(start, end),\n styleSet: block.getInlineStyleAt(start),\n customStyleMap: _this2.props.customStyleMap,\n customStyleFn: _this2.props.customStyleFn,\n isLast: ii === lastLeafSet && jj === lastLeaf\n });\n }).toArray();\n var decoratorKey = leafSet.get('decoratorKey');\n if (decoratorKey == null) {\n return leaves;\n }\n if (!_this2.props.decorator) {\n return leaves;\n }\n var decorator = nullthrows(_this2.props.decorator);\n var DecoratorComponent = decorator.getComponentForKey(decoratorKey);\n if (!DecoratorComponent) {\n return leaves;\n }\n var decoratorProps = decorator.getPropsForKey(decoratorKey);\n var decoratorOffsetKey = DraftOffsetKey.encode(blockKey, ii, 0);\n var start = leavesForLeafSet.first().get('start');\n var end = leavesForLeafSet.last().get('end');\n var decoratedText = text.slice(start, end);\n var entityKey = block.getEntityAt(leafSet.get('start')); // Resetting dir to the same value on a child node makes Chrome/Firefox\n // confused on cursor movement. See http://jsfiddle.net/d157kLck/3/\n\n var dir = UnicodeBidiDirection.getHTMLDirIfDifferent(UnicodeBidi.getDirection(decoratedText), _this2.props.direction);\n var commonProps = {\n contentState: _this2.props.contentState,\n decoratedText: decoratedText,\n dir: dir,\n start: start,\n end: end,\n blockKey: blockKey,\n entityKey: entityKey,\n offsetKey: decoratorOffsetKey\n };\n return React.createElement(DecoratorComponent, _extends({}, decoratorProps, commonProps, {\n key: decoratorOffsetKey\n }), leaves);\n }).toArray();\n };\n _proto.render = function render() {\n var _this3 = this;\n var _this$props = this.props,\n direction = _this$props.direction,\n offsetKey = _this$props.offsetKey;\n var className = cx({\n 'public/DraftStyleDefault/block': true,\n 'public/DraftStyleDefault/ltr': direction === 'LTR',\n 'public/DraftStyleDefault/rtl': direction === 'RTL'\n });\n return React.createElement(\"div\", {\n \"data-offset-key\": offsetKey,\n className: className,\n ref: function ref(_ref) {\n return _this3._node = _ref;\n }\n }, this._renderChildren());\n };\n return DraftEditorBlock;\n}(React.Component);\nmodule.exports = DraftEditorBlock;","\"use strict\";\n\n/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @typechecks\n */\nvar PhotosMimeType = require(\"./PhotosMimeType\");\nvar createArrayFromMixed = require(\"./createArrayFromMixed\");\nvar emptyFunction = require(\"./emptyFunction\");\nvar CR_LF_REGEX = new RegExp(\"\\r\\n\", 'g');\nvar LF_ONLY = \"\\n\";\nvar RICH_TEXT_TYPES = {\n 'text/rtf': 1,\n 'text/html': 1\n};\n/**\n * If DataTransferItem is a file then return the Blob of data.\n *\n * @param {object} item\n * @return {?blob}\n */\n\nfunction getFileFromDataTransfer(item) {\n if (item.kind == 'file') {\n return item.getAsFile();\n }\n}\nvar DataTransfer = /*#__PURE__*/\nfunction () {\n /**\n * @param {object} data\n */\n function DataTransfer(data) {\n this.data = data; // Types could be DOMStringList or array\n\n this.types = data.types ? createArrayFromMixed(data.types) : [];\n }\n /**\n * Is this likely to be a rich text data transfer?\n *\n * @return {boolean}\n */\n\n var _proto = DataTransfer.prototype;\n _proto.isRichText = function isRichText() {\n // If HTML is available, treat this data as rich text. This way, we avoid\n // using a pasted image if it is packaged with HTML -- this may occur with\n // pastes from MS Word, for example. However this is only rich text if\n // there's accompanying text.\n if (this.getHTML() && this.getText()) {\n return true;\n } // When an image is copied from a preview window, you end up with two\n // DataTransferItems one of which is a file's metadata as text. Skip those.\n\n if (this.isImage()) {\n return false;\n }\n return this.types.some(function (type) {\n return RICH_TEXT_TYPES[type];\n });\n };\n /**\n * Get raw text.\n *\n * @return {?string}\n */\n\n _proto.getText = function getText() {\n var text;\n if (this.data.getData) {\n if (!this.types.length) {\n text = this.data.getData('Text');\n } else if (this.types.indexOf('text/plain') != -1) {\n text = this.data.getData('text/plain');\n }\n }\n return text ? text.replace(CR_LF_REGEX, LF_ONLY) : null;\n };\n /**\n * Get HTML paste data\n *\n * @return {?string}\n */\n\n _proto.getHTML = function getHTML() {\n if (this.data.getData) {\n if (!this.types.length) {\n return this.data.getData('Text');\n } else if (this.types.indexOf('text/html') != -1) {\n return this.data.getData('text/html');\n }\n }\n };\n /**\n * Is this a link data transfer?\n *\n * @return {boolean}\n */\n\n _proto.isLink = function isLink() {\n return this.types.some(function (type) {\n return type.indexOf('Url') != -1 || type.indexOf('text/uri-list') != -1 || type.indexOf('text/x-moz-url');\n });\n };\n /**\n * Get a link url.\n *\n * @return {?string}\n */\n\n _proto.getLink = function getLink() {\n if (this.data.getData) {\n if (this.types.indexOf('text/x-moz-url') != -1) {\n var url = this.data.getData('text/x-moz-url').split('\\n');\n return url[0];\n }\n return this.types.indexOf('text/uri-list') != -1 ? this.data.getData('text/uri-list') : this.data.getData('url');\n }\n return null;\n };\n /**\n * Is this an image data transfer?\n *\n * @return {boolean}\n */\n\n _proto.isImage = function isImage() {\n var isImage = this.types.some(function (type) {\n // Firefox will have a type of application/x-moz-file for images during\n // dragging\n return type.indexOf('application/x-moz-file') != -1;\n });\n if (isImage) {\n return true;\n }\n var items = this.getFiles();\n for (var i = 0; i < items.length; i++) {\n var type = items[i].type;\n if (!PhotosMimeType.isImage(type)) {\n return false;\n }\n }\n return true;\n };\n _proto.getCount = function getCount() {\n if (this.data.hasOwnProperty('items')) {\n return this.data.items.length;\n } else if (this.data.hasOwnProperty('mozItemCount')) {\n return this.data.mozItemCount;\n } else if (this.data.files) {\n return this.data.files.length;\n }\n return null;\n };\n /**\n * Get files.\n *\n * @return {array}\n */\n\n _proto.getFiles = function getFiles() {\n if (this.data.items) {\n // createArrayFromMixed doesn't properly handle DataTransferItemLists.\n return Array.prototype.slice.call(this.data.items).map(getFileFromDataTransfer).filter(emptyFunction.thatReturnsArgument);\n } else if (this.data.files) {\n return Array.prototype.slice.call(this.data.files);\n } else {\n return [];\n }\n };\n /**\n * Are there any files to fetch?\n *\n * @return {boolean}\n */\n\n _proto.hasFiles = function hasFiles() {\n return this.getFiles().length > 0;\n };\n return DataTransfer;\n}();\nmodule.exports = DataTransfer;","\"use strict\";\n\n/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * \n */\nfunction makeEmptyFunction(arg) {\n return function () {\n return arg;\n };\n}\n/**\n * This function accepts and discards inputs; it has no side effects. This is\n * primarily useful idiomatically for overridable function endpoints which\n * always need to be callable, since JS lacks a null-call idiom ala Cocoa.\n */\n\nvar emptyFunction = function emptyFunction() {};\nemptyFunction.thatReturns = makeEmptyFunction;\nemptyFunction.thatReturnsFalse = makeEmptyFunction(false);\nemptyFunction.thatReturnsTrue = makeEmptyFunction(true);\nemptyFunction.thatReturnsNull = makeEmptyFunction(null);\nemptyFunction.thatReturnsThis = function () {\n return this;\n};\nemptyFunction.thatReturnsArgument = function (arg) {\n return arg;\n};\nmodule.exports = emptyFunction;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar invariant = require(\"fbjs/lib/invariant\");\nvar TEXT_CLIPPING_REGEX = /\\.textClipping$/;\nvar TEXT_TYPES = {\n 'text/plain': true,\n 'text/html': true,\n 'text/rtf': true\n}; // Somewhat arbitrary upper bound on text size. Let's not lock up the browser.\n\nvar TEXT_SIZE_UPPER_BOUND = 5000;\n/**\n * Extract the text content from a file list.\n */\n\nfunction getTextContentFromFiles(files, callback) {\n var readCount = 0;\n var results = [];\n files.forEach(function ( /*blob*/\n file) {\n readFile(file, function ( /*string*/\n text) {\n readCount++;\n text && results.push(text.slice(0, TEXT_SIZE_UPPER_BOUND));\n if (readCount == files.length) {\n callback(results.join('\\r'));\n }\n });\n });\n}\n/**\n * todo isaac: Do work to turn html/rtf into a content fragment.\n */\n\nfunction readFile(file, callback) {\n if (!global.FileReader || file.type && !(file.type in TEXT_TYPES)) {\n callback('');\n return;\n }\n if (file.type === '') {\n var _contents = ''; // Special-case text clippings, which have an empty type but include\n // `.textClipping` in the file name. `readAsText` results in an empty\n // string for text clippings, so we force the file name to serve\n // as the text value for the file.\n\n if (TEXT_CLIPPING_REGEX.test(file.name)) {\n _contents = file.name.replace(TEXT_CLIPPING_REGEX, '');\n }\n callback(_contents);\n return;\n }\n var reader = new FileReader();\n reader.onload = function () {\n var result = reader.result;\n !(typeof result === 'string') ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'We should be calling \"FileReader.readAsText\" which returns a string') : invariant(false) : void 0;\n callback(result);\n };\n reader.onerror = function () {\n callback('');\n };\n reader.readAsText(file);\n}\nmodule.exports = getTextContentFromFiles;","(function (global, undefined) {\n \"use strict\";\n\n if (global.setImmediate) {\n return;\n }\n var nextHandle = 1; // Spec says greater than zero\n var tasksByHandle = {};\n var currentlyRunningATask = false;\n var doc = global.document;\n var registerImmediate;\n function setImmediate(callback) {\n // Callback can either be a function or a string\n if (typeof callback !== \"function\") {\n callback = new Function(\"\" + callback);\n }\n // Copy function arguments\n var args = new Array(arguments.length - 1);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i + 1];\n }\n // Store and register the task\n var task = {\n callback: callback,\n args: args\n };\n tasksByHandle[nextHandle] = task;\n registerImmediate(nextHandle);\n return nextHandle++;\n }\n function clearImmediate(handle) {\n delete tasksByHandle[handle];\n }\n function run(task) {\n var callback = task.callback;\n var args = task.args;\n switch (args.length) {\n case 0:\n callback();\n break;\n case 1:\n callback(args[0]);\n break;\n case 2:\n callback(args[0], args[1]);\n break;\n case 3:\n callback(args[0], args[1], args[2]);\n break;\n default:\n callback.apply(undefined, args);\n break;\n }\n }\n function runIfPresent(handle) {\n // From the spec: \"Wait until any invocations of this algorithm started before this one have completed.\"\n // So if we're currently running a task, we'll need to delay this invocation.\n if (currentlyRunningATask) {\n // Delay by doing a setTimeout. setImmediate was tried instead, but in Firefox 7 it generated a\n // \"too much recursion\" error.\n setTimeout(runIfPresent, 0, handle);\n } else {\n var task = tasksByHandle[handle];\n if (task) {\n currentlyRunningATask = true;\n try {\n run(task);\n } finally {\n clearImmediate(handle);\n currentlyRunningATask = false;\n }\n }\n }\n }\n function installNextTickImplementation() {\n registerImmediate = function (handle) {\n process.nextTick(function () {\n runIfPresent(handle);\n });\n };\n }\n function canUsePostMessage() {\n // The test against `importScripts` prevents this implementation from being installed inside a web worker,\n // where `global.postMessage` means something completely different and can't be used for this purpose.\n if (global.postMessage && !global.importScripts) {\n var postMessageIsAsynchronous = true;\n var oldOnMessage = global.onmessage;\n global.onmessage = function () {\n postMessageIsAsynchronous = false;\n };\n global.postMessage(\"\", \"*\");\n global.onmessage = oldOnMessage;\n return postMessageIsAsynchronous;\n }\n }\n function installPostMessageImplementation() {\n // Installs an event handler on `global` for the `message` event: see\n // * https://developer.mozilla.org/en/DOM/window.postMessage\n // * http://www.whatwg.org/specs/web-apps/current-work/multipage/comms.html#crossDocumentMessages\n\n var messagePrefix = \"setImmediate$\" + Math.random() + \"$\";\n var onGlobalMessage = function (event) {\n if (event.source === global && typeof event.data === \"string\" && event.data.indexOf(messagePrefix) === 0) {\n runIfPresent(+event.data.slice(messagePrefix.length));\n }\n };\n if (global.addEventListener) {\n global.addEventListener(\"message\", onGlobalMessage, false);\n } else {\n global.attachEvent(\"onmessage\", onGlobalMessage);\n }\n registerImmediate = function (handle) {\n global.postMessage(messagePrefix + handle, \"*\");\n };\n }\n function installMessageChannelImplementation() {\n var channel = new MessageChannel();\n channel.port1.onmessage = function (event) {\n var handle = event.data;\n runIfPresent(handle);\n };\n registerImmediate = function (handle) {\n channel.port2.postMessage(handle);\n };\n }\n function installReadyStateChangeImplementation() {\n var html = doc.documentElement;\n registerImmediate = function (handle) {\n // Create a
spacer. In this case, use the\n // itself as the selection target.\n\n var node = this.leaf;\n !node ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Missing node') : invariant(false) : void 0;\n var child = node.firstChild;\n !child ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Missing child') : invariant(false) : void 0;\n var targetNode;\n if (child.nodeType === Node.TEXT_NODE) {\n targetNode = child;\n } else if (isHTMLBRElement(child)) {\n targetNode = node;\n } else {\n targetNode = child.firstChild;\n !targetNode ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Missing targetNode') : invariant(false) : void 0;\n }\n setDraftEditorSelection(selection, targetNode, blockKey, start, end);\n };\n _proto.shouldComponentUpdate = function shouldComponentUpdate(nextProps) {\n var leafNode = this.leaf;\n !leafNode ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'Missing leafNode') : invariant(false) : void 0;\n var shouldUpdate = leafNode.textContent !== nextProps.text || nextProps.styleSet !== this.props.styleSet || nextProps.forceSelection;\n return shouldUpdate;\n };\n _proto.componentDidUpdate = function componentDidUpdate() {\n this._setSelection();\n };\n _proto.componentDidMount = function componentDidMount() {\n this._setSelection();\n };\n _proto.render = function render() {\n var _this2 = this;\n var block = this.props.block;\n var text = this.props.text; // If the leaf is at the end of its block and ends in a soft newline, append\n // an extra line feed character. Browsers collapse trailing newline\n // characters, which leaves the cursor in the wrong place after a\n // shift+enter. The extra character repairs this.\n\n if (text.endsWith('\\n') && this.props.isLast) {\n text += '\\n';\n }\n var _this$props2 = this.props,\n customStyleMap = _this$props2.customStyleMap,\n customStyleFn = _this$props2.customStyleFn,\n offsetKey = _this$props2.offsetKey,\n styleSet = _this$props2.styleSet;\n var styleObj = styleSet.reduce(function (map, styleName) {\n var mergedStyles = {};\n var style = customStyleMap[styleName];\n if (style !== undefined && map.textDecoration !== style.textDecoration) {\n // .trim() is necessary for IE9/10/11 and Edge\n mergedStyles.textDecoration = [map.textDecoration, style.textDecoration].join(' ').trim();\n }\n return _assign(map, style, mergedStyles);\n }, {});\n if (customStyleFn) {\n var newStyles = customStyleFn(styleSet, block);\n styleObj = _assign(styleObj, newStyles);\n }\n return React.createElement(\"span\", {\n \"data-offset-key\": offsetKey,\n ref: function ref(_ref) {\n return _this2.leaf = _ref;\n },\n style: styleObj\n }, React.createElement(DraftEditorTextNode, null, text));\n };\n return DraftEditorLeaf;\n}(React.Component);\nmodule.exports = DraftEditorLeaf;","\"use strict\";\n\n/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\nvar isElement = require(\"./isElement\");\nfunction isHTMLBRElement(node) {\n if (!node || !node.ownerDocument) {\n return false;\n }\n return isElement(node) && node.nodeName === 'BR';\n}\nmodule.exports = isHTMLBRElement;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n */\n'use strict';\n\nmodule.exports = {\n initODS: function initODS() {},\n handleExtensionCausedError: function handleExtensionCausedError() {}\n};","\"use strict\";\n\n/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @typechecks\n */\n\n/* eslint-disable fb-www/typeof-undefined */\n\n/**\n * Same as document.activeElement but wraps in a try-catch block. In IE it is\n * not safe to call document.activeElement if there is nothing focused.\n *\n * The activeElement will be null only if the document or document body is not\n * yet defined.\n *\n * @param {?DOMDocument} doc Defaults to current document.\n * @return {?DOMElement}\n */\nfunction getActiveElement(doc) /*?DOMElement*/\n{\n doc = doc || (typeof document !== 'undefined' ? document : undefined);\n if (typeof doc === 'undefined') {\n return null;\n }\n try {\n return doc.activeElement || doc.body;\n } catch (e) {\n return doc.body;\n }\n}\nmodule.exports = getActiveElement;","\"use strict\";\n\n/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @typechecks\n */\nvar getElementRect = require(\"./getElementRect\");\n/**\n * Gets an element's position in pixels relative to the viewport. The returned\n * object represents the position of the element's top left corner.\n *\n * @param {DOMElement} element\n * @return {object}\n */\n\nfunction getElementPosition(element) {\n var rect = getElementRect(element);\n return {\n x: rect.left,\n y: rect.top,\n width: rect.right - rect.left,\n height: rect.bottom - rect.top\n };\n}\nmodule.exports = getElementPosition;","\"use strict\";\n\n/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * \n * @typechecks\n */\nfunction getViewportWidth() {\n var width;\n if (document.documentElement) {\n width = document.documentElement.clientWidth;\n }\n if (!width && document.body) {\n width = document.body.clientWidth;\n }\n return width || 0;\n}\nfunction getViewportHeight() {\n var height;\n if (document.documentElement) {\n height = document.documentElement.clientHeight;\n }\n if (!height && document.body) {\n height = document.body.clientHeight;\n }\n return height || 0;\n}\n/**\n * Gets the viewport dimensions including any scrollbars.\n */\n\nfunction getViewportDimensions() {\n return {\n width: window.innerWidth || getViewportWidth(),\n height: window.innerHeight || getViewportHeight()\n };\n}\n/**\n * Gets the viewport dimensions excluding any scrollbars.\n */\n\ngetViewportDimensions.withoutScrollbars = function () {\n return {\n width: getViewportWidth(),\n height: getViewportHeight()\n };\n};\nmodule.exports = getViewportDimensions;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar _assign = require(\"object-assign\");\nfunction _extends() {\n _extends = _assign || function (target) {\n for (var i = 1; i < arguments.length; i++) {\n var source = arguments[i];\n for (var key in source) {\n if (Object.prototype.hasOwnProperty.call(source, key)) {\n target[key] = source[key];\n }\n }\n }\n return target;\n };\n return _extends.apply(this, arguments);\n}\nfunction _assertThisInitialized(self) {\n if (self === void 0) {\n throw new ReferenceError(\"this hasn't been initialised - super() hasn't been called\");\n }\n return self;\n}\nfunction _inheritsLoose(subClass, superClass) {\n subClass.prototype = Object.create(superClass.prototype);\n subClass.prototype.constructor = subClass;\n subClass.__proto__ = superClass;\n}\nfunction _defineProperty(obj, key, value) {\n if (key in obj) {\n Object.defineProperty(obj, key, {\n value: value,\n enumerable: true,\n configurable: true,\n writable: true\n });\n } else {\n obj[key] = value;\n }\n return obj;\n}\nvar DraftEditorLeaf = require(\"./DraftEditorLeaf.react\");\nvar DraftOffsetKey = require(\"./DraftOffsetKey\");\nvar React = require(\"react\");\nvar Scroll = require(\"fbjs/lib/Scroll\");\nvar Style = require(\"fbjs/lib/Style\");\nvar UnicodeBidi = require(\"fbjs/lib/UnicodeBidi\");\nvar UnicodeBidiDirection = require(\"fbjs/lib/UnicodeBidiDirection\");\nvar cx = require(\"fbjs/lib/cx\");\nvar getElementPosition = require(\"fbjs/lib/getElementPosition\");\nvar getScrollPosition = require(\"fbjs/lib/getScrollPosition\");\nvar getViewportDimensions = require(\"fbjs/lib/getViewportDimensions\");\nvar invariant = require(\"fbjs/lib/invariant\");\nvar isHTMLElement = require(\"./isHTMLElement\");\nvar nullthrows = require(\"fbjs/lib/nullthrows\");\nvar SCROLL_BUFFER = 10;\n\n/**\n * Return whether a block overlaps with either edge of the `SelectionState`.\n */\nvar isBlockOnSelectionEdge = function isBlockOnSelectionEdge(selection, key) {\n return selection.getAnchorKey() === key || selection.getFocusKey() === key;\n};\n/**\n * The default block renderer for a `DraftEditor` component.\n *\n * A `DraftEditorBlock` is able to render a given `ContentBlock` to its\n * appropriate decorator and inline style components.\n */\n\nvar DraftEditorBlock = /*#__PURE__*/function (_React$Component) {\n _inheritsLoose(DraftEditorBlock, _React$Component);\n function DraftEditorBlock() {\n var _this;\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n _this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this;\n _defineProperty(_assertThisInitialized(_this), \"_node\", void 0);\n return _this;\n }\n var _proto = DraftEditorBlock.prototype;\n _proto.shouldComponentUpdate = function shouldComponentUpdate(nextProps) {\n return this.props.block !== nextProps.block || this.props.tree !== nextProps.tree || this.props.direction !== nextProps.direction || isBlockOnSelectionEdge(nextProps.selection, nextProps.block.getKey()) && nextProps.forceSelection;\n }\n /**\n * When a block is mounted and overlaps the selection state, we need to make\n * sure that the cursor is visible to match native behavior. This may not\n * be the case if the user has pressed `RETURN` or pasted some content, since\n * programmatically creating these new blocks and setting the DOM selection\n * will miss out on the browser natively scrolling to that position.\n *\n * To replicate native behavior, if the block overlaps the selection state\n * on mount, force the scroll position. Check the scroll state of the scroll\n * parent, and adjust it to align the entire block to the bottom of the\n * scroll parent.\n */;\n\n _proto.componentDidMount = function componentDidMount() {\n if (this.props.preventScroll) {\n return;\n }\n var selection = this.props.selection;\n var endKey = selection.getEndKey();\n if (!selection.getHasFocus() || endKey !== this.props.block.getKey()) {\n return;\n }\n var blockNode = this._node;\n if (blockNode == null) {\n return;\n }\n var scrollParent = Style.getScrollParent(blockNode);\n var scrollPosition = getScrollPosition(scrollParent);\n var scrollDelta;\n if (scrollParent === window) {\n var nodePosition = getElementPosition(blockNode);\n var nodeBottom = nodePosition.y + nodePosition.height;\n var viewportHeight = getViewportDimensions().height;\n scrollDelta = nodeBottom - viewportHeight;\n if (scrollDelta > 0) {\n window.scrollTo(scrollPosition.x, scrollPosition.y + scrollDelta + SCROLL_BUFFER);\n }\n } else {\n !isHTMLElement(blockNode) ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'blockNode is not an HTMLElement') : invariant(false) : void 0;\n var blockBottom = blockNode.offsetHeight + blockNode.offsetTop;\n var pOffset = scrollParent.offsetTop + scrollParent.offsetHeight;\n var scrollBottom = pOffset + scrollPosition.y;\n scrollDelta = blockBottom - scrollBottom;\n if (scrollDelta > 0) {\n Scroll.setTop(scrollParent, Scroll.getTop(scrollParent) + scrollDelta + SCROLL_BUFFER);\n }\n }\n };\n _proto._renderChildren = function _renderChildren() {\n var _this2 = this;\n var block = this.props.block;\n var blockKey = block.getKey();\n var text = block.getText();\n var lastLeafSet = this.props.tree.size - 1;\n var hasSelection = isBlockOnSelectionEdge(this.props.selection, blockKey);\n return this.props.tree.map(function (leafSet, ii) {\n var leavesForLeafSet = leafSet.get('leaves'); // T44088704\n\n if (leavesForLeafSet.size === 0) {\n return null;\n }\n var lastLeaf = leavesForLeafSet.size - 1;\n var leaves = leavesForLeafSet.map(function (leaf, jj) {\n var offsetKey = DraftOffsetKey.encode(blockKey, ii, jj);\n var start = leaf.get('start');\n var end = leaf.get('end');\n return React.createElement(DraftEditorLeaf, {\n key: offsetKey,\n offsetKey: offsetKey,\n block: block,\n start: start,\n selection: hasSelection ? _this2.props.selection : null,\n forceSelection: _this2.props.forceSelection,\n text: text.slice(start, end),\n styleSet: block.getInlineStyleAt(start),\n customStyleMap: _this2.props.customStyleMap,\n customStyleFn: _this2.props.customStyleFn,\n isLast: ii === lastLeafSet && jj === lastLeaf\n });\n }).toArray();\n var decoratorKey = leafSet.get('decoratorKey');\n if (decoratorKey == null) {\n return leaves;\n }\n if (!_this2.props.decorator) {\n return leaves;\n }\n var decorator = nullthrows(_this2.props.decorator);\n var DecoratorComponent = decorator.getComponentForKey(decoratorKey);\n if (!DecoratorComponent) {\n return leaves;\n }\n var decoratorProps = decorator.getPropsForKey(decoratorKey);\n var decoratorOffsetKey = DraftOffsetKey.encode(blockKey, ii, 0);\n var start = leavesForLeafSet.first().get('start');\n var end = leavesForLeafSet.last().get('end');\n var decoratedText = text.slice(start, end);\n var entityKey = block.getEntityAt(leafSet.get('start')); // Resetting dir to the same value on a child node makes Chrome/Firefox\n // confused on cursor movement. See http://jsfiddle.net/d157kLck/3/\n\n var dir = UnicodeBidiDirection.getHTMLDirIfDifferent(UnicodeBidi.getDirection(decoratedText), _this2.props.direction);\n var commonProps = {\n contentState: _this2.props.contentState,\n decoratedText: decoratedText,\n dir: dir,\n start: start,\n end: end,\n blockKey: blockKey,\n entityKey: entityKey,\n offsetKey: decoratorOffsetKey\n };\n return React.createElement(DecoratorComponent, _extends({}, decoratorProps, commonProps, {\n key: decoratorOffsetKey\n }), leaves);\n }).toArray();\n };\n _proto.render = function render() {\n var _this3 = this;\n var _this$props = this.props,\n direction = _this$props.direction,\n offsetKey = _this$props.offsetKey;\n var className = cx({\n 'public/DraftStyleDefault/block': true,\n 'public/DraftStyleDefault/ltr': direction === 'LTR',\n 'public/DraftStyleDefault/rtl': direction === 'RTL'\n });\n return React.createElement(\"div\", {\n \"data-offset-key\": offsetKey,\n className: className,\n ref: function ref(_ref) {\n return _this3._node = _ref;\n }\n }, this._renderChildren());\n };\n return DraftEditorBlock;\n}(React.Component);\nmodule.exports = DraftEditorBlock;","\"use strict\";\n\n/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @typechecks\n */\nvar PhotosMimeType = require(\"./PhotosMimeType\");\nvar createArrayFromMixed = require(\"./createArrayFromMixed\");\nvar emptyFunction = require(\"./emptyFunction\");\nvar CR_LF_REGEX = new RegExp(\"\\r\\n\", 'g');\nvar LF_ONLY = \"\\n\";\nvar RICH_TEXT_TYPES = {\n 'text/rtf': 1,\n 'text/html': 1\n};\n/**\n * If DataTransferItem is a file then return the Blob of data.\n *\n * @param {object} item\n * @return {?blob}\n */\n\nfunction getFileFromDataTransfer(item) {\n if (item.kind == 'file') {\n return item.getAsFile();\n }\n}\nvar DataTransfer = /*#__PURE__*/\nfunction () {\n /**\n * @param {object} data\n */\n function DataTransfer(data) {\n this.data = data; // Types could be DOMStringList or array\n\n this.types = data.types ? createArrayFromMixed(data.types) : [];\n }\n /**\n * Is this likely to be a rich text data transfer?\n *\n * @return {boolean}\n */\n\n var _proto = DataTransfer.prototype;\n _proto.isRichText = function isRichText() {\n // If HTML is available, treat this data as rich text. This way, we avoid\n // using a pasted image if it is packaged with HTML -- this may occur with\n // pastes from MS Word, for example. However this is only rich text if\n // there's accompanying text.\n if (this.getHTML() && this.getText()) {\n return true;\n } // When an image is copied from a preview window, you end up with two\n // DataTransferItems one of which is a file's metadata as text. Skip those.\n\n if (this.isImage()) {\n return false;\n }\n return this.types.some(function (type) {\n return RICH_TEXT_TYPES[type];\n });\n };\n /**\n * Get raw text.\n *\n * @return {?string}\n */\n\n _proto.getText = function getText() {\n var text;\n if (this.data.getData) {\n if (!this.types.length) {\n text = this.data.getData('Text');\n } else if (this.types.indexOf('text/plain') != -1) {\n text = this.data.getData('text/plain');\n }\n }\n return text ? text.replace(CR_LF_REGEX, LF_ONLY) : null;\n };\n /**\n * Get HTML paste data\n *\n * @return {?string}\n */\n\n _proto.getHTML = function getHTML() {\n if (this.data.getData) {\n if (!this.types.length) {\n return this.data.getData('Text');\n } else if (this.types.indexOf('text/html') != -1) {\n return this.data.getData('text/html');\n }\n }\n };\n /**\n * Is this a link data transfer?\n *\n * @return {boolean}\n */\n\n _proto.isLink = function isLink() {\n return this.types.some(function (type) {\n return type.indexOf('Url') != -1 || type.indexOf('text/uri-list') != -1 || type.indexOf('text/x-moz-url');\n });\n };\n /**\n * Get a link url.\n *\n * @return {?string}\n */\n\n _proto.getLink = function getLink() {\n if (this.data.getData) {\n if (this.types.indexOf('text/x-moz-url') != -1) {\n var url = this.data.getData('text/x-moz-url').split('\\n');\n return url[0];\n }\n return this.types.indexOf('text/uri-list') != -1 ? this.data.getData('text/uri-list') : this.data.getData('url');\n }\n return null;\n };\n /**\n * Is this an image data transfer?\n *\n * @return {boolean}\n */\n\n _proto.isImage = function isImage() {\n var isImage = this.types.some(function (type) {\n // Firefox will have a type of application/x-moz-file for images during\n // dragging\n return type.indexOf('application/x-moz-file') != -1;\n });\n if (isImage) {\n return true;\n }\n var items = this.getFiles();\n for (var i = 0; i < items.length; i++) {\n var type = items[i].type;\n if (!PhotosMimeType.isImage(type)) {\n return false;\n }\n }\n return true;\n };\n _proto.getCount = function getCount() {\n if (this.data.hasOwnProperty('items')) {\n return this.data.items.length;\n } else if (this.data.hasOwnProperty('mozItemCount')) {\n return this.data.mozItemCount;\n } else if (this.data.files) {\n return this.data.files.length;\n }\n return null;\n };\n /**\n * Get files.\n *\n * @return {array}\n */\n\n _proto.getFiles = function getFiles() {\n if (this.data.items) {\n // createArrayFromMixed doesn't properly handle DataTransferItemLists.\n return Array.prototype.slice.call(this.data.items).map(getFileFromDataTransfer).filter(emptyFunction.thatReturnsArgument);\n } else if (this.data.files) {\n return Array.prototype.slice.call(this.data.files);\n } else {\n return [];\n }\n };\n /**\n * Are there any files to fetch?\n *\n * @return {boolean}\n */\n\n _proto.hasFiles = function hasFiles() {\n return this.getFiles().length > 0;\n };\n return DataTransfer;\n}();\nmodule.exports = DataTransfer;","\"use strict\";\n\n/**\n * Copyright (c) 2013-present, Facebook, Inc.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * \n */\nfunction makeEmptyFunction(arg) {\n return function () {\n return arg;\n };\n}\n/**\n * This function accepts and discards inputs; it has no side effects. This is\n * primarily useful idiomatically for overridable function endpoints which\n * always need to be callable, since JS lacks a null-call idiom ala Cocoa.\n */\n\nvar emptyFunction = function emptyFunction() {};\nemptyFunction.thatReturns = makeEmptyFunction;\nemptyFunction.thatReturnsFalse = makeEmptyFunction(false);\nemptyFunction.thatReturnsTrue = makeEmptyFunction(true);\nemptyFunction.thatReturnsNull = makeEmptyFunction(null);\nemptyFunction.thatReturnsThis = function () {\n return this;\n};\nemptyFunction.thatReturnsArgument = function (arg) {\n return arg;\n};\nmodule.exports = emptyFunction;","/**\n * Copyright (c) Facebook, Inc. and its affiliates.\n *\n * This source code is licensed under the MIT license found in the\n * LICENSE file in the root directory of this source tree.\n *\n * @format\n * \n * @emails oncall+draft_js\n */\n'use strict';\n\nvar invariant = require(\"fbjs/lib/invariant\");\nvar TEXT_CLIPPING_REGEX = /\\.textClipping$/;\nvar TEXT_TYPES = {\n 'text/plain': true,\n 'text/html': true,\n 'text/rtf': true\n}; // Somewhat arbitrary upper bound on text size. Let's not lock up the browser.\n\nvar TEXT_SIZE_UPPER_BOUND = 5000;\n/**\n * Extract the text content from a file list.\n */\n\nfunction getTextContentFromFiles(files, callback) {\n var readCount = 0;\n var results = [];\n files.forEach(function ( /*blob*/\n file) {\n readFile(file, function ( /*string*/\n text) {\n readCount++;\n text && results.push(text.slice(0, TEXT_SIZE_UPPER_BOUND));\n if (readCount == files.length) {\n callback(results.join('\\r'));\n }\n });\n });\n}\n/**\n * todo isaac: Do work to turn html/rtf into a content fragment.\n */\n\nfunction readFile(file, callback) {\n if (!global.FileReader || file.type && !(file.type in TEXT_TYPES)) {\n callback('');\n return;\n }\n if (file.type === '') {\n var _contents = ''; // Special-case text clippings, which have an empty type but include\n // `.textClipping` in the file name. `readAsText` results in an empty\n // string for text clippings, so we force the file name to serve\n // as the text value for the file.\n\n if (TEXT_CLIPPING_REGEX.test(file.name)) {\n _contents = file.name.replace(TEXT_CLIPPING_REGEX, '');\n }\n callback(_contents);\n return;\n }\n var reader = new FileReader();\n reader.onload = function () {\n var result = reader.result;\n !(typeof result === 'string') ? process.env.NODE_ENV !== \"production\" ? invariant(false, 'We should be calling \"FileReader.readAsText\" which returns a string') : invariant(false) : void 0;\n callback(result);\n };\n reader.onerror = function () {\n callback('');\n };\n reader.readAsText(file);\n}\nmodule.exports = getTextContentFromFiles;","(function (global, undefined) {\n \"use strict\";\n\n if (global.setImmediate) {\n return;\n }\n var nextHandle = 1; // Spec says greater than zero\n var tasksByHandle = {};\n var currentlyRunningATask = false;\n var doc = global.document;\n var registerImmediate;\n function setImmediate(callback) {\n // Callback can either be a function or a string\n if (typeof callback !== \"function\") {\n callback = new Function(\"\" + callback);\n }\n // Copy function arguments\n var args = new Array(arguments.length - 1);\n for (var i = 0; i < args.length; i++) {\n args[i] = arguments[i + 1];\n }\n // Store and register the task\n var task = {\n callback: callback,\n args: args\n };\n tasksByHandle[nextHandle] = task;\n registerImmediate(nextHandle);\n return nextHandle++;\n }\n function clearImmediate(handle) {\n delete tasksByHandle[handle];\n }\n function run(task) {\n var callback = task.callback;\n var args = task.args;\n switch (args.length) {\n case 0:\n callback();\n break;\n case 1:\n callback(args[0]);\n break;\n case 2:\n callback(args[0], args[1]);\n break;\n case 3:\n callback(args[0], args[1], args[2]);\n break;\n default:\n callback.apply(undefined, args);\n break;\n }\n }\n function runIfPresent(handle) {\n // From the spec: \"Wait until any invocations of this algorithm started before this one have completed.\"\n // So if we're currently running a task, we'll need to delay this invocation.\n if (currentlyRunningATask) {\n // Delay by doing a setTimeout. setImmediate was tried instead, but in Firefox 7 it generated a\n // \"too much recursion\" error.\n setTimeout(runIfPresent, 0, handle);\n } else {\n var task = tasksByHandle[handle];\n if (task) {\n currentlyRunningATask = true;\n try {\n run(task);\n } finally {\n clearImmediate(handle);\n currentlyRunningATask = false;\n }\n }\n }\n }\n function installNextTickImplementation() {\n registerImmediate = function (handle) {\n process.nextTick(function () {\n runIfPresent(handle);\n });\n };\n }\n function canUsePostMessage() {\n // The test against `importScripts` prevents this implementation from being installed inside a web worker,\n // where `global.postMessage` means something completely different and can't be used for this purpose.\n if (global.postMessage && !global.importScripts) {\n var postMessageIsAsynchronous = true;\n var oldOnMessage = global.onmessage;\n global.onmessage = function () {\n postMessageIsAsynchronous = false;\n };\n global.postMessage(\"\", \"*\");\n global.onmessage = oldOnMessage;\n return postMessageIsAsynchronous;\n }\n }\n function installPostMessageImplementation() {\n // Installs an event handler on `global` for the `message` event: see\n // * https://developer.mozilla.org/en/DOM/window.postMessage\n // * http://www.whatwg.org/specs/web-apps/current-work/multipage/comms.html#crossDocumentMessages\n\n var messagePrefix = \"setImmediate$\" + Math.random() + \"$\";\n var onGlobalMessage = function (event) {\n if (event.source === global && typeof event.data === \"string\" && event.data.indexOf(messagePrefix) === 0) {\n runIfPresent(+event.data.slice(messagePrefix.length));\n }\n };\n if (global.addEventListener) {\n global.addEventListener(\"message\", onGlobalMessage, false);\n } else {\n global.attachEvent(\"onmessage\", onGlobalMessage);\n }\n registerImmediate = function (handle) {\n global.postMessage(messagePrefix + handle, \"*\");\n };\n }\n function installMessageChannelImplementation() {\n var channel = new MessageChannel();\n channel.port1.onmessage = function (event) {\n var handle = event.data;\n runIfPresent(handle);\n };\n registerImmediate = function (handle) {\n channel.port2.postMessage(handle);\n };\n }\n function installReadyStateChangeImplementation() {\n var html = doc.documentElement;\n registerImmediate = function (handle) {\n // Create a